DK113859B - Fremgangsmåde til fremstilling af hydroksamsyrer. - Google Patents
Fremgangsmåde til fremstilling af hydroksamsyrer.Info
- Publication number
- DK113859B DK113859B DK115665AA DK115665A DK113859B DK 113859 B DK113859 B DK 113859B DK 115665A A DK115665A A DK 115665AA DK 115665 A DK115665 A DK 115665A DK 113859 B DK113859 B DK 113859B
- Authority
- DK
- Denmark
- Prior art keywords
- preparation
- hydroxamic acids
- hydroxamic
- acids
- Prior art date
Links
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical class C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/16—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B21/00—Nitrogen; Compounds thereof
- C01B21/082—Compounds containing nitrogen and non-metals and optionally metals
- C01B21/14—Hydroxylamine; Salts thereof
- C01B21/1409—Preparation
- C01B21/1445—Preparation of hydoxylamine from its salts
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL6402255A NL6402255A (enFirst) | 1964-03-06 | 1964-03-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK113859B true DK113859B (da) | 1969-05-05 |
Family
ID=19789487
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK115665AA DK113859B (da) | 1964-03-06 | 1965-03-05 | Fremgangsmåde til fremstilling af hydroksamsyrer. |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US3411881A (enFirst) |
| BE (1) | BE660703A (enFirst) |
| BR (1) | BR6567622D0 (enFirst) |
| CH (1) | CH454103A (enFirst) |
| DE (1) | DE1239316B (enFirst) |
| DK (1) | DK113859B (enFirst) |
| FR (1) | FR1428276A (enFirst) |
| GB (1) | GB1098243A (enFirst) |
| NL (2) | NL6402255A (enFirst) |
| SE (1) | SE315269B (enFirst) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4099010A (en) * | 1976-08-04 | 1978-07-04 | Morton-Norwich Products, Inc. | Phthaloyl amino acid hydroxamic acids |
| US4507248A (en) * | 1982-11-01 | 1985-03-26 | Allied Corporation | Preparation from hydroxylammonium sulfate of oximes and hydroxamic acids via alcoholic hydroxylamine solution |
| GB9215665D0 (en) * | 1992-07-23 | 1992-09-09 | British Bio Technology | Compounds |
| GB9401129D0 (en) * | 1994-01-21 | 1994-03-16 | British Bio Technology | Hydroxamic acid derivatives as metalloproteinase inhibitors |
| FI962905L (fi) * | 1994-01-22 | 1996-07-19 | British Biotech Pharm | Metalloproteinaasi-inhibiittoreita |
| GB9423914D0 (en) * | 1994-11-26 | 1995-01-11 | British Biotech Pharm | Polyether derivatives as metalloproteinase inhibitors |
| US5917090A (en) * | 1995-06-30 | 1999-06-29 | British Biotech Pharmaceuticals Ltd. | Matrix metalloproteinase inhibitors |
| CN106008266B (zh) * | 2016-05-20 | 2018-06-29 | 中国地质科学院矿产综合利用研究所 | 羟肟酸类稀土浮选药剂的绿色制备方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2862002A (en) * | 1955-11-17 | 1958-11-25 | Hoffmann La Roche | Synthesis of 4-amino-3-isoxazolidone |
| US2943092A (en) * | 1956-05-02 | 1960-06-28 | Smrt Jiri | Method of preparing 4-amino-3-isoxazolidinones |
| GB852176A (en) * | 1957-08-19 | 1960-10-26 | Ici Ltd | Improved process for the manufacture of hydroxamic acids |
| US3145082A (en) * | 1959-12-07 | 1964-08-18 | Dow Chemical Co | Stabilized hydroxylamine and its method of preparation |
| US3148940A (en) * | 1960-07-01 | 1964-09-15 | Dow Chemical Co | Preparation of a hydroxylamine coordination compound |
-
0
- NL NL122359D patent/NL122359C/xx active
-
1964
- 1964-03-06 NL NL6402255A patent/NL6402255A/xx unknown
-
1965
- 1965-02-11 US US431993A patent/US3411881A/en not_active Expired - Lifetime
- 1965-02-16 GB GB6658/65A patent/GB1098243A/en not_active Expired
- 1965-02-26 CH CH273465A patent/CH454103A/de unknown
- 1965-03-04 SE SE2801/65A patent/SE315269B/xx unknown
- 1965-03-05 DE DEN26326A patent/DE1239316B/de active Pending
- 1965-03-05 BR BR167622/65A patent/BR6567622D0/pt unknown
- 1965-03-05 DK DK115665AA patent/DK113859B/da unknown
- 1965-03-05 BE BE660703A patent/BE660703A/xx unknown
- 1965-03-05 FR FR8046A patent/FR1428276A/fr not_active Expired
-
1968
- 1968-03-18 US US737263*A patent/US3468936A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR1428276A (fr) | 1966-02-11 |
| GB1098243A (en) | 1968-01-10 |
| NL6402255A (enFirst) | 1965-09-07 |
| US3468936A (en) | 1969-09-23 |
| BR6567622D0 (pt) | 1973-08-28 |
| NL122359C (enFirst) | |
| SE315269B (enFirst) | 1969-09-29 |
| CH454103A (de) | 1968-04-15 |
| BE660703A (enFirst) | 1965-09-06 |
| US3411881A (en) | 1968-11-19 |
| DE1239316B (de) | 1967-04-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK117353B (da) | Fremgangsmåde til fremstilling af substituerede arylacethydroxamsyrer. | |
| DK115704B (da) | Fremgangsmåde til fremstilling af 2-aryl-nitroimidazolforbindelser. | |
| DK113434B (da) | Fremgangsmåde til fremstilling af 5-nitro-imidazolforbindelser. | |
| DK118018B (da) | Fremgangsmåde til fremstilling af diorganoantimonforbindelser. | |
| DK121415B (da) | Fremgangsmåde til kontinuerlig fremstilling af faststofdispersioner. | |
| DK113859B (da) | Fremgangsmåde til fremstilling af hydroksamsyrer. | |
| DK118019B (da) | Fremgangsmåde til fremstilling af diorganoantimonforbindelser. | |
| DK115108B (da) | Fremgangsmåde til fremstilling af 2-amino-benzophenon-β-oximer. | |
| DK116513B (da) | Analogifremgangsmåde til fremstilling af substituerede o-phenoxy-phenylestere. | |
| DK114980B (da) | Fremgangsmåde til fremstilling af sulfamylanthranilsyreamider. | |
| DK122756B (da) | Analogifremgangsmåde til fremstilling af 2-alkoxy-5-trifluormethylbenzoesyrer. | |
| DK111891B (da) | Fremgangsmåde til fremstilling af 5-oxo-17α-methyl-20-hydroxy-(des-A)-19-nor-pregna-9-en. | |
| DK115694B (da) | Fremgangsmåde til fremstilling af α-dithioler. | |
| DK112318B (da) | Fremgangsmåde til fremstilling af 2-benzensulfonylamidopyrimidiner. | |
| DK122071B (da) | Analogifremgangsmåde til fremstilling af methylenbutyrylphenoler. | |
| DK120085B (da) | Fremgangsmåde til fremstilling af mitosanforbindelser. | |
| DK113149B (da) | Fremgangsmåde til fremstilling af sulfamylanthranilsyrer. | |
| DK122880B (da) | Fremgangsmåde til fremstilling af sulfamylanthranilsyrer. | |
| DK111884B (da) | Fremgangsmåde til fremstilling af estere. | |
| DK122280B (da) | Fremgangsmåde til fremstilling af indolyleddikesyrer. | |
| DK107421C (da) | Fremgangsmåde til fremstilling af 17α-ethoxy-6-chlor-6-dehydroprogesteron. | |
| DK106860C (da) | Fremgangsmåde til fremstilling af N-alkanoylamino-5-nitro-2-furamidiner. | |
| DK125710B (da) | Fremgangsmåde til fremstilling af 4-methyl-oxazoler. | |
| DK127724B (da) | Fremgangsmåde til fremstilling af trans-40-aminomethylcyclohexan-1-carboxylsyre. | |
| DK117148B (da) | Fremgangsmåde til fremstilling af substituerede benzofurazaner. |