DE3341553A1 - Gasturbinentriebwerk mit einem teilchenabscheider - Google Patents
Gasturbinentriebwerk mit einem teilchenabscheiderInfo
- Publication number
- DE3341553A1 DE3341553A1 DE19833341553 DE3341553A DE3341553A1 DE 3341553 A1 DE3341553 A1 DE 3341553A1 DE 19833341553 DE19833341553 DE 19833341553 DE 3341553 A DE3341553 A DE 3341553A DE 3341553 A1 DE3341553 A1 DE 3341553A1
- Authority
- DE
- Germany
- Prior art keywords
- gas turbine
- vanes
- annular
- turbine engine
- foreign material
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- RLQJEEJISHYWON-UHFFFAOYSA-N flonicamid Chemical compound FC(F)(F)C1=CC=NC=C1C(=O)NCC#N RLQJEEJISHYWON-UHFFFAOYSA-N 0.000 title 1
- 239000000463 material Substances 0.000 claims description 41
- 239000002245 particle Substances 0.000 claims description 41
- 238000011144 upstream manufacturing Methods 0.000 claims description 31
- 238000004891 communication Methods 0.000 claims description 2
- 239000012530 fluid Substances 0.000 claims description 2
- 239000007789 gas Substances 0.000 description 14
- 230000000694 effects Effects 0.000 description 7
- 239000004576 sand Substances 0.000 description 6
- 230000007423 decrease Effects 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 230000001133 acceleration Effects 0.000 description 3
- 239000000428 dust Substances 0.000 description 3
- 230000000717 retained effect Effects 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 238000002485 combustion reaction Methods 0.000 description 2
- 230000003628 erosive effect Effects 0.000 description 2
- 239000000446 fuel Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 230000001154 acute effect Effects 0.000 description 1
- 239000000567 combustion gas Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- 230000001066 destructive effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000005293 physical law Methods 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F02—COMBUSTION ENGINES; HOT-GAS OR COMBUSTION-PRODUCT ENGINE PLANTS
- F02C—GAS-TURBINE PLANTS; AIR INTAKES FOR JET-PROPULSION PLANTS; CONTROLLING FUEL SUPPLY IN AIR-BREATHING JET-PROPULSION PLANTS
- F02C7/00—Features, components parts, details or accessories, not provided for in, or of interest apart form groups F02C1/00 - F02C6/00; Air intakes for jet-propulsion plants
- F02C7/04—Air intakes for gas-turbine plants or jet-propulsion plants
- F02C7/05—Air intakes for gas-turbine plants or jet-propulsion plants having provisions for obviating the penetration of damaging objects or particles
- F02C7/052—Air intakes for gas-turbine plants or jet-propulsion plants having provisions for obviating the penetration of damaging objects or particles with dust-separation devices
Landscapes
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Combustion & Propulsion (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Separating Particles In Gases By Inertia (AREA)
- Structures Of Non-Positive Displacement Pumps (AREA)
- Cyclones (AREA)
- Rotary Pumps (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/444,570 US4527387A (en) | 1982-11-26 | 1982-11-26 | Particle separator scroll vanes |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3341553A1 true DE3341553A1 (de) | 1984-05-30 |
| DE3341553C2 DE3341553C2 (enExample) | 1993-05-06 |
Family
ID=23765465
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19833341553 Granted DE3341553A1 (de) | 1982-11-26 | 1983-11-17 | Gasturbinentriebwerk mit einem teilchenabscheider |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4527387A (enExample) |
| JP (1) | JPS59108827A (enExample) |
| CA (1) | CA1219226A (enExample) |
| DE (1) | DE3341553A1 (enExample) |
| FR (1) | FR2536789B1 (enExample) |
| GB (2) | GB2131882B (enExample) |
| IL (1) | IL69905A (enExample) |
| IT (1) | IT1168298B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10215551A1 (de) * | 2002-04-09 | 2003-10-23 | Rolls Royce Deutschland | Turboprop-Flugzeugtriebwerk |
Families Citing this family (78)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2149017B (en) * | 1983-11-03 | 1988-01-27 | Gen Electric | Aircraft engine air intake including a foreign object separator |
| US4702071A (en) * | 1985-06-28 | 1987-10-27 | Rolls-Royce Plc | Inlet particle separator |
| US4867634A (en) * | 1986-05-09 | 1989-09-19 | Allied-Signal Inc. | Turbocharger turbine housing particulate debris trap |
| CH675146A5 (enExample) * | 1988-02-01 | 1990-08-31 | Asea Brown Boveri | |
| US4928480A (en) * | 1988-03-04 | 1990-05-29 | General Electric Company | Separator having multiple particle extraction passageways |
| US4860534A (en) * | 1988-08-24 | 1989-08-29 | General Motors Corporation | Inlet particle separator with anti-icing means |
| US5431535C1 (en) * | 1989-12-05 | 2001-01-09 | Boeing Co | Foreign matter diverter systems for turbofan engines |
| US5039317A (en) * | 1990-07-05 | 1991-08-13 | Allied-Signal Inc. | Radial inflow particle separation method and apparatus |
| US5137434A (en) * | 1990-10-04 | 1992-08-11 | Devilbiss Air Power Company | Universal motor oilless air compressor |
| JP3679183B2 (ja) * | 1996-01-31 | 2005-08-03 | 日本碍子株式会社 | ガス流路 |
| US6064987A (en) * | 1997-03-21 | 2000-05-16 | Walker Digital, Llc | Method and apparatus for providing and processing installment plans at a terminal |
| US5827043A (en) * | 1997-06-27 | 1998-10-27 | United Technologies Corporation | Coolable airfoil |
| RU2132959C1 (ru) * | 1998-04-14 | 1999-07-10 | Новицкий Сергей Михайлович | Сепаратор-отражатель посторонних предметов в наружный контур турбореактивного двухконтурного двигателя |
| FR2781010B1 (fr) * | 1998-07-09 | 2000-08-04 | Snecma | Pieges a particules pour turbomachine |
| US8876930B2 (en) * | 1999-11-23 | 2014-11-04 | Marina Ellen Marinella Pavlatos | Single/multiple guard(s)/cap(s) and/or screen(s) with engine attached chamber/manifold particle collector |
| WO2001037968A1 (en) * | 1999-11-23 | 2001-05-31 | Pavlatos Marina Ellen Marinell | Engine with upstream and rotationally attached guard |
| WO2001083297A2 (en) * | 2000-05-04 | 2001-11-08 | Jangshik Yun | Aircraft gas turbine engine having a centrifuge |
| RU2189474C1 (ru) * | 2000-12-27 | 2002-09-20 | Общество с ограниченной ответственностью "Проектно-конструкторское бюро "Энергия" | Способ подачи и отвода потока очищенного охлаждающего воздуха к турбогенератору |
| US6698180B2 (en) * | 2001-08-01 | 2004-03-02 | Rolls-Royce Corporation | Particle separator for a turbine engine |
| US6508052B1 (en) * | 2001-08-01 | 2003-01-21 | Rolls-Royce Corporation | Particle separator |
| US6991436B2 (en) * | 2002-07-29 | 2006-01-31 | Powermate Corporation | Air compressor mounted on a compressor tank |
| RU2242626C1 (ru) * | 2003-04-11 | 2004-12-20 | Федеральное государственное унитарное предприятие "Центральный институт авиационного моторостроения им. П.И. Баранова" | Пылезащитное устройство инерционного типа |
| US6969237B2 (en) * | 2003-08-28 | 2005-11-29 | United Technologies Corporation | Turbine airfoil cooling flow particle separator |
| DE102004061173B4 (de) * | 2004-12-16 | 2013-12-05 | Rolls-Royce Deutschland Ltd & Co Kg | Gasturbinentriebwerk mit einem Partikelseparator |
| GB0428205D0 (en) * | 2004-12-23 | 2005-06-01 | Rolls Royce Plc | Intake duct |
| EP1674694B1 (en) * | 2004-12-23 | 2014-02-12 | Rolls-Royce plc | Compressor intake duct |
| WO2007120162A2 (en) * | 2005-06-20 | 2007-10-25 | Rolls-Royce North American Technologies, Inc. | Particle separator for a gas turbine engine |
| EP1893857B1 (en) | 2005-06-20 | 2012-10-24 | Rolls-Royce North American Technologies, Inc. | Inertial particle separator |
| EP1893862B1 (en) * | 2005-06-20 | 2014-05-21 | Rolls-Royce North American Technologies, Inc. | Particle separators for gas turbine engines |
| RU2315879C2 (ru) * | 2006-02-26 | 2008-01-27 | Открытое акционерное общество "Авиадвигатель" | Турбореактивный двухконтурный двигатель сверхвысокой степени двухконтурности |
| US20080047425A1 (en) * | 2006-08-23 | 2008-02-28 | United Technologies Corporation | Mission adaptable inlet particle separator |
| US8539748B2 (en) * | 2006-12-15 | 2013-09-24 | General Electric Company | Segmented inertial particle separators and methods of assembling turbine engines |
| US7678165B2 (en) * | 2006-12-28 | 2010-03-16 | General Electric Company | Particle separator using boundary layer control |
| US7665965B1 (en) | 2007-01-17 | 2010-02-23 | Florida Turbine Technologies, Inc. | Turbine rotor disk with dirt particle separator |
| US10286407B2 (en) | 2007-11-29 | 2019-05-14 | General Electric Company | Inertial separator |
| US7927408B2 (en) * | 2007-11-30 | 2011-04-19 | Honeywell International Inc. | Inlet particle separator systems and methods |
| WO2010074934A1 (en) * | 2008-12-26 | 2010-07-01 | Rolls-Royce North American Technologies, Inc. | Inlet particle separator system for a gas turbine engine |
| RU2538350C2 (ru) * | 2009-10-16 | 2015-01-10 | Снекма | Воздухозаборник газотурбинного двигателя в гондоле |
| FR2951503B1 (fr) * | 2009-10-16 | 2011-11-18 | Snecma | Entree d air de moteur a turbine a gaz dans une nacelle |
| US8945254B2 (en) | 2011-12-21 | 2015-02-03 | General Electric Company | Gas turbine engine particle separator |
| US9314723B2 (en) | 2012-09-17 | 2016-04-19 | Honeywell International Inc. | Inlet particle separator systems and methods |
| US10184399B2 (en) | 2012-09-17 | 2019-01-22 | Honeywell International Inc. | Inlet particle separator systems and methods |
| US20140119903A1 (en) * | 2012-10-29 | 2014-05-01 | United Technologies Corporation | Gas Turbine Engine With Inlet Particle Separator and Thermal Management |
| US20140144123A1 (en) * | 2012-11-29 | 2014-05-29 | Honeywell International Inc. | Inlet particle separator system with air injection |
| US9067163B2 (en) | 2013-04-26 | 2015-06-30 | Hamilton Sundstrand Corporation | Particle separator |
| US9272293B2 (en) | 2013-04-29 | 2016-03-01 | Hamilton Sundstrand Corporation | Particle separator |
| US9638103B2 (en) * | 2013-07-26 | 2017-05-02 | Honeywell International Inc. | Plasma flow control inlet particle separator system |
| CA2859441C (en) * | 2013-08-16 | 2021-10-12 | Eric Loth | Particle separator |
| US9915176B2 (en) | 2014-05-29 | 2018-03-13 | General Electric Company | Shroud assembly for turbine engine |
| US10975731B2 (en) | 2014-05-29 | 2021-04-13 | General Electric Company | Turbine engine, components, and methods of cooling same |
| US11033845B2 (en) | 2014-05-29 | 2021-06-15 | General Electric Company | Turbine engine and particle separators therefore |
| CA2949547A1 (en) | 2014-05-29 | 2016-02-18 | General Electric Company | Turbine engine and particle separators therefore |
| RU2578789C2 (ru) * | 2014-08-25 | 2016-03-27 | Юрий Яковлевич Ситницкий | Способ улучшения сепарации посторонних предметов в привтулочной зоне вентилятора газотурбинного двигателя |
| US10167725B2 (en) | 2014-10-31 | 2019-01-01 | General Electric Company | Engine component for a turbine engine |
| US10036319B2 (en) | 2014-10-31 | 2018-07-31 | General Electric Company | Separator assembly for a gas turbine engine |
| RU2594832C1 (ru) * | 2015-02-05 | 2016-08-20 | Юрий Яковлевич Ситницкий | Способ удаления тяжелых частиц из воздушного потока в осевой ступени компрессора и устройство осевой ступени, удаляющей тяжелые частицы |
| FR3041036B1 (fr) * | 2015-09-10 | 2018-07-13 | Safran Helicopter Engines | Dispositif de piegeage de particules circulant dans une turbomachine et turbomachine equipee d'un tel dispositif. |
| US9988936B2 (en) | 2015-10-15 | 2018-06-05 | General Electric Company | Shroud assembly for a gas turbine engine |
| US10428664B2 (en) | 2015-10-15 | 2019-10-01 | General Electric Company | Nozzle for a gas turbine engine |
| US10138904B2 (en) | 2016-01-06 | 2018-11-27 | Honeywell International Inc. | Inlet particle separator system with high curvature hub |
| US10724436B2 (en) * | 2016-01-21 | 2020-07-28 | General Electric Company | Inlet particle separator for a turbine engine |
| RU2638235C2 (ru) * | 2016-04-25 | 2017-12-12 | Юрий Яковлевич Ситницкий | Способ и устройство для предотвращения прохода посторонних предметов во внутренний тракт вентиляторного газотурбинного двигателя |
| US10704425B2 (en) | 2016-07-14 | 2020-07-07 | General Electric Company | Assembly for a gas turbine engine |
| US10695704B2 (en) * | 2016-07-20 | 2020-06-30 | General Electric Company | Multi-station debris separation system |
| US10393021B2 (en) * | 2016-09-01 | 2019-08-27 | Rolls-Royce North American Technologies Inc. | Particle separator |
| US10265707B2 (en) | 2016-12-21 | 2019-04-23 | Hamilton Sundstrand Corporation | Motor cooling circuit with integrated FOD particle separator |
| US10913073B2 (en) | 2017-01-09 | 2021-02-09 | Lynntech, Inc. | Electrostatic enhancement of inlet particle separators for engines |
| US10513979B2 (en) * | 2017-01-24 | 2019-12-24 | General Electric Company | Asymmetric inlet particle separator system |
| RU2672196C2 (ru) * | 2017-04-06 | 2018-11-12 | Юрий Яковлевич Ситницкий | Устройство для удаления посторонних предметов из воздушного потока первой ступени осевого компрессора или привтулочной зоны вентиляторной ступени газотурбинного двигателя |
| RU2671256C1 (ru) * | 2017-09-28 | 2018-10-30 | Юрий Яковлевич Ситницкий | Воздухозаборное устройство для вертолетного газотурбинного двигателя, удаляющее из воздуха частицы песка, пыли и другие посторонние предметы |
| US10738699B2 (en) | 2018-01-19 | 2020-08-11 | Rolls-Royce North American Technologies Inc. | Air-inlet particle separator having a bleed surface |
| US11066996B2 (en) * | 2018-04-27 | 2021-07-20 | Pratt & Whitney Canada Corp. | Gas turbine engine with inertial particle separator |
| RU2725034C1 (ru) * | 2019-10-31 | 2020-06-29 | Юрий Яковлевич Ситницкий | Устройство для очистки воздуха от посторонних предметов в компрессоре двухконтурного турбореактивного двигателя |
| US11608782B2 (en) | 2020-04-15 | 2023-03-21 | Pratt & Whitney Canada Corp. | Axial inertial particle separator for turbine engine |
| JP7445553B2 (ja) * | 2020-07-22 | 2024-03-07 | 上田日本無線株式会社 | 気体センサ用気液分離器 |
| RU2752681C1 (ru) * | 2020-12-29 | 2021-07-29 | Акционерное общество "Объединенная двигателестроительная корпорация" (АО "ОДК") | Способ защиты газогенератора турбореактивного двухконтурного двигателя от попадания частиц пыли |
| RU2755550C1 (ru) * | 2021-02-12 | 2021-09-17 | Юрий Яковлевич Ситницкий | Воздухозаборное устройство вертолета |
| JP2023096761A (ja) | 2021-12-27 | 2023-07-07 | 川崎重工業株式会社 | ガスタービンエンジン |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3513641A (en) * | 1968-08-22 | 1970-05-26 | Boeing Co | Foreign particle separator for an air moving member |
| US3832086A (en) * | 1971-11-23 | 1974-08-27 | Gen Electric | Particle separator with scroll scavenging means |
| DE2629231A1 (de) * | 1975-02-20 | 1977-12-29 | Avco Corp | Gasturbinen-lufteinlaesse mit teilchen-separatoren |
| GB1544202A (en) * | 1975-05-23 | 1979-04-11 | Lucas Industries Ltd | Filter |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2802618A (en) * | 1953-06-29 | 1957-08-13 | Gen Motors Corp | Foreign object separator |
| GB1070458A (en) * | 1964-06-12 | 1967-06-01 | Boeing Co | Separator for removing foreign matter from a gas stream |
| US3362155A (en) * | 1965-03-29 | 1968-01-09 | Gen Electric | Axial flow separator |
| US3309867A (en) * | 1965-03-31 | 1967-03-21 | Gen Electric | Axial flow separator |
| US3338049A (en) * | 1966-02-01 | 1967-08-29 | Gen Electric | Gas turbine engine including separator for removing extraneous matter |
| GB1195973A (en) * | 1966-06-22 | 1970-06-24 | Rolls Royce | Air Intakes. |
| BE791726A (fr) * | 1971-11-23 | 1973-05-22 | Gen Electric | Separateur de particules avec dispositif de balayage en colimacon |
| US3970439A (en) * | 1973-10-15 | 1976-07-20 | Avco Corporation | Particle separator |
| US3979903A (en) * | 1974-08-01 | 1976-09-14 | General Electric Company | Gas turbine engine with booster stage |
| US4268284A (en) * | 1977-11-07 | 1981-05-19 | Avco Corporation | Multichannel particle separator of the anti-icing type |
| US4265646A (en) * | 1979-10-01 | 1981-05-05 | General Electric Company | Foreign particle separator system |
-
1982
- 1982-11-26 US US06/444,570 patent/US4527387A/en not_active Expired - Lifetime
-
1983
- 1983-09-15 GB GB08324759A patent/GB2131882B/en not_active Expired
- 1983-10-04 IL IL69905A patent/IL69905A/xx unknown
- 1983-10-13 CA CA000438948A patent/CA1219226A/en not_active Expired
- 1983-11-17 DE DE19833341553 patent/DE3341553A1/de active Granted
- 1983-11-21 IT IT23793/83A patent/IT1168298B/it active
- 1983-11-24 JP JP58219673A patent/JPS59108827A/ja active Granted
- 1983-11-25 FR FR838318799A patent/FR2536789B1/fr not_active Expired - Lifetime
-
1987
- 1987-03-18 GB GB08706359A patent/GB2186032B/en not_active Expired
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3513641A (en) * | 1968-08-22 | 1970-05-26 | Boeing Co | Foreign particle separator for an air moving member |
| US3832086A (en) * | 1971-11-23 | 1974-08-27 | Gen Electric | Particle separator with scroll scavenging means |
| DE2629231A1 (de) * | 1975-02-20 | 1977-12-29 | Avco Corp | Gasturbinen-lufteinlaesse mit teilchen-separatoren |
| GB1544202A (en) * | 1975-05-23 | 1979-04-11 | Lucas Industries Ltd | Filter |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10215551A1 (de) * | 2002-04-09 | 2003-10-23 | Rolls Royce Deutschland | Turboprop-Flugzeugtriebwerk |
| US6746207B1 (en) | 2002-04-09 | 2004-06-08 | Rolls-Royce Deutschland Ltd & Co Kg | Turboprop aircraft engine |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS59108827A (ja) | 1984-06-23 |
| IT1168298B (it) | 1987-05-20 |
| JPH0340215B2 (enExample) | 1991-06-18 |
| FR2536789B1 (fr) | 1990-11-23 |
| GB2131882B (en) | 1987-10-21 |
| DE3341553C2 (enExample) | 1993-05-06 |
| US4527387A (en) | 1985-07-09 |
| GB2131882A (en) | 1984-06-27 |
| IL69905A (en) | 1988-03-31 |
| GB8706359D0 (en) | 1987-04-23 |
| IT8323793A0 (it) | 1983-11-21 |
| CA1219226A (en) | 1987-03-17 |
| GB2186032B (en) | 1988-02-03 |
| GB2186032A (en) | 1987-08-05 |
| FR2536789A1 (fr) | 1984-06-01 |
| GB8324759D0 (en) | 1983-10-19 |
| IL69905A0 (en) | 1984-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3341553C2 (enExample) | ||
| DE60314446T2 (de) | Verfahren zur reinigung einer stationären gasturbineneinheit im betrieb | |
| DE2256972C2 (de) | Abscheider zum Entfernen von Fremdteilchen aus dem einem Gasturbinentriebwerk zugeführten Luftstrom | |
| DE3345957A1 (de) | Axialstroemungsabscheider | |
| DE69112216T2 (de) | Radialeinlassvorrichtung zur trennung von partikeln. | |
| DE2452526C2 (de) | Lufteinlaß für den Turboantrieb eines Luftfahrzeuges, insbesondere eines Hubschraubers | |
| DE2542765C2 (de) | Infrarotstrahlungsunterdrückungseinrichtung für ein Flugzeug-Gasturbinentriebwerk | |
| EP0019057B1 (de) | Fliehkraftstaubabscheidersystem mit mehreren Stufen | |
| DE2837036C2 (enExample) | ||
| DE2947737A1 (de) | Fluessigkeitsabscheider | |
| DE2644066C2 (de) | Beschaufelung für eine Strömungsarbeitsmaschine | |
| DE1291165B (de) | Fremdstoffabscheider fuer Gasturbinen | |
| DE2418398A1 (de) | Aggregat, vorzugsweise in reihenanordnung, von mit wirbelstroemung arbeitenden reinigern fuer luft und andere gase | |
| DE1301647B (de) | Abscheider zum Entfernen von Fremdstoffen aus dem einem Gasturbinentriebwerk zugefuehrten Luftstrom | |
| DE1601549A1 (de) | Gasturbinenanlage mit einem Abscheider zum Entfernen von Fremdkoerpern | |
| DE3611803A1 (de) | Flugzeug-triebwerkseinlauf | |
| DE3021349A1 (de) | Oeldichtungsanordnung fuer die welle eines turboladers | |
| DE19820097A1 (de) | Anordnung zur Grenzschichtabsaugung und Stoßgrenzschichtkontrolle für ein Flugzeug | |
| EP0178316A1 (de) | Fliehkraftabscheider. | |
| EP1488077A1 (de) | Gekühlte turbinenschaufel | |
| DE1902492A1 (de) | Trenneinrichtung | |
| DE112009000712T5 (de) | Haubenleitschaufeln eines Motorkühllüfters mit offenen Flügeln | |
| DE112012002923B4 (de) | Radialverdichter | |
| DE2629231A1 (de) | Gasturbinen-lufteinlaesse mit teilchen-separatoren | |
| DE102015111746A1 (de) | Gekühltes Turbinenlaufrad, insbesondere für ein Flugtriebwerk |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: VOIGT, R., DIPL.-ING., PAT.-ANW., 6232 BAD SODEN |
|
| D2 | Grant after examination | ||
| 8320 | Willingness to grant licences declared (paragraph 23) | ||
| 8364 | No opposition during term of opposition |