DE1915005B2 - B transistorleistungsverstaerker - Google Patents
B transistorleistungsverstaerkerInfo
- Publication number
- DE1915005B2 DE1915005B2 DE19691915005 DE1915005A DE1915005B2 DE 1915005 B2 DE1915005 B2 DE 1915005B2 DE 19691915005 DE19691915005 DE 19691915005 DE 1915005 A DE1915005 A DE 1915005A DE 1915005 B2 DE1915005 B2 DE 1915005B2
- Authority
- DE
- Germany
- Prior art keywords
- transistors
- collector
- connection
- emitter
- connections
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 230000000295 complement effect Effects 0.000 claims description 11
- 239000003990 capacitor Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 4
- 230000007704 transition Effects 0.000 description 3
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 241000158147 Sator Species 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- JEDYYFXHPAIBGR-UHFFFAOYSA-N butafenacil Chemical compound O=C1N(C)C(C(F)(F)F)=CC(=O)N1C1=CC=C(Cl)C(C(=O)OC(C)(C)C(=O)OCC=C)=C1 JEDYYFXHPAIBGR-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03F—AMPLIFIERS
- H03F3/00—Amplifiers with only discharge tubes or only semiconductor devices as amplifying elements
- H03F3/30—Single-ended push-pull [SEPP] amplifiers; Phase-splitters therefor
- H03F3/3069—Single-ended push-pull [SEPP] amplifiers; Phase-splitters therefor the emitters of complementary power transistors being connected to the output
- H03F3/3076—Single-ended push-pull [SEPP] amplifiers; Phase-splitters therefor the emitters of complementary power transistors being connected to the output with symmetrical driving of the end stage
- H03F3/3077—Single-ended push-pull [SEPP] amplifiers; Phase-splitters therefor the emitters of complementary power transistors being connected to the output with symmetrical driving of the end stage using Darlington transistors
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03F—AMPLIFIERS
- H03F3/00—Amplifiers with only discharge tubes or only semiconductor devices as amplifying elements
- H03F3/30—Single-ended push-pull [SEPP] amplifiers; Phase-splitters therefor
- H03F3/3083—Single-ended push-pull [SEPP] amplifiers; Phase-splitters therefor the power transistors being of the same type
- H03F3/3086—Single-ended push-pull [SEPP] amplifiers; Phase-splitters therefor the power transistors being of the same type two power transistors being controlled by the input signal
- H03F3/3091—Single-ended push-pull [SEPP] amplifiers; Phase-splitters therefor the power transistors being of the same type two power transistors being controlled by the input signal comprising two complementary transistors for phase-splitting
Landscapes
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Amplifiers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US71637568A | 1968-03-27 | 1968-03-27 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1915005A1 DE1915005A1 (de) | 1969-10-02 |
| DE1915005B2 true DE1915005B2 (de) | 1971-06-09 |
Family
ID=24877762
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691915005 Withdrawn DE1915005B2 (de) | 1968-03-27 | 1969-03-25 | B transistorleistungsverstaerker |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3537023A (enExample) |
| JP (1) | JPS5519082B1 (enExample) |
| BE (1) | BE730482A (enExample) |
| DE (1) | DE1915005B2 (enExample) |
| FR (1) | FR2004870A1 (enExample) |
| GB (1) | GB1266908A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2409929A1 (de) * | 1973-07-19 | 1975-02-06 | Shin Shirasuna Electric Corp | Niederfrequenz-leistungsverstaerker |
| DE2920793A1 (de) * | 1978-05-22 | 1979-11-29 | Rca Corp | Gegentakt-b-transistorverstaerker |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2102553B1 (de) * | 1971-01-20 | 1972-06-08 | Texas Instruments Deutschland Gmbh | Gegentakt-Endstufenschaltung |
| US3787777A (en) * | 1971-11-19 | 1974-01-22 | Beltone Electronics Corp | Electric amplifier |
| JPS499959A (enExample) * | 1972-05-23 | 1974-01-29 | ||
| JPS4911053A (enExample) * | 1972-05-26 | 1974-01-31 | ||
| US3854057A (en) * | 1972-12-11 | 1974-12-10 | Lrc Corp | High speed impedance sensitive switch driver |
| US3872390A (en) * | 1973-12-26 | 1975-03-18 | Motorola Inc | CMOS operational amplifier with internal emitter follower |
| JPS5829647B2 (ja) * | 1976-02-10 | 1983-06-24 | ヤマハ株式会社 | トランジスタ増幅回路 |
| US4086542A (en) * | 1976-02-12 | 1978-04-25 | Nippon Gakki Seizo Kabushiki Kaisha | Complementary push-pull amplifier |
| US4121168A (en) * | 1977-08-24 | 1978-10-17 | Burr-Brown Research Corporation | Optically coupled bias circuit for complementary output circuit and method |
| US4140976A (en) * | 1977-09-22 | 1979-02-20 | David Wartofsky | Thermally stable push-pull amplifier |
| GB8311072D0 (en) * | 1983-04-22 | 1983-05-25 | Sinclair Res Ltd | Amplifiers |
| US4864249A (en) * | 1988-02-29 | 1989-09-05 | Reiffin Martin G | Nonslewing amplifier |
| US4827223A (en) * | 1988-03-21 | 1989-05-02 | Elantec | Buffer amplifier |
| US5229721A (en) * | 1992-04-06 | 1993-07-20 | Plantronics, Inc. | Micropower amplifier/transducer driver with signal expansion |
| RU2318292C1 (ru) * | 2006-09-28 | 2008-02-27 | Сергей Всеволодович Шпак | Звеньевой усилитель тока |
| KR102421015B1 (ko) * | 2017-04-28 | 2022-07-15 | 부르메스터 아우디오시스테메 게엠베하 | 신호 증폭기 회로, 전압 변환기 및 시스템 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2994834A (en) * | 1956-02-29 | 1961-08-01 | Baldwin Piano Co | Transistor amplifiers |
| US3271691A (en) * | 1961-05-08 | 1966-09-06 | Gen Electric | Radiation monitor circuit including amplifier |
| US3077566A (en) * | 1961-06-01 | 1963-02-12 | Mouroe Electronies Inc | Transistor operational amplifier |
| US3375455A (en) * | 1964-10-20 | 1968-03-26 | California Inst Res Found | Symmetrical amplifier without dc shift between input and output |
| US3434067A (en) * | 1966-08-19 | 1969-03-18 | Herman J Eckelmann Jr | Push-pull amplifiers |
-
1968
- 1968-03-27 US US716375A patent/US3537023A/en not_active Expired - Lifetime
-
1969
- 1969-03-25 DE DE19691915005 patent/DE1915005B2/de not_active Withdrawn
- 1969-03-26 BE BE730482D patent/BE730482A/xx not_active IP Right Cessation
- 1969-03-27 FR FR6909135A patent/FR2004870A1/fr not_active Withdrawn
- 1969-03-27 GB GB1266908D patent/GB1266908A/en not_active Expired
- 1969-03-27 JP JP2281669A patent/JPS5519082B1/ja active Pending
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2409929A1 (de) * | 1973-07-19 | 1975-02-06 | Shin Shirasuna Electric Corp | Niederfrequenz-leistungsverstaerker |
| DE2920793A1 (de) * | 1978-05-22 | 1979-11-29 | Rca Corp | Gegentakt-b-transistorverstaerker |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2004870A1 (enExample) | 1969-12-05 |
| US3537023A (en) | 1970-10-27 |
| JPS5519082B1 (enExample) | 1980-05-23 |
| BE730482A (enExample) | 1969-09-01 |
| DE1915005A1 (de) | 1969-10-02 |
| GB1266908A (enExample) | 1972-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2432867C3 (de) | Verstärkerschaltung | |
| DE1915005B2 (de) | B transistorleistungsverstaerker | |
| DE2917926A1 (de) | Gegentakt-schaltleistungsverstaerker | |
| DE2837853C3 (de) | Differenzverstärker | |
| DE2420158A1 (de) | Differenzverstaerker | |
| DE3011835C2 (de) | Leistungsverstärker | |
| DE2647916A1 (de) | Nf-leistungsverstaerker | |
| DE2328402A1 (de) | Konstantstromkreis | |
| DE2409929C3 (de) | Verzerrungsarmer, niederfrequenter Gegentakt-Leistungsverstärker | |
| DE1537656B2 (enExample) | ||
| DE2711912A1 (de) | Nf-leistungsverstaerker | |
| DE1180000B (de) | Transistor-Leistungsverstaerkerstufe | |
| DE2233612C3 (de) | Endstufe für einen Prüfsignalgeber | |
| DE3032675C2 (de) | Tonfrequenz-Leistungsverstärker-Schaltung. | |
| DE2646386A1 (de) | Transistorverstaerker | |
| DE2554770C2 (de) | Transistor-Gegentaktverstärker | |
| DE1774831A1 (de) | Schaltung zur alternativen Verwendung als Absolutverstaerker oder Multiplizierer | |
| DE3120689A1 (de) | "gegentaktendstufe" | |
| DE2332092C3 (de) | Gegentakt-Verstärker-Schaltungsanordnung | |
| DE1762989A1 (de) | Halbleiter-UEbertragungseinrichtung | |
| DE1915005C (de) | B Transistorleistungsverstarker | |
| DE2439240A1 (de) | Transistorschaltung zum erzeugen einer abtastprobe | |
| DE1245429B (de) | Verstaerkerschaltung mit zwei Transistoren, deren Emitter-Kollektor-Strecken in Reihe an die Speisespannung angeschlossen sind | |
| DE2637500C2 (de) | Leistungsverstärker zur Verstärkung elektrischer Spannungen | |
| EP0048490A1 (de) | Schaltungsanordnung zum Umsetzen eines binären Eingangssignals in ein Telegrafiersignal |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |