DE2318062A1 - Elektrische entladungslampe - Google Patents
Elektrische entladungslampeInfo
- Publication number
- DE2318062A1 DE2318062A1 DE2318062A DE2318062A DE2318062A1 DE 2318062 A1 DE2318062 A1 DE 2318062A1 DE 2318062 A DE2318062 A DE 2318062A DE 2318062 A DE2318062 A DE 2318062A DE 2318062 A1 DE2318062 A1 DE 2318062A1
- Authority
- DE
- Germany
- Prior art keywords
- metal
- discharge
- lamp
- vapors
- sodium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000002184 metal Substances 0.000 claims description 19
- 229910052751 metal Inorganic materials 0.000 claims description 18
- 239000000919 ceramic Substances 0.000 claims description 12
- 239000000126 substance Substances 0.000 claims description 10
- 239000011248 coating agent Substances 0.000 claims description 8
- 238000000576 coating method Methods 0.000 claims description 8
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 239000000463 material Substances 0.000 claims description 6
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 5
- 229910052721 tungsten Inorganic materials 0.000 claims description 5
- 239000010937 tungsten Substances 0.000 claims description 5
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 3
- 239000013078 crystal Substances 0.000 claims description 3
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 3
- 229910052753 mercury Inorganic materials 0.000 claims description 3
- 229910052750 molybdenum Inorganic materials 0.000 claims description 3
- 239000011733 molybdenum Substances 0.000 claims description 3
- 150000002739 metals Chemical class 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims 2
- 229910001516 alkali metal iodide Inorganic materials 0.000 claims 2
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 229910052708 sodium Inorganic materials 0.000 description 13
- 239000011734 sodium Substances 0.000 description 13
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 12
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 12
- 239000011521 glass Substances 0.000 description 5
- 235000009518 sodium iodide Nutrition 0.000 description 4
- 229910001507 metal halide Inorganic materials 0.000 description 3
- 229910052758 niobium Inorganic materials 0.000 description 3
- 239000010955 niobium Substances 0.000 description 3
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 3
- 229910052594 sapphire Inorganic materials 0.000 description 3
- 239000010980 sapphire Substances 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 230000005540 biological transmission Effects 0.000 description 2
- 229910010293 ceramic material Inorganic materials 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000005309 metal halides Chemical class 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000010453 quartz Substances 0.000 description 2
- 238000007789 sealing Methods 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 230000016571 aggressive behavior Effects 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- VRAIHTAYLFXSJJ-UHFFFAOYSA-N alumane Chemical compound [AlH3].[AlH3] VRAIHTAYLFXSJJ-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 229910052574 oxide ceramic Inorganic materials 0.000 description 1
- 239000011224 oxide ceramic Substances 0.000 description 1
- 239000010979 ruby Substances 0.000 description 1
- 229910001750 ruby Inorganic materials 0.000 description 1
- -1 sodium halide Chemical class 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- CMJCEVKJYRZMIA-UHFFFAOYSA-M thallium(i) iodide Chemical compound [Tl]I CMJCEVKJYRZMIA-UHFFFAOYSA-M 0.000 description 1
- RMUKCGUDVKEQPL-UHFFFAOYSA-K triiodoindigane Chemical compound I[In](I)I RMUKCGUDVKEQPL-UHFFFAOYSA-K 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/18—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent
- H01J61/22—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent vapour of an alkali metal
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/36—Seals between parts of vessels; Seals for leading-in conductors; Leading-in conductors
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Glass Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUEE002023 | 1972-05-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2318062A1 true DE2318062A1 (de) | 1973-11-22 |
Family
ID=10995441
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2318062A Pending DE2318062A1 (de) | 1972-05-12 | 1973-04-06 | Elektrische entladungslampe |
Country Status (12)
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0602529A3 (de) * | 1992-12-14 | 1995-01-04 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Hochdruckentladungslampe mit einem keramischen Entladungsgefäss. |
| WO2005083744A3 (de) * | 2004-02-23 | 2006-02-16 | Lampen Mbh Patent Treuhand Ges | Elektrodensystem für eine hochdruckentladungslampe |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS51102379A (ja) * | 1975-03-07 | 1976-09-09 | Hitachi Ltd | Hodento |
| NL7612120A (nl) * | 1976-11-02 | 1978-05-05 | Philips Nv | Elektrische gasontladingslamp. |
| EP0074720B1 (en) * | 1981-09-15 | 1986-01-08 | THORN EMI plc | Discharge lamps |
| DE3211782A1 (de) * | 1982-03-30 | 1983-10-06 | Siemens Ag | Bad und verfahren zum anodisieren von aluminierten teilen |
-
1973
- 1973-03-28 CH CH447073A patent/CH559970A5/xx not_active IP Right Cessation
- 1973-03-28 ZA ZA732156A patent/ZA732156B/xx unknown
- 1973-04-05 IN IN803/CAL/73A patent/IN137781B/en unknown
- 1973-04-06 DE DE2318062A patent/DE2318062A1/de active Pending
- 1973-04-24 JP JP4658773A patent/JPS5347635B2/ja not_active Expired
- 1973-04-26 DD DD170453A patent/DD104152A5/xx unknown
- 1973-05-02 IT IT23617/73A patent/IT993557B/it active
- 1973-05-05 ES ES414454A patent/ES414454A1/es not_active Expired
- 1973-05-05 EG EG167/73A patent/EG11442A/xx active
- 1973-05-10 FR FR7317002A patent/FR2184693B1/fr not_active Expired
- 1973-05-10 NL NL7306537.A patent/NL166154C/xx not_active IP Right Cessation
- 1973-05-11 BR BR3454/73A patent/BR7303454D0/pt unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0602529A3 (de) * | 1992-12-14 | 1995-01-04 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Hochdruckentladungslampe mit einem keramischen Entladungsgefäss. |
| US5455480A (en) * | 1992-12-14 | 1995-10-03 | Patent-Treuhand-Gesellschaft F. Elektrische Gluehlampen Mbh | High-pressure discharge lamp with ceramic discharge vessel and ceramic sealing means having lead-through comprising thin wires having a thermal coefficient of expansion substantially less than that of the ceramic sealing means |
| WO2005083744A3 (de) * | 2004-02-23 | 2006-02-16 | Lampen Mbh Patent Treuhand Ges | Elektrodensystem für eine hochdruckentladungslampe |
Also Published As
| Publication number | Publication date |
|---|---|
| BR7303454D0 (pt) | 1974-07-11 |
| IN137781B (enrdf_load_stackoverflow) | 1975-09-20 |
| ZA732156B (en) | 1974-01-30 |
| FR2184693B1 (enrdf_load_stackoverflow) | 1977-04-29 |
| NL7306537A (enrdf_load_stackoverflow) | 1973-11-14 |
| ES414454A1 (es) | 1976-02-01 |
| JPS501574A (enrdf_load_stackoverflow) | 1975-01-09 |
| DD104152A5 (enrdf_load_stackoverflow) | 1974-02-20 |
| FR2184693A1 (enrdf_load_stackoverflow) | 1973-12-28 |
| CH559970A5 (enrdf_load_stackoverflow) | 1975-03-14 |
| NL166154C (nl) | 1981-06-15 |
| JPS5347635B2 (enrdf_load_stackoverflow) | 1978-12-22 |
| IT993557B (it) | 1975-09-30 |
| EG11442A (en) | 1978-06-30 |
| NL166154B (nl) | 1981-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69911878T2 (de) | Metallhalogenid lampe | |
| DE69504312T2 (de) | Elektrische lampe mit einer unterschicht zur erhöhung der lichtleistung einer lumineszierenden schicht | |
| DE69505783T2 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE2819407C3 (de) | Dichtungsmasse für Keramiken sowie Entladungsgerät unter Verwendung dieser Dichtungsmasse | |
| DE2023772C3 (de) | Metallhalogenidentladungslampe | |
| DE69921412T2 (de) | Hochdruck metallhalogenidlampe | |
| DE1764979A1 (de) | Quecksilber-Metallhalogenid-Dampflampe mit Regeneration | |
| DE3210809C2 (de) | Miniatur-Hochdruckentladungslampe | |
| DE1911985C3 (de) | Hochdruck-Bogenentladungslampe | |
| DE2318062A1 (de) | Elektrische entladungslampe | |
| DE2619674A1 (de) | Halogen-metalldampfentladungslampe | |
| DE720713C (de) | Verfahren zur Herstellung von Leuchtschirmen fuer elektrische Entladungsgefaesse | |
| DE2154712A1 (de) | Lampenanordnung mit Abdichtung Aluminiumdioxid-Metall | |
| DE2422576C3 (de) | Quecksilberdampflampe | |
| DE2550661C3 (de) | Quecksilberdampf - Hochdrucklampe | |
| DE2307192B2 (de) | Hochdruckentladungslampe | |
| DE838796C (de) | Gasentladungslampe | |
| DE7313608U (de) | Elektrische Entladungslampe | |
| DE2106447A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit einem Zusatz von Metallhalogeniden | |
| DE3733217C2 (enrdf_load_stackoverflow) | ||
| DE1949656A1 (de) | Verfahren zum Fuellen von ohne Saugrohr ausgebildeten Entladungsroehren | |
| WO1995010120A1 (de) | Metallhalogenidentladungslampe | |
| DE2535986A1 (de) | Elektrische hochdruck-entladungsroehre | |
| DE2402760A1 (de) | Metallhalogenid-hochdruckentladungslampe | |
| DE3404661A1 (de) | Hochdruck-metalldampflampe mit verbesserter farbwiedergabe |