DE2249457A1 - Bildaufnahmeroehre - Google Patents
BildaufnahmeroehreInfo
- Publication number
- DE2249457A1 DE2249457A1 DE2249457A DE2249457A DE2249457A1 DE 2249457 A1 DE2249457 A1 DE 2249457A1 DE 2249457 A DE2249457 A DE 2249457A DE 2249457 A DE2249457 A DE 2249457A DE 2249457 A1 DE2249457 A1 DE 2249457A1
- Authority
- DE
- Germany
- Prior art keywords
- layer
- aforementioned
- image pickup
- electrically conductive
- transparent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 210000005069 ears Anatomy 0.000 title 1
- 238000006243 chemical reaction Methods 0.000 claims description 23
- 238000010894 electron beam technology Methods 0.000 claims description 21
- 239000000463 material Substances 0.000 claims description 10
- UKUVVAMSXXBMRX-UHFFFAOYSA-N 2,4,5-trithia-1,3-diarsabicyclo[1.1.1]pentane Chemical compound S1[As]2S[As]1S2 UKUVVAMSXXBMRX-UHFFFAOYSA-N 0.000 claims description 9
- 229940052288 arsenic trisulfide Drugs 0.000 claims description 8
- KBJQPSPKRGXBTH-UHFFFAOYSA-L cadmium(2+);selenite Chemical compound [Cd+2].[O-][Se]([O-])=O KBJQPSPKRGXBTH-UHFFFAOYSA-L 0.000 claims description 5
- PFNQVRZLDWYSCW-UHFFFAOYSA-N (fluoren-9-ylideneamino) n-naphthalen-1-ylcarbamate Chemical compound C12=CC=CC=C2C2=CC=CC=C2C1=NOC(=O)NC1=CC=CC2=CC=CC=C12 PFNQVRZLDWYSCW-UHFFFAOYSA-N 0.000 claims description 2
- 239000005083 Zinc sulfide Substances 0.000 claims description 2
- 229940007424 antimony trisulfide Drugs 0.000 claims description 2
- NVWBARWTDVQPJD-UHFFFAOYSA-N antimony(3+);trisulfide Chemical compound [S-2].[S-2].[S-2].[Sb+3].[Sb+3] NVWBARWTDVQPJD-UHFFFAOYSA-N 0.000 claims description 2
- WBFMCDAQUDITAS-UHFFFAOYSA-N arsenic triselenide Chemical compound [Se]=[As][Se][As]=[Se] WBFMCDAQUDITAS-UHFFFAOYSA-N 0.000 claims description 2
- 238000009413 insulation Methods 0.000 claims description 2
- 230000002093 peripheral effect Effects 0.000 claims description 2
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 claims description 2
- UHYPYGJEEGLRJD-UHFFFAOYSA-N cadmium(2+);selenium(2-) Chemical compound [Se-2].[Cd+2] UHYPYGJEEGLRJD-UHFFFAOYSA-N 0.000 claims 1
- BYJADUSHMADYRW-UHFFFAOYSA-L cadmium(2+);sulfite Chemical compound [Cd+2].[O-]S([O-])=O BYJADUSHMADYRW-UHFFFAOYSA-L 0.000 claims 1
- PGWFQHBXMJMAPN-UHFFFAOYSA-N ctk4b5078 Chemical group [Cd].OS(=O)(=O)[Se]S(O)(=O)=O PGWFQHBXMJMAPN-UHFFFAOYSA-N 0.000 claims 1
- YBMRDBCBODYGJE-UHFFFAOYSA-N germanium oxide Inorganic materials O=[Ge]=O YBMRDBCBODYGJE-UHFFFAOYSA-N 0.000 claims 1
- PVADDRMAFCOOPC-UHFFFAOYSA-N oxogermanium Chemical compound [Ge]=O PVADDRMAFCOOPC-UHFFFAOYSA-N 0.000 claims 1
- XPDICGYEJXYUDW-UHFFFAOYSA-N tetraarsenic tetrasulfide Chemical compound S1[As]2S[As]3[As]1S[As]2S3 XPDICGYEJXYUDW-UHFFFAOYSA-N 0.000 claims 1
- 239000010410 layer Substances 0.000 description 118
- 239000002800 charge carrier Substances 0.000 description 24
- AQCDIIAORKRFCD-UHFFFAOYSA-N cadmium selenide Chemical compound [Cd]=[Se] AQCDIIAORKRFCD-UHFFFAOYSA-N 0.000 description 11
- 238000010276 construction Methods 0.000 description 8
- 230000005684 electric field Effects 0.000 description 5
- 230000007547 defect Effects 0.000 description 3
- 230000006870 function Effects 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 230000035945 sensitivity Effects 0.000 description 3
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 description 2
- 206010034972 Photosensitivity reaction Diseases 0.000 description 2
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 2
- 238000012217 deletion Methods 0.000 description 2
- 230000037430 deletion Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 230000036211 photosensitivity Effects 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 229940082569 selenite Drugs 0.000 description 2
- MCAHWIHFGHIESP-UHFFFAOYSA-L selenite(2-) Chemical compound [O-][Se]([O-])=O MCAHWIHFGHIESP-UHFFFAOYSA-L 0.000 description 2
- 150000003346 selenoethers Chemical class 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229910001887 tin oxide Inorganic materials 0.000 description 2
- QIHHYQWNYKOHEV-UHFFFAOYSA-N 4-tert-butyl-3-nitrobenzoic acid Chemical compound CC(C)(C)C1=CC=C(C(O)=O)C=C1[N+]([O-])=O QIHHYQWNYKOHEV-UHFFFAOYSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- 229910006404 SnO 2 Inorganic materials 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- CXKCTMHTOKXKQT-UHFFFAOYSA-N cadmium oxide Inorganic materials [Cd]=O CXKCTMHTOKXKQT-UHFFFAOYSA-N 0.000 description 1
- CFEAAQFZALKQPA-UHFFFAOYSA-N cadmium(2+);oxygen(2-) Chemical compound [O-2].[Cd+2] CFEAAQFZALKQPA-UHFFFAOYSA-N 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 210000002445 nipple Anatomy 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000005215 recombination Methods 0.000 description 1
- 230000006798 recombination Effects 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 1
- 230000003313 weakening effect Effects 0.000 description 1
- 229910052984 zinc sulfide Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J29/00—Details of cathode-ray tubes or of electron-beam tubes of the types covered by group H01J31/00
- H01J29/02—Electrodes; Screens; Mounting, supporting, spacing or insulating thereof
- H01J29/08—Electrodes intimately associated with a screen on or from which an image or pattern is formed, picked-up, converted or stored, e.g. backing-plates for storage tubes or collecting secondary electrons
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J29/00—Details of cathode-ray tubes or of electron-beam tubes of the types covered by group H01J31/00
- H01J29/02—Electrodes; Screens; Mounting, supporting, spacing or insulating thereof
- H01J29/10—Screens on or from which an image or pattern is formed, picked up, converted or stored
- H01J29/36—Photoelectric screens; Charge-storage screens
- H01J29/39—Charge-storage screens
- H01J29/45—Charge-storage screens exhibiting internal electric effects caused by electromagnetic radiation, e.g. photoconductive screen, photodielectric screen, photovoltaic screen
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J31/00—Cathode ray tubes; Electron beam tubes
- H01J31/08—Cathode ray tubes; Electron beam tubes having a screen on or from which an image or pattern is formed, picked up, converted, or stored
- H01J31/26—Image pick-up tubes having an input of visible light and electric output
- H01J31/28—Image pick-up tubes having an input of visible light and electric output with electron ray scanning the image screen
- H01J31/34—Image pick-up tubes having an input of visible light and electric output with electron ray scanning the image screen having regulation of screen potential at cathode potential, e.g. orthicon
- H01J31/38—Tubes with photoconductive screen, e.g. vidicon
Landscapes
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Image-Pickup Tubes, Image-Amplification Tubes, And Storage Tubes (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US289278A US3872344A (en) | 1972-09-15 | 1972-09-15 | Image pickup tube |
| GB4285472A GB1386687A (en) | 1972-09-15 | 1972-09-15 | Image pickup tube |
| FR7233275A FR2199616B1 (enExample) | 1972-09-15 | 1972-09-20 | |
| NL7212747A NL7212747A (enExample) | 1972-09-15 | 1972-09-21 | |
| DE2249457A DE2249457A1 (de) | 1972-09-15 | 1972-10-09 | Bildaufnahmeroehre |
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US289278A US3872344A (en) | 1972-09-15 | 1972-09-15 | Image pickup tube |
| GB4285472A GB1386687A (en) | 1972-09-15 | 1972-09-15 | Image pickup tube |
| FR7233275A FR2199616B1 (enExample) | 1972-09-15 | 1972-09-20 | |
| NL7212747A NL7212747A (enExample) | 1972-09-15 | 1972-09-21 | |
| DE2249457A DE2249457A1 (de) | 1972-09-15 | 1972-10-09 | Bildaufnahmeroehre |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2249457A1 true DE2249457A1 (de) | 1974-04-18 |
Family
ID=27510273
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2249457A Pending DE2249457A1 (de) | 1972-09-15 | 1972-10-09 | Bildaufnahmeroehre |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3872344A (enExample) |
| DE (1) | DE2249457A1 (enExample) |
| FR (1) | FR2199616B1 (enExample) |
| GB (1) | GB1386687A (enExample) |
| NL (1) | NL7212747A (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS60140636A (ja) * | 1983-12-28 | 1985-07-25 | Toshiba Corp | 撮像管の光導電タ−ゲツトおよびその製造方法 |
| NL8500500A (nl) * | 1985-02-22 | 1986-09-16 | Philips Nv | Kathodestraalbuis met een stigmator voor bundelfoutcorrectie. |
| JP2793618B2 (ja) * | 1989-02-03 | 1998-09-03 | 株式会社日立製作所 | 撮像管 |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2487665A (en) * | 1947-05-02 | 1949-11-08 | Rca Corp | Image tube |
| US2851625A (en) * | 1952-10-30 | 1958-09-09 | Rca Corp | Image tube |
| US2774002A (en) * | 1954-12-21 | 1956-12-11 | Itt | Image tube |
| US3020442A (en) * | 1959-05-11 | 1962-02-06 | Westinghouse Electric Corp | Photoconductive target |
| US3136909A (en) * | 1959-07-10 | 1964-06-09 | Rca Corp | Storage device having a photo-conductive target |
| US3155859A (en) * | 1961-02-09 | 1964-11-03 | Gen Electric | Target electrode assembly |
| NL275008A (enExample) * | 1961-02-21 | |||
| US3280357A (en) * | 1962-03-01 | 1966-10-18 | Rca Corp | Light sensitive device |
| NL292137A (enExample) * | 1962-04-30 | |||
| US3218505A (en) * | 1962-07-23 | 1965-11-16 | Hughes Aircraft Co | Moving target indicator tube having rectifying barrier target electrode |
| US3569763A (en) * | 1966-02-14 | 1971-03-09 | Tokyo Shibaura Electric Co | Multilayer photoconductive device having adjacent layers of different spectral response |
| US3571646A (en) * | 1967-07-17 | 1971-03-23 | Tokyo Shibaura Electric Co | Photoconductive target with n-type layer of cadmium selenide including cadmium chloride and cuprous chloride |
| GB1323747A (en) * | 1970-09-04 | 1973-07-18 | Magyar Tudommanyos Akademia Mu | Television camera tube targets |
| US3714488A (en) * | 1970-09-19 | 1973-01-30 | Matsushita Electronics Corp | Pick-up tube envelope sealant extending into groove of annular target support |
-
1972
- 1972-09-15 US US289278A patent/US3872344A/en not_active Expired - Lifetime
- 1972-09-15 GB GB4285472A patent/GB1386687A/en not_active Expired
- 1972-09-20 FR FR7233275A patent/FR2199616B1/fr not_active Expired
- 1972-09-21 NL NL7212747A patent/NL7212747A/xx unknown
- 1972-10-09 DE DE2249457A patent/DE2249457A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| GB1386687A (en) | 1975-03-12 |
| FR2199616A1 (enExample) | 1974-04-12 |
| US3872344A (en) | 1975-03-18 |
| NL7212747A (enExample) | 1974-03-25 |
| FR2199616B1 (enExample) | 1977-01-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3008858A1 (de) | Photoelektrischer wandler | |
| DE69325496T2 (de) | Bildaufrahmegerät und Verfahren zum Betrieb | |
| DE69525477T2 (de) | Flacher detektor für strahlungsabbildung mit reduzierten gespeicherten ladungen | |
| DE1439634C2 (de) | Kathodenstrahlspeicherröhre | |
| DE2129909C2 (de) | Kathodenstrahlspeicherröhre | |
| DE1295614B (de) | Speicherschirm fuer eine Bildaufnahmeroehre | |
| DE2935788C2 (de) | Fernsehaufnahmeröhre | |
| DE1474362A1 (de) | Einrichtung zur Speicherung von Informationen | |
| DE1564521B1 (de) | Speicherelektrode fuer eine Fernsehaufnahmeroehre | |
| DE1514472A1 (de) | Photoleitende Schicht und Verfahren zu ihrer Herstellung | |
| DE2249457A1 (de) | Bildaufnahmeroehre | |
| DE1240549B (de) | Verfahren zum Betrieb einer Bildaufnahmeroehre | |
| DE1261966B (de) | Photokathode fuer Bildverstaerker, Bildwandler oder Fernsehkameraroehren | |
| DE2031324A1 (de) | Photoempfindliche Halbleiteranordnung | |
| DE706872C (de) | Anordnung zur punktweisen Abtastung eines auf einer Bildelektrode mit elektronischer Halbleiterschicht gespeicherten Ladungsbildes | |
| DE1537148A1 (de) | Bildwandlerroehre | |
| DE1039661B (de) | Photoleitfaehige Einrichtung mit einer Schicht aus Antimontrisulfid | |
| DE2141233A1 (de) | Photoleiter | |
| DE1201865B (de) | Schirm fuer Fernsehaufnahmeroehren vom Vidicontyp | |
| DE2219453C3 (de) | Halbleiterspeicherelektrode einer Fernsehaufnahmeröhre einer Einröhren-Farbaufnahmekamera | |
| DE2053927C3 (de) | Aufnahmeröhre vom Vidicontyp mit einer photoleitenden Auftreffplatte | |
| DE1564521C (de) | Speicherelektrode für eine Fernseh aufnahmeröhre | |
| DE3013657C2 (enExample) | ||
| DE1952445U (de) | Bildaufnahmeroehre. | |
| DE910904C (de) | Speichernde Bildzerlegerroehre |