CS259529B2 - Method of n-acyl-4-hydroxyphenylamines production - Google Patents
Method of n-acyl-4-hydroxyphenylamines production Download PDFInfo
- Publication number
- CS259529B2 CS259529B2 CS853446A CS344685A CS259529B2 CS 259529 B2 CS259529 B2 CS 259529B2 CS 853446 A CS853446 A CS 853446A CS 344685 A CS344685 A CS 344685A CS 259529 B2 CS259529 B2 CS 259529B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- hydroxyacetophenone
- acetyl
- aminophenol
- rearrangement
- reaction
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 27
- TXFPEBPIARQUIG-UHFFFAOYSA-N 4'-hydroxyacetophenone Chemical compound CC(=O)C1=CC=C(O)C=C1 TXFPEBPIARQUIG-UHFFFAOYSA-N 0.000 claims abstract description 56
- 229940073735 4-hydroxy acetophenone Drugs 0.000 claims abstract description 26
- 239000003054 catalyst Substances 0.000 claims abstract description 23
- BVZSQTRWIYKUSF-TWGQIWQCSA-N 4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]phenol Chemical compound C1=C(C=CC(=C1)O)/C(=N\O)/C BVZSQTRWIYKUSF-TWGQIWQCSA-N 0.000 claims abstract description 21
- 238000006237 Beckmann rearrangement reaction Methods 0.000 claims abstract description 15
- 150000002443 hydroxylamines Chemical class 0.000 claims abstract description 5
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 34
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 31
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 22
- 238000002360 preparation method Methods 0.000 claims description 22
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 21
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 19
- 125000003118 aryl group Chemical group 0.000 claims description 14
- 230000008707 rearrangement Effects 0.000 claims description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 12
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 9
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 claims description 7
- 239000000908 ammonium hydroxide Substances 0.000 claims description 7
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 claims description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 6
- 239000007858 starting material Substances 0.000 claims description 6
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 230000003197 catalytic effect Effects 0.000 claims 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 abstract description 38
- -1 hydroxy aromatic ketone Chemical class 0.000 abstract description 22
- 150000002576 ketones Chemical class 0.000 abstract description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 47
- 238000006243 chemical reaction Methods 0.000 description 41
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 21
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 19
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 19
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 18
- 239000013078 crystal Substances 0.000 description 17
- 229960000583 acetic acid Drugs 0.000 description 15
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 15
- 229940049953 phenylacetate Drugs 0.000 description 15
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 238000005618 Fries rearrangement reaction Methods 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 239000000047 product Substances 0.000 description 9
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 8
- 238000006640 acetylation reaction Methods 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 239000012345 acetylating agent Substances 0.000 description 7
- 230000021736 acetylation Effects 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 235000019439 ethyl acetate Nutrition 0.000 description 7
- 150000002923 oximes Chemical class 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 6
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- LUJMEECXHPYQOF-UHFFFAOYSA-N 3-hydroxyacetophenone Chemical compound CC(=O)C1=CC=CC(O)=C1 LUJMEECXHPYQOF-UHFFFAOYSA-N 0.000 description 4
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000001569 carbon dioxide Substances 0.000 description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 229910001220 stainless steel Inorganic materials 0.000 description 4
- 239000010935 stainless steel Substances 0.000 description 4
- ZWVHTXAYIKBMEE-UHFFFAOYSA-N 2-hydroxyacetophenone Chemical compound OCC(=O)C1=CC=CC=C1 ZWVHTXAYIKBMEE-UHFFFAOYSA-N 0.000 description 3
- ZNBNBTIDJSKEAM-UHFFFAOYSA-N 4-[7-hydroxy-2-[5-[5-[6-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-2,8-dimethyl-1,10-dioxaspiro[4.5]decan-9-yl]-2-methyl-3-propanoyloxypentanoic acid Chemical compound C1C(O)C(C)C(C(C)C(OC(=O)CC)C(C)C(O)=O)OC11OC(C)(C2OC(C)(CC2)C2C(CC(O2)C2C(CC(C)C(O)(CO)O2)C)C)CC1 ZNBNBTIDJSKEAM-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 238000005863 Friedel-Crafts acylation reaction Methods 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 238000006555 catalytic reaction Methods 0.000 description 3
- HYYHQASRTSDPOD-UHFFFAOYSA-N hydroxylamine;phosphoric acid Chemical compound ON.OP(O)(O)=O HYYHQASRTSDPOD-UHFFFAOYSA-N 0.000 description 3
- 229910000378 hydroxylammonium sulfate Inorganic materials 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 238000002390 rotary evaporation Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 2
- SMIOEQSLJNNKQF-UHFFFAOYSA-N 4-acetoxy acetophenone Chemical compound CC(=O)OC1=CC=C(C(C)=O)C=C1 SMIOEQSLJNNKQF-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000007857 hydrazones Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- AMZORBZSQRUXNC-UHFFFAOYSA-N o-Tolyl acetate Chemical compound CC(=O)OC1=CC=CC=C1C AMZORBZSQRUXNC-UHFFFAOYSA-N 0.000 description 2
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- ADVGKWPZRIDURE-UHFFFAOYSA-N 2'-Hydroxyacetanilide Chemical compound CC(=O)NC1=CC=CC=C1O ADVGKWPZRIDURE-UHFFFAOYSA-N 0.000 description 1
- JZXBPZWZZOXDFB-RMKNXTFCSA-N 2-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenol Chemical compound C\C(=N/O)C1=CC=CC=C1O JZXBPZWZZOXDFB-RMKNXTFCSA-N 0.000 description 1
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- JXEHBRQVIPIGRN-UHFFFAOYSA-N 2-hydroxyimino-2-phenylethanol Chemical compound OCC(=NO)C1=CC=CC=C1 JXEHBRQVIPIGRN-UHFFFAOYSA-N 0.000 description 1
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- YJGQJJIPPGVQCE-UHFFFAOYSA-N 4-ethanehydrazonoylphenol Chemical compound NN=C(C)C1=CC=C(O)C=C1 YJGQJJIPPGVQCE-UHFFFAOYSA-N 0.000 description 1
- IAMNVCJECQWBLZ-UHFFFAOYSA-N 4-hydroxy-2-methylacetophenone Chemical compound CC(=O)C1=CC=C(O)C=C1C IAMNVCJECQWBLZ-UHFFFAOYSA-N 0.000 description 1
- ZFIQGRISGKSVAG-UHFFFAOYSA-N 4-methylaminophenol Chemical compound CNC1=CC=C(O)C=C1 ZFIQGRISGKSVAG-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 229920000557 Nafion® Polymers 0.000 description 1
- IGVPBCZDHMIOJH-UHFFFAOYSA-N Phenyl butyrate Chemical compound CCCC(=O)OC1=CC=CC=C1 IGVPBCZDHMIOJH-UHFFFAOYSA-N 0.000 description 1
- 150000008062 acetophenones Chemical class 0.000 description 1
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- AOMUALOCHQKUCD-UHFFFAOYSA-N dodecyl 4-chloro-3-[[3-(4-methoxyphenyl)-3-oxopropanoyl]amino]benzoate Chemical compound CCCCCCCCCCCCOC(=O)C1=CC=C(Cl)C(NC(=O)CC(=O)C=2C=CC(OC)=CC=2)=C1 AOMUALOCHQKUCD-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- NXPHCVPFHOVZBC-UHFFFAOYSA-N hydroxylamine;sulfuric acid Chemical compound ON.OS(O)(=O)=O NXPHCVPFHOVZBC-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 238000006384 oligomerization reaction Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229960005489 paracetamol Drugs 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- WMFABESKCHGSRC-UHFFFAOYSA-N propanoyl fluoride Chemical compound CCC(F)=O WMFABESKCHGSRC-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/16—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS867153A CS259542B2 (cs) | 1984-07-03 | 1986-10-03 | Způsob výroby N-acyI-(4-acyInxyfenyl)aminů |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/618,659 US4524217A (en) | 1984-06-08 | 1984-06-08 | Process for producing N-acyl-hydroxy aromatic amines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CS344685A2 CS344685A2 (en) | 1988-02-15 |
| CS259529B2 true CS259529B2 (en) | 1988-10-14 |
Family
ID=24478609
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS853446A CS259529B2 (en) | 1984-06-08 | 1985-05-14 | Method of n-acyl-4-hydroxyphenylamines production |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | US4524217A (enExample) |
| CS (1) | CS259529B2 (enExample) |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4994613A (en) * | 1983-02-16 | 1991-02-19 | Hoechst Celanese Corporation | Process for preparing 4-hydroxyacetophenone oxime with mother liquor recycle |
| US4568763A (en) * | 1984-07-03 | 1986-02-04 | Celanese Corporation | Process for producing N-acyl-acyloxy aromatic amines |
| US4560789A (en) * | 1984-07-03 | 1985-12-24 | Celanese Corporation | Process for producing 4-acetoxyacetanilide |
| US5157142A (en) * | 1986-06-17 | 1992-10-20 | Hoechst Celanese Corporation | Thiocarbamates and their derivatives |
| US5151540A (en) * | 1986-11-26 | 1992-09-29 | Hoechst Celanese Corporation | Thio carbamates and their derivatives |
| US4973752A (en) * | 1987-11-06 | 1990-11-27 | Fruchey Olan S | Novel process to prevent formation of chlorinated by-products in APAP production |
| US4855499A (en) * | 1987-11-06 | 1989-08-08 | Hoechst Celanese Corporation | Novel process to prevent formation of chlorinated by-products in APAP production |
| US4933496A (en) * | 1988-01-28 | 1990-06-12 | Hoechst Celanese Corporation | Process for producing an aqueous 4-hydroxyacetophenone (4-hap) which is stable at room temperature |
| CA1304407C (en) * | 1988-02-08 | 1992-06-30 | Hoechst Celanese Corporation | Process for the synthesis of 3-chloro-4-hydroxyacetanilide |
| US5155273A (en) * | 1988-07-12 | 1992-10-13 | Hoechst Celanese Corporation | Production of acetaminophen |
| US4954652A (en) * | 1988-07-12 | 1990-09-04 | Hoechst Celanese Corporation | Production of acetaminophen |
| US4894482A (en) * | 1988-12-06 | 1990-01-16 | Hoechst Celanese Corporation | Process for drying hydrogen fluoride-carboxylic acid mixtures |
| US4990681A (en) * | 1989-12-04 | 1991-02-05 | Curtis Thomas A | Method for removing hydrogen fluoride from mixtures comprising aromatic ketones |
| HUT60463A (en) * | 1990-11-01 | 1992-09-28 | Hoechst Celanese Corp | Process for cleaning acetaminophen |
| US5372932A (en) * | 1992-12-22 | 1994-12-13 | Eastman Kodak Company | Analytical element and method for the determination of a specific binding ligand using a 4-hydroxy or 4-alkoxyarylacetamide as stabilizer |
| US5372931A (en) * | 1992-12-22 | 1994-12-13 | Eastman Kodak Company | Use of 4'-hydroxy- and 4'-alkoxy-substituted electron transfer agents in compositions, elements, test kits and analytical methods |
| US5399760A (en) * | 1993-04-29 | 1995-03-21 | Hoechst Celanese Corporation | Color control & stability in acetaminophen |
| US5344979A (en) * | 1993-04-29 | 1994-09-06 | Hoechst Celanese Corporation | Process for preparing color-stabilized acetaminophen |
| US5312990A (en) * | 1993-05-28 | 1994-05-17 | Hoechst Celanese Corporation | Di-amino compounds |
| US5300691A (en) * | 1993-05-28 | 1994-04-05 | Hoechst Celanese Corporation | Substituted benzyl amines |
| US5510389A (en) * | 1994-03-02 | 1996-04-23 | The Procter & Gamble Company | Concentrated acetaminophen solution compositions |
| US5892118A (en) * | 1996-10-09 | 1999-04-06 | Daiwa Kasei Industry Co., Ltd. | Process for producing 4,6-diaminoresorcinols |
| WO2001087871A2 (en) * | 2000-05-17 | 2001-11-22 | Millennium Pharmaceuticals, Inc. | Methods for producing amino substituted chromanes and intermediates therefor |
| GB0807534D0 (en) * | 2008-04-24 | 2008-06-04 | Oxtox Ltd | Assay |
| CA2794171C (en) | 2010-03-24 | 2018-07-03 | Jazz Pharmaceuticals, Inc. | Controlled release dosage forms for high dose, water soluble and hygroscopic drug substances |
| US9102589B2 (en) | 2010-07-30 | 2015-08-11 | Granules India Limited | Reactive distillation process for preparation of acetaminophen |
| US10398662B1 (en) | 2015-02-18 | 2019-09-03 | Jazz Pharma Ireland Limited | GHB formulation and method for its manufacture |
| UY37341A (es) | 2016-07-22 | 2017-11-30 | Flamel Ireland Ltd | Formulaciones de gamma-hidroxibutirato de liberación modificada con farmacocinética mejorada |
| US11602513B1 (en) | 2016-07-22 | 2023-03-14 | Flamel Ireland Limited | Modified release gamma-hydroxybutyrate formulations having improved pharmacokinetics |
| US11986451B1 (en) | 2016-07-22 | 2024-05-21 | Flamel Ireland Limited | Modified release gamma-hydroxybutyrate formulations having improved pharmacokinetics |
| US11504347B1 (en) | 2016-07-22 | 2022-11-22 | Flamel Ireland Limited | Modified release gamma-hydroxybutyrate formulations having improved pharmacokinetics |
| US12186296B1 (en) | 2016-07-22 | 2025-01-07 | Flamel Ireland Limited | Modified release gamma-hydroxybutyrate formulations having improved pharmacokinetics |
| US12478604B1 (en) | 2016-07-22 | 2025-11-25 | Flamel Ireland Limited | Modified release gamma-hydroxybutyrate formulations having improved pharmacokinetics |
| US11602512B1 (en) | 2016-07-22 | 2023-03-14 | Flamel Ireland Limited | Modified release gamma-hydroxybutyrate formulations having improved pharmacokinetics |
| US20180263936A1 (en) | 2017-03-17 | 2018-09-20 | Jazz Pharmaceuticals Ireland Limited | Gamma-hydroxybutyrate compositions and their use for the treatment of disorders |
| CA3115122A1 (en) | 2018-11-19 | 2020-05-28 | Jazz Pharmaceuticals Ireland Limited | Alcohol-resistant drug formulations |
| EP3930702A1 (en) | 2019-03-01 | 2022-01-05 | Flamel Ireland Limited | Gamma-hydroxybutyrate compositions having improved pharmacokinetics in the fed state |
| TW202139986A (zh) | 2020-02-21 | 2021-11-01 | 愛爾蘭商爵士製藥愛爾蘭有限責任公司 | 治療原發性嗜睡症之方法 |
| WO2022076824A1 (en) | 2020-10-08 | 2022-04-14 | Jazz Pharmaceuticals Ireland Limited | Sodium oxybate to treat idiopathic hypersomnia |
| US12103900B2 (en) * | 2020-11-24 | 2024-10-01 | Laxmi Organic Industries Ltd | Environment-friendly process for selective acylation of aminophenol |
| US11583510B1 (en) | 2022-02-07 | 2023-02-21 | Flamel Ireland Limited | Methods of administering gamma hydroxybutyrate formulations after a high-fat meal |
| US11779557B1 (en) | 2022-02-07 | 2023-10-10 | Flamel Ireland Limited | Modified release gamma-hydroxybutyrate formulations having improved pharmacokinetics |
| WO2025038619A1 (en) | 2023-08-14 | 2025-02-20 | Wisconsin Alumni Research Foundation | Producing paracetamol from biomass-derived p-hydroxybenzoic acid and p-hydroxybenzamide |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2833825A (en) * | 1954-03-22 | 1958-05-06 | California Research Corp | Preparation of acylphenols |
| FR1601M (fr) * | 1961-10-18 | 1962-12-10 | Ile De France | Nouveaux médicaments analgésiques. |
| US3192213A (en) * | 1962-10-12 | 1965-06-29 | Olin Mathieson | Aminoalkyl anilides |
| US3413340A (en) * | 1962-12-04 | 1968-11-26 | Mallinckrodt Chemical Works | N-(carboxymethyl)-3-alkoxy-polyiodoanilide compounds |
| US3201401A (en) * | 1964-09-17 | 1965-08-17 | Olin Mathieson | Aminoalkoxy and aminoalkylthioanilide compounds |
| US3389171A (en) * | 1965-02-17 | 1968-06-18 | Dow Chemical Co | Dihaloanilines and method of preparation thereof |
| GB1174051A (en) * | 1965-11-30 | 1969-12-10 | Beecham Group Ltd | Aminophenol Derivatives and Analgesic and Antipyretic Compositions |
| FR1507886A (fr) * | 1967-01-13 | 1967-12-29 | J Berthier Sa Lab | Nouveaux dérivés du dipropylacétylanilide |
| US3775485A (en) * | 1970-09-14 | 1973-11-27 | Shell Oil Co | Production of hydroxyaryl thioethers |
| US3839446A (en) * | 1970-11-18 | 1974-10-01 | Stauffer Chemical Co | Ether and sulfide meta-substituted anilides |
| US3801644A (en) * | 1971-08-25 | 1974-04-02 | Warner Lambert Co | Substituted-o-hydroxy-omega-(methylsulfinyl)acetophenones and process for producing same |
| US3786090A (en) * | 1971-09-29 | 1974-01-15 | Interx Research Corp | Alkoxyacetanilide compounds |
| DE2616986A1 (de) * | 1976-04-17 | 1977-10-27 | Bayer Ag | Verfahren zur herstellung von hydroxyketonen |
-
1984
- 1984-06-08 US US06/618,659 patent/US4524217A/en not_active Expired - Fee Related
-
1985
- 1985-05-14 CS CS853446A patent/CS259529B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US4524217A (en) | 1985-06-18 |
| CS344685A2 (en) | 1988-02-15 |
| US4524217B1 (enExample) | 1990-04-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS259529B2 (en) | Method of n-acyl-4-hydroxyphenylamines production | |
| US5107032A (en) | Process for the preparation of o-phthalaldehydes | |
| US4568763A (en) | Process for producing N-acyl-acyloxy aromatic amines | |
| EP0168908B1 (en) | Process for producing n-acyl-acyloxy aromatic amines | |
| US4560789A (en) | Process for producing 4-acetoxyacetanilide | |
| US4705896A (en) | Novel extractants for the recovery of palladium | |
| US5157142A (en) | Thiocarbamates and their derivatives | |
| EP0074725B1 (en) | A method for the production of nuclear substituted cinnamoylanthranilic acid derivatives and intermediates thereof | |
| US4453017A (en) | Process for the methylation of phenolic compounds with trimethyl phosphate | |
| US4665216A (en) | Process for producing n-acyl-acyloxy aromatic amines | |
| US4778922A (en) | Process for producing N,O-diacetyl-6-amino-2-naphthol | |
| US4415751A (en) | Process for preparing phenylalkanoic acids | |
| US3787477A (en) | Preparation of cyanohydrins | |
| US4578250A (en) | Method for the recovery of palladium | |
| CS259542B2 (cs) | Způsob výroby N-acyI-(4-acyInxyfenyl)aminů | |
| CA2346900A1 (en) | Method of producing ketimines | |
| JPS6115869A (ja) | パラジウムを採取するための新規な抽出剤および方法 | |
| KR900004399B1 (ko) | N-아실-p-아미노페놀 및 4-아실옥시-N-아실 아닐리드의 제조방법 | |
| US4083857A (en) | Process | |
| CA1262144A (en) | Process for producing n-acyl-hydroxy and n-acyl- acyloxy aromatic amines | |
| IE58239B1 (en) | Process for producing n-acyl-acyloxy aromatic amines | |
| FI66590B (fi) | Foerfarande foer framstaellning av 5'-alkanoylamino-2'-(2-hydroxi-3-isopropylaminopropoxi)-acetofenon | |
| CN1006068B (zh) | V-乙酰-羟基苯胺的制备方法 | |
| EP0161499B1 (en) | Process for preparation of aminophthalideisoquinolines | |
| JPS5927862A (ja) | (p−ヒドロキシフエニル)(ペルフルオロアルキル)アセトニトリル誘導体 |