DE758642A - - Google Patents
Info
- Publication number
- DE758642A DE758642A DE758642A DE 758642 A DE758642 A DE 758642A DE 758642 A DE758642 A DE 758642A
- Authority
- DE
- Germany
- Prior art keywords
- light
- transparent
- box
- zigzag
- luminous
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000005284 excitation Effects 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 2
- 239000007789 gas Substances 0.000 description 3
- FSCNUJMKSQHQSY-UHFFFAOYSA-N Gein Chemical compound COC1=CC(CC=C)=CC=C1OC1C(O)C(O)C(O)C(COC2C(C(O)C(O)CO2)O)O1 FSCNUJMKSQHQSY-UHFFFAOYSA-N 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- 238000005286 illumination Methods 0.000 description 2
- 238000012423 maintenance Methods 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 230000035699 permeability Effects 0.000 description 2
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 1
- 229920013660 Cellon Polymers 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465382 Physalis alkekengi Species 0.000 description 1
- 230000003321 amplification Effects 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000000254 damaging effect Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000004557 technical material Substances 0.000 description 1
- VGBPIHVLVSGJGR-UHFFFAOYSA-N thorium(4+);tetranitrate Chemical compound [Th+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O VGBPIHVLVSGJGR-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2020808B2 (de) | Optisches Bauelement zur Herstellung beleuchtbarer Werbezeichen, Signalvorrichtungen oder dergleichen | |
| DE2946191A1 (de) | Farbige leuchte, z.b. fuer leuchtreklame, aussen- und innenbeleuchtung | |
| DE3877969T2 (de) | Lichtpaneel. | |
| DE3829027A1 (de) | Vorrichtung fuer die aufnahme von pflanzen | |
| DE102008013589A1 (de) | Beleuchtung eines Aquariums | |
| DE758642A (enExample) | ||
| DE102004057663B4 (de) | Solarmodul mit durch regulär angeordnete Löcher semitransparenten kristallinen Solarzellen und Verfahren zur Herstellung | |
| DE1277615B (de) | Vorrichtung zum Foerdern des Pflanzenwachstums durch spektrale Strahldichteverteilung unter Verwendung ausgewaehlter fluoreszierender Leuchtstoffe | |
| DE9202955U1 (de) | Leuchtkörper aus kombinierten Kunststoff-Platten, enthaltend Weißpigment und Fluoreszenzfarbstoff | |
| DE3233820A1 (de) | Kombinationsleuchte | |
| DE20101028U1 (de) | Taschenlampe, insbesondere Tischlampe oder Präsentationsteller | |
| DE537285C (de) | Leuchte fuer Lichtsignalzwecke | |
| DE202010010263U1 (de) | Beleuchtungseinrichtung, insbesondere für einen Außenbereich | |
| DE880692C (de) | Blitzlichtlampe | |
| DE8521579U1 (de) | Grableuchte | |
| DE202022001400U1 (de) | Nachtorientierungslicht | |
| DE19620621C2 (de) | Elektrisches Grablicht | |
| DE29609043U1 (de) | Elektrisches Grablicht | |
| DE542212C (de) | Kastenschild mit Innenbeleuchtung | |
| DE863693C (de) | Elektrische Leuchtroehre | |
| DE2119636A1 (de) | Anlage zur Beleuchtung von Gewächshäusern, Freilandkulturen und dergleichen | |
| DE287175C (enExample) | ||
| DE20015812U1 (de) | Künstliches Feuer | |
| DE1628967U (de) | Leuchte fuer luftschutzzwecke mit leuchtstofflampen. | |
| Edensor | 10 Seeing with Australian light |