DE2329691A1 - Wolfram-brom-zykluslampe - Google Patents
Wolfram-brom-zykluslampeInfo
- Publication number
- DE2329691A1 DE2329691A1 DE19732329691 DE2329691A DE2329691A1 DE 2329691 A1 DE2329691 A1 DE 2329691A1 DE 19732329691 DE19732329691 DE 19732329691 DE 2329691 A DE2329691 A DE 2329691A DE 2329691 A1 DE2329691 A1 DE 2329691A1
- Authority
- DE
- Germany
- Prior art keywords
- lamp
- boron
- bromine
- amount
- tungsten
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- CKQBSDUWDZEMJL-UHFFFAOYSA-N [W].[Br] Chemical compound [W].[Br] CKQBSDUWDZEMJL-UHFFFAOYSA-N 0.000 title claims description 11
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 33
- 229910052796 boron Inorganic materials 0.000 claims description 33
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 20
- 229910052794 bromium Inorganic materials 0.000 claims description 20
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 18
- 239000007789 gas Substances 0.000 claims description 14
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 9
- 239000007787 solid Substances 0.000 claims description 7
- 229910052721 tungsten Inorganic materials 0.000 claims description 7
- 239000010937 tungsten Substances 0.000 claims description 7
- 239000003039 volatile agent Substances 0.000 claims description 3
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical class BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 16
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 11
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 125000004429 atom Chemical group 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 6
- 239000001301 oxygen Substances 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 229910052786 argon Inorganic materials 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- -1 bromine hydrocarbon compound Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- BGECDVWSWDRFSP-UHFFFAOYSA-N borazine Chemical compound B1NBNBN1 BGECDVWSWDRFSP-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000000151 deposition Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 229910052743 krypton Inorganic materials 0.000 description 2
- DNNSSWSSYDEUBZ-UHFFFAOYSA-N krypton atom Chemical compound [Kr] DNNSSWSSYDEUBZ-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 229910052724 xenon Inorganic materials 0.000 description 2
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical class B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 150000001639 boron compounds Chemical class 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- AIGRXSNSLVJMEA-FQEVSTJZSA-N ethoxy-(4-nitrophenoxy)-phenyl-sulfanylidene-$l^{5}-phosphane Chemical compound O([P@@](=S)(OCC)C=1C=CC=CC=1)C1=CC=C([N+]([O-])=O)C=C1 AIGRXSNSLVJMEA-FQEVSTJZSA-N 0.000 description 1
- 238000005247 gettering Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000009972 noncorrosive effect Effects 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01K—ELECTRIC INCANDESCENT LAMPS
- H01K1/00—Details
- H01K1/50—Selection of substances for gas fillings; Specified pressure thereof
Landscapes
- Discharge Lamp (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7208874A NL7208874A (enExample) | 1972-06-28 | 1972-06-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2329691A1 true DE2329691A1 (de) | 1974-01-17 |
Family
ID=19816394
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732329691 Withdrawn DE2329691A1 (de) | 1972-06-28 | 1973-06-09 | Wolfram-brom-zykluslampe |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS552706B2 (enExample) |
| BE (1) | BE801467A (enExample) |
| DE (1) | DE2329691A1 (enExample) |
| FR (1) | FR2191264B1 (enExample) |
| GB (1) | GB1420111A (enExample) |
| IT (1) | IT989450B (enExample) |
| NL (1) | NL7208874A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS55149975U (enExample) * | 1979-04-13 | 1980-10-29 | ||
| JPS5911966Y2 (ja) * | 1979-11-30 | 1984-04-11 | 株式会社 泉井鉄工所 | 延縄の幹縄纏絡防止装置 |
-
1972
- 1972-06-28 NL NL7208874A patent/NL7208874A/xx not_active Application Discontinuation
-
1973
- 1973-06-09 DE DE19732329691 patent/DE2329691A1/de not_active Withdrawn
- 1973-06-25 JP JP7090473A patent/JPS552706B2/ja not_active Expired
- 1973-06-25 GB GB3003773A patent/GB1420111A/en not_active Expired
- 1973-06-25 IT IT2581173A patent/IT989450B/it active
- 1973-06-26 FR FR7323347A patent/FR2191264B1/fr not_active Expired
- 1973-06-26 BE BE132745A patent/BE801467A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4957685A (enExample) | 1974-06-04 |
| GB1420111A (en) | 1976-01-07 |
| FR2191264A1 (enExample) | 1974-02-01 |
| BE801467A (fr) | 1973-12-26 |
| FR2191264B1 (enExample) | 1976-11-12 |
| IT989450B (it) | 1975-05-20 |
| JPS552706B2 (enExample) | 1980-01-22 |
| NL7208874A (enExample) | 1974-01-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1764979A1 (de) | Quecksilber-Metallhalogenid-Dampflampe mit Regeneration | |
| DE3210809C2 (de) | Miniatur-Hochdruckentladungslampe | |
| DE2321358A1 (de) | Wolfram-brom-zyklus-lampe | |
| DE2329691A1 (de) | Wolfram-brom-zykluslampe | |
| DE1589266A1 (de) | Verfahren zur Herstellung von Gluehlampen mit Transportgasfuellung | |
| DE3110818A1 (de) | Bogenentladungslampe | |
| DE2447881A1 (de) | Halogengluehlampen mit einem fuellgas aus brom, chlor und wasserstoff | |
| DE2120471C3 (de) | Hochdruckentladungslampe mit Alkalihalogenid-Zusätzen und Getter | |
| DE2643749A1 (de) | Elektrische gluehlampe mit einem wolfram-brom-zyklus | |
| DE2134133C3 (de) | Halogen-Glühlampe | |
| DE1155098B (de) | Verfahren zur Gewinnung von reinstem Silicium | |
| DE2846816A1 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE1944870C3 (de) | Halogen-Glühlampe mit Regenerationszyklus | |
| DE1938955B2 (de) | Elektrische Gluehlampe | |
| DE2430695A1 (de) | Lampe mit differentieller leistungsabgabe | |
| DE2803122C2 (de) | Halogen-Glühlampe mit einem Bromkreislauf und Verfahren zu ihrer Herstellung | |
| DE1589146C (de) | Glühlampe | |
| DE2316554C3 (de) | Verfahren zur Herstellung von Halogenglühlampen | |
| DE1927967C3 (de) | Elektrische Glühlampe | |
| DE2303967A1 (de) | Elektrische gluehlampe mit wolframbrom-zyklus | |
| DE2303966A1 (de) | Elektrische gluehlampe mit wolframbrom-zyklus | |
| DE1927967B2 (de) | Elektrische gluehlampe | |
| DE611879C (de) | Gasgefuellte Metallfadenlampe | |
| DE1764954C3 (de) | Halogen-Glühlampe | |
| AT145076B (de) | Gasgefüllte elektrische Glühlampe mit wendelförmigem Glühkörper. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8139 | Disposal/non-payment of the annual fee |