DE2603670A1 - Reaktivfarbstoffe - Google Patents
ReaktivfarbstoffeInfo
- Publication number
- DE2603670A1 DE2603670A1 DE19762603670 DE2603670A DE2603670A1 DE 2603670 A1 DE2603670 A1 DE 2603670A1 DE 19762603670 DE19762603670 DE 19762603670 DE 2603670 A DE2603670 A DE 2603670A DE 2603670 A1 DE2603670 A1 DE 2603670A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- methyl
- parts
- meaning given
- dyes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000003086 colorant Substances 0.000 title 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 20
- 239000000460 chlorine Substances 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 14
- 239000000975 dye Substances 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 150000002367 halogens Chemical group 0.000 claims description 10
- 239000000985 reactive dye Substances 0.000 claims description 8
- 238000004043 dyeing Methods 0.000 claims description 6
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- GOYNRDSJTYLXBU-UHFFFAOYSA-N 5-chloro-2,4,6-trifluoropyrimidine Chemical compound FC1=NC(F)=C(Cl)C(F)=N1 GOYNRDSJTYLXBU-UHFFFAOYSA-N 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 150000004985 diamines Chemical class 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical compound COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 claims description 2
- HFTXMVAEJHPHOH-UHFFFAOYSA-N methylperoxysulfonylformic acid Chemical class COOS(=O)(=O)C(=O)O HFTXMVAEJHPHOH-UHFFFAOYSA-N 0.000 claims description 2
- 125000004957 naphthylene group Chemical group 0.000 claims description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 claims 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- -1 aralkyl radicals Chemical class 0.000 description 14
- 239000011780 sodium chloride Substances 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 229920000742 Cotton Polymers 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 241001074085 Scophthalmus aquosus Species 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- MMNWSHJJPDXKCH-UHFFFAOYSA-N 9,10-dioxoanthracene-2-sulfonic acid Chemical compound C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 MMNWSHJJPDXKCH-UHFFFAOYSA-N 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 210000002268 wool Anatomy 0.000 description 3
- 239000001045 blue dye Substances 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- XAQCYASNAMYTQA-UHFFFAOYSA-N 2,4-diamino-5-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=C(N)C=C1N XAQCYASNAMYTQA-UHFFFAOYSA-N 0.000 description 1
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 1
- HEAHMJLHQCESBZ-UHFFFAOYSA-N 2,5-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(N)C(S(O)(=O)=O)=C1 HEAHMJLHQCESBZ-UHFFFAOYSA-N 0.000 description 1
- UONVFNLDGRWLKF-UHFFFAOYSA-N 2,5-diaminobenzoic acid Chemical compound NC1=CC=C(N)C(C(O)=O)=C1 UONVFNLDGRWLKF-UHFFFAOYSA-N 0.000 description 1
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 1
- UJJIPRCLIYLSHI-UHFFFAOYSA-N 2-[2-amino-5-[4-amino-3-(carboxymethoxy)phenyl]phenoxy]acetic acid Chemical compound C1=C(OCC(O)=O)C(N)=CC=C1C1=CC=C(N)C(OCC(O)=O)=C1 UJJIPRCLIYLSHI-UHFFFAOYSA-N 0.000 description 1
- IIQLVLWFQUUZII-UHFFFAOYSA-N 2-amino-5-(4-amino-3-carboxyphenyl)benzoic acid Chemical compound C1=C(C(O)=O)C(N)=CC=C1C1=CC=C(N)C(C(O)=O)=C1 IIQLVLWFQUUZII-UHFFFAOYSA-N 0.000 description 1
- FGQDYDZVRHQDIN-UHFFFAOYSA-N 2-amino-5-(4-aminophenyl)benzenesulfonic acid Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C(S(O)(=O)=O)=C1 FGQDYDZVRHQDIN-UHFFFAOYSA-N 0.000 description 1
- WMPOWTWJFGZRIG-UHFFFAOYSA-N 4,5,6-tribromotriazine Chemical compound BrC1=NN=NC(Br)=C1Br WMPOWTWJFGZRIG-UHFFFAOYSA-N 0.000 description 1
- LZKGFGLOQNSMBS-UHFFFAOYSA-N 4,5,6-trichlorotriazine Chemical compound ClC1=NN=NC(Cl)=C1Cl LZKGFGLOQNSMBS-UHFFFAOYSA-N 0.000 description 1
- HWFMYPFQBBWVPN-UHFFFAOYSA-N 4,8-diaminonaphthalene-2,6-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C(N)=CC(S(O)(=O)=O)=CC2=C1N HWFMYPFQBBWVPN-UHFFFAOYSA-N 0.000 description 1
- VAANUEHPYNAMQR-UHFFFAOYSA-N 5-amino-2-(4-aminophenyl)cyclohexa-2,4-diene-1,1-disulfonic acid Chemical compound OS(=O)(=O)C1(S(O)(=O)=O)CC(N)=CC=C1C1=CC=C(N)C=C1 VAANUEHPYNAMQR-UHFFFAOYSA-N 0.000 description 1
- CAPKHWMXDRXDIC-UHFFFAOYSA-N 5-amino-2-[2-(4-amino-2-sulfophenyl)ethyl]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1CCC1=CC=C(N)C=C1S(O)(=O)=O CAPKHWMXDRXDIC-UHFFFAOYSA-N 0.000 description 1
- REJHVSOVQBJEBF-OWOJBTEDSA-N 5-azaniumyl-2-[(e)-2-(4-azaniumyl-2-sulfonatophenyl)ethenyl]benzenesulfonate Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1\C=C\C1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-OWOJBTEDSA-N 0.000 description 1
- REJHVSOVQBJEBF-UHFFFAOYSA-N DSD-acid Natural products OS(=O)(=O)C1=CC(N)=CC=C1C=CC1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000012084 conversion product Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- VILFVXYKHXVYAB-UHFFFAOYSA-N naphthalene-2,7-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 VILFVXYKHXVYAB-UHFFFAOYSA-N 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/022—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring the heterocyclic ring being alternatively specified
- C09B62/024—Anthracene dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762603670 DE2603670A1 (de) | 1976-01-31 | 1976-01-31 | Reaktivfarbstoffe |
| GB316077A GB1514152A (en) | 1976-01-31 | 1977-01-26 | Reactive dyestuffs |
| CH102277A CH611329A5 (en) | 1976-01-31 | 1977-01-27 | Process for preparing reactive dyes |
| BR7700524A BR7700524A (pt) | 1976-01-31 | 1977-01-28 | Corantes reativos,processo para sua preparacao e seu emprego |
| JP789177A JPS5294325A (en) | 1976-01-31 | 1977-01-28 | Reactive dyes |
| ES455417A ES455417A1 (es) | 1976-01-31 | 1977-01-28 | Procedimiento para la obtencion de colorantes reactivos. |
| FR7702671A FR2339654A1 (fr) | 1976-01-31 | 1977-01-31 | Colorants reactifs, leur obtention et leur application |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762603670 DE2603670A1 (de) | 1976-01-31 | 1976-01-31 | Reaktivfarbstoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2603670A1 true DE2603670A1 (de) | 1977-08-04 |
Family
ID=5968703
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762603670 Withdrawn DE2603670A1 (de) | 1976-01-31 | 1976-01-31 | Reaktivfarbstoffe |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS5294325A (cg-RX-API-DMAC7.html) |
| BR (1) | BR7700524A (cg-RX-API-DMAC7.html) |
| CH (1) | CH611329A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2603670A1 (cg-RX-API-DMAC7.html) |
| ES (1) | ES455417A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2339654A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1514152A (cg-RX-API-DMAC7.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2817733A1 (de) * | 1978-04-22 | 1979-10-31 | Bayer Ag | Anthrachinon-reaktivfarbstoffe |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3027546A1 (de) | 1980-07-21 | 1982-02-18 | Bayer Ag, 5090 Leverkusen | Reaktivfaerbeverfahren |
| EP0097119A3 (de) * | 1982-06-11 | 1984-09-05 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| DE3918653C2 (de) * | 1988-06-14 | 2003-01-16 | Clariant Finance Bvi Ltd | Chromophore Verbindung mit heterocyclischem Reaktivrest |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE787122A (fr) * | 1971-08-04 | 1973-02-05 | Ciba Geigy | Composes azoiques, leur preparation et leur utilisation |
-
1976
- 1976-01-31 DE DE19762603670 patent/DE2603670A1/de not_active Withdrawn
-
1977
- 1977-01-26 GB GB316077A patent/GB1514152A/en not_active Expired
- 1977-01-27 CH CH102277A patent/CH611329A5/xx not_active IP Right Cessation
- 1977-01-28 JP JP789177A patent/JPS5294325A/ja active Pending
- 1977-01-28 BR BR7700524A patent/BR7700524A/pt unknown
- 1977-01-28 ES ES455417A patent/ES455417A1/es not_active Expired
- 1977-01-31 FR FR7702671A patent/FR2339654A1/fr active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2817733A1 (de) * | 1978-04-22 | 1979-10-31 | Bayer Ag | Anthrachinon-reaktivfarbstoffe |
Also Published As
| Publication number | Publication date |
|---|---|
| ES455417A1 (es) | 1977-12-16 |
| FR2339654B1 (cg-RX-API-DMAC7.html) | 1980-08-29 |
| BR7700524A (pt) | 1977-10-04 |
| CH611329A5 (en) | 1979-05-31 |
| JPS5294325A (en) | 1977-08-08 |
| GB1514152A (en) | 1978-06-14 |
| FR2339654A1 (fr) | 1977-08-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0048355A1 (de) | Wasserlösliche Disazoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe | |
| DE2842640A1 (de) | Reaktivfarbstoffe | |
| EP0065732B1 (de) | Wasserlösliche Disazoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe | |
| EP0357915B1 (de) | Disazoreaktivfarbstoffe | |
| DE2607028A1 (de) | Reaktivfarbstoffe | |
| DE2308857A1 (de) | Reaktivfarbstoffe | |
| DE2904124A1 (de) | Wasserloesliche, faserreaktive disazofarbstoffe, verfahren zu deren herstellung und ihre verwendung zum faerben und bedrucken von hydroxygruppen- und carbonamidgruppenhaltigen fasermaterialien | |
| DE2603670A1 (de) | Reaktivfarbstoffe | |
| EP0168703A2 (de) | Reaktivfarbstoffe | |
| EP0318785B1 (de) | Reaktivfarbstoffe | |
| EP0361186A2 (de) | Direktfarbstoffe | |
| EP0094019B1 (de) | Wasserlösliche Disazoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe | |
| DE2920949A1 (de) | Reaktivfarbstoffe | |
| EP0685480A1 (de) | Wasserlösliche Triphendioxazinverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe | |
| EP0076922B1 (de) | Wasserlösliche Disazoverbindungen und deren neue Kupplungskomponenten, Verfahren zu ihrer Herstellung und Verwendung der Disazoverbindungen als Farbstoffe | |
| DE2504868A1 (de) | Tetrakisazoverbindungen | |
| DE3039137C2 (cg-RX-API-DMAC7.html) | ||
| EP0377902A1 (de) | Reaktivfarbstoffe | |
| EP0125650B1 (de) | Reaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von Substraten | |
| CH637677A5 (de) | Reaktivfarbstoffe. | |
| DE3023855A1 (de) | Reaktivfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben und bedrucken hydroxylgruppenhaltiger oder stickstoffhaltiger fasermaterialien | |
| EP0235729B1 (de) | Reaktivfarbstoffe | |
| EP0026913B1 (de) | Kupferkomplex-Naphthylazonaphthyl-Verbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von Fasermaterialien und Leder | |
| EP0198350B1 (de) | Disazoreaktivfarbstoffe | |
| EP0037986B1 (de) | Verfahren zur Herstellung von Phthalocyaninfarbstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |