DE3305184C3 - - Google Patents
Info
- Publication number
- DE3305184C3 DE3305184C3 DE3305184C3 DE 3305184 C3 DE3305184 C3 DE 3305184C3 DE 3305184 C3 DE3305184 C3 DE 3305184C3
- Authority
- DE
- Germany
- Prior art keywords
- brake
- cast iron
- carbon
- less
- strength
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 229910001018 Cast iron Inorganic materials 0.000 claims description 6
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 5
- 229910052710 silicon Inorganic materials 0.000 claims description 5
- 239000010703 silicon Substances 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 4
- 229920002165 CarbonCast Polymers 0.000 claims description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 229910052698 phosphorus Inorganic materials 0.000 claims description 2
- 239000011574 phosphorus Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 229910001060 Gray iron Inorganic materials 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000005275 alloying Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910045601 alloy Inorganic materials 0.000 description 2
- 239000000956 alloy Substances 0.000 description 2
- 238000013016 damping Methods 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 230000008092 positive effect Effects 0.000 description 1
- 230000035882 stress Effects 0.000 description 1
- 230000008646 thermal stress Effects 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910000859 α-Fe Inorganic materials 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2928004C2 (enrdf_load_stackoverflow) | ||
| DE102007031927B4 (de) | Austenitische auf Eisen basierende Legierung | |
| DE60208099T2 (de) | Eisenbahnradlegierung | |
| DE3427740A1 (de) | Messinglegierung, herstellungsverfahren und verwendung | |
| DE3515198C2 (enrdf_load_stackoverflow) | ||
| DE10201218A1 (de) | Sphärogusslegierung | |
| WO2006056334A1 (de) | Sphärogusslegierung und verfahren zur herstellung von gussteilen aus der sphähogusslegierung | |
| DE3305184C2 (de) | Bremsenkörper ohne Naben | |
| DE3305184C3 (enrdf_load_stackoverflow) | ||
| DE2457719B2 (de) | Werkstoff für Schienenräder | |
| EP1152164B1 (de) | Bremsscheibe für Motorfahrzeuge sowie Stahllegierung und Verfahren zu ihrer Herstellung | |
| DE3509709A1 (de) | Verfahren zur herstellung eines zwischenstufenvergueteten gusseisenkoerpers mit kugelgraphit und der dabei erhaltene koerper | |
| EP1004789B1 (de) | Bremsscheibe für Nutzfahrzeuge | |
| DE102005001537B3 (de) | Gleitlagerverbundwerkstoff | |
| DE3000772C2 (de) | Zinnhaltige Aluminium-Lagerlegierung | |
| EP1992711B1 (de) | Gusseisenlegierung mit Lamellengraphit | |
| DE60001415T2 (de) | Cvt/ivt bestandteil | |
| DE202010011588U1 (de) | Träger und Bremssattel für eine Scheibenbremse | |
| DE3000773C2 (de) | Zinnhaltige Aluminium-Lagerlegierung | |
| DE20306253U1 (de) | ADI-Rad | |
| DE4444426A1 (de) | Radreifen-Stahl | |
| DE10064248A1 (de) | Graugusslegierung für ein Reibelement einer Reibungskupplung und Reibelement für eine Reibungskupplung | |
| DE3000775C2 (de) | Zinnhaltige Aluminium-Lagerlegierung | |
| EP2167829B1 (de) | Gleitlagerverbundwerkstoff | |
| DE3310374C2 (de) | Anwendung einer Glühbehandlung auf Gußeisen mit Lamellengraphit |