DE3569120D1 - Flame retardant molding compositions - Google Patents
Flame retardant molding compositionsInfo
- Publication number
- DE3569120D1 DE3569120D1 DE8585114234T DE3569120T DE3569120D1 DE 3569120 D1 DE3569120 D1 DE 3569120D1 DE 8585114234 T DE8585114234 T DE 8585114234T DE 3569120 T DE3569120 T DE 3569120T DE 3569120 D1 DE3569120 D1 DE 3569120D1
- Authority
- DE
- Germany
- Prior art keywords
- flame retardant
- molding compositions
- retardant molding
- compositions
- flame
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 title 1
- 239000003063 flame retardant Substances 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
- 238000000465 moulding Methods 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3412—Heterocyclic compounds having nitrogen in the ring having one nitrogen atom in the ring
- C08K5/3415—Five-membered rings
- C08K5/3417—Five-membered rings condensed with carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/672,511 US4673699A (en) | 1984-11-19 | 1984-11-19 | Flame retardant molding compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3569120D1 true DE3569120D1 (en) | 1989-05-03 |
Family
ID=24698858
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8585114234T Expired DE3569120D1 (en) | 1984-11-19 | 1985-11-08 | Flame retardant molding compositions |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4673699A (enExample) |
| EP (1) | EP0183107B1 (enExample) |
| JP (1) | JPS61126167A (enExample) |
| CA (1) | CA1256235A (enExample) |
| DE (1) | DE3569120D1 (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4873277A (en) * | 1986-10-31 | 1989-10-10 | General Electric Company | Aromatic carbonate resin exhibiting improved impact properties |
| DE4119329A1 (de) * | 1991-06-12 | 1992-12-17 | Bayer Ag | Verwendung von kernbromierten phthalsaeurederivaten zur stabilisierung von thermoplastischen polycarbonaten gegen die einwirkung von gammastrahlen |
| HUP0700433A2 (en) * | 2007-06-21 | 2009-03-30 | Avidin Kutato | Compounds influencing development or functioning of cellular vesicular systems particularly lipid droplets, pharmaceutical compositions containing these compounds and use them for treatment of illnesses |
| HUP0700432A2 (en) * | 2007-06-21 | 2009-03-30 | Avicor Kft | Compounds for detecting of lipid droplets, compositions for detecting of lipid droplets and method for visualization of cells or cell components |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3357942A (en) * | 1965-04-05 | 1967-12-12 | Eastman Kodak Co | Fire-retardant polycarbonates |
| US3873567A (en) * | 1968-09-05 | 1975-03-25 | Universal Oil Prod Co | N-substituted polybromoaromatic ortho-dicarboximides |
| US4374220A (en) * | 1968-09-18 | 1983-02-15 | Raychem Corporation | Imide flame retardants and compositions containing them |
| US4581396A (en) * | 1968-09-18 | 1986-04-08 | Raychem Corporation | Flame retardants and compositions containing them |
| GB1273071A (en) * | 1969-03-21 | 1972-05-03 | Hooker Chemical Corp | Fire retardant additive systems |
| AT297333B (de) * | 1969-06-13 | 1972-03-27 | Bayer Ag | Verfahren zur Herstellung von Polycarbonaten mit verminderter Brennbarkeit |
| US3632544A (en) * | 1970-05-07 | 1972-01-04 | Borg Warner | Self-extinguishing polymeric compositions |
| US3836490A (en) * | 1970-10-08 | 1974-09-17 | Bayer Ag | Flameproof polycarbonates containing an alkali metal salt soluble in the polycarbonate melt |
| US3828003A (en) * | 1970-10-26 | 1974-08-06 | Nippon Oils & Fats Co Ltd | Flame resistant polymer compositions |
| DE2265415C2 (de) * | 1971-09-24 | 1985-05-02 | Ethyl Corp., Richmond, Va. | Bis-5,6-dibromonorbornan-2,3-dicarboximide und deren Verwendung |
| US3784509A (en) * | 1971-09-24 | 1974-01-08 | Cities Service Co | Fire retardant compositions |
| DE2149311A1 (de) * | 1971-10-02 | 1973-04-05 | Bayer Ag | Flammwidrige polycarbonate |
| US3883476A (en) * | 1971-10-04 | 1975-05-13 | Ciba Geigy Corp | Pyromellitic diimides of 3,5-dialkyl-4-hydroxyphenylsubstituted amines |
| US3734926A (en) * | 1971-10-04 | 1973-05-22 | Ciba Geigy Corp | Benzophenone-3,4,3{40 ,4-tetracarboxylic acid diimides of 3,5-dialkyl-4-hydroxyphenylsubstituted amines |
| CA986522A (en) * | 1971-10-04 | 1976-03-30 | Ciba-Geigy Ag | Pyromellitic diimides of 3,5-dialkyl-4-hydroxyphenylsubstituted amines |
| US3821162A (en) * | 1971-10-04 | 1974-06-28 | Ciba Geigy Corp | Benzophenone-3,4,3,4-tetracarboxylic acid diimides of 3,5-dialkyl-4- hydroxyphenyl substituted amines |
| BE790385A (fr) * | 1971-11-01 | 1973-02-15 | Gen Electric | Perfectionnements aux compositions thermoplastiques a inflammation retardee, et aux procedes pour leur |
| US4056504A (en) * | 1974-08-16 | 1977-11-01 | Bayer Aktiengesellschaft | Polycarbonate molding compositions |
| US4208489A (en) * | 1977-01-29 | 1980-06-17 | Bayer Aktiengesellschaft | Polycarbonate molding compositions with improved flame-repellency |
| US4115333A (en) * | 1977-03-18 | 1978-09-19 | General Electric Company | Warp-resistant reinforced thermoplastic compositions comprising polyester resins and zinc stearate |
| DE2937877A1 (de) * | 1978-09-29 | 1980-04-17 | Mobay Chemical Corp | Flammwidrigesolycarbonat |
| US4339383A (en) * | 1979-07-11 | 1982-07-13 | Ciba-Geigy Corporation | Imide containing stabilizers for chlorinated thermoplastics |
| US4366276A (en) * | 1980-06-25 | 1982-12-28 | Bayer Aktiengesellschaft | Flame-resistant moulding materials based on thermoplastic aromatic polyesters and polyesters carbonates, a process for their production and their use in the production of moulded bodies |
| DE3203905A1 (de) * | 1982-02-05 | 1983-08-11 | Bayer Ag, 5090 Leverkusen | Polycarbonat-formmassen mit verbesserter flammwidrigkeit |
| CA1249095A (en) * | 1982-08-25 | 1989-01-17 | Giovanni Dozzi | Self-extinguishing polycarbonate composition |
| US4506047A (en) * | 1983-06-06 | 1985-03-19 | Mobay Chemical Corporation | Polycarbonate compositions having improved rigidity |
| DE3334822A1 (de) * | 1983-09-26 | 1985-04-04 | Bayer Ag, 5090 Leverkusen | Neue flammschutzmittel, ihre herstellung und ihre verwendung zur flammfestausruestung von polycarbonaten |
-
1984
- 1984-11-19 US US06/672,511 patent/US4673699A/en not_active Expired - Fee Related
-
1985
- 1985-04-09 CA CA000478677A patent/CA1256235A/en not_active Expired
- 1985-11-08 EP EP85114234A patent/EP0183107B1/en not_active Expired
- 1985-11-08 DE DE8585114234T patent/DE3569120D1/de not_active Expired
- 1985-11-18 JP JP60256826A patent/JPS61126167A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0183107B1 (en) | 1989-03-29 |
| US4673699A (en) | 1987-06-16 |
| CA1256235A (en) | 1989-06-20 |
| EP0183107A1 (en) | 1986-06-04 |
| JPH0423660B2 (enExample) | 1992-04-22 |
| JPS61126167A (ja) | 1986-06-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB8505441D0 (en) | Flame-retardant composition | |
| GB2083480B (en) | Flame retardant compositions | |
| GB2106523B (en) | Flame retardant polyester resin compositions | |
| JPS56110755A (en) | Flame retardant composition | |
| ZA902379B (en) | Flame retardant composition | |
| ZA902382B (en) | Flame retardant compositions | |
| GB8413929D0 (en) | Flame retardant compositions | |
| GB2085448B (en) | Flame retardant resin composition | |
| GB2186878B (en) | Flame retardant resin compositions | |
| DE3276759D1 (en) | Flame retardant polymer compositions | |
| EP0227912A3 (en) | Flame retardant polymer compositions | |
| ZA875335B (en) | Flame retardant compositions | |
| DE3571818D1 (en) | Flame retardant molded composition which incorporates a poly (styrene-co-n-phenylmaleimide-co-dibromostyrene) | |
| JPS5747342A (en) | Flame retardant resin composition | |
| GB8407229D0 (en) | Sizing compositions | |
| DE3566268D1 (en) | Flame resistant polycarbonate moulding compositions | |
| GB8823481D0 (en) | Flame retardant compositions | |
| DE3569120D1 (en) | Flame retardant molding compositions | |
| GB2180541B (en) | Flame retardant polymer compositions | |
| GB2085899B (en) | Flame retardant composition | |
| IE900017L (en) | Flame retardant compositions | |
| EP0410221A3 (en) | Flame retardant compositions | |
| GB2083481B (en) | Flame retardant compositions | |
| DE3568280D1 (en) | Flame-retardant resin composition | |
| GB2153832B (en) | Flame retardant polyolefin compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |