DE2453621A1 - Mittel zur flammfestausruestung von polyamid - Google Patents
Mittel zur flammfestausruestung von polyamidInfo
- Publication number
- DE2453621A1 DE2453621A1 DE19742453621 DE2453621A DE2453621A1 DE 2453621 A1 DE2453621 A1 DE 2453621A1 DE 19742453621 DE19742453621 DE 19742453621 DE 2453621 A DE2453621 A DE 2453621A DE 2453621 A1 DE2453621 A1 DE 2453621A1
- Authority
- DE
- Germany
- Prior art keywords
- polyamide
- flame retardant
- cyanuric acid
- flame
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000003063 flame retardant Substances 0.000 title claims description 50
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 title claims description 40
- 239000004952 Polyamide Substances 0.000 title claims description 23
- 229920002647 polyamide Polymers 0.000 title claims description 23
- -1 cyanuric acid compound Chemical class 0.000 claims description 43
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 claims description 26
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 239000004033 plastic Substances 0.000 claims description 3
- 229920003023 plastic Polymers 0.000 claims description 3
- ZLKYBXDNXFQYDL-UHFFFAOYSA-N 2,4,6-triethoxy-1,3,5-triazine Chemical compound CCOC1=NC(OCC)=NC(OCC)=N1 ZLKYBXDNXFQYDL-UHFFFAOYSA-N 0.000 claims description 2
- DFUGJTBMQKRCPI-UHFFFAOYSA-N 2,4,6-trimethoxy-1,3,5-triazine Chemical compound COC1=NC(OC)=NC(OC)=N1 DFUGJTBMQKRCPI-UHFFFAOYSA-N 0.000 claims description 2
- 239000007983 Tris buffer Substances 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- AHWDQDMGFXRVFB-UHFFFAOYSA-N 1,3,5-trimethyl-1,3,5-triazinane-2,4,6-trione Chemical compound CN1C(=O)N(C)C(=O)N(C)C1=O AHWDQDMGFXRVFB-UHFFFAOYSA-N 0.000 claims 1
- SNULTPQANPFFQH-UHFFFAOYSA-N 6-methoxy-1h-1,3,5-triazine-2,4-dione Chemical compound COC1=NC(=O)NC(=O)N1 SNULTPQANPFFQH-UHFFFAOYSA-N 0.000 claims 1
- 238000012360 testing method Methods 0.000 description 28
- 229920006122 polyamide resin Polymers 0.000 description 27
- 239000008187 granular material Substances 0.000 description 24
- 238000002485 combustion reaction Methods 0.000 description 17
- 229920002292 Nylon 6 Polymers 0.000 description 15
- 230000000694 effects Effects 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 11
- 230000000704 physical effect Effects 0.000 description 11
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 10
- 238000001746 injection moulding Methods 0.000 description 10
- 238000000465 moulding Methods 0.000 description 10
- 239000008188 pellet Substances 0.000 description 10
- 239000002253 acid Substances 0.000 description 7
- 230000000052 comparative effect Effects 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 7
- 239000002245 particle Substances 0.000 description 7
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 6
- 230000001771 impaired effect Effects 0.000 description 6
- 229920000642 polymer Polymers 0.000 description 6
- 239000000654 additive Substances 0.000 description 5
- 239000001361 adipic acid Substances 0.000 description 5
- 235000011037 adipic acid Nutrition 0.000 description 5
- 229920002302 Nylon 6,6 Polymers 0.000 description 4
- 230000000996 additive effect Effects 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 3
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 239000000314 lubricant Substances 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 239000011975 tartaric acid Substances 0.000 description 3
- 235000002906 tartaric acid Nutrition 0.000 description 3
- JHWNWJKBPDFINM-UHFFFAOYSA-N Laurolactam Chemical compound O=C1CCCCCCCCCCCN1 JHWNWJKBPDFINM-UHFFFAOYSA-N 0.000 description 2
- 239000004677 Nylon Substances 0.000 description 2
- 229920000299 Nylon 12 Polymers 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 230000000875 corresponding effect Effects 0.000 description 2
- 238000005520 cutting process Methods 0.000 description 2
- XLJMAIOERFSOGZ-UHFFFAOYSA-N cyanic acid Chemical compound OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 2
- 150000007973 cyanuric acids Chemical class 0.000 description 2
- 230000006735 deficit Effects 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 239000010419 fine particle Substances 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- LNTHITQWFMADLM-UHFFFAOYSA-N gallic acid Chemical compound OC(=O)C1=CC(O)=C(O)C(O)=C1 LNTHITQWFMADLM-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229920001778 nylon Polymers 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- WMRCTEPOPAZMMN-UHFFFAOYSA-N 2-undecylpropanedioic acid Chemical compound CCCCCCCCCCCC(C(O)=O)C(O)=O WMRCTEPOPAZMMN-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229920000572 Nylon 6/12 Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 241000519995 Stachys sylvatica Species 0.000 description 1
- 101150052863 THY1 gene Proteins 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 150000008431 aliphatic amides Chemical class 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- YSKUZVBSHIWEFK-UHFFFAOYSA-N ammelide Chemical compound NC1=NC(O)=NC(O)=N1 YSKUZVBSHIWEFK-UHFFFAOYSA-N 0.000 description 1
- MASBWURJQFFLOO-UHFFFAOYSA-N ammeline Chemical compound NC1=NC(N)=NC(O)=N1 MASBWURJQFFLOO-UHFFFAOYSA-N 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 150000001463 antimony compounds Chemical class 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- OHJMTUPIZMNBFR-UHFFFAOYSA-N biuret Chemical compound NC(=O)NC(N)=O OHJMTUPIZMNBFR-UHFFFAOYSA-N 0.000 description 1
- 238000000071 blow moulding Methods 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 239000000805 composite resin Substances 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000003912 environmental pollution Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- FEEPBTVZSYQUDP-UHFFFAOYSA-N heptatriacontanediamide Chemical compound NC(=O)CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC(N)=O FEEPBTVZSYQUDP-UHFFFAOYSA-N 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- WGOROJDSDNILMB-UHFFFAOYSA-N octatriacontanediamide Chemical compound NC(=O)CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC(N)=O WGOROJDSDNILMB-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000001932 seasonal effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000002341 toxic gas Substances 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea group Chemical group NC(=O)N XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000009941 weaving Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3467—Heterocyclic compounds having nitrogen in the ring having more than two nitrogen atoms in the ring
- C08K5/3477—Six-membered rings
- C08K5/3492—Triazines
- C08K5/34924—Triazines containing cyanurate groups; Tautomers thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP12708573A JPS5328185B2 (cg-RX-API-DMAC10.html) | 1973-11-12 | 1973-11-12 | |
| JP724174A JPS50105744A (cg-RX-API-DMAC10.html) | 1974-01-14 | 1974-01-14 | |
| JP11298674A JPS5139751A (ja) | 1974-10-01 | 1974-10-01 | Horiamidojushonannenkazai |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2453621A1 true DE2453621A1 (de) | 1975-05-15 |
Family
ID=27277522
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742453621 Ceased DE2453621A1 (de) | 1973-11-12 | 1974-11-12 | Mittel zur flammfestausruestung von polyamid |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3980616A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1039882A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2453621A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2250798B1 (cg-RX-API-DMAC10.html) |
| IT (1) | IT1030790B (cg-RX-API-DMAC10.html) |
| NL (1) | NL7414325A (cg-RX-API-DMAC10.html) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2727690A1 (de) * | 1976-06-21 | 1978-01-05 | Ici Ltd | Polyamidgrundmischung |
| DE2740092A1 (de) * | 1976-09-06 | 1978-03-16 | Mitsubishi Chem Ind | Polyamidharzmasse |
| DE4141861A1 (de) * | 1991-12-18 | 1993-06-24 | Du Pont Int | Flammwidrige polyamide |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1060705B (it) * | 1976-05-28 | 1982-08-20 | Montedison Spa | Composizioni polimeriche autoestinguenti |
| US4298518A (en) * | 1976-09-06 | 1981-11-03 | Mitsubishi Chemical Industries, Ltd. | Polyamide resin composition |
| IN146455B (cg-RX-API-DMAC10.html) * | 1976-09-15 | 1979-06-09 | Snia Viscosa | |
| JPS6033850B2 (ja) * | 1977-01-17 | 1985-08-05 | 日産化学工業株式会社 | 難燃性樹脂組成物 |
| US4383064A (en) * | 1977-03-03 | 1983-05-10 | Toray Industries, Inc. | Flame retardant polyamide composition |
| GB2003485B (en) * | 1977-08-30 | 1982-03-10 | Asahi Chemical Ind | Flame retardant resin composition comprising reaction product of polyguanamine compound and cyanuric or isocyanuric acid compound |
| US4263203A (en) * | 1978-05-09 | 1981-04-21 | Unitika Limited | Flame retardants for polyamides |
| DE3027617A1 (de) * | 1980-07-21 | 1982-02-18 | Bayer Ag, 5090 Leverkusen | Flammfeste polyamidformmassen |
| DE3027622A1 (de) * | 1980-07-21 | 1982-02-18 | Bayer Ag, 5090 Leverkusen | Flammfeste polyamidformmassen |
| JPS5796040A (en) * | 1980-12-08 | 1982-06-15 | Polyplastics Co | Polyester resin composition having resistance to discoloration by light (color fastness to light) |
| FR2523589A1 (fr) * | 1982-03-16 | 1983-09-23 | Inventa Ag | Matiere a mouler ignifuge en polyamide, son procede de preparation et produit actif retardateur de combustion |
| FR2564475B1 (fr) * | 1984-05-21 | 1986-11-28 | Atochem | Compositions a base de polyamides a combustibilite retardee |
| US5227416A (en) * | 1991-12-23 | 1993-07-13 | Ppg Industries, Inc. | Intumescent flame retardant composition |
| WO1996006672A1 (en) * | 1994-08-26 | 1996-03-07 | Us Sulfamate, Inc. | Molten urea dehydrate derived compositions |
| US5756571A (en) * | 1997-02-13 | 1998-05-26 | Agrinutrients Company, Inc. | Intumescent thermoplastic polyamide graft polymers |
| CA2356917A1 (en) | 1999-10-27 | 2001-05-03 | Kaneka Corporation | Extruded styrene resin foams and methods for producing the same |
| EP2285224B1 (en) | 2008-05-01 | 2015-07-29 | Lawrence Equipment, Inc. | Vacuum pressing platen assembly and method for adjustment |
| WO2010057851A1 (en) | 2008-11-24 | 2010-05-27 | Basf Se | Melamine phenylphosphinate flame retardant compositions |
| KR101602814B1 (ko) * | 2015-08-24 | 2016-03-22 | (주)디티알 | 고인장강도용 유리 섬유 강화 폴리아마이드66 수지 조성물 및 이의 제조방법 |
| CN109503969B (zh) * | 2018-11-27 | 2021-11-12 | 江苏万纳普新材料科技有限公司 | 一种尼龙直接注射成型用高效增强型阻燃导热遮光多功能母粒及其制备方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1694254C3 (de) * | 1968-03-16 | 1984-06-28 | Bayer Ag, 5090 Leverkusen | Selbstverlöschende faserverstärkte Polyamid-Formmassen |
| US3627737A (en) * | 1968-12-19 | 1971-12-14 | Monsanto Co | Filaments wet-spun from viscosity-stabilized aromatic polyamides |
| US3624252A (en) * | 1970-03-02 | 1971-11-30 | Dow Chemical Co | Triazine compounds |
| US3793289A (en) * | 1971-10-13 | 1974-02-19 | Allied Chem | Flame retardant nylon compositions |
| US3843650A (en) * | 1972-06-09 | 1974-10-22 | Dow Chemical Co | Tris-(polyhalophenoxy)-s-triazine |
| US3888822A (en) * | 1973-12-17 | 1975-06-10 | Allied Chem | Process for increasing flame resistance of nylon and resulting flame resistant nylon composition |
-
1974
- 1974-11-04 NL NL7414325A patent/NL7414325A/xx not_active Application Discontinuation
- 1974-11-06 CA CA213,179A patent/CA1039882A/en not_active Expired
- 1974-11-11 IT IT29269/74A patent/IT1030790B/it active
- 1974-11-12 US US05/523,043 patent/US3980616A/en not_active Expired - Lifetime
- 1974-11-12 DE DE19742453621 patent/DE2453621A1/de not_active Ceased
-
1975
- 1975-01-09 FR FR7500504A patent/FR2250798B1/fr not_active Expired
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2727690A1 (de) * | 1976-06-21 | 1978-01-05 | Ici Ltd | Polyamidgrundmischung |
| DE2740092A1 (de) * | 1976-09-06 | 1978-03-16 | Mitsubishi Chem Ind | Polyamidharzmasse |
| DE2740092B2 (de) | 1976-09-06 | 1980-05-08 | Mitsubishi Chemical Industries, Ltd., Tokio | Polyamidharzmasse |
| DE4141861A1 (de) * | 1991-12-18 | 1993-06-24 | Du Pont Int | Flammwidrige polyamide |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2250798B1 (cg-RX-API-DMAC10.html) | 1978-12-08 |
| FR2250798A1 (cg-RX-API-DMAC10.html) | 1975-06-06 |
| NL7414325A (nl) | 1975-05-14 |
| IT1030790B (it) | 1979-04-10 |
| CA1039882A (en) | 1978-10-03 |
| US3980616A (en) | 1976-09-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2453621A1 (de) | Mittel zur flammfestausruestung von polyamid | |
| EP0503421B1 (de) | Mit Carbodiimiden modifizierte Polyesterfasern und Verfahren zu ihrer Herstellung | |
| EP0417717B1 (de) | Mit Carbodiimiden modifizierte Polyesterfasern und Verfahren zu ihrer Herstellung | |
| DE69831796T2 (de) | Flammhemmende harzzusammensetzungen | |
| DE2221772C2 (de) | Entflammungshemmende, glasfaserverstärkte thermoplastische Polyester-Formmasse | |
| DE2545568C3 (de) | Flamm- und lichtbogenfeste Polyesterpreßmassen | |
| DE60000446T2 (de) | Flammgehemmte polyamid-zusammensetzung | |
| DE69834459T2 (de) | Flammgeschützte Polybutylenterephthalat-Zusammensetzung | |
| DE2459062A1 (de) | Glasfaserverstaerkte, flammwidrige, thermoplastische polyesterformmassen | |
| DE2158432B2 (de) | Verstärkte Polyalkylenterephthalatmassen mit verringerter Brennbarkeit | |
| DE2727690B2 (de) | Polyamidgemisch mit feuerhemmenden Additiven für die Weiterverarbeitung zu einer feuerhemmenden Polyamidmasse und dessen Verwendung | |
| EP2823018B1 (de) | Flammschutzmittelzusammensetzung für thermoplastische polymere bestehend aus porösem, amorphen glaspulver und melamincyanurat | |
| DE1694962A1 (de) | Verfahren zur Herstellung gefuellter Polyolefine | |
| DE2525513A1 (de) | Stabilisierte polyalkylenharz- gemische | |
| DE2249271A1 (de) | Feuerhemmende polyamidmassen | |
| DE2745906C2 (de) | Verfahren zur Herstellung einer gehärteten linearen aromatischen Polyestermasse | |
| EP0848035A1 (de) | Flammwidrige, ungesättigte Polyesterharze | |
| DE3208486C2 (de) | Flammfeste Polyamid-Formmasse und Verfahren zu ihrer Herstellung | |
| DE2837378C3 (de) | Flammwidrige Formmassen | |
| DE3722118C2 (cg-RX-API-DMAC10.html) | ||
| EP0970093B1 (de) | Aluminiumsalze von alkylhydroxymethylphosphinsäuren | |
| DE69123400T2 (de) | Flammfeste Polyolefinfasern und Folien | |
| EP0551850A1 (de) | Flammgeschützte thermoplastische Polyesterformmasse und ihre Verwendung | |
| DE2740728A1 (de) | Selbstverloeschende polymermaterialien und verfahren zur herstellung derselben | |
| DE4314853A1 (de) | Flammhemmende thermoplastische Kunststoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |