DE1298638B - Auskoppelvorrichtung fuer eine kreiszylindrische Magnetronroehre - Google Patents
Auskoppelvorrichtung fuer eine kreiszylindrische MagnetronroehreInfo
- Publication number
- DE1298638B DE1298638B DEG31024A DEG0031024A DE1298638B DE 1298638 B DE1298638 B DE 1298638B DE G31024 A DEG31024 A DE G31024A DE G0031024 A DEG0031024 A DE G0031024A DE 1298638 B DE1298638 B DE 1298638B
- Authority
- DE
- Germany
- Prior art keywords
- metallic parts
- magnetic
- magnetron tube
- window
- decoupling
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000463 material Substances 0.000 claims description 4
- 230000000149 penetrating effect Effects 0.000 claims description 4
- 239000002245 particle Substances 0.000 claims description 2
- 230000005611 electricity Effects 0.000 claims 1
- 230000035515 penetration Effects 0.000 claims 1
- 229910000831 Steel Inorganic materials 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000010959 steel Substances 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 230000004907 flux Effects 0.000 description 3
- 230000001960 triggered effect Effects 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000035699 permeability Effects 0.000 description 2
- IDCBOTIENDVCBQ-UHFFFAOYSA-N TEPP Chemical compound CCOP(=O)(OCC)OP(=O)(OCC)OCC IDCBOTIENDVCBQ-UHFFFAOYSA-N 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000696 magnetic material Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J23/00—Details of transit-time tubes of the types covered by group H01J25/00
- H01J23/36—Coupling devices having distributed capacitance and inductance, structurally associated with the tube, for introducing or removing wave energy
Landscapes
- Microwave Tubes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US858665A US3059142A (en) | 1959-12-10 | 1959-12-10 | High power microwave device |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1298638B true DE1298638B (de) | 1969-07-03 |
Family
ID=25328847
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG31024A Pending DE1298638B (de) | 1959-12-10 | 1960-11-29 | Auskoppelvorrichtung fuer eine kreiszylindrische Magnetronroehre |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3059142A (enExample) |
| DE (1) | DE1298638B (enExample) |
| GB (1) | GB912052A (enExample) |
| IT (1) | IT699974A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3252034A (en) * | 1962-04-16 | 1966-05-17 | Eitel Mccullough Inc | R-f window for high power electron tubes |
| NL298479A (enExample) * | 1962-10-01 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2404212A (en) * | 1942-12-24 | 1946-07-16 | Gen Electric | Magnetron |
| NL160193B (nl) * | 1950-06-15 | Wavin Bv | Inrichting voor het vervaardigen van een kunststofbuis met dwarse golven. | |
| GB762106A (en) * | 1953-03-26 | 1956-11-21 | Standard Telephones Cables Ltd | Improvements in or relating to travelling wave tubes |
| US2842713A (en) * | 1953-07-03 | 1958-07-08 | Raytheon Mfg Co | Electron discharge device |
| BE556363A (enExample) * | 1954-09-16 |
-
0
- IT IT699974D patent/IT699974A/it unknown
-
1959
- 1959-12-10 US US858665A patent/US3059142A/en not_active Expired - Lifetime
-
1960
- 1960-11-29 DE DEG31024A patent/DE1298638B/de active Pending
- 1960-12-08 GB GB42266/60A patent/GB912052A/en not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| None * |
Also Published As
| Publication number | Publication date |
|---|---|
| GB912052A (en) | 1962-12-05 |
| IT699974A (enExample) | |
| US3059142A (en) | 1962-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE853915C (de) | Ultrahochfrequenz-Sperrvorrichtung in Hohlwellenleitern | |
| DE1807720B2 (de) | Stehwellen-linearbeschleuniger | |
| DE3111305A1 (de) | Mikrowellen-entladungs-ionenquelle | |
| DE2516335A1 (de) | Mikrowellenroehre | |
| DE3343918A1 (de) | Vakuumschalter fuer den niederspannungsbereich, insbesondere niederspannungsschuetz | |
| DE69024330T2 (de) | Mikrowellenofenmagnetron mit einer Filterstruktur | |
| EP0063840B1 (de) | Hochspannungs-Vakuumröhre, insbesondere Röntgenröhre | |
| DE2362734C2 (de) | Magnetron | |
| EP1537594B1 (de) | Hochspannungs-vakuumröhre | |
| DE2506841C2 (de) | Hochspannungs-Vakuumröhre | |
| DE1298638B (de) | Auskoppelvorrichtung fuer eine kreiszylindrische Magnetronroehre | |
| DE2417651A1 (de) | Magnetische fokussierungsanordnung fuer geradlinige strahlen | |
| DE69312152T2 (de) | Hohlkathodenentladungsröhre | |
| DE2208570A1 (de) | Hochfrequenzröhre | |
| DE1763146A1 (de) | Strombegrenzer | |
| DE1566033A1 (de) | Leitungstrenner fuer mit periodischen Permanentmagneten fokussierte Wanderfeldroehre | |
| DE2639033C3 (de) | Bauteil in mit Ladungsträgerstrahlen arbeitenden elektrischen Vakuumgeräten und Verfahren zu dessen Herstellung | |
| DE2913769C2 (enExample) | ||
| DE69201669T2 (de) | Hochspannungs-Isoliervorrichtung. | |
| DE2652070C2 (de) | Bildwandler | |
| EP0608478A2 (de) | Vorrichtung zur Kathodenzerstäubung | |
| DE1541093C (de) | Klystron mit angekoppeltem Resonator mit veränderbarer Resonanzfrequenz | |
| DE1065025B (de) | Laufzeitroehrenanordnung mit einem abstimmbaren Hohlraumresonator | |
| DE1491535C (de) | Hochfrequenz Elektronenentladungs einrichtung | |
| DE1089112B (de) | Vakuumpumpe |