DE2641880C2 - - Google Patents
Info
- Publication number
- DE2641880C2 DE2641880C2 DE2641880A DE2641880A DE2641880C2 DE 2641880 C2 DE2641880 C2 DE 2641880C2 DE 2641880 A DE2641880 A DE 2641880A DE 2641880 A DE2641880 A DE 2641880A DE 2641880 C2 DE2641880 C2 DE 2641880C2
- Authority
- DE
- Germany
- Prior art keywords
- ceramic
- lamp
- lamp bulb
- auxiliary electrode
- cylindrical
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000919 ceramic Substances 0.000 claims description 31
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 12
- 229910052751 metal Inorganic materials 0.000 claims description 10
- 239000002184 metal Substances 0.000 claims description 10
- 229910052721 tungsten Inorganic materials 0.000 claims description 10
- 239000010937 tungsten Substances 0.000 claims description 10
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 7
- 150000002739 metals Chemical class 0.000 claims description 7
- 229910052750 molybdenum Inorganic materials 0.000 claims description 7
- 239000011733 molybdenum Substances 0.000 claims description 7
- 229910045601 alloy Inorganic materials 0.000 claims description 5
- 239000000956 alloy Substances 0.000 claims description 5
- 229910010293 ceramic material Inorganic materials 0.000 claims description 5
- 229910052702 rhenium Inorganic materials 0.000 claims description 5
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 claims description 5
- 239000000463 material Substances 0.000 description 14
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 11
- 229910052758 niobium Inorganic materials 0.000 description 10
- 239000010955 niobium Substances 0.000 description 10
- 230000004927 fusion Effects 0.000 description 7
- 239000011521 glass Substances 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 238000010276 construction Methods 0.000 description 5
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 230000008901 benefit Effects 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 3
- 239000003566 sealing material Substances 0.000 description 3
- 238000005245 sintering Methods 0.000 description 3
- 229910052715 tantalum Inorganic materials 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229910052724 xenon Inorganic materials 0.000 description 2
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 2
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229910020068 MgAl Inorganic materials 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- FQNGWRSKYZLJDK-UHFFFAOYSA-N [Ca].[Ba] Chemical compound [Ca].[Ba] FQNGWRSKYZLJDK-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004568 cement Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 238000007639 printing Methods 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 229910052594 sapphire Inorganic materials 0.000 description 1
- 239000010980 sapphire Substances 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 229910001023 sodium amalgam Inorganic materials 0.000 description 1
- 229910052596 spinel Inorganic materials 0.000 description 1
- 239000011029 spinel Substances 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- 229910003452 thorium oxide Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- PBYZMCDFOULPGH-UHFFFAOYSA-N tungstate Chemical compound [O-][W]([O-])(=O)=O PBYZMCDFOULPGH-UHFFFAOYSA-N 0.000 description 1
- 229910001845 yogo sapphire Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/36—Seals between parts of vessels; Seals for leading-in conductors; Leading-in conductors
- H01J61/366—Seals for leading-in conductors
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NLAANVRAGE7511415,A NL174103C (nl) | 1975-09-29 | 1975-09-29 | Elektrische ontladingslamp. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2641880A1 DE2641880A1 (de) | 1977-03-31 |
| DE2641880C2 true DE2641880C2 (OSRAM) | 1987-12-23 |
Family
ID=19824544
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762641880 Granted DE2641880A1 (de) | 1975-09-29 | 1976-09-17 | Elektrische entladungslampe |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4160930A (OSRAM) |
| JP (1) | JPS5242674A (OSRAM) |
| BE (1) | BE846637A (OSRAM) |
| CA (1) | CA1060525A (OSRAM) |
| DE (1) | DE2641880A1 (OSRAM) |
| FR (1) | FR2326034A1 (OSRAM) |
| GB (1) | GB1513700A (OSRAM) |
| HU (1) | HU181520B (OSRAM) |
| IT (1) | IT1072424B (OSRAM) |
| NL (1) | NL174103C (OSRAM) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4065691A (en) * | 1976-12-06 | 1977-12-27 | General Electric Company | Ceramic lamp having electrodes supported by crimped tubular inlead |
| DE2734099C3 (de) | 1977-07-28 | 1980-08-28 | Heimann Gmbh, 6200 Wiesbaden | Gasentladungslampe |
| US4437039A (en) | 1978-10-03 | 1984-03-13 | North American Philips Electric Corp. | Starting arrangement for high-intensity-discharge sodium lamp |
| NL8003216A (nl) * | 1980-06-03 | 1982-01-04 | Philips Nv | Hogedrukontladingslamp. |
| GB2105904B (en) * | 1981-09-04 | 1985-10-23 | Emi Plc Thorn | High pressure discharge lamps |
| HU185198B (en) * | 1982-01-28 | 1984-12-28 | Egyesuelt Izzolampa | Current inlet particularly for vacuumtechnical devices |
| DE3473087D1 (en) * | 1983-04-22 | 1988-09-01 | Philips Nv | High-pressure discharge lamp |
| GB2173943A (en) * | 1985-04-18 | 1986-10-22 | Noblelight Limited | Improvements in and relating to cathodes |
| DE3803227A1 (de) * | 1988-02-04 | 1989-08-17 | Hoechst Ceram Tec Ag | Verfahren zum vakuumdichten verschliessen eines keramikrohres |
| US5178808A (en) * | 1988-10-05 | 1993-01-12 | Makar Frank B | End seal manufacture for ceramic arc tubes |
| DE4127555A1 (de) * | 1991-08-20 | 1993-02-25 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Hochdruckentladungslampe |
| US5404078A (en) * | 1991-08-20 | 1995-04-04 | Patent-Treuhand-Gesellschaft Fur Elektrische Gluhlampen Mbh | High-pressure discharge lamp and method of manufacture |
| US5754005A (en) * | 1993-10-29 | 1998-05-19 | General Electric Company | Electric lamps containing electrical leads of a molybdenum and tungsten alloy |
| EP0751549B1 (en) * | 1995-01-13 | 2003-08-06 | Ngk Insulators, Ltd. | High pressure discharge lamp and production method thereof |
| RU2169410C1 (ru) * | 2000-01-21 | 2001-06-20 | Российский Федеральный Ядерный Центр - Всероссийский Научно-Исследовательский Институт Экспериментальной Физики | Электродный узел импульсного источника света |
| US6882109B2 (en) * | 2000-03-08 | 2005-04-19 | Japan Storage Battery Co., Ltd. | Electric discharge lamp |
| US6731066B2 (en) * | 2001-02-23 | 2004-05-04 | Osram Sylvania Inc. | Ceramic arc tube assembly |
| US6873108B2 (en) * | 2001-09-14 | 2005-03-29 | Osram Sylvania Inc. | Monolithic seal for a sapphire metal halide lamp |
| JP4454527B2 (ja) * | 2005-03-31 | 2010-04-21 | 日本碍子株式会社 | 発光管及び高圧放電灯 |
| GB0523478D0 (en) * | 2005-11-18 | 2005-12-28 | Lg Philips Displays B V | Improvements in and relating to electrodes |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE866371C (de) * | 1941-03-08 | 1953-02-09 | Patra Patent Treuhand | Verfahren zur Herstellung von Hochdruckentladungslampen aus Quarzglas |
| DE1093055B (de) * | 1956-05-31 | 1960-11-17 | Siemens Ag | Mehrfach-Metall-Glas-Metall-Einschmelzung |
| US3230410A (en) * | 1960-12-29 | 1966-01-18 | Gen Electric | Arc discharge device with triggering electrode |
| DE1246180B (de) * | 1962-12-14 | 1967-08-03 | Siemens Ag | Verfahren zur Herstellung von Metall-Glas-Verschmelzungen |
| GB1095712A (en) * | 1965-01-07 | 1967-12-20 | Gen Electric Co Ltd | Improvements in or relating to electric discharge devices having envelopes of high alumina content material |
| US3461334A (en) * | 1967-02-27 | 1969-08-12 | Westinghouse Electric Corp | Ceramic discharge lamp |
| DE2209848A1 (de) * | 1972-03-01 | 1973-09-06 | Patra Patent Treuhand | Vakuumdichter verschluss bei metalldampfhochdruckentladungslampen |
| NL165326C (nl) * | 1973-04-06 | 1981-03-16 | Egyesuelt Izzolampa | Gasontladingslamp. |
| NL174682C (nl) * | 1974-11-14 | 1985-01-16 | Philips Nv | Elektrische ontladingslamp. |
| NL7511416A (nl) * | 1975-09-29 | 1977-03-31 | Philips Nv | Elektrische ontladingslamp. |
| US4052636A (en) * | 1976-08-02 | 1977-10-04 | General Electric Company | High pressure sodium vapor lamp stabilized for pulse operation |
-
1975
- 1975-09-29 NL NLAANVRAGE7511415,A patent/NL174103C/xx not_active IP Right Cessation
-
1976
- 1976-09-16 US US05/723,743 patent/US4160930A/en not_active Expired - Lifetime
- 1976-09-17 DE DE19762641880 patent/DE2641880A1/de active Granted
- 1976-09-23 CA CA261,851A patent/CA1060525A/en not_active Expired
- 1976-09-24 IT IT27631/76A patent/IT1072424B/it active
- 1976-09-24 GB GB39788/76A patent/GB1513700A/en not_active Expired
- 1976-09-24 HU HU76PI540A patent/HU181520B/hu unknown
- 1976-09-27 BE BE170985A patent/BE846637A/xx not_active IP Right Cessation
- 1976-09-28 JP JP51115493A patent/JPS5242674A/ja active Granted
- 1976-09-29 FR FR7629232A patent/FR2326034A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB1513700A (en) | 1978-06-07 |
| NL174103C (nl) | 1984-04-16 |
| NL7511415A (nl) | 1977-03-31 |
| US4160930A (en) | 1979-07-10 |
| JPS5242674A (en) | 1977-04-02 |
| JPS5722188B2 (OSRAM) | 1982-05-12 |
| DE2641880A1 (de) | 1977-03-31 |
| IT1072424B (it) | 1985-04-10 |
| CA1060525A (en) | 1979-08-14 |
| FR2326034A1 (fr) | 1977-04-22 |
| HU181520B (en) | 1983-10-28 |
| FR2326034B1 (OSRAM) | 1982-01-15 |
| BE846637A (fr) | 1977-03-28 |
| NL174103B (nl) | 1983-11-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2641880C2 (OSRAM) | ||
| EP0602530B1 (de) | Verfahren zur Herstellung einer vakuumdichten Abdichtung für ein keramisches Entladungsgefäss und Entladungslampe | |
| DE69402848T2 (de) | Keramisches entladungsgefäss und verfahren zu dessen herstellung | |
| DE2548732C2 (de) | Elektrische Entladungslampe | |
| EP0371315B1 (de) | Entladungsgefäss für eine Hochdruckentladungslampe und Verfahren zu dessen Herstellung | |
| DE69600960T2 (de) | Hochdruckentladungslampe | |
| DE2951966C2 (de) | Hochdruck-Metalldampfentladungslampe | |
| DE69318638T2 (de) | Universelle Metallhalogenidlampe | |
| DE68911954T2 (de) | Elektrische Lampe. | |
| DE3789950T2 (de) | Keramischer Kolben für Hochdruckentladungslampe. | |
| DE2641867A1 (de) | Elektrische entladungslampe | |
| EP0602529A2 (de) | Hochdruckentladungslampe mit einem keramischen Entladungsgefäss | |
| DE1571502A1 (de) | Verfahren zum Verschliessen einer Roehre aus feuerfestem Oxid-Material | |
| DE69405181T2 (de) | Hochdruck-Entladungslampe | |
| DE68918480T2 (de) | Keramischer Kolben für Hochdruckentladungslampe und Verfahren zur Herstellung dieses Kolbens. | |
| EP1032022B1 (de) | Metallhalogenidlampe mit keramischem Entladungsgefäss | |
| DE69008957T2 (de) | Elektrische Lampe. | |
| DE2548301C3 (de) | Natriumdampf-Hochdrucklampe | |
| DE2307191A1 (de) | Hochdruck-gasentladungslampe | |
| DE2639478A1 (de) | Hochdruckgasentladungslampe | |
| DE3200699C2 (de) | Entladungsgefäß für Hochdruck-Natriumdampflampen | |
| DE2032277A1 (de) | Stromzuführungskonstruktion fur kera mische Entladungslampen | |
| DE102006024238A1 (de) | Hochdruckentladungslampe | |
| EP0722616A1 (de) | Metallhalogenidentladungslampe | |
| DE69707350T2 (de) | Elektrodenanordnung für Natrium-Hochdruckentladungslampe und deren Herstellungsverfahren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8380 | Miscellaneous part iii |
Free format text: DER VERTRETER IST NACHZUTRAGEN AUER, H., DIPL.-ING., PAT.-ANW., 2000 HAMBURG |
|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |