DE1531108A1 - Rolltreppe - Google Patents
RolltreppeInfo
- Publication number
- DE1531108A1 DE1531108A1 DE19671531108 DE1531108A DE1531108A1 DE 1531108 A1 DE1531108 A1 DE 1531108A1 DE 19671531108 DE19671531108 DE 19671531108 DE 1531108 A DE1531108 A DE 1531108A DE 1531108 A1 DE1531108 A1 DE 1531108A1
- Authority
- DE
- Germany
- Prior art keywords
- recess
- elastic
- chain
- teeth
- escalator
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000005764 inhibitory process Effects 0.000 claims 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 claims 1
- 238000001179 sorption measurement Methods 0.000 claims 1
- 239000000463 material Substances 0.000 description 4
- 238000007373 indentation Methods 0.000 description 3
- 238000010276 construction Methods 0.000 description 2
- 241000084978 Rena Species 0.000 description 1
- 206010048232 Yawning Diseases 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000010977 jade Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B66—HOISTING; LIFTING; HAULING
- B66B—ELEVATORS; ESCALATORS OR MOVING WALKWAYS
- B66B23/00—Component parts of escalators or moving walkways
- B66B23/02—Driving gear
Landscapes
- Escalators And Moving Walkways (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10510366 | 1966-11-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1531108A1 true DE1531108A1 (de) | 1969-12-18 |
Family
ID=14398526
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671531108 Pending DE1531108A1 (de) | 1966-11-16 | 1967-11-14 | Rolltreppe |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3499340A (enExample) |
| DE (1) | DE1531108A1 (enExample) |
| FR (1) | FR1557724A (enExample) |
| GB (1) | GB1199466A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10125622A1 (de) * | 2001-05-25 | 2002-12-05 | Kone Corp | Gedämpftes Kettenrad |
| DE10229572B4 (de) * | 2002-07-02 | 2005-09-29 | Kone Corp. | Gedämpftes Kettenrad |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3889550A (en) * | 1973-11-19 | 1975-06-17 | Caterpillar Tractor Co | Impact absorbing noise suppression device |
| US3854345A (en) * | 1974-03-20 | 1974-12-17 | Caterpillar Tractor Co | Noise attenuating impact absorbing means for sprocket teeth and track |
| US4055368A (en) * | 1976-04-28 | 1977-10-25 | Caterpillar Tractor Co. | Biasing element having one or more force stages |
| US5566810A (en) * | 1995-07-12 | 1996-10-22 | Otis Elevator Company | Reduction of handrail vibration in passenger conveyors |
| US5819910A (en) * | 1996-07-10 | 1998-10-13 | Otis Elevator Company | Noise reduced step chain sprocket |
| KR100246746B1 (ko) * | 1997-11-03 | 2000-04-01 | 이종수 | 에스컬레이터의핸드레일구동장치 |
| DE10063844B4 (de) * | 2000-12-21 | 2004-07-22 | Kone Corp. | Antriebssystem für Rolltreppen und Rollsteige |
| US6457573B1 (en) | 2001-02-02 | 2002-10-01 | Otis Elevator Company | Belt drive back up device for escalator drive |
| WO2004054918A1 (en) * | 2002-12-13 | 2004-07-01 | Otis Elevator Company | Stepchain link for an escalator |
| US20060011450A1 (en) * | 2003-01-07 | 2006-01-19 | Fargo Richard N | Drive belt for a passenger conveyor |
| US7032983B2 (en) * | 2003-09-17 | 2006-04-25 | Ta Ya Chain Co., Ltd. | Silent and reduced vibration chainwheel |
| CN105899853A (zh) * | 2013-03-01 | 2016-08-24 | 博格华纳公司 | 降低噪声、振动和声振粗糙度的链轮技术 |
| US11878750B2 (en) * | 2020-01-17 | 2024-01-23 | Caterpillar Inc. | Wear inserts cast in a wear surface of a drive component |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA653577A (en) * | 1962-12-04 | O. Bradley Robert | Drive for moving stairways |
-
1967
- 1967-11-10 FR FR1557724D patent/FR1557724A/fr not_active Expired
- 1967-11-14 DE DE19671531108 patent/DE1531108A1/de active Pending
- 1967-11-15 GB GB51932/67A patent/GB1199466A/en not_active Expired
- 1967-11-16 US US683572A patent/US3499340A/en not_active Expired - Lifetime
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10125622A1 (de) * | 2001-05-25 | 2002-12-05 | Kone Corp | Gedämpftes Kettenrad |
| DE10125622B4 (de) * | 2001-05-25 | 2004-01-22 | Kone Corp. | Gedämpftes Kettenrad |
| DE10229572B4 (de) * | 2002-07-02 | 2005-09-29 | Kone Corp. | Gedämpftes Kettenrad |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1557724A (enExample) | 1969-02-21 |
| GB1199466A (en) | 1970-07-22 |
| US3499340A (en) | 1970-03-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1531108A1 (de) | Rolltreppe | |
| AT393006B (de) | Zahnriemen | |
| DE2821039A1 (de) | Kettenradantrieb | |
| DE69123039T2 (de) | Kermetall für gummigleisketten und gleiskettenvorrichtung | |
| DE2616765A1 (de) | W-n zahnrad mit einem einfachflankigen oder doppelflankigen zahnprofil | |
| DE3306490A1 (de) | Kraft- beziehungsweise bewegungsuebertragungsvorrichtung mit zahnriemen und zahnriemenscheiben | |
| DE2624424B2 (de) | Zahnriemen | |
| DE2724144A1 (de) | Antriebseinheit fuer einen endlosfoerderer | |
| DE3122227C2 (enExample) | ||
| DE2100240A1 (de) | Mehrfachgutförderer, insbesondere für den Transport von Personen, mit sich ändernder Fördergeschwindigkeit | |
| DE3704176C2 (enExample) | ||
| DE1957922C3 (de) | Zahnriemengetriebe, dessen Zahnriemen ein endloses Zugglied mit Zähnen aus einem elastomeren Material aufweist | |
| DE1480836A1 (de) | Gleiskette fuer Raupenfahrzeuge | |
| DE60222350T2 (de) | Kernstück für Gummiraupenkette und Gummiraupenkette | |
| DE2202823B2 (de) | Drahtseil mit einer Kunststoffoder Kautschuklage | |
| DE102015000485A1 (de) | Kettenfahrwerk sowie Arbeitsmaschine mit Kettenantrieb | |
| DE1650653B1 (de) | Zahnriementrieb | |
| DE1918847A1 (de) | Raupenband | |
| DE2263118A1 (de) | Verfahren und vorrichtung zum formen von plastikmaterial um elastische einsaetze | |
| DE1962861A1 (de) | Hochfestes Stahldrahtbandseil | |
| DE2325931C2 (de) | Rundlitzendrahtseil | |
| DE1505017A1 (de) | Luftreifen,insbesondere fuer gelaendegaengiges Fahrzeug | |
| EP0070506A2 (de) | Schrämarm an einer Schrämmaschine | |
| DE2927962A1 (de) | Foerderrinne | |
| DE2149557B2 (de) | Gleiskette für Kettenfahrzeuge |