DE2149033B2 - Bogenentladungslampe hoher Intensität - Google Patents
Bogenentladungslampe hoher IntensitätInfo
- Publication number
- DE2149033B2 DE2149033B2 DE2149033A DE2149033A DE2149033B2 DE 2149033 B2 DE2149033 B2 DE 2149033B2 DE 2149033 A DE2149033 A DE 2149033A DE 2149033 A DE2149033 A DE 2149033A DE 2149033 B2 DE2149033 B2 DE 2149033B2
- Authority
- DE
- Germany
- Prior art keywords
- lamp
- tin
- electrode
- tungsten
- oxyhalide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000010891 electric arc Methods 0.000 title claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 42
- 239000001301 oxygen Substances 0.000 claims description 42
- 229910052760 oxygen Inorganic materials 0.000 claims description 42
- 239000000460 chlorine Substances 0.000 claims description 35
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 16
- 229910052801 chlorine Inorganic materials 0.000 claims description 16
- 229910052718 tin Inorganic materials 0.000 claims description 15
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 14
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 8
- 229910052740 iodine Inorganic materials 0.000 claims description 8
- 239000011630 iodine Substances 0.000 claims description 8
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 7
- 229910052753 mercury Inorganic materials 0.000 claims description 6
- JTDNNCYXCFHBGG-UHFFFAOYSA-L tin(ii) iodide Chemical compound I[Sn]I JTDNNCYXCFHBGG-UHFFFAOYSA-L 0.000 claims description 6
- 238000004140 cleaning Methods 0.000 claims description 5
- 238000011049 filling Methods 0.000 claims description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- 229910021626 Tin(II) chloride Inorganic materials 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 235000011150 stannous chloride Nutrition 0.000 claims description 3
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 claims description 3
- 239000011261 inert gas Substances 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- 229910052756 noble gas Inorganic materials 0.000 claims description 2
- 229910052709 silver Inorganic materials 0.000 claims description 2
- 239000004332 silver Substances 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- 101100322245 Caenorhabditis elegans des-2 gene Proteins 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 claims 1
- 230000003595 spectral effect Effects 0.000 claims 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 31
- 229910052721 tungsten Inorganic materials 0.000 description 29
- 239000010937 tungsten Substances 0.000 description 29
- 125000004429 atom Chemical group 0.000 description 16
- 238000000034 method Methods 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 13
- 230000008569 process Effects 0.000 description 13
- 230000015572 biosynthetic process Effects 0.000 description 11
- 238000009792 diffusion process Methods 0.000 description 6
- 230000009471 action Effects 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000000694 effects Effects 0.000 description 4
- 230000003628 erosive effect Effects 0.000 description 4
- OAAKZKGKPMPJIF-UHFFFAOYSA-N [Cl].[I] Chemical compound [Cl].[I] OAAKZKGKPMPJIF-UHFFFAOYSA-N 0.000 description 3
- 238000010494 dissociation reaction Methods 0.000 description 3
- 230000005593 dissociations Effects 0.000 description 3
- 230000033001 locomotion Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000010453 quartz Substances 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000010957 pewter Substances 0.000 description 2
- 229910000498 pewter Inorganic materials 0.000 description 2
- 238000009877 rendering Methods 0.000 description 2
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 2
- 229910003452 thorium oxide Inorganic materials 0.000 description 2
- -1 tin halide Chemical class 0.000 description 2
- 235000007487 Calathea allouia Nutrition 0.000 description 1
- 244000278792 Calathea allouia Species 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- WTBLSNWIUUXYIC-UHFFFAOYSA-N [Cl+].[Sn+2] Chemical compound [Cl+].[Sn+2] WTBLSNWIUUXYIC-UHFFFAOYSA-N 0.000 description 1
- TVFFCXRJSYKOAX-UHFFFAOYSA-M [W+](=O)=O.[Cl-] Chemical compound [W+](=O)=O.[Cl-] TVFFCXRJSYKOAX-UHFFFAOYSA-M 0.000 description 1
- NGGAZZRRNNMLNA-UHFFFAOYSA-N [W].ClOOCl Chemical compound [W].ClOOCl NGGAZZRRNNMLNA-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 1
- UDJQAOMQLIIJIE-UHFFFAOYSA-L dichlorotungsten Chemical compound Cl[W]Cl UDJQAOMQLIIJIE-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 238000005247 gettering Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QGLKJKCYBOYXKC-UHFFFAOYSA-N nonaoxidotritungsten Chemical compound O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 QGLKJKCYBOYXKC-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000004544 sputter deposition Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 238000012932 thermodynamic analysis Methods 0.000 description 1
- IUTCEZPPWBHGIX-UHFFFAOYSA-N tin(2+) Chemical compound [Sn+2] IUTCEZPPWBHGIX-UHFFFAOYSA-N 0.000 description 1
- NXHILIPIEUBEPD-UHFFFAOYSA-H tungsten hexafluoride Chemical compound F[W](F)(F)(F)(F)F NXHILIPIEUBEPD-UHFFFAOYSA-H 0.000 description 1
- 229910001930 tungsten oxide Inorganic materials 0.000 description 1
- 238000009834 vaporization Methods 0.000 description 1
- 230000008016 vaporization Effects 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/18—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent
Landscapes
- Discharge Lamp (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US078484A US3882343A (en) | 1970-10-06 | 1970-10-06 | Tin chloride molecular radiation lamp |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2149033A1 DE2149033A1 (de) | 1972-04-13 |
| DE2149033B2 true DE2149033B2 (de) | 1975-09-18 |
Family
ID=22144312
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2149033A Pending DE2149033B2 (de) | 1970-10-06 | 1971-10-01 | Bogenentladungslampe hoher Intensität |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3882343A (enExample) |
| JP (1) | JPS5219034B1 (enExample) |
| BE (1) | BE773499A (enExample) |
| DE (1) | DE2149033B2 (enExample) |
| FR (1) | FR2111056A5 (enExample) |
| GB (1) | GB1360677A (enExample) |
| IT (1) | IT938945B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2195063A2 (en) * | 1972-08-02 | 1974-03-01 | Gen Electric | Mercury vapour discharge lamp - contg. stannous bromide to improve colour warmth |
| GB2133925B (en) * | 1982-12-29 | 1987-02-18 | Gen Electric | Control of radial distributions in high intensity discharge lamps |
| TW385479B (en) * | 1998-04-08 | 2000-03-21 | Koninkl Philips Electronics Nv | Metal-halide lamp |
| KR20010037340A (ko) | 1999-10-15 | 2001-05-07 | 구자홍 | 요오드화주석을 사용한 무전극램프 |
| WO2008032247A1 (en) * | 2006-09-12 | 2008-03-20 | Koninklijke Philips Electronics N.V. | Lamp comprising a conductor embedded in the quartz glass envelope of the lamp |
| US20090146571A1 (en) * | 2007-12-06 | 2009-06-11 | Russell Timothy D | Metal halide lamp with halogen-promoted wall cleaning cycle |
| WO2016193694A2 (en) * | 2015-05-29 | 2016-12-08 | Hanovia Limited | Mercury-free gas discharge lamp |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3279877A (en) * | 1963-12-31 | 1966-10-18 | Westinghouse Electric Corp | Method for processing high-pressure vapor-discharge arc tube |
| US3566178A (en) * | 1968-12-11 | 1971-02-23 | Tokyo Shibaura Electric Co | High pressure discharge lamp containing an inert gas,mercury,a halogen and tin |
| US3586898A (en) * | 1969-05-19 | 1971-06-22 | Gen Electric | Aluminum chloride discharge lamp |
-
1970
- 1970-10-06 US US078484A patent/US3882343A/en not_active Expired - Lifetime
-
1971
- 1971-09-15 GB GB4309871A patent/GB1360677A/en not_active Expired
- 1971-10-01 DE DE2149033A patent/DE2149033B2/de active Pending
- 1971-10-01 JP JP46076380A patent/JPS5219034B1/ja active Pending
- 1971-10-05 IT IT29506/71A patent/IT938945B/it active
- 1971-10-05 BE BE773499A patent/BE773499A/xx unknown
- 1971-10-06 FR FR7135987A patent/FR2111056A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2149033A1 (de) | 1972-04-13 |
| GB1360677A (en) | 1974-07-17 |
| FR2111056A5 (enExample) | 1972-06-02 |
| JPS5219034B1 (enExample) | 1977-05-25 |
| US3882343A (en) | 1975-05-06 |
| BE773499A (fr) | 1972-04-05 |
| IT938945B (it) | 1973-02-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2455277C2 (de) | Hochdruck-Zinnhalogenidentladungslampe | |
| DE3042291C2 (de) | Hochdruck-Metallhalogenid-Entladungslampe | |
| DE3006846C2 (enExample) | ||
| DE2625954A1 (de) | Niederdruckquecksilberdampfentladungslampe und verfahren zu ihrer herstellung | |
| DE2707295C3 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE1764979A1 (de) | Quecksilber-Metallhalogenid-Dampflampe mit Regeneration | |
| DE2023772B2 (de) | Metallhalogenidentladungslampe | |
| DE1911985C3 (de) | Hochdruck-Bogenentladungslampe | |
| DE2225308C3 (de) | Hochdruckgasentladungslampe | |
| DE2422411A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE2149033B2 (de) | Bogenentladungslampe hoher Intensität | |
| DE2550661C3 (de) | Quecksilberdampf - Hochdrucklampe | |
| DE2422576C3 (de) | Quecksilberdampflampe | |
| DE2408572A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE1089479B (de) | Elektrische Edelgas-Hochdruck-Entladungslampe | |
| DE2028781A1 (de) | Hochdruck-Quecksilberdampf Jodid-Entladungslampe | |
| DE2402760C3 (de) | Hochdruck-Entladungslampe | |
| DE2120471B2 (de) | Hochdruckentladungslampe mit Alkalihalogenid-Zusätzen und Getter | |
| DE2023770C3 (de) | Hochleistungsbogenlampe | |
| DE2605290C2 (de) | Hochdruck-Entladungslampe | |
| DE2430695C3 (de) | Halogenglühlampe mit diff erenter Leistungsgabe | |
| DE1938955B2 (de) | Elektrische Gluehlampe | |
| DE656524C (de) | Photoelektrische Zelle mit aeusserem lichtelektrischem Effekt | |
| DE2546417C3 (de) | Quecksilberdampf-Entladungslampe mit Metallhalogenidzusätzen | |
| DE2738204C3 (de) | Verfahren zur Herstellung von Hochdruck-Entladungslampen |