DE1518713C - - Google Patents
Info
- Publication number
- DE1518713C DE1518713C DE19651518713 DE1518713A DE1518713C DE 1518713 C DE1518713 C DE 1518713C DE 19651518713 DE19651518713 DE 19651518713 DE 1518713 A DE1518713 A DE 1518713A DE 1518713 C DE1518713 C DE 1518713C
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- terpene
- radical
- temperatures
- solvent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 terpene esters Chemical class 0.000 claims description 15
- 235000007586 terpenes Nutrition 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 8
- WUOACPNHFRMFPN-UHFFFAOYSA-N Terpineol Chemical compound CC1=CCC(C(C)(C)O)CC1 WUOACPNHFRMFPN-UHFFFAOYSA-N 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 239000011780 sodium chloride Substances 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- ASZLNPRMVCGYCI-UHFFFAOYSA-N 1$l^{2}-azolidine Chemical group C1CC[N]C1 ASZLNPRMVCGYCI-UHFFFAOYSA-N 0.000 claims description 2
- 241000251730 Chondrichthyes Species 0.000 claims description 2
- GGCZERPQGJTIQP-UHFFFAOYSA-M Sodium 2-anthraquinonesulfonate Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)[O-])=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-M 0.000 claims description 2
- IQPQWNKOIGAROB-UHFFFAOYSA-N [N-]=C=O Chemical compound [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims description 2
- 125000002723 alicyclic group Chemical group 0.000 claims description 2
- 150000001447 alkali salts Chemical class 0.000 claims description 2
- 125000005466 alkylenyl group Chemical group 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 238000003379 elimination reaction Methods 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atoms Chemical group [H]* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 229910052709 silver Inorganic materials 0.000 claims description 2
- 239000004332 silver Substances 0.000 claims description 2
- 229930002942 camphan Natural products 0.000 claims 1
- 125000004433 nitrogen atoms Chemical group N* 0.000 claims 1
- 150000002937 p-menthane derivatives Chemical class 0.000 claims 1
- 150000002148 esters Chemical class 0.000 description 23
- 238000004519 manufacturing process Methods 0.000 description 15
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 235000015320 potassium carbonate Nutrition 0.000 description 5
- QMVPMAAFGQKVCJ-SNVBAGLBSA-N (R)-(+)-citronellol Natural products OCC[C@H](C)CCC=C(C)C QMVPMAAFGQKVCJ-SNVBAGLBSA-N 0.000 description 4
- CDOSHBSSFJOMGT-JTQLQIEISA-N (R)-linalool Natural products CC(C)=CCC[C@@](C)(O)C=C CDOSHBSSFJOMGT-JTQLQIEISA-N 0.000 description 4
- ODZPKZBBUMBTMG-UHFFFAOYSA-N Sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 239000001184 potassium carbonate Substances 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- XACWJIQLDLUFSR-UHFFFAOYSA-N pyrrolidine-1-carbonyl chloride Chemical compound ClC(=O)N1CCCC1 XACWJIQLDLUFSR-UHFFFAOYSA-N 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000001490 (3R)-3,7-dimethylocta-1,6-dien-3-ol Substances 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N Boron trifluoride Chemical class FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 229920000089 Cyclic olefin copolymer Polymers 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M NaHCO3 Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 159000000032 aromatic acids Chemical class 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229930004021 citronellol Natural products 0.000 description 2
- 235000000484 citronellol Nutrition 0.000 description 2
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 229930007744 linalool Natural products 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- DNUTZBZXLPWRJG-UHFFFAOYSA-N piperidine-1-carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 description 2
- NYCVCXMSZNOGDH-UHFFFAOYSA-M pyrrolidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCC1 NYCVCXMSZNOGDH-UHFFFAOYSA-M 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 2
- NOOLISFMXDJSKH-UTLUCORTSA-N (+)-Neomenthol Chemical compound CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1O NOOLISFMXDJSKH-UTLUCORTSA-N 0.000 description 1
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical compound C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 description 1
- RGZSQWQPBWRIAQ-LSDHHAIUSA-N (+)-α-Bisabolol Chemical compound CC(C)=CCC[C@@](C)(O)[C@@H]1CCC(C)=CC1 RGZSQWQPBWRIAQ-LSDHHAIUSA-N 0.000 description 1
- 229930006727 (-)-endo-fenchol Natural products 0.000 description 1
- IAIHUHQCLTYTSF-MRTMQBJTSA-N (-)-endo-fenchol Chemical compound C1C[C@]2(C)[C@H](O)C(C)(C)[C@H]1C2 IAIHUHQCLTYTSF-MRTMQBJTSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SQCZQTSHSZLZIQ-UHFFFAOYSA-N 1-Chloropentane Chemical compound CCCCCCl SQCZQTSHSZLZIQ-UHFFFAOYSA-N 0.000 description 1
- BEWYHVAWEKZDPP-WAAGHKOSSA-N 1β,4β-bornane Chemical compound C1C[C@]2(C)CC[C@H]1C2(C)C BEWYHVAWEKZDPP-WAAGHKOSSA-N 0.000 description 1
- VXPDMTCKQJCASL-UHFFFAOYSA-N 2,6-dimethylpiperidine-1-carboxylic acid Chemical compound CC1CCCC(C)N1C(O)=O VXPDMTCKQJCASL-UHFFFAOYSA-N 0.000 description 1
- NDNQUJQOJSNZGA-UHFFFAOYSA-N 2-N-phenylpyridine-2,5-diamine Chemical compound N1=CC(N)=CC=C1NC1=CC=CC=C1 NDNQUJQOJSNZGA-UHFFFAOYSA-N 0.000 description 1
- VOIZNVUXCQLQHS-UHFFFAOYSA-N 3-bromobenzoic acid Chemical compound OC(=O)C1=CC=CC(Br)=C1 VOIZNVUXCQLQHS-UHFFFAOYSA-N 0.000 description 1
- HFGHRUCCKVYFKL-UHFFFAOYSA-N 4-ethoxy-2-piperazin-1-yl-7-pyridin-4-yl-5H-pyrimido[5,4-b]indole Chemical compound C1=C2NC=3C(OCC)=NC(N4CCNCC4)=NC=3C2=CC=C1C1=CC=NC=C1 HFGHRUCCKVYFKL-UHFFFAOYSA-N 0.000 description 1
- BBYDXOIZLAWGSL-UHFFFAOYSA-M 4-fluorobenzoate Chemical compound [O-]C(=O)C1=CC=C(F)C=C1 BBYDXOIZLAWGSL-UHFFFAOYSA-M 0.000 description 1
- CZKLEJHVLCMVQR-UHFFFAOYSA-N 4-fluorobenzoyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C=C1 CZKLEJHVLCMVQR-UHFFFAOYSA-N 0.000 description 1
- CUFNKYGDVFVPHO-UHFFFAOYSA-N Azulene Chemical compound C1=CC=CC2=CC=CC2=C1 CUFNKYGDVFVPHO-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N Benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 229940116229 Borneol Drugs 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N Carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N Dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 239000005792 Geraniol Substances 0.000 description 1
- GLZPCOQZEFWAFX-YFHOEESVSA-N Geraniol Natural products CC(C)=CCC\C(C)=C/CO GLZPCOQZEFWAFX-YFHOEESVSA-N 0.000 description 1
- 229960004873 LEVOMENTHOL Drugs 0.000 description 1
- 229940041616 Menthol Drugs 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N Phenylisocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- JIAARYAFYJHUJI-UHFFFAOYSA-L Zinc chloride Chemical class [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N al2o3 Chemical class [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 230000003110 anti-inflammatory Effects 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229940036350 bisabolol Drugs 0.000 description 1
- 229930000006 bisabolols Natural products 0.000 description 1
- 229930006742 bornane Natural products 0.000 description 1
- 229930006709 borneol Natural products 0.000 description 1
- ZZHGIUCYKGFIPV-UHFFFAOYSA-N butylcarbamic acid Chemical compound CCCCNC(O)=O ZZHGIUCYKGFIPV-UHFFFAOYSA-N 0.000 description 1
- 150000001715 carbamic acids Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000000875 corresponding Effects 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- JBDSSBMEKXHSJF-UHFFFAOYSA-N cyclopentanecarboxylic acid Chemical compound OC(=O)C1CCCC1 JBDSSBMEKXHSJF-UHFFFAOYSA-N 0.000 description 1
- YUOXWVHVESHIJP-UHFFFAOYSA-M cyclopentanecarboxylic acid;chloride Chemical compound [Cl-].OC(=O)C1CCCC1 YUOXWVHVESHIJP-UHFFFAOYSA-M 0.000 description 1
- SGBIPKSFOQACNA-UHFFFAOYSA-M cyclopropanecarboxylate;hydrochloride Chemical compound [Cl-].OC(=O)C1CC1 SGBIPKSFOQACNA-UHFFFAOYSA-M 0.000 description 1
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical compound OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 1
- HYHWDGZUQOWSCT-UHFFFAOYSA-N dibutylcarbamic acid Chemical compound CCCCN(C(O)=O)CCCC HYHWDGZUQOWSCT-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000008396 flotation agent Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 229930008393 geraniol Natural products 0.000 description 1
- 229940113087 geraniol Drugs 0.000 description 1
- PYGSKMBEVAICCR-UHFFFAOYSA-N hexa-1,5-diene Chemical group C=CCCC=C PYGSKMBEVAICCR-UHFFFAOYSA-N 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229950004594 levomenol Drugs 0.000 description 1
- STUHQDIOZQUPGP-UHFFFAOYSA-N morpholin-4-ium-4-carboxylate Chemical compound OC(=O)N1CCOCC1 STUHQDIOZQUPGP-UHFFFAOYSA-N 0.000 description 1
- XMWFMEYDRNJSOO-UHFFFAOYSA-N morpholine-4-carbonyl chloride Chemical compound ClC(=O)N1CCOCC1 XMWFMEYDRNJSOO-UHFFFAOYSA-N 0.000 description 1
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N n-methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 150000002829 nitrogen Chemical group 0.000 description 1
- CFJYNSNXFXLKNS-UHFFFAOYSA-N p-menthane Chemical class CC(C)C1CCC(C)CC1 CFJYNSNXFXLKNS-UHFFFAOYSA-N 0.000 description 1
- PWXJULSLLONQHY-UHFFFAOYSA-N phenylcarbamic acid Chemical compound OC(=O)NC1=CC=CC=C1 PWXJULSLLONQHY-UHFFFAOYSA-N 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 150000003505 terpenes Chemical group 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000011592 zinc chloride Chemical class 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- GLZPCOQZEFWAFX-JXMROGBWSA-N β-Geraniol Chemical compound CC(C)=CCC\C(C)=C\CO GLZPCOQZEFWAFX-JXMROGBWSA-N 0.000 description 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DED0047716 | 1965-07-13 | ||
| DED0047716 | 1965-07-13 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1518713B1 DE1518713B1 (de) | 1971-01-14 |
| DE1518713C true DE1518713C (pt) | 1973-04-19 |
Family
ID=7050623
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19651518713 Granted DE1518713B1 (de) | 1965-07-13 | 1965-07-13 | Verfahren zur Herstellung von Terpenestern |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3480663A (pt) |
| AT (1) | AT280984B (pt) |
| BE (1) | BE684038A (pt) |
| BR (1) | BR6681201D0 (pt) |
| CH (1) | CH481863A (pt) |
| DE (1) | DE1518713B1 (pt) |
| DK (1) | DK123020B (pt) |
| ES (1) | ES329009A1 (pt) |
| FI (1) | FI44602C (pt) |
| FR (1) | FR5603M (pt) |
| GB (1) | GB1099558A (pt) |
| NL (1) | NL6609768A (pt) |
| SE (1) | SE351419B (pt) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4675342A (en) * | 1979-02-02 | 1987-06-23 | The United States Of America As Represented By The Secretary Of Agriculture | Cockroach repellents |
| US4291041A (en) * | 1979-02-02 | 1981-09-22 | The United States Of America As Represented By The Secretary Of Agriculture | Alicyclic piperidine derivatives as insect repellents |
| US5593691A (en) * | 1993-06-03 | 1997-01-14 | Marigen S.A. | Biotenside solvents for pharmaceuticals and cosmetics |
| GB0214342D0 (en) * | 2002-06-21 | 2002-07-31 | Givaudan Sa | Insect repellents |
| DE102005026768B4 (de) * | 2005-06-10 | 2007-05-03 | Symrise Gmbh & Co. Kg | Verfahren zum Entfernen von Farnesol aus Mischungen mit alpha-Bisabolol |
| US8007849B2 (en) * | 2005-12-14 | 2011-08-30 | International Flavors & Fragrances Inc. | Unsaturated cyclic and acyclic carbamates exhibiting taste and flavor enhancement effect in flavor compositions |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3238036A (en) * | 1963-04-02 | 1966-03-01 | Union Carbide Corp | Method of inhibiting plant growth with cyclohexenyl carbamates |
-
1965
- 1965-07-13 DE DE19651518713 patent/DE1518713B1/de active Granted
-
1966
- 1966-06-16 CH CH870966A patent/CH481863A/de not_active IP Right Cessation
- 1966-06-27 FR FR67067A patent/FR5603M/fr not_active Expired
- 1966-06-30 FI FI661759A patent/FI44602C/fi active
- 1966-07-05 GB GB30095/66A patent/GB1099558A/en not_active Expired
- 1966-07-12 AT AT669766A patent/AT280984B/de not_active IP Right Cessation
- 1966-07-12 BR BR181201/66A patent/BR6681201D0/pt unknown
- 1966-07-12 BE BE684038D patent/BE684038A/xx unknown
- 1966-07-12 NL NL6609768A patent/NL6609768A/xx unknown
- 1966-07-12 DK DK361866AA patent/DK123020B/da unknown
- 1966-07-12 ES ES0329009A patent/ES329009A1/es not_active Expired
- 1966-07-12 US US564547A patent/US3480663A/en not_active Expired - Lifetime
- 1966-07-13 SE SE09589/66A patent/SE351419B/xx unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1793559C3 (de) | Verfahren zur Herstellung von Furan 3 carbonsaureestern Ausscheidung aus 1543804 | |
| DE2518392C2 (de) | Neue Kohlensäure-alkyl-cycloalkylester, deren Herstellung und Verwendung | |
| DE1518713C (pt) | ||
| DE1817925C3 (de) | Lavandulylsaurenitril und Verfahren zu dessen Herstellung | |
| DE1518713B1 (de) | Verfahren zur Herstellung von Terpenestern | |
| DE3624258A1 (de) | Verfahren zur herstellung von chlorcarbonsaeurechloriden | |
| DE2429935C3 (de) | Verfahren zur Herstellung von 2,2,6,6- Tetramethyl-4-oxopiperidin | |
| DE1095284B (de) | Verfahren zur Herstellung von í¸-Thiazolinen | |
| DE1695594A1 (de) | In 2-Stellung substituierte delta1-Pyrrolinverbindungen und Verfahren zu ihrer Herstellung | |
| DE3026094C2 (de) | Verfahren zur Herstellung von Cyclopropancarbonsäureamiden | |
| US2759945A (en) | Nicotinic acid esters of pyranmethanol | |
| DE2356702A1 (de) | Verfahren zur herstellung von transchrysanthemummonocarbonsaeure | |
| DE2751134A1 (de) | Verfahren zur herstellung von gamma-chlorcarbonsaeureestern | |
| EP0089485B1 (de) | Verfahren zur Herstellung von 5-Chlor-1H-tetrazol-1-carbonsäureestern sowie Verfahren zur Herstellung der erforderlichen Dichlorisonitril-carbonsäureester | |
| US2195382A (en) | Unsaturated furoate | |
| EP0171046B1 (de) | Verfahren zur Herstellung von Pantolacton | |
| EP0002477B1 (de) | Verfahren zur Herstellung von 1,1-Dihalogen-4-methyl-1,3-pentadienen | |
| DE2558399B2 (de) | Verfahren zur herstellung von 3,6-dichlorpicolinsaeure | |
| DE1158499B (de) | Verfahren zur Herstellung von Isonitrilen | |
| DE3437890A1 (de) | Verfahren zur herstellung von 7-oxabicycloheptan-verbindungen und neue zwischenprodukte | |
| AT219579B (de) | Verfahren zur Herstellung von α-Cyclohexylbuttersäuredialkylaminoäthylestern und deren Salzen | |
| US2919289A (en) | Method of synthesis of dialkyl alphaketoglutarate from alkyl 2, 5-dialkoxy-2, 5-dihydro-2-furoate | |
| DE3210297C2 (de) | Verfahren zur Herstellung von Dichlorisonitrilcarbonsäureestern | |
| DE1518404C (de) | Verfahren zur Herstellung von m-Aminophenylalylsulfiden | |
| DE2822157A1 (de) | 2-oxo-alkanphosphonsaeuredialkylester, verfahren zu ihrer herstellung sowie ihre verwendung zur synthese von neuen prostaglandin-analoga |