DE1464388B2 - Kathodenstrahlröhre - Google Patents
KathodenstrahlröhreInfo
- Publication number
- DE1464388B2 DE1464388B2 DE19631464388 DE1464388A DE1464388B2 DE 1464388 B2 DE1464388 B2 DE 1464388B2 DE 19631464388 DE19631464388 DE 19631464388 DE 1464388 A DE1464388 A DE 1464388A DE 1464388 B2 DE1464388 B2 DE 1464388B2
- Authority
- DE
- Germany
- Prior art keywords
- anodes
- cathode ray
- electrodes
- lens
- different
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 8
- 239000011521 glass Substances 0.000 description 5
- 230000035515 penetration Effects 0.000 description 5
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 230000008719 thickening Effects 0.000 description 3
- 101001061788 Homo sapiens Ras-related protein Rab-35 Proteins 0.000 description 2
- 102100029568 Ras-related protein Rab-35 Human genes 0.000 description 2
- 238000010894 electron beam technology Methods 0.000 description 2
- 230000005686 electrostatic field Effects 0.000 description 2
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- CLSVJBIHYWPGQY-UHFFFAOYSA-N [3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate Chemical compound CCOC(=O)OC1=C(C=2C(=CC=C(C)C=2)C)C(=O)NC11CCC(OC)CC1 CLSVJBIHYWPGQY-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J29/00—Details of cathode-ray tubes or of electron-beam tubes of the types covered by group H01J31/00
- H01J29/46—Arrangements of electrodes and associated parts for generating or controlling the ray or beam, e.g. electron-optical arrangement
- H01J29/48—Electron guns
- H01J29/50—Electron guns two or more guns in a single vacuum space, e.g. for plural-ray tube
- H01J29/506—Electron guns two or more guns in a single vacuum space, e.g. for plural-ray tube guns in delta or circular configuration
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J31/00—Cathode ray tubes; Electron beam tubes
- H01J31/08—Cathode ray tubes; Electron beam tubes having a screen on or from which an image or pattern is formed, picked up, converted, or stored
- H01J31/10—Image or pattern display tubes, i.e. having electrical input and optical output; Flying-spot tubes for scanning purposes
- H01J31/20—Image or pattern display tubes, i.e. having electrical input and optical output; Flying-spot tubes for scanning purposes for displaying images or patterns in two or more colours
- H01J31/208—Image or pattern display tubes, i.e. having electrical input and optical output; Flying-spot tubes for scanning purposes for displaying images or patterns in two or more colours using variable penetration depth of the electron beam in the luminescent layer, e.g. penetrons
Landscapes
- Cathode-Ray Tubes And Fluorescent Screens For Display (AREA)
- Video Image Reproduction Devices For Color Tv Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US215011A US3294999A (en) | 1962-08-06 | 1962-08-06 | Cathode ray tube |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1464388A1 DE1464388A1 (de) | 1969-02-20 |
| DE1464388B2 true DE1464388B2 (de) | 1970-09-17 |
Family
ID=22801275
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19631464388 Pending DE1464388B2 (de) | 1962-08-06 | 1963-08-01 | Kathodenstrahlröhre |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3294999A (enExample) |
| BE (1) | BE635894A (enExample) |
| DE (1) | DE1464388B2 (enExample) |
| GB (1) | GB1013989A (enExample) |
| NL (1) | NL296268A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3558954A (en) * | 1967-10-17 | 1971-01-26 | Rca Corp | Color tube having ground plane between focus electrodes and screen grids |
| US3755703A (en) * | 1968-04-14 | 1973-08-28 | Sony Corp | Electron gun device for color tube |
| US3461342A (en) * | 1968-06-14 | 1969-08-12 | Philco Ford Corp | Color crt assembly |
| US3663907A (en) * | 1970-12-08 | 1972-05-16 | Rca Corp | Beam convergence exciter for shadow mask color picture tube |
| US4061941A (en) * | 1976-06-24 | 1977-12-06 | Gte Sylvania Incorporated | CRT electron gun assembly |
| US4028581A (en) * | 1976-06-24 | 1977-06-07 | Gte Sylvania Incorporated | Plural beam electron gun assembly |
| JPS53145562A (en) * | 1977-05-25 | 1978-12-18 | Hitachi Ltd | Electronic gun |
| US6614163B1 (en) * | 1999-06-21 | 2003-09-02 | Samsung Sdi Co., Ltd. | Cathode ray tube |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2719243A (en) * | 1951-07-03 | 1955-09-27 | Du Mont Allen B Lab Inc | Electrostatic electron lens |
| BE513449A (enExample) * | 1951-08-11 | |||
| US2743391A (en) * | 1951-11-02 | 1956-04-24 | Du Mont Allen B Lab Inc | Cathode ray tube |
| US3011090A (en) * | 1952-06-24 | 1961-11-28 | Rca Corp | Plural beam tube |
| US2803768A (en) * | 1955-01-27 | 1957-08-20 | Du Mont Allen B Lab Inc | Cathode ray tube |
| US3023336A (en) * | 1957-10-25 | 1962-02-27 | Tektronix Inc | Cathode ray tube having post acceleration |
| US2922072A (en) * | 1957-12-05 | 1960-01-19 | Sylvania Electric Prod | Image reproduction device |
| BE624849A (enExample) * | 1961-05-08 | |||
| BE625033A (enExample) * | 1961-11-20 |
-
0
- BE BE635894D patent/BE635894A/xx unknown
- NL NL296268D patent/NL296268A/xx unknown
-
1962
- 1962-08-06 US US215011A patent/US3294999A/en not_active Expired - Lifetime
-
1963
- 1963-07-16 GB GB28155/63A patent/GB1013989A/en not_active Expired
- 1963-08-01 DE DE19631464388 patent/DE1464388B2/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| US3294999A (en) | 1966-12-27 |
| DE1464388A1 (de) | 1969-02-20 |
| GB1013989A (en) | 1965-12-22 |
| BE635894A (enExample) | |
| NL296268A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2534912C2 (de) | Elektrostatische Fokussierlinse für Kathodenstrahlröhren | |
| DE2418199C2 (de) | Farbbildwiedergabeanordnung | |
| DE2747441A1 (de) | Elektronenstrahlerzeuger | |
| EP0061525B1 (de) | Flache Bildwiedergaberöhre | |
| DE2824820A1 (de) | Elektronenstrahlsystem mit verteilter elektrostatischer linse | |
| DE1464388B2 (de) | Kathodenstrahlröhre | |
| DE2311369A1 (de) | Elektronenstrahlroehre mit einem nichtrotationssymmetrischen element | |
| DE1002789B (de) | Elektrische Entladungsroehre zur Wiedergabe von Bildern | |
| DE1512226A1 (de) | Kathodenstrahlroehre fuer Farbfernsehempfaenger | |
| DE2914838C2 (de) | Elektronenstrahlerzeugungssystem | |
| DE1803033C3 (de) | Lochmasken-Farbbildröhre | |
| DE1464388C (de) | Kathodenstrahlrohre | |
| DE3854466T2 (de) | Elektronenkanonen für Kathodenstrahl-Röhren. | |
| DE1130938B (de) | Kathodenstrahlroehre mit Nachbeschleunigung | |
| DE3216039C2 (de) | Elektronenstrahl-Erzeugungssystem einer Kathodenstrahlröhre | |
| DE69119206T2 (de) | Bildwiedergabeanordnung vom dünnen Typ | |
| DE1101494B (de) | Mehrstrahl-Bildroehre mit Fokusmaske und einem Mosaikschirm | |
| DE1965498C3 (de) | Kathodenstrahlrohre | |
| DD212355A5 (de) | Kathodenstrahlroehre | |
| DE1074631B (de) | Kathodenstrahlrohre zur Darstellung von Farbbildern | |
| DE4235306C2 (de) | Kathodenstrahlröhre mit kombinierter dynamischer Fokussierungs-Korrektur und dynamischer Astigmatismus-Korrektur | |
| EP0157445A1 (de) | Elektronenstrahlröhre | |
| DE1080595B (de) | Kathodenstrahlroehre zur Wiedergabe von Farbfernsehbildern | |
| DE1093023B (de) | Kathodenstrahlroehre mit mehreren Strahlerzeugungssystemen, insbesondere fuer Farbfernsehzwecke | |
| DE1957153A1 (de) | Kathodenstrahlroehre |