DE1767033C3 - - Google Patents
Info
- Publication number
- DE1767033C3 DE1767033C3 DE19681767033 DE1767033A DE1767033C3 DE 1767033 C3 DE1767033 C3 DE 1767033C3 DE 19681767033 DE19681767033 DE 19681767033 DE 1767033 A DE1767033 A DE 1767033A DE 1767033 C3 DE1767033 C3 DE 1767033C3
- Authority
- DE
- Germany
- Prior art keywords
- inlet
- liquid
- outlet
- transfer medium
- heat transfer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000007788 liquid Substances 0.000 claims description 26
- 238000006243 chemical reaction Methods 0.000 claims description 23
- 239000003054 catalyst Substances 0.000 claims description 6
- 238000009826 distribution Methods 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 4
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 239000002826 coolant Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- RZWWGOCLMSGROE-UHFFFAOYSA-N n-(2,6-dichlorophenyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide Chemical compound N1=C2N=C(C)C=C(C)N2N=C1S(=O)(=O)NC1=C(Cl)C=CC=C1Cl RZWWGOCLMSGROE-UHFFFAOYSA-N 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US64607167A | 1967-06-14 | 1967-06-14 | |
| US64607167 | 1967-06-14 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1767033A1 DE1767033A1 (de) | 1971-08-19 |
| DE1767033B2 DE1767033B2 (de) | 1976-01-08 |
| DE1767033C3 true DE1767033C3 (enExample) | 1976-08-26 |
Family
ID=24591622
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1767033A Granted DE1767033B2 (de) | 1967-06-14 | 1968-03-22 | Reaktionsofen zur Durchführung exothermer katalytischer Reaktionen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3482948A (enExample) |
| DE (1) | DE1767033B2 (enExample) |
| FR (1) | FR1577494A (enExample) |
| GB (1) | GB1219973A (enExample) |
| SE (1) | SE346222B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3941568A (en) * | 1971-05-20 | 1976-03-02 | Allied Chemical Corporation | Apparatus for the production of ethylene dichloride |
| FR2452315B1 (fr) * | 1979-03-28 | 1985-07-05 | Azote & Prod Chim | Reacteur de nitration d'hydrocarbures en phase gazeuse sous pression |
| US4814977A (en) * | 1983-10-18 | 1989-03-21 | S&C Electric Company | Apparatus and method for direct memory to peripheral and peripheral to memory data transfers |
| DE3612213A1 (de) * | 1986-04-11 | 1987-10-15 | Basf Ag | Rohrbuendelreaktor, dessen verwendung bei exothermen organischen reaktionen und verfahren zur herstellung von ketonen und aldehyden mit hilfe des rohrbuendelreaktors |
| US5599510A (en) * | 1991-12-31 | 1997-02-04 | Amoco Corporation | Catalytic wall reactors and use of catalytic wall reactors for methane coupling and hydrocarbon cracking reactions |
| KR100450234B1 (ko) * | 2002-07-10 | 2004-09-24 | 주식회사 엘지화학 | 개선된 열교환 시스템을 갖는 촉매 산화 반응기 |
| JP4742520B2 (ja) * | 2004-05-27 | 2011-08-10 | 三菱化学株式会社 | 反応装置、反応装置制御システム、及び接触気相酸化反応方法 |
| GB2446820B (en) * | 2007-02-23 | 2011-09-21 | Mark Collins | A Method of Generating Heat |
| BR112018009507B1 (pt) * | 2015-11-13 | 2022-02-01 | Johnson Matthey Public Limited Company | Aparelho e processo para produção de formaldeído, e, uso de um aparelho |
| PL3826763T3 (pl) * | 2018-07-24 | 2024-02-26 | Noram Engineering And Constructors Ltd. | Reaktor i sposób nitrowania |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1604739A (en) * | 1921-12-05 | 1926-10-26 | Barrett Co | Apparatus for promoting catalytic reactions |
| US1812341A (en) * | 1930-02-04 | 1931-06-30 | Selden Res & Engineering Corp | Catalytic apparatus |
| US2411097A (en) * | 1944-03-16 | 1946-11-12 | American Locomotive Co | Heat exchanger |
| US2852564A (en) * | 1955-01-21 | 1958-09-16 | Reichhold Chemicals Inc | Process for controlling reaction temperature in vapor phase oxidation of alcohols to aldehydes |
| US3247279A (en) * | 1962-02-12 | 1966-04-19 | Halcon International Inc | Heat control in catalytic oxidation process |
-
1967
- 1967-06-14 US US646071A patent/US3482948A/en not_active Expired - Lifetime
-
1968
- 1968-03-22 DE DE1767033A patent/DE1767033B2/de active Granted
- 1968-04-30 SE SE5835/68A patent/SE346222B/xx unknown
- 1968-05-01 GB GB20552/68D patent/GB1219973A/en not_active Expired
- 1968-06-10 FR FR1577494D patent/FR1577494A/fr not_active Expired
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2538596A1 (de) | Wasserbecken-kernreaktor fuer waermeerzeugung | |
| DE3715713C1 (de) | Waermetauscher insbesondere zum Kuehlen von Spaltgasen | |
| DE1767033C3 (enExample) | ||
| DE1941005B2 (de) | Dampferzeuger | |
| DE3247333A1 (de) | Vorrichtung zum kalibrieren eines rohres aus kunststoff durch strangpressen | |
| DE2819777A1 (de) | Geraet zum austauschen von waerme zwischen zwei fluids | |
| DE1767033B2 (de) | Reaktionsofen zur Durchführung exothermer katalytischer Reaktionen | |
| DE3835096A1 (de) | Warmwasser-schichtspeicher | |
| DE2616788A1 (de) | Tauchrohr-waermetauscher | |
| DE2336632C3 (de) | Wärmeaustauschvorrichtung | |
| DE3643303A1 (de) | Vorrichtung zum waermetausch, insbesondere zwischen synthesegas- und kesselspeisewasser | |
| DE2019234A1 (de) | Rueckstromkessel | |
| DE3121297C2 (de) | Vorrichtung zum Regeln der Temperatur eines korrosiven Gases, insbesondere Synthesegas | |
| DE8109822U1 (de) | Apparat zum aufwaermen einer fluessigkeit | |
| DE3402807C2 (de) | Verfahren zur Oxydation von flüssigen organischen Stoffen | |
| DE1767034C3 (enExample) | ||
| DE2903250C2 (de) | Kessel zum Erhitzen und Speichern von Wasser | |
| DE2437195A1 (de) | Vorrichtung zum trocknen komprimierter gase | |
| DE2813614C2 (de) | Indirekt beheizter Dampferzeuger | |
| DE2131149A1 (de) | Behaelter mit Einrichtungen zum Waermeaustausch durch die Wand | |
| DE3005858A1 (de) | Waermetauscher mit treibkanal | |
| DE2318030C3 (de) | Wärmeübertrager mit in einem vertikalen Kessel vertikal angeordneten Rohrbündel | |
| DE2358065A1 (de) | Dampferzeuger | |
| DE441858C (de) | Elektrolytischer Apparat | |
| DE2745912C2 (de) | Wärmeübertrager |