DE3714602A1 - Verfahren zur herstellung von 2,3,5,6-tetrafluor-benzyl-alkoholen - Google Patents
Verfahren zur herstellung von 2,3,5,6-tetrafluor-benzyl-alkoholenInfo
- Publication number
- DE3714602A1 DE3714602A1 DE19873714602 DE3714602A DE3714602A1 DE 3714602 A1 DE3714602 A1 DE 3714602A1 DE 19873714602 DE19873714602 DE 19873714602 DE 3714602 A DE3714602 A DE 3714602A DE 3714602 A1 DE3714602 A1 DE 3714602A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- alkylating agent
- methyl
- preparation
- mol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims abstract description 24
- -1 2,3,5,6-tetrafluorobenzyl alcohols Chemical class 0.000 title claims abstract description 6
- 229940100198 alkylating agent Drugs 0.000 claims abstract description 19
- 239000002168 alkylating agent Substances 0.000 claims abstract description 19
- NVIFVTYDZMXWGX-UHFFFAOYSA-N sodium metaborate Chemical compound [Na+].[O-]B=O NVIFVTYDZMXWGX-UHFFFAOYSA-N 0.000 claims abstract description 12
- 239000007858 starting material Substances 0.000 claims abstract description 10
- 239000003085 diluting agent Substances 0.000 claims abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 6
- 239000001257 hydrogen Substances 0.000 claims abstract description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 6
- KVLBXIOFJUWSJQ-UHFFFAOYSA-N 2,3,5,6-tetrafluorobenzoic acid Chemical class OC(=O)C1=C(F)C(F)=CC(F)=C1F KVLBXIOFJUWSJQ-UHFFFAOYSA-N 0.000 claims abstract description 5
- 238000006243 chemical reaction Methods 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 claims description 5
- 150000001350 alkyl halides Chemical class 0.000 claims description 2
- 150000008050 dialkyl sulfates Chemical class 0.000 claims description 2
- 239000003495 polar organic solvent Substances 0.000 claims description 2
- 150000003459 sulfonic acid esters Chemical class 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 235000019445 benzyl alcohol Nutrition 0.000 abstract description 2
- 150000003938 benzyl alcohols Chemical class 0.000 abstract description 2
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- PJCSTULKVNHEGW-UHFFFAOYSA-N (2,3,5,6-tetrafluoro-4-methylphenyl)methanol Chemical compound CC1=C(F)C(F)=C(CO)C(F)=C1F PJCSTULKVNHEGW-UHFFFAOYSA-N 0.000 description 2
- AGWVQASYTKCTCC-UHFFFAOYSA-N (2,3,5,6-tetrafluorophenyl)methanol Chemical compound OCC1=C(F)C(F)=CC(F)=C1F AGWVQASYTKCTCC-UHFFFAOYSA-N 0.000 description 2
- COOULIOYEXBFDT-UHFFFAOYSA-N 2,3,5,6-tetrafluoro-4-methylbenzoic acid Chemical compound CC1=C(F)C(F)=C(C(O)=O)C(F)=C1F COOULIOYEXBFDT-UHFFFAOYSA-N 0.000 description 2
- SZNYYWIUQFZLLT-UHFFFAOYSA-N 2-methyl-1-(2-methylpropoxy)propane Chemical compound CC(C)COCC(C)C SZNYYWIUQFZLLT-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SFKRXQKJTIYUAG-UHFFFAOYSA-N 2,3,4,5-tetrafluorobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(F)C(F)=C1F SFKRXQKJTIYUAG-UHFFFAOYSA-N 0.000 description 1
- MEXUTNIFSHFQRG-UHFFFAOYSA-N 6,7,12,13-tetrahydro-5h-indolo[2,3-a]pyrrolo[3,4-c]carbazol-5-one Chemical compound C12=C3C=CC=C[C]3NC2=C2NC3=CC=C[CH]C3=C2C2=C1C(=O)NC2 MEXUTNIFSHFQRG-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- HXELGNKCCDGMMN-UHFFFAOYSA-N [F].[Cl] Chemical group [F].[Cl] HXELGNKCCDGMMN-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 238000003541 multi-stage reaction Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C33/00—Unsaturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C33/40—Halogenated unsaturated alcohols
- C07C33/46—Halogenated unsaturated alcohols containing only six-membered aromatic rings as cyclic parts
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19873714602 DE3714602A1 (de) | 1987-05-01 | 1987-05-01 | Verfahren zur herstellung von 2,3,5,6-tetrafluor-benzyl-alkoholen |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19873714602 DE3714602A1 (de) | 1987-05-01 | 1987-05-01 | Verfahren zur herstellung von 2,3,5,6-tetrafluor-benzyl-alkoholen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3714602A1 true DE3714602A1 (de) | 1988-11-10 |
| DE3714602C2 DE3714602C2 (OSRAM) | 1989-05-03 |
Family
ID=6326666
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19873714602 Granted DE3714602A1 (de) | 1987-05-01 | 1987-05-01 | Verfahren zur herstellung von 2,3,5,6-tetrafluor-benzyl-alkoholen |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE3714602A1 (OSRAM) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4918246A (en) * | 1988-03-30 | 1990-04-17 | Aldrich Chemical Company, Inc. | Process for preparing optically active haloalcohols |
| US6020517A (en) * | 1996-08-29 | 2000-02-01 | Showa Denko K.K. | Process for production of benzonitrile and benzyl alcohol |
| WO2002034707A1 (en) * | 2000-10-27 | 2002-05-02 | Syngenta Limited | Preparation of 4-methyl-2,3,5,6-tetrafluorobenzyl alcohol |
| WO2002026678A3 (en) * | 2000-09-27 | 2002-07-25 | Showa Denko Kk | Process for producing fluorinated methyl-benzyl alcohol |
| EP1247792A3 (de) * | 2001-04-06 | 2003-10-29 | Bayer Ag | Verfahren zur Herstellung von halogensubstituierten Dibenzylalkoholen, diese halogensubstituierten Dibenzylalkohole sowie deren Verwendung |
| CN107827708A (zh) * | 2017-11-06 | 2018-03-23 | 大连奇凯医药科技有限公司 | 一种制备多氟苄醇的方法 |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0031199A1 (en) * | 1979-12-21 | 1981-07-01 | Imperial Chemical Industries Plc | Substituted benzyl esters of cyclopropane carboxylic acids and their preparation, compositions containing them and methods of combating insect pests therewith, and substituted benzyl alcohols |
| EP0060617A1 (en) * | 1981-03-18 | 1982-09-22 | Imperial Chemical Industries Plc | Fluorobenzyl cyclopropane carboxylates, their preparation, compositions and use as insecticides |
-
1987
- 1987-05-01 DE DE19873714602 patent/DE3714602A1/de active Granted
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0031199A1 (en) * | 1979-12-21 | 1981-07-01 | Imperial Chemical Industries Plc | Substituted benzyl esters of cyclopropane carboxylic acids and their preparation, compositions containing them and methods of combating insect pests therewith, and substituted benzyl alcohols |
| EP0060617A1 (en) * | 1981-03-18 | 1982-09-22 | Imperial Chemical Industries Plc | Fluorobenzyl cyclopropane carboxylates, their preparation, compositions and use as insecticides |
Non-Patent Citations (2)
| Title |
|---|
| Bull. Korean Chem. Soc., 3, 1982, 149-152 * |
| J. Am. Chem. Soc., 78, 1956, 2582 * |
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4918246A (en) * | 1988-03-30 | 1990-04-17 | Aldrich Chemical Company, Inc. | Process for preparing optically active haloalcohols |
| US6020517A (en) * | 1996-08-29 | 2000-02-01 | Showa Denko K.K. | Process for production of benzonitrile and benzyl alcohol |
| DE19780906B4 (de) * | 1996-08-29 | 2007-04-19 | Showa Denko K.K. | Verfahren zur Herstellung von Benzonitril und Benzylalkohol |
| WO2002026678A3 (en) * | 2000-09-27 | 2002-07-25 | Showa Denko Kk | Process for producing fluorinated methyl-benzyl alcohol |
| US6828467B2 (en) | 2000-09-27 | 2004-12-07 | Showa Denko K.K. | Process for producing fluorinated methyl-benzyl alcohol |
| WO2002034707A1 (en) * | 2000-10-27 | 2002-05-02 | Syngenta Limited | Preparation of 4-methyl-2,3,5,6-tetrafluorobenzyl alcohol |
| US6894195B2 (en) | 2000-10-27 | 2005-05-17 | Syngenta Limited | Preparation of 4-methyl-2,3,5,6-tetrafluorobenzyl alcohol |
| EP1247792A3 (de) * | 2001-04-06 | 2003-10-29 | Bayer Ag | Verfahren zur Herstellung von halogensubstituierten Dibenzylalkoholen, diese halogensubstituierten Dibenzylalkohole sowie deren Verwendung |
| US6759558B2 (en) | 2001-04-06 | 2004-07-06 | Bayer Aktiengesellschaft | Process for preparing halogen-substituted dibenzyl alcohols, these halogen-substituted dibenzyl alcohols and their use |
| CN107827708A (zh) * | 2017-11-06 | 2018-03-23 | 大连奇凯医药科技有限公司 | 一种制备多氟苄醇的方法 |
| CN107827708B (zh) * | 2017-11-06 | 2020-09-29 | 大连奇凯医药科技有限公司 | 一种制备多氟苄醇的方法 |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3714602C2 (OSRAM) | 1989-05-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0003060B1 (de) | Verfahren zur Trennung von Stereoisomeren von substituierten Vinylcyclopropancarbonsäuren | |
| DE3714602C2 (OSRAM) | ||
| EP0352456B1 (de) | Verfahren zur Herstellung von alpha, beta -ungesättigten Ketonen | |
| DE2732291A1 (de) | Verfahren zur herstellung von 1-amino-8-naphthol-3,6-disulfonsaeure (h-saeure) | |
| DE69513673T2 (de) | Verfahren zur herstellung von cyclopropancarbonsäure und ihre derivaten | |
| EP0184731A1 (de) | Verfahren zur Herstellung von 2-(1-Hydroxymethyl)-acrylnitril und -acrylestern | |
| EP0132733A2 (de) | Neue Fluorpivalsäurefluoride und Verfahren zu ihrer Herstellung | |
| DE69205601T2 (de) | Verfahren zur Herstellung von 3-Cyano-3,5,5-trimethylcyclohexanon. | |
| DE3026094C2 (de) | Verfahren zur Herstellung von Cyclopropancarbonsäureamiden | |
| DD206371A5 (de) | Verfahren zur herstellung eines 2s chiralen alkohols | |
| EP0087585A1 (de) | Verfahren zur Herstellung von 3-Alkoxi-acrylnitrilen | |
| EP0676390B1 (de) | Verfahren zur Herstellung von 1-Aminocyclopropancarbonsäurehydrochlorid | |
| EP0664285B1 (de) | Verfahren zur Herstellung von 1-Amino-1-methyl-3(4)-cyano-cyclohexan | |
| EP1019356B1 (de) | Verfahren zur herstellung von 3-hydroxy-2-methylbenzoesäure | |
| DE3245503A1 (de) | Verfahren zur herstellung von alkyl-hydroxylaminen | |
| EP0779269A1 (de) | Verfahren zur Herstellung synthetischer Pyrethroide durch azeotrope Veresterung | |
| DE69825556T2 (de) | Verfahren zu Herstellung von 2-Mercaptothiazol | |
| DE69021155T4 (de) | Verfahren zur Herstellung von 2-Chlor-4-Fluorphenol. | |
| DE19711826A1 (de) | Verbessertes Verfahren zur Herstellung von Trifluormethyloxiran | |
| EP2190809B1 (de) | Verfahren zur herstellung optisch aktiver alpha-alkylcarbonylverbindungen | |
| EP0075093B1 (de) | Verfahren zur Herstellung von L-Prolin | |
| EP0019845A1 (de) | Ethylether des Isocamphyl-guajakols, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von 3-(Isocamphyl-(5))-cyclohexanol | |
| EP0089485A2 (de) | Verfahren zur Herstellung von 5-Chlor-1H-tetrazol-1-carbonsäureestern sowie Verfahren zur Herstellung der erforderlichen Dichlorisonitril-carbonsäureester | |
| EP0457725A2 (de) | Verfahren zur Herstellung von 2,3-Dibrompropionylchlorid | |
| DE3014122A1 (de) | Verfahren zur herstellung von n,n-dimethyl-n' -(2-brom-4-methyl-phenyl)-triazen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: BAYER HEALTHCARE AG, 51373 LEVERKUSEN, DE |