DE69220943T2 - Tandem flugzeit massenspektrometer - Google Patents
Tandem flugzeit massenspektrometerInfo
- Publication number
- DE69220943T2 DE69220943T2 DE69220943T DE69220943T DE69220943T2 DE 69220943 T2 DE69220943 T2 DE 69220943T2 DE 69220943 T DE69220943 T DE 69220943T DE 69220943 T DE69220943 T DE 69220943T DE 69220943 T2 DE69220943 T2 DE 69220943T2
- Authority
- DE
- Germany
- Prior art keywords
- mass analyzer
- reflection
- flight
- reflection mass
- face
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 150000002500 ions Chemical class 0.000 claims description 123
- 238000000034 method Methods 0.000 claims description 18
- 238000001228 spectrum Methods 0.000 claims description 18
- 239000000126 substance Substances 0.000 claims description 9
- 238000001819 mass spectrum Methods 0.000 claims description 8
- 230000008859 change Effects 0.000 claims description 2
- 230000008878 coupling Effects 0.000 claims 1
- 238000010168 coupling process Methods 0.000 claims 1
- 238000005859 coupling reaction Methods 0.000 claims 1
- 238000000605 extraction Methods 0.000 description 25
- 238000003795 desorption Methods 0.000 description 14
- 230000001133 acceleration Effects 0.000 description 11
- 239000012634 fragment Substances 0.000 description 11
- 238000004885 tandem mass spectrometry Methods 0.000 description 10
- 150000001793 charged compounds Chemical class 0.000 description 9
- 238000013467 fragmentation Methods 0.000 description 6
- 238000006062 fragmentation reaction Methods 0.000 description 6
- 108090000765 processed proteins & peptides Proteins 0.000 description 6
- 239000000523 sample Substances 0.000 description 6
- 239000011159 matrix material Substances 0.000 description 5
- 102000004169 proteins and genes Human genes 0.000 description 5
- 108090000623 proteins and genes Proteins 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000009826 distribution Methods 0.000 description 4
- 238000010884 ion-beam technique Methods 0.000 description 4
- 102000004196 processed proteins & peptides Human genes 0.000 description 4
- 238000013459 approach Methods 0.000 description 3
- 238000010494 dissociation reaction Methods 0.000 description 3
- 230000005593 dissociations Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 238000001360 collision-induced dissociation Methods 0.000 description 2
- 238000005056 compaction Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000002596 correlated effect Effects 0.000 description 2
- 230000000875 corresponding effect Effects 0.000 description 2
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 2
- 238000010894 electron beam technology Methods 0.000 description 2
- 238000010265 fast atom bombardment Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000012916 structural analysis Methods 0.000 description 2
- 230000002123 temporal effect Effects 0.000 description 2
- 239000010963 304 stainless steel Substances 0.000 description 1
- 229930186217 Glycolipid Natural products 0.000 description 1
- 102000002068 Glycopeptides Human genes 0.000 description 1
- 108010015899 Glycopeptides Proteins 0.000 description 1
- 102000006391 Ion Pumps Human genes 0.000 description 1
- 108010083687 Ion Pumps Proteins 0.000 description 1
- 241000102542 Kara Species 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 102000007079 Peptide Fragments Human genes 0.000 description 1
- 108010033276 Peptide Fragments Proteins 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 229910000589 SAE 304 stainless steel Inorganic materials 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- 125000003275 alpha amino acid group Chemical group 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- -1 cesium ions Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000009795 derivation Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 238000006303 photolysis reaction Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 238000004544 sputter deposition Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000001269 time-of-flight mass spectrometry Methods 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J49/00—Particle spectrometers or separator tubes
- H01J49/004—Combinations of spectrometers, tandem spectrometers, e.g. MS/MS, MSn
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J49/00—Particle spectrometers or separator tubes
- H01J49/26—Mass spectrometers or separator tubes
- H01J49/34—Dynamic spectrometers
- H01J49/40—Time-of-flight spectrometers
- H01J49/406—Time-of-flight spectrometers with multiple reflections
Landscapes
- Chemical & Material Sciences (AREA)
- Analytical Chemistry (AREA)
- Other Investigation Or Analysis Of Materials By Electrical Means (AREA)
- Electron Tubes For Measurement (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/700,697 US5202563A (en) | 1991-05-16 | 1991-05-16 | Tandem time-of-flight mass spectrometer |
| PCT/US1992/003884 WO1992021140A1 (en) | 1991-05-16 | 1992-05-15 | Tandem time-of-flight mass spectrometer |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69220943D1 DE69220943D1 (de) | 1997-08-21 |
| DE69220943T2 true DE69220943T2 (de) | 1997-12-04 |
Family
ID=24814545
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69220943T Expired - Fee Related DE69220943T2 (de) | 1991-05-16 | 1992-05-15 | Tandem flugzeit massenspektrometer |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US5202563A (enExample) |
| EP (1) | EP0584262B1 (enExample) |
| JP (1) | JPH07500449A (enExample) |
| CA (1) | CA2103038C (enExample) |
| DE (1) | DE69220943T2 (enExample) |
| WO (1) | WO1992021140A1 (enExample) |
Families Citing this family (68)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2250632B (en) * | 1990-10-18 | 1994-11-23 | Unisearch Ltd | Tandem mass spectrometry systems based on time-of-flight analyser |
| US5763875A (en) * | 1991-11-12 | 1998-06-09 | Max Planck Gesellschaft | Method and apparatus for quantitative, non-resonant photoionization of neutral particles |
| US5376788A (en) * | 1993-05-26 | 1994-12-27 | University Of Manitoba | Apparatus and method for matrix-assisted laser desorption mass spectrometry |
| GB2303962B (en) * | 1994-05-31 | 1998-07-08 | Univ Warwick | Tandem mass spectrometry apparatus |
| US6002127A (en) | 1995-05-19 | 1999-12-14 | Perseptive Biosystems, Inc. | Time-of-flight mass spectrometry analysis of biomolecules |
| US5625184A (en) | 1995-05-19 | 1997-04-29 | Perseptive Biosystems, Inc. | Time-of-flight mass spectrometry analysis of biomolecules |
| GB9604057D0 (en) * | 1996-02-27 | 1996-05-01 | Univ Birmingham | Mass selector |
| US5777325A (en) * | 1996-05-06 | 1998-07-07 | Hewlett-Packard Company | Device for time lag focusing time-of-flight mass spectrometry |
| GB9612091D0 (en) * | 1996-06-10 | 1996-08-14 | Hd Technologies Limited | Improvements in or relating to time-of-flight mass spectrometers |
| AU4042597A (en) * | 1996-07-19 | 1998-02-10 | Hybridon, Inc. | Method for sequencing nucleic acids using matrix-assisted laser desorption ionization time-of-flight mass spectrometry |
| DE19631161A1 (de) * | 1996-08-01 | 1998-02-12 | Bergmann Thorald | Flugzeit-Flugzeit-Massenspektrometer mit differentiell gepumpter Kollisionszelle |
| DE19631162A1 (de) * | 1996-08-01 | 1998-02-12 | Bergmann Thorald | Kollisionszelle mit integriertem Ionenselektor für Flugzeit-Flugzeit-Massenspektrometer |
| US6469295B1 (en) * | 1997-05-30 | 2002-10-22 | Bruker Daltonics Inc. | Multiple reflection time-of-flight mass spectrometer |
| US5955730A (en) * | 1997-06-26 | 1999-09-21 | Comstock, Inc. | Reflection time-of-flight mass spectrometer |
| WO1999001889A1 (en) * | 1997-07-02 | 1999-01-14 | Merck & Co., Inc. | Novel mass spectrometer |
| GB9717926D0 (en) * | 1997-08-22 | 1997-10-29 | Micromass Ltd | Methods and apparatus for tandem mass spectrometry |
| US6348688B1 (en) * | 1998-02-06 | 2002-02-19 | Perseptive Biosystems | Tandem time-of-flight mass spectrometer with delayed extraction and method for use |
| DE69936168T2 (de) * | 1998-06-18 | 2007-09-27 | Micromass UK Ltd., Simonsway | Mehrfachprobeninlassmassenspektrometer |
| GB2339958B (en) * | 1998-07-17 | 2001-02-21 | Genomic Solutions Ltd | Time-of-flight mass spectrometer |
| US6518569B1 (en) | 1999-06-11 | 2003-02-11 | Science & Technology Corporation @ Unm | Ion mirror |
| US6858839B1 (en) * | 2000-02-08 | 2005-02-22 | Agilent Technologies, Inc. | Ion optics for mass spectrometers |
| US6570152B1 (en) | 2000-03-03 | 2003-05-27 | Micromass Limited | Time of flight mass spectrometer with selectable drift length |
| GB2406436B (en) * | 2000-03-13 | 2005-06-08 | Univ Warwick | Time of flight mass spectrometry apparatus |
| US6545268B1 (en) | 2000-04-10 | 2003-04-08 | Perseptive Biosystems | Preparation of ion pulse for time-of-flight and for tandem time-of-flight mass analysis |
| EP1327151A2 (en) * | 2000-10-11 | 2003-07-16 | Ciphergen Biosystems, Inc. | Methods for characterizing molecular interactions using affinity capture tandem mass spectrometry |
| US20020195555A1 (en) * | 2000-10-11 | 2002-12-26 | Weinberger Scot R. | Apparatus and methods for affinity capture tandem mass spectrometry |
| US6570153B1 (en) | 2000-10-18 | 2003-05-27 | Agilent Technologies, Inc. | Tandem mass spectrometry using a single quadrupole mass analyzer |
| US6441369B1 (en) | 2000-11-15 | 2002-08-27 | Perseptive Biosystems, Inc. | Tandem time-of-flight mass spectrometer with improved mass resolution |
| EP1358480A2 (en) * | 2001-02-01 | 2003-11-05 | The Johns Hopkins University | Diagnosis of pathogen infections using mass spectral analysis of immune system modulators in post-exposure biological samples. |
| US20040234971A1 (en) * | 2001-02-01 | 2004-11-25 | Joany Jackman | Diagnosis of pathogen infections using mass spectral analysis of immune system modulators in post-exposure biological samples |
| US6777671B2 (en) * | 2001-04-10 | 2004-08-17 | Science & Engineering Services, Inc. | Time-of-flight/ion trap mass spectrometer, a method, and a computer program product to use the same |
| US6781117B1 (en) | 2002-05-30 | 2004-08-24 | Ross C Willoughby | Efficient direct current collision and reaction cell |
| US7825374B2 (en) * | 2003-02-21 | 2010-11-02 | The Johns Hopkins University | Tandem time-of-flight mass spectrometer |
| GB2403063A (en) * | 2003-06-21 | 2004-12-22 | Anatoli Nicolai Verentchikov | Time of flight mass spectrometer employing a plurality of lenses focussing an ion beam in shift direction |
| US7385187B2 (en) * | 2003-06-21 | 2008-06-10 | Leco Corporation | Multi-reflecting time-of-flight mass spectrometer and method of use |
| US7199363B2 (en) * | 2003-10-14 | 2007-04-03 | Micromass Uk Limited | Mass spectrometer |
| US7297960B2 (en) * | 2003-11-17 | 2007-11-20 | Micromass Uk Limited | Mass spectrometer |
| AU2004294054A1 (en) * | 2003-11-25 | 2005-06-09 | Syft Technologies Limited | Improvements in or relating to SIFT-MS instruments |
| JP4214925B2 (ja) * | 2004-02-26 | 2009-01-28 | 株式会社島津製作所 | 質量分析装置 |
| JP4980583B2 (ja) * | 2004-05-21 | 2012-07-18 | 日本電子株式会社 | 飛行時間型質量分析方法及び装置 |
| WO2006037059A2 (en) | 2004-09-27 | 2006-04-06 | The Johns Hopkins Universtiy | Point-of-care mass spectrometer system |
| US7351958B2 (en) * | 2005-01-24 | 2008-04-01 | Applera Corporation | Ion optics systems |
| US7439520B2 (en) * | 2005-01-24 | 2008-10-21 | Applied Biosystems Inc. | Ion optics systems |
| JP4581958B2 (ja) * | 2005-10-18 | 2010-11-17 | 株式会社島津製作所 | 質量分析装置 |
| WO2008127376A2 (en) * | 2006-10-17 | 2008-10-23 | The Regents Of The University Of California | Biological cell sorting and characterization using aerosol mass spectrometry |
| GB0620963D0 (en) * | 2006-10-20 | 2006-11-29 | Thermo Finnigan Llc | Multi-channel detection |
| GB0624677D0 (en) * | 2006-12-11 | 2007-01-17 | Shimadzu Corp | A co-axial time-of-flight mass spectrometer |
| US7663100B2 (en) * | 2007-05-01 | 2010-02-16 | Virgin Instruments Corporation | Reversed geometry MALDI TOF |
| DE102007048618B4 (de) * | 2007-10-10 | 2011-12-22 | Bruker Daltonik Gmbh | Gereinigte Tochterionenspektren aus MALDI-Ionisierung |
| US8138472B2 (en) * | 2009-04-29 | 2012-03-20 | Academia Sinica | Molecular ion accelerator |
| DE112013003058B4 (de) | 2012-06-18 | 2021-10-28 | Leco Corp. | Tandem Flugzeitmassenspektrometer mit ungleichmässiger Probennahme |
| GB201613988D0 (en) | 2016-08-16 | 2016-09-28 | Micromass Uk Ltd And Leco Corp | Mass analyser having extended flight path |
| GB2567794B (en) | 2017-05-05 | 2023-03-08 | Micromass Ltd | Multi-reflecting time-of-flight mass spectrometers |
| GB2563571B (en) | 2017-05-26 | 2023-05-24 | Micromass Ltd | Time of flight mass analyser with spatial focussing |
| US11049712B2 (en) | 2017-08-06 | 2021-06-29 | Micromass Uk Limited | Fields for multi-reflecting TOF MS |
| US11239067B2 (en) | 2017-08-06 | 2022-02-01 | Micromass Uk Limited | Ion mirror for multi-reflecting mass spectrometers |
| CN111164731B (zh) | 2017-08-06 | 2022-11-18 | 英国质谱公司 | 进入多通道质谱分析仪的离子注入 |
| US11295944B2 (en) | 2017-08-06 | 2022-04-05 | Micromass Uk Limited | Printed circuit ion mirror with compensation |
| WO2019030477A1 (en) | 2017-08-06 | 2019-02-14 | Anatoly Verenchikov | ACCELERATOR FOR MASS SPECTROMETERS WITH MULTIPASSES |
| US11081332B2 (en) | 2017-08-06 | 2021-08-03 | Micromass Uk Limited | Ion guide within pulsed converters |
| US11211238B2 (en) | 2017-08-06 | 2021-12-28 | Micromass Uk Limited | Multi-pass mass spectrometer |
| GB201806507D0 (en) | 2018-04-20 | 2018-06-06 | Verenchikov Anatoly | Gridless ion mirrors with smooth fields |
| GB201807626D0 (en) | 2018-05-10 | 2018-06-27 | Micromass Ltd | Multi-reflecting time of flight mass analyser |
| GB201807605D0 (en) | 2018-05-10 | 2018-06-27 | Micromass Ltd | Multi-reflecting time of flight mass analyser |
| GB201808530D0 (en) | 2018-05-24 | 2018-07-11 | Verenchikov Anatoly | TOF MS detection system with improved dynamic range |
| GB201810573D0 (en) | 2018-06-28 | 2018-08-15 | Verenchikov Anatoly | Multi-pass mass spectrometer with improved duty cycle |
| GB201901411D0 (en) | 2019-02-01 | 2019-03-20 | Micromass Ltd | Electrode assembly for mass spectrometer |
| GB201903779D0 (en) | 2019-03-20 | 2019-05-01 | Micromass Ltd | Multiplexed time of flight mass spectrometer |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2560434B1 (fr) * | 1984-02-29 | 1987-09-11 | Centre Nat Rech Scient | Spectrometre de masse a temps de vol |
| JPS6182652A (ja) * | 1984-09-29 | 1986-04-26 | Shimadzu Corp | 飛行時間型衝突解離質量分析装置 |
| DE3524536A1 (de) * | 1985-07-10 | 1987-01-22 | Bruker Analytische Messtechnik | Flugzeit-massenspektrometer mit einem ionenreflektor |
| WO1989006044A1 (en) * | 1987-12-24 | 1989-06-29 | Unisearch Limited | Mass spectrometer |
| US4851669A (en) * | 1988-06-02 | 1989-07-25 | The Regents Of The University Of California | Surface-induced dissociation for mass spectrometry |
| DE3842044A1 (de) * | 1988-12-14 | 1990-06-21 | Forschungszentrum Juelich Gmbh | Flugzeit(massen)spektrometer mit hoher aufloesung und transmission |
| DE3920566A1 (de) * | 1989-06-23 | 1991-01-10 | Bruker Franzen Analytik Gmbh | Ms-ms-flugzeit-massenspektrometer |
| GB8915972D0 (en) * | 1989-07-12 | 1989-08-31 | Kratos Analytical Ltd | An ion mirror for a time-of-flight mass spectrometer |
| GB9006303D0 (en) * | 1990-03-21 | 1990-05-16 | Kratos Analytical Ltd | Mass spectrometry systems |
| GB9010619D0 (en) * | 1990-05-11 | 1990-07-04 | Kratos Analytical Ltd | Ion storage device |
| DE4106796A1 (de) * | 1991-03-04 | 1991-11-07 | Wollnik Hermann | Ein flugzeit-massenspektrometer als sekundaerstufe eines ms-ms systems |
-
1991
- 1991-05-16 US US07/700,697 patent/US5202563A/en not_active Expired - Lifetime
-
1992
- 1992-05-15 DE DE69220943T patent/DE69220943T2/de not_active Expired - Fee Related
- 1992-05-15 WO PCT/US1992/003884 patent/WO1992021140A1/en not_active Ceased
- 1992-05-15 CA CA002103038A patent/CA2103038C/en not_active Expired - Fee Related
- 1992-05-15 EP EP92913066A patent/EP0584262B1/en not_active Expired - Lifetime
- 1992-05-15 JP JP5500118A patent/JPH07500449A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| US5202563A (en) | 1993-04-13 |
| CA2103038A1 (en) | 1992-11-17 |
| JPH07500449A (ja) | 1995-01-12 |
| DE69220943D1 (de) | 1997-08-21 |
| CA2103038C (en) | 2002-08-13 |
| EP0584262B1 (en) | 1997-07-16 |
| WO1992021140A1 (en) | 1992-11-26 |
| EP0584262A4 (enExample) | 1994-08-31 |
| EP0584262A1 (en) | 1994-03-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69220943T2 (de) | Tandem flugzeit massenspektrometer | |
| US5464985A (en) | Non-linear field reflectron | |
| DE112015001566B4 (de) | Vielfachreflexions- und Laufzeitverfahrens-Massenspektrometer mit axial gepulstem Konverter | |
| US5986258A (en) | Extended Bradbury-Nielson gate | |
| DE112010006135B3 (de) | Ionenfallen-Massenspektrometer | |
| Boesl et al. | Multiphoton mass spectrometry of metastables: direct observation of decay in a high-resolution time-of-flight instrument | |
| DE10248814B4 (de) | Höchstauflösendes Flugzeitmassenspektrometer kleiner Bauart | |
| DE112013005348B4 (de) | Zylindrisches mehrfach reflektierendes Flugzeitmassenspektrometer | |
| US5160840A (en) | Time-of-flight analyzer and method | |
| DE112013000722B4 (de) | Mehrfachreflexions-Massenspektrometer | |
| Cornish et al. | Tandem time-of-flight mass spectrometer | |
| US5814813A (en) | End cap reflection for a time-of-flight mass spectrometer and method of using the same | |
| DE112013000726B4 (de) | Mehrfachreflexions-Massenspektrometer | |
| US6489610B1 (en) | Tandem time-of-flight mass spectrometer | |
| US5753909A (en) | High resolution postselector for time-of-flight mass spectrometery | |
| US5696375A (en) | Multideflector | |
| DE69919325T2 (de) | Spektrometer mit gepulster ionenquelle, kopplungsvorrichtung zur dämpfung der ionenbewegung, und methode zur verwendung derselben | |
| DE102011108691B4 (de) | Seitliche Einführung von Ionen in Hochfrequenz-Ionenleitsysteme | |
| DE112015001570T5 (de) | GC-TOF MS mit verbesserter Nachweisgrenze | |
| DE112013003058T5 (de) | Tandem Flugzeitmassenspektrometer mit ungleichmässiger Probennahme | |
| US5861623A (en) | Nth order delayed extraction | |
| Piyadasa et al. | A high resolving power multiple reflection matrix‐assisted laser desorption/ionization time‐of‐flight mass spectrometer | |
| US5744797A (en) | Split-field interface | |
| US6310353B1 (en) | Shielded lens | |
| US20010054684A1 (en) | Surface induced dissociation with pulsed ion extraction |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |