DE2028730A1 - Wegzuwerfendes klinisches Thermometer - Google Patents
Wegzuwerfendes klinisches ThermometerInfo
- Publication number
- DE2028730A1 DE2028730A1 DE19702028730 DE2028730A DE2028730A1 DE 2028730 A1 DE2028730 A1 DE 2028730A1 DE 19702028730 DE19702028730 DE 19702028730 DE 2028730 A DE2028730 A DE 2028730A DE 2028730 A1 DE2028730 A1 DE 2028730A1
- Authority
- DE
- Germany
- Prior art keywords
- temperature
- elements
- temperature display
- thermometer
- thermometer according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000576 coating method Methods 0.000 claims description 12
- 239000011248 coating agent Substances 0.000 claims description 9
- 239000011368 organic material Substances 0.000 claims description 7
- 229920000298 Cellophane Polymers 0.000 claims description 4
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 239000000463 material Substances 0.000 description 4
- -1 1,6 hexanediol 3,4 dichlorobenzaldehyde Chemical compound 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- SATCULPHIDQDRE-UHFFFAOYSA-N piperonal Chemical compound O=CC1=CC=C2OCOC2=C1 SATCULPHIDQDRE-UHFFFAOYSA-N 0.000 description 2
- NOOLISFMXDJSKH-UTLUCORTSA-N (+)-Neomenthol Chemical compound CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1O NOOLISFMXDJSKH-UTLUCORTSA-N 0.000 description 1
- HJIAMFHSAAEUKR-UHFFFAOYSA-N (2-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC=CC=C1C(=O)C1=CC=CC=C1 HJIAMFHSAAEUKR-UHFFFAOYSA-N 0.000 description 1
- BXCBUWKTXLWPSB-UHFFFAOYSA-N 1-(chloromethyl)-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1CCl BXCBUWKTXLWPSB-UHFFFAOYSA-N 0.000 description 1
- ORPVVAKYSXQCJI-UHFFFAOYSA-N 1-bromo-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1Br ORPVVAKYSXQCJI-UHFFFAOYSA-N 0.000 description 1
- WTTWSMJHJFNCQB-UHFFFAOYSA-N 2-(dibenzylamino)ethanol Chemical compound C=1C=CC=CC=1CN(CCO)CC1=CC=CC=C1 WTTWSMJHJFNCQB-UHFFFAOYSA-N 0.000 description 1
- QBLISOIWPZSVIK-UHFFFAOYSA-N 4-bromobutoxybenzene Chemical compound BrCCCCOC1=CC=CC=C1 QBLISOIWPZSVIK-UHFFFAOYSA-N 0.000 description 1
- SCRBSGZBTHKAHU-UHFFFAOYSA-N 4-bromoisoquinoline Chemical compound C1=CC=C2C(Br)=CN=CC2=C1 SCRBSGZBTHKAHU-UHFFFAOYSA-N 0.000 description 1
- MQWCXKGKQLNYQG-UHFFFAOYSA-N 4-methylcyclohexan-1-ol Chemical compound CC1CCC(O)CC1 MQWCXKGKQLNYQG-UHFFFAOYSA-N 0.000 description 1
- 229920002799 BoPET Polymers 0.000 description 1
- NOOLISFMXDJSKH-UHFFFAOYSA-N DL-menthol Natural products CC(C)C1CCC(C)CC1O NOOLISFMXDJSKH-UHFFFAOYSA-N 0.000 description 1
- 239000005041 Mylar™ Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229940041616 menthol Drugs 0.000 description 1
- 239000012768 molten material Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 229940081310 piperonal Drugs 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01K—MEASURING TEMPERATURE; MEASURING QUANTITY OF HEAT; THERMALLY-SENSITIVE ELEMENTS NOT OTHERWISE PROVIDED FOR
- G01K11/00—Measuring temperature based upon physical or chemical changes not covered by groups G01K3/00, G01K5/00, G01K7/00 or G01K9/00
- G01K11/06—Measuring temperature based upon physical or chemical changes not covered by groups G01K3/00, G01K5/00, G01K7/00 or G01K9/00 using melting, freezing, or softening
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01K—MEASURING TEMPERATURE; MEASURING QUANTITY OF HEAT; THERMALLY-SENSITIVE ELEMENTS NOT OTHERWISE PROVIDED FOR
- G01K11/00—Measuring temperature based upon physical or chemical changes not covered by groups G01K3/00, G01K5/00, G01K7/00 or G01K9/00
- G01K11/06—Measuring temperature based upon physical or chemical changes not covered by groups G01K3/00, G01K5/00, G01K7/00 or G01K9/00 using melting, freezing, or softening
- G01K11/08—Measuring temperature based upon physical or chemical changes not covered by groups G01K3/00, G01K5/00, G01K7/00 or G01K9/00 using melting, freezing, or softening of disposable test bodies, e.g. cone
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Measuring Temperature Or Quantity Of Heat (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US86841069A | 1969-10-22 | 1969-10-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2028730A1 true DE2028730A1 (de) | 1971-04-29 |
Family
ID=25351630
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702028730 Pending DE2028730A1 (de) | 1969-10-22 | 1970-06-11 | Wegzuwerfendes klinisches Thermometer |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3631720A (enExample) |
| BE (1) | BE751594A (enExample) |
| CH (1) | CH515495A (enExample) |
| DE (1) | DE2028730A1 (enExample) |
| FR (1) | FR2048844A5 (enExample) |
| GB (1) | GB1286756A (enExample) |
| NL (1) | NL7013358A (enExample) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3704985A (en) * | 1971-03-04 | 1972-12-05 | Bio Medical Sciences Inc | Temperature indicator |
| US3774450A (en) * | 1971-07-15 | 1973-11-27 | Bio Medical Sciences Inc | Temperature indicating composition |
| IT988499B (it) * | 1972-03-03 | 1975-04-10 | Robertshaw M | Perfezionamenti agli indicatori di basse temperature |
| SE383657B (sv) * | 1972-10-25 | 1976-03-22 | Bio Medical Sciences Inc | Langstreckt muntermometer |
| JPS5332615Y2 (enExample) * | 1973-04-02 | 1978-08-12 | ||
| US4028941A (en) * | 1974-10-04 | 1977-06-14 | Kms Fusion, Inc. | Sensors for low temperature application |
| US4248089A (en) * | 1975-09-08 | 1981-02-03 | Ferdinand Heinmets | Temperature measuring |
| US4034609A (en) * | 1976-01-02 | 1977-07-12 | Fuller David L | Digital sensing device |
| JPS52115277A (en) * | 1976-03-24 | 1977-09-27 | Koyama Riyousei | Method of recognizing given temperature |
| US4232552A (en) * | 1978-09-28 | 1980-11-11 | Akzona Incorporated | Temperature indicating compositions of matter |
| US4339207A (en) * | 1978-09-28 | 1982-07-13 | Akzona Incorporated | Temperature indicating compositions of matter |
| US4362645A (en) * | 1978-09-28 | 1982-12-07 | Akzona, Inc. | Temperature indicating compositions of matter |
| US4333339A (en) * | 1980-03-21 | 1982-06-08 | Akzona Incorporated | Steam trap monitor |
| GB2311371B (en) * | 1996-03-21 | 1999-06-23 | B & H Liquid Crystal Devices | A beer mat |
| JP3578391B2 (ja) * | 1998-10-22 | 2004-10-20 | 東芝テック株式会社 | 温度管理部材及びこれを用いた温度管理方法 |
| RU2154261C1 (ru) * | 1999-05-26 | 2000-08-10 | Институт общей и неорганической химии им. Н.С. Курнакова РАН | Состав для химического индикатора температуры и времени |
| MXPA02008835A (es) * | 2000-03-10 | 2003-02-10 | Univ North Carolina State | Metodo y sistema para evaluacion, validacion y monitoreo conservador de procesamiento termico. |
| AU2002358964A1 (en) * | 2001-12-19 | 2003-06-30 | Uriel Bachrach | A device for monitoring a predetermined temperature |
| DE20219911U1 (de) * | 2002-12-23 | 2003-03-13 | BSH Bosch und Siemens Hausgeräte GmbH, 81669 München | Temperaturanzeigeelement für ein Kältegerät |
| EP1623048B1 (en) * | 2003-01-28 | 2014-03-19 | North Carolina State University | Methods, systems, and devices for evaluation of thermal treatment |
| CA2663740C (en) * | 2006-10-02 | 2015-11-03 | Alstom Technology Ltd. | Method for passive determination of the operating temperature in a thermally highly loaded device, and apparatus for carrying out the method |
| US7815370B2 (en) * | 2007-10-11 | 2010-10-19 | Cummins Filtration Ip, Inc. | Apparatus, system, and method for detecting temperature threshold events in an aftertreatment device |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2379459A (en) * | 1944-02-02 | 1945-07-03 | Schreiber Raymond Paul | Temperature indicator |
| US2614430A (en) * | 1950-02-01 | 1952-10-21 | Eastman Kodak Co | Temperature indicating device |
| US3465590A (en) * | 1960-08-22 | 1969-09-09 | Sybron Corp | Thermometer |
| US3175401A (en) * | 1962-04-12 | 1965-03-30 | Donald E Geldmacher | Body temperature indicator |
| US3430491A (en) * | 1966-12-27 | 1969-03-04 | Leigh R Gignilliat | Disposable clinical thermometer |
-
1969
- 1969-10-22 US US868410A patent/US3631720A/en not_active Expired - Lifetime
-
1970
- 1970-05-26 FR FR7019202A patent/FR2048844A5/fr not_active Expired
- 1970-06-08 BE BE751594D patent/BE751594A/xx unknown
- 1970-06-11 DE DE19702028730 patent/DE2028730A1/de active Pending
- 1970-06-25 GB GB30791/70A patent/GB1286756A/en not_active Expired
- 1970-06-30 CH CH993670A patent/CH515495A/fr not_active IP Right Cessation
- 1970-09-09 NL NL7013358A patent/NL7013358A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3631720A (en) | 1972-01-04 |
| FR2048844A5 (enExample) | 1971-03-19 |
| GB1286756A (en) | 1972-08-23 |
| NL7013358A (enExample) | 1971-04-26 |
| CH515495A (fr) | 1971-11-15 |
| BE751594A (fr) | 1970-12-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2028730A1 (de) | Wegzuwerfendes klinisches Thermometer | |
| DE69511563T2 (de) | Zeitanzeigevorrichtung mit diskontinuierlichem klebstoff | |
| DE1944238A1 (de) | Anzeigevorrichtung | |
| DE2920162A1 (de) | Blisterverpackung | |
| DE2834592C2 (de) | Etikettenband mit Selbstklebeetiketten | |
| DE2250412B2 (de) | Temperaturanzeigevorrichtung | |
| DE3027911C2 (de) | Druckkopf für eine Druckvorrichtung | |
| DE2428782A1 (de) | Selbstklebender verschluss | |
| EP0721898A1 (de) | Aufnahmebehälter und Rückstellsystem | |
| EP0017006B1 (de) | Epikutantestpflaster | |
| DE2444379A1 (de) | Markierungsvorrichtung fuer im wesentlichen an der haut vorzunehmende untersuchungen | |
| DE2444984C3 (de) | Mehrschichtiger Etikettenaufbau mit rückseitig bedruckbaren Etiketten | |
| DE69023072T2 (de) | Temperaturabhängige Anzeigeeinrichtung mit Flüssigkristallen. | |
| DE2230890C3 (de) | Schmelzsubstanz-Thermometer | |
| DE2836904B1 (de) | Klebehalterung | |
| DE69506582T2 (de) | Distanzstück für platten | |
| AT353901B (de) | Markierungskarte fuer roentgenfilme | |
| DE2230890B2 (de) | Schmelzsubstanz-Thermometer | |
| DE895099C (de) | Kassette fuer Roentgenaufnahmen von Kleinteilen | |
| DE1263474B (de) | Verfahren zum Herstellen eines mit Selbstklebeetiketten versehenen Vorratstraegers | |
| EP0008027A1 (de) | Etikettenband mit Selbstklebeetiketten | |
| DE151155C (enExample) | ||
| DE1436139C (de) | Karte mit Klebereltern bzw Taben fur Karteikartensysteme | |
| DE2954622C2 (enExample) | ||
| DE2057537C (de) | Druckplattenband |