DE3622045A1 - Stufenloses hydromechanisches verzweigungsgetriebe, insbesondere fuer kraftfahrzeuge - Google Patents
Stufenloses hydromechanisches verzweigungsgetriebe, insbesondere fuer kraftfahrzeugeInfo
- Publication number
- DE3622045A1 DE3622045A1 DE19863622045 DE3622045A DE3622045A1 DE 3622045 A1 DE3622045 A1 DE 3622045A1 DE 19863622045 DE19863622045 DE 19863622045 DE 3622045 A DE3622045 A DE 3622045A DE 3622045 A1 DE3622045 A1 DE 3622045A1
- Authority
- DE
- Germany
- Prior art keywords
- planetary gear
- gear
- shaft
- summing
- transmission according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 230000002706 hydrostatic effect Effects 0.000 claims description 68
- 230000005540 biological transmission Effects 0.000 claims description 56
- 230000002441 reversible effect Effects 0.000 claims description 33
- 230000008878 coupling Effects 0.000 claims description 9
- 238000010168 coupling process Methods 0.000 claims description 9
- 238000005859 coupling reaction Methods 0.000 claims description 9
- 238000010276 construction Methods 0.000 claims description 6
- 230000001419 dependent effect Effects 0.000 claims description 4
- 230000002349 favourable effect Effects 0.000 claims description 3
- 238000010586 diagram Methods 0.000 description 10
- 238000013519 translation Methods 0.000 description 8
- 230000014616 translation Effects 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 5
- 230000000712 assembly Effects 0.000 description 4
- 238000000429 assembly Methods 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 4
- 230000001360 synchronised effect Effects 0.000 description 4
- 238000009434 installation Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 2
- 238000011010 flushing procedure Methods 0.000 description 2
- 239000000446 fuel Substances 0.000 description 2
- 238000005096 rolling process Methods 0.000 description 2
- 238000003892 spreading Methods 0.000 description 2
- 230000006978 adaptation Effects 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 238000005461 lubrication Methods 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 101150039622 so gene Proteins 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F16—ENGINEERING ELEMENTS AND UNITS; GENERAL MEASURES FOR PRODUCING AND MAINTAINING EFFECTIVE FUNCTIONING OF MACHINES OR INSTALLATIONS; THERMAL INSULATION IN GENERAL
- F16H—GEARING
- F16H47/00—Combinations of mechanical gearing with fluid clutches or fluid gearing
- F16H47/02—Combinations of mechanical gearing with fluid clutches or fluid gearing the fluid gearing being of the volumetric type
- F16H47/04—Combinations of mechanical gearing with fluid clutches or fluid gearing the fluid gearing being of the volumetric type the mechanical gearing being of the type with members having orbital motion
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F16—ENGINEERING ELEMENTS AND UNITS; GENERAL MEASURES FOR PRODUCING AND MAINTAINING EFFECTIVE FUNCTIONING OF MACHINES OR INSTALLATIONS; THERMAL INSULATION IN GENERAL
- F16H—GEARING
- F16H37/00—Combinations of mechanical gearings, not provided for in groups F16H1/00 - F16H35/00
- F16H37/02—Combinations of mechanical gearings, not provided for in groups F16H1/00 - F16H35/00 comprising essentially only toothed or friction gearings
- F16H37/06—Combinations of mechanical gearings, not provided for in groups F16H1/00 - F16H35/00 comprising essentially only toothed or friction gearings with a plurality of driving or driven shafts; with arrangements for dividing torque between two or more intermediate shafts
- F16H37/08—Combinations of mechanical gearings, not provided for in groups F16H1/00 - F16H35/00 comprising essentially only toothed or friction gearings with a plurality of driving or driven shafts; with arrangements for dividing torque between two or more intermediate shafts with differential gearing
- F16H37/0833—Combinations of mechanical gearings, not provided for in groups F16H1/00 - F16H35/00 comprising essentially only toothed or friction gearings with a plurality of driving or driven shafts; with arrangements for dividing torque between two or more intermediate shafts with differential gearing with arrangements for dividing torque between two or more intermediate shafts, i.e. with two or more internal power paths
- F16H37/084—Combinations of mechanical gearings, not provided for in groups F16H1/00 - F16H35/00 comprising essentially only toothed or friction gearings with a plurality of driving or driven shafts; with arrangements for dividing torque between two or more intermediate shafts with differential gearing with arrangements for dividing torque between two or more intermediate shafts, i.e. with two or more internal power paths at least one power path being a continuously variable transmission, i.e. CVT
- F16H2037/088—Power-split transmissions with summing differentials, with the input of the CVT connected or connectable to the input shaft
- F16H2037/0886—Power-split transmissions with summing differentials, with the input of the CVT connected or connectable to the input shaft with switching means, e.g. to change ranges
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Structure Of Transmissions (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863622045 DE3622045A1 (de) | 1985-09-18 | 1986-07-01 | Stufenloses hydromechanisches verzweigungsgetriebe, insbesondere fuer kraftfahrzeuge |
| EP86112723A EP0222108B1 (de) | 1985-09-18 | 1986-09-15 | Stufenloses hydromechanisches Verzweigungsgetriebe, insbesondere für Kraftfahrzeuge |
| US08/135,759 US5328418A (en) | 1985-09-18 | 1993-10-14 | Stepless hydromechanical mechanism with multiple power-transmission paths, more particularly for motor vehicles |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3533191 | 1985-09-18 | ||
| DE19863622045 DE3622045A1 (de) | 1985-09-18 | 1986-07-01 | Stufenloses hydromechanisches verzweigungsgetriebe, insbesondere fuer kraftfahrzeuge |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3622045A1 true DE3622045A1 (de) | 1987-03-26 |
| DE3622045C2 DE3622045C2 (enExample) | 1988-12-08 |
Family
ID=25836081
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19863622045 Granted DE3622045A1 (de) | 1985-09-18 | 1986-07-01 | Stufenloses hydromechanisches verzweigungsgetriebe, insbesondere fuer kraftfahrzeuge |
Country Status (2)
| Country | Link |
|---|---|
| EP (1) | EP0222108B1 (enExample) |
| DE (1) | DE3622045A1 (enExample) |
Cited By (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3815780A1 (de) * | 1987-05-12 | 1988-12-01 | Jarchow Friedrich | Stufenlos wirkendes hydrostatischmechanisches lastschaltgetriebe |
| DE3730474A1 (de) * | 1987-09-11 | 1989-03-23 | Michael Meyerle | Stufenloses hydrostatisch-mechanisches verzweigungsgetriebe, insbesondere fuer kraftfahrzeuge |
| DE3838767A1 (de) * | 1987-05-12 | 1989-06-08 | Jarchow Friedrich | Stufenlos wirkendes hydrostatisch-mechanisches lastschaltgetriebe mit hoher schaltqualitaet |
| DE3838768A1 (de) * | 1987-05-12 | 1989-06-08 | Jarchow Friedrich | Stufenlos wirkendes hydrostatisch-mechanisches lastschaltgetriebe mit schalt-zahnkupplungen fuer gangwechsel vorbereitende schaltungen und lamellenkupplungen fuer die gangwechsel |
| EP0347594A1 (de) * | 1988-06-24 | 1989-12-27 | MAN Nutzfahrzeuge Aktiengesellschaft | Antriebseinrichtung eines Fahrzeugs |
| DE4313378A1 (de) * | 1993-04-23 | 1994-10-27 | Renk Ag | Automatisches Lastschaltgetriebe mit stufenlos einstellbarer Übersetzung |
| DE102008040450A1 (de) * | 2008-07-16 | 2010-01-21 | Zf Friedrichshafen Ag | Stufenlose Getriebevorrichtung für ein Fahrzeug |
| US8262525B2 (en) | 2007-10-02 | 2012-09-11 | Zf Friedrichshafen Ag | Hydrostatic-mechanical power split transmission |
| US8262530B2 (en) | 2007-10-02 | 2012-09-11 | Zf Friedrichshafen Ag | Power-branched transmission |
| US8287414B2 (en) | 2007-10-02 | 2012-10-16 | Zf Friedrichshafen Ag | Transmission device having a variator |
| US8323138B2 (en) | 2007-10-02 | 2012-12-04 | Zf Friedrichshafen Ag | Power split transmission |
| US8328676B2 (en) | 2007-10-02 | 2012-12-11 | Zf Friedrichshafen Ag | Power split transmission |
| US8393988B2 (en) | 2007-10-02 | 2013-03-12 | Zf Friedrichshafen Ag | Transmission device for a vehicle |
| US8414439B2 (en) | 2007-10-02 | 2013-04-09 | Zf Friedrichshafen Ag | Transmission device for a vehicle, having a variator |
| US8424633B2 (en) | 2007-10-02 | 2013-04-23 | Zf Friedrichshafen Ag | Variable transmission device for a vehicle |
| US8752374B2 (en) | 2007-10-02 | 2014-06-17 | Zf Friedrichshafen Ag | Device for adjusting the stroke volume of hydraulic piston machines |
| US8756931B2 (en) | 2007-10-02 | 2014-06-24 | Zf Friedrichshafen Ag | Device for adjusting the stroke volume of hydraulic piston machines |
| DE102017219995A1 (de) * | 2017-11-10 | 2019-05-16 | Zf Friedrichshafen Ag | Stufenloses Leistungsverzweigungsgetriebe |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8720639D0 (en) * | 1987-09-02 | 1987-10-07 | Lcvt Ltd | Continuously variable transmission |
| DE3909939A1 (de) * | 1988-03-30 | 1989-10-19 | Zahnradfabrik Friedrichshafen | Lastschaltgetriebe |
| DE4042696C2 (de) * | 1989-09-02 | 2003-04-24 | Meyerle Hannelore | Stufenloses hydrostatisch-mechanisches Leistungsverzweigungsgetriebe, insbesondere für Kraftfahrzeuge |
| GB9011806D0 (en) * | 1990-05-25 | 1990-07-18 | Egan Michael J | Rotary transmission system |
| FR2809154A1 (fr) * | 2000-05-17 | 2001-11-23 | Timothee Biel | Transmission differentielle pour deux entrainements positifs |
| DE102006061116A1 (de) * | 2006-12-22 | 2008-06-26 | Audi Ag | Hydrostatisch-mechanisch leistungsverzweigtes, stufenloses Getriebe |
| DE102014223213A1 (de) | 2014-11-13 | 2016-05-19 | Zf Friedrichshafen Ag | Bereichsgetriebe und Verfahren zum Betreiben eines Bereichsgetriebes |
Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2363996A1 (de) * | 1972-12-22 | 1974-06-27 | George M Delalio | Umlaufraedergetriebe |
| GB1411909A (en) * | 1971-06-21 | 1975-10-29 | Orshansky Transmission Corp | Hydrochemical transmission |
| US3979972A (en) * | 1974-02-06 | 1976-09-14 | Toyota Jidosha Kogyo Kabushiki Kaisha | Hydromechanical transmission |
| US4116089A (en) * | 1977-04-14 | 1978-09-26 | Orshansky Transmission Corporation | Hydromechanical transmission |
| DE2935361A1 (de) * | 1979-09-01 | 1981-03-12 | Daimler-Benz Ag, 7000 Stuttgart | Automatisches gangwechselgetriebe mit einer dauer- und gangschaltbremse |
| US4261229A (en) * | 1978-08-24 | 1981-04-14 | Aisin Seiki Kabushiki Kaisha | Automatic speed ratio control system for stepless transmission of automotive vehicles |
| DE2757300C2 (de) * | 1977-12-22 | 1982-08-12 | Zahnradfabrik Friedrichshafen Ag, 7990 Friedrichshafen | Leistungsverzweigtes hydrostatisch-mechanisches Verbundgetriebe |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2716960C2 (de) * | 1977-04-16 | 1984-08-23 | Zahnradfabrik Friedrichshafen Ag, 7990 Friedrichshafen | Hydrostatisch-mechanisches Getriebe mit Leistungsverzweigung |
| DE2757191C2 (de) * | 1977-12-22 | 1983-01-13 | Zahnradfabrik Friedrichshafen Ag, 7990 Friedrichshafen | Stufenlos einstellbares hydrostatisch-mechanisches Verbundgetriebe |
| DE2758659C3 (de) * | 1977-12-29 | 1982-03-18 | Zahnradfabrik Friedrichshafen Ag, 7990 Friedrichshafen | Hydrostatisch-mechanisches Getriebe mit Leistungsverzweigung |
| DE2854375C2 (de) * | 1978-12-16 | 1982-06-24 | Zahnradfabrik Friedrichshafen Ag, 7990 Friedrichshafen | Hydrostatisch-mechanisches Verbundgetriebe |
| DE3147447C2 (de) * | 1981-12-01 | 1984-06-14 | Jarchow, Friedrich, Prof. Dr.-Ing., 4300 Essen | Hydrostatischmechanisches Stellkoppelgetriebe mit eingangsseitiger Leistungsverzweigung |
-
1986
- 1986-07-01 DE DE19863622045 patent/DE3622045A1/de active Granted
- 1986-09-15 EP EP86112723A patent/EP0222108B1/de not_active Expired - Lifetime
Patent Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1411909A (en) * | 1971-06-21 | 1975-10-29 | Orshansky Transmission Corp | Hydrochemical transmission |
| DE2363996A1 (de) * | 1972-12-22 | 1974-06-27 | George M Delalio | Umlaufraedergetriebe |
| US3979972A (en) * | 1974-02-06 | 1976-09-14 | Toyota Jidosha Kogyo Kabushiki Kaisha | Hydromechanical transmission |
| US4116089A (en) * | 1977-04-14 | 1978-09-26 | Orshansky Transmission Corporation | Hydromechanical transmission |
| DE2757300C2 (de) * | 1977-12-22 | 1982-08-12 | Zahnradfabrik Friedrichshafen Ag, 7990 Friedrichshafen | Leistungsverzweigtes hydrostatisch-mechanisches Verbundgetriebe |
| US4261229A (en) * | 1978-08-24 | 1981-04-14 | Aisin Seiki Kabushiki Kaisha | Automatic speed ratio control system for stepless transmission of automotive vehicles |
| DE2935361A1 (de) * | 1979-09-01 | 1981-03-12 | Daimler-Benz Ag, 7000 Stuttgart | Automatisches gangwechselgetriebe mit einer dauer- und gangschaltbremse |
Cited By (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3815780A1 (de) * | 1987-05-12 | 1988-12-01 | Jarchow Friedrich | Stufenlos wirkendes hydrostatischmechanisches lastschaltgetriebe |
| DE3838767A1 (de) * | 1987-05-12 | 1989-06-08 | Jarchow Friedrich | Stufenlos wirkendes hydrostatisch-mechanisches lastschaltgetriebe mit hoher schaltqualitaet |
| DE3838768A1 (de) * | 1987-05-12 | 1989-06-08 | Jarchow Friedrich | Stufenlos wirkendes hydrostatisch-mechanisches lastschaltgetriebe mit schalt-zahnkupplungen fuer gangwechsel vorbereitende schaltungen und lamellenkupplungen fuer die gangwechsel |
| DE3730474A1 (de) * | 1987-09-11 | 1989-03-23 | Michael Meyerle | Stufenloses hydrostatisch-mechanisches verzweigungsgetriebe, insbesondere fuer kraftfahrzeuge |
| WO1989002552A1 (fr) * | 1987-09-11 | 1989-03-23 | Michael Meyerle | Transmission a changement de vitesse mecanique/hydrostatique a reglage continu, notamment pour vehicules automobiles |
| EP0347594A1 (de) * | 1988-06-24 | 1989-12-27 | MAN Nutzfahrzeuge Aktiengesellschaft | Antriebseinrichtung eines Fahrzeugs |
| DE4313378A1 (de) * | 1993-04-23 | 1994-10-27 | Renk Ag | Automatisches Lastschaltgetriebe mit stufenlos einstellbarer Übersetzung |
| US8262525B2 (en) | 2007-10-02 | 2012-09-11 | Zf Friedrichshafen Ag | Hydrostatic-mechanical power split transmission |
| US8262530B2 (en) | 2007-10-02 | 2012-09-11 | Zf Friedrichshafen Ag | Power-branched transmission |
| US8287414B2 (en) | 2007-10-02 | 2012-10-16 | Zf Friedrichshafen Ag | Transmission device having a variator |
| US8323138B2 (en) | 2007-10-02 | 2012-12-04 | Zf Friedrichshafen Ag | Power split transmission |
| US8328676B2 (en) | 2007-10-02 | 2012-12-11 | Zf Friedrichshafen Ag | Power split transmission |
| US8393988B2 (en) | 2007-10-02 | 2013-03-12 | Zf Friedrichshafen Ag | Transmission device for a vehicle |
| US8414439B2 (en) | 2007-10-02 | 2013-04-09 | Zf Friedrichshafen Ag | Transmission device for a vehicle, having a variator |
| US8424633B2 (en) | 2007-10-02 | 2013-04-23 | Zf Friedrichshafen Ag | Variable transmission device for a vehicle |
| US8752374B2 (en) | 2007-10-02 | 2014-06-17 | Zf Friedrichshafen Ag | Device for adjusting the stroke volume of hydraulic piston machines |
| US8756931B2 (en) | 2007-10-02 | 2014-06-24 | Zf Friedrichshafen Ag | Device for adjusting the stroke volume of hydraulic piston machines |
| DE102008040450A1 (de) * | 2008-07-16 | 2010-01-21 | Zf Friedrichshafen Ag | Stufenlose Getriebevorrichtung für ein Fahrzeug |
| DE102017219995A1 (de) * | 2017-11-10 | 2019-05-16 | Zf Friedrichshafen Ag | Stufenloses Leistungsverzweigungsgetriebe |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0222108A2 (de) | 1987-05-20 |
| EP0222108B1 (de) | 1990-12-05 |
| EP0222108A3 (en) | 1987-08-26 |
| DE3622045C2 (enExample) | 1988-12-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3622045C2 (enExample) | ||
| EP0263856B1 (de) | Stufenloses verzweigungsgetriebe insbesondere für kraftfahrzeuge | |
| DE2854375C2 (de) | Hydrostatisch-mechanisches Verbundgetriebe | |
| AT414345B (de) | Leistungsverzweigungsgetriebe für kraftfahrzeuge | |
| DE69301757T2 (de) | Mehrgängiges, synchron-automatisches Getriebe für Kraftfahrzeuge | |
| DE202008017570U1 (de) | Lastschaltbares Mehrstufengetriebe | |
| DE102007047194A1 (de) | Leistungsverzweigungsgetriebe | |
| DE29816863U1 (de) | Stufenloses Getriebe, insbesondere mit Leistungsverzweigung | |
| EP0238521B1 (de) | Stufenloses hydromechanisches verzweigungsgetriebe für kraftfahrzeuge | |
| DE2815831A1 (de) | Getriebeanordnung mit hydrostatischer anfahrstufe und zwei hydromechanischen gangstufen | |
| DE4106746A1 (de) | Stufenloses hydrostatisch-mechanisches verzweigungsgetriebe, insbesondere fuer kraftfahrzeuge | |
| EP0291525B1 (de) | Stufenloses fahr- und lenkgetriebe für gleiskettenfahrzeuge | |
| EP0386214B1 (de) | Stufenloses hydrostatisch-mechanisches verzweigungsgetriebe, insbesondere für kraftfahrzeuge | |
| DE19621201A1 (de) | Stufenloses Getriebe | |
| DE3341217C2 (de) | Automatisches Kraftfahrzeuggetriebe | |
| EP0242372B1 (de) | Stufenloses hydromechanisches verzweigungsgetriebe insbesondere für kraftfahrzeuge | |
| DE3910410A1 (de) | Hydrostatisch mechanisches leistungsverzweigungsgetriebe | |
| DE3609907C3 (de) | Stufenloses hydrostatisch-mechanisches Leistungsverzweigungsgetriebe, insbesondere für Kraftfahrzeuge | |
| DE202022104125U1 (de) | Leistungsverzweigungsgetriebe | |
| DE19803510C2 (de) | Getriebeeinheit | |
| EP0343197B1 (de) | Stufenloses hydrostatisch-mechanisches verzweigungsgetriebe, insbesondere für kraftfahrzeuge | |
| DE3909940A1 (de) | Lastschaltgetriebe mit stufenlos einstellbarer uebersetzung | |
| DE8526625U1 (de) | Stufenloses hydromechanisches Verzweigungsgetriebe für Kraftfahrzeuge | |
| DE4042697C2 (de) | Stufenloses hydrostatisch-mechanisches Leistungsverzweigungsgetriebe, insbesondere für Kraftfahrzeuge | |
| EP0702168A2 (de) | Hydrostatisch-mechanisches Getriebe mit Leistungsverzweigung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: MEYERLE, HANNELORE, 88074 MECKENBEUREN, DE MEYERLE |
|
| 8381 | Inventor (new situation) |
Free format text: MEYERLE, MICHAEL, 88074 MECKENBEUREN, VERSTORBEN, DE |
|
| 8339 | Ceased/non-payment of the annual fee |