DE2358188A1 - Hochleistungslampe mit einem sockel zur bogenloeschung - Google Patents
Hochleistungslampe mit einem sockel zur bogenloeschungInfo
- Publication number
- DE2358188A1 DE2358188A1 DE2358188A DE2358188A DE2358188A1 DE 2358188 A1 DE2358188 A1 DE 2358188A1 DE 2358188 A DE2358188 A DE 2358188A DE 2358188 A DE2358188 A DE 2358188A DE 2358188 A1 DE2358188 A1 DE 2358188A1
- Authority
- DE
- Germany
- Prior art keywords
- sleeve
- base
- supply line
- extends
- lamp
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000010891 electric arc Methods 0.000 claims description 30
- 230000015556 catabolic process Effects 0.000 claims description 16
- 239000012212 insulator Substances 0.000 claims description 16
- 239000004020 conductor Substances 0.000 claims description 14
- 229910052751 metal Inorganic materials 0.000 claims description 9
- 239000002184 metal Substances 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 8
- 229910010293 ceramic material Inorganic materials 0.000 claims description 5
- 239000011810 insulating material Substances 0.000 claims 3
- 239000012774 insulation material Substances 0.000 claims 2
- 239000011521 glass Substances 0.000 description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 11
- 229910052708 sodium Inorganic materials 0.000 description 11
- 239000011734 sodium Substances 0.000 description 11
- 239000000919 ceramic Substances 0.000 description 6
- 238000003466 welding Methods 0.000 description 6
- 230000006378 damage Effects 0.000 description 5
- 229910052758 niobium Inorganic materials 0.000 description 5
- 239000010955 niobium Substances 0.000 description 5
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 239000005388 borosilicate glass Substances 0.000 description 3
- 238000005219 brazing Methods 0.000 description 3
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 3
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 3
- 239000000292 calcium oxide Substances 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 3
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 230000001066 destructive effect Effects 0.000 description 2
- 230000004907 flux Effects 0.000 description 2
- 239000005355 lead glass Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 239000010453 quartz Substances 0.000 description 2
- 238000007789 sealing Methods 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 238000005476 soldering Methods 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- 238000009423 ventilation Methods 0.000 description 2
- 229910052724 xenon Inorganic materials 0.000 description 2
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 2
- 229910000497 Amalgam Inorganic materials 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- 240000008168 Ficus benjamina Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 238000012550 audit Methods 0.000 description 1
- 239000006121 base glass Substances 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 210000002445 nipple Anatomy 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 239000011819 refractory material Substances 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 229910001023 sodium amalgam Inorganic materials 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/30—Vessels; Containers
- H01J61/34—Double-wall vessels or containers
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Common Detailed Techniques For Electron Tubes Or Discharge Tubes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00313556A US3849691A (en) | 1972-12-08 | 1972-12-08 | High intensity lamp containing arc extinguishing base |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2358188A1 true DE2358188A1 (de) | 1974-07-04 |
Family
ID=23216204
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2358188A Pending DE2358188A1 (de) | 1972-12-08 | 1973-11-22 | Hochleistungslampe mit einem sockel zur bogenloeschung |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3849691A (enExample) |
| JP (1) | JPS5648941B2 (enExample) |
| BE (1) | BE808356A (enExample) |
| BR (1) | BR7309573D0 (enExample) |
| DE (1) | DE2358188A1 (enExample) |
| FR (1) | FR2210011B1 (enExample) |
| GB (1) | GB1443018A (enExample) |
| NL (1) | NL7315789A (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4205258A (en) * | 1979-03-21 | 1980-05-27 | Westinghouse Electric Corp. | Internal shorting fuse for a high-intensity discharge lamp |
| US4382205A (en) * | 1980-09-02 | 1983-05-03 | General Electric Company | Metal vapor arc lamp having thermal link diminishable in heat conduction |
| GB2145557B (en) * | 1983-08-13 | 1987-05-07 | Emi Plc Thorn | Improvements in discharge lamps |
| AU557488B2 (en) * | 1984-05-04 | 1986-12-24 | Toshiba, Kabushiki Kaisha | High-pressure metal vapour discharge lamp |
| US5382869A (en) * | 1992-11-24 | 1995-01-17 | Osram Sylvania Inc. | Lamp base inner shell |
| JP3578662B2 (ja) * | 1999-05-21 | 2004-10-20 | 松下電器産業株式会社 | 管球の口金付け方法 |
| JP3324564B2 (ja) * | 1999-05-25 | 2002-09-17 | 松下電器産業株式会社 | 管球の製造方法 |
| GB2362257B (en) * | 2000-03-24 | 2005-01-05 | Advanced Lighting Tech Inc | System for supporting arc tubes in HID lamps |
| US20060279193A1 (en) * | 2003-05-21 | 2006-12-14 | Marien Leo Gustaaf J E | High-pressure discharge lamp |
| CN120769725A (zh) | 2022-12-15 | 2025-10-10 | 易思科波伊克斯公司 | 用于估算速度场的装置和方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL61607C (enExample) * | 1940-11-29 | |||
| US2888585A (en) * | 1956-08-30 | 1959-05-26 | Gen Electric | Arc tube mount |
| US3253179A (en) * | 1962-11-26 | 1966-05-24 | Gen Electric | Electric incandescent lamp and manufacture thereof |
| US3248590A (en) * | 1963-03-01 | 1966-04-26 | Gen Electric | High pressure sodium vapor lamp |
-
1972
- 1972-12-08 US US00313556A patent/US3849691A/en not_active Expired - Lifetime
-
1973
- 1973-11-16 NL NL7315789A patent/NL7315789A/xx not_active Application Discontinuation
- 1973-11-22 DE DE2358188A patent/DE2358188A1/de active Pending
- 1973-12-04 FR FR7343207A patent/FR2210011B1/fr not_active Expired
- 1973-12-05 BR BR9573/73A patent/BR7309573D0/pt unknown
- 1973-12-06 JP JP13575673A patent/JPS5648941B2/ja not_active Expired
- 1973-12-07 GB GB5688273A patent/GB1443018A/en not_active Expired
- 1973-12-07 BE BE138627A patent/BE808356A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5648941B2 (enExample) | 1981-11-18 |
| JPS4988378A (enExample) | 1974-08-23 |
| US3849691A (en) | 1974-11-19 |
| FR2210011B1 (enExample) | 1977-06-10 |
| NL7315789A (enExample) | 1974-06-11 |
| BE808356A (fr) | 1974-03-29 |
| BR7309573D0 (pt) | 1974-08-29 |
| FR2210011A1 (enExample) | 1974-07-05 |
| GB1443018A (en) | 1976-07-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3133642C2 (enExample) | ||
| DE19515479A1 (de) | Lampenanordnung mit einem Mantel und Isolator-Stützlagern | |
| DE1217496B (de) | Quecksilberdampf-Hochdruckentladungslampe mit Metallhalogen-Zusatz | |
| DE2261233A1 (de) | Hochdruckgasentladungslampe | |
| DE2641867A1 (de) | Elektrische entladungslampe | |
| DE60130204T2 (de) | Hochdruckentladungslampe | |
| DE3504058A1 (de) | Elektrodenfreie niederdruckgasentladungslampe | |
| DE2332274A1 (de) | Hochdruckgasentladungslampe | |
| DE2358188A1 (de) | Hochleistungslampe mit einem sockel zur bogenloeschung | |
| DE69405181T2 (de) | Hochdruck-Entladungslampe | |
| DE3015451C2 (de) | Metalldampfentladungslampe | |
| DE2625554C2 (de) | Wandstabilisierte Blitzröhre | |
| US3767965A (en) | High intensity lamp containing internal shorting fuse | |
| DE4008375A1 (de) | Hochdruckentladungslampe | |
| DE3200699A1 (de) | Entladungsgefaess fuer hochdruck-natriumdampflampen | |
| DE69020465T2 (de) | Einseitig gequetschte elektrische Metalldampfentladungslampe. | |
| DE3536385C2 (enExample) | ||
| DE2102112A1 (de) | Hochdruck Gasentladungslampe | |
| DE2753898A1 (de) | Hochintensive entladungslampe | |
| DE69303070T2 (de) | Hochdruckentladungslampe | |
| DE2105184A1 (de) | Hochdruckgasentladungslampe | |
| DE202010018034U1 (de) | Hochdruckentladungslampe | |
| DE69216916T2 (de) | Hochdruckentladungslampe | |
| DE2331905A1 (de) | Hochdruckgasentladungslampe | |
| DE2309690C3 (de) | Hochdruck-Entladungslampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |