CS195327B2 - Process for cleavage of dl-mixtures of compounds of alanine - Google Patents
Process for cleavage of dl-mixtures of compounds of alanine Download PDFInfo
- Publication number
- CS195327B2 CS195327B2 CS771133A CS113377A CS195327B2 CS 195327 B2 CS195327 B2 CS 195327B2 CS 771133 A CS771133 A CS 771133A CS 113377 A CS113377 A CS 113377A CS 195327 B2 CS195327 B2 CS 195327B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- alanine
- fluorolanine
- quinine
- deutero
- compound
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 9
- 239000000203 mixture Substances 0.000 title claims description 9
- 235000004279 alanine Nutrition 0.000 title claims description 6
- 238000003776 cleavage reaction Methods 0.000 title claims description 5
- 230000007017 scission Effects 0.000 title claims description 5
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 title 1
- 150000003839 salts Chemical class 0.000 claims abstract description 6
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 claims description 17
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 claims description 10
- 235000001258 Cinchona calisaya Nutrition 0.000 claims description 8
- 229960000948 quinine Drugs 0.000 claims description 8
- -1 alanine compound Chemical class 0.000 claims description 5
- LOUPRKONTZGTKE-LHHVKLHASA-N quinidine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@H]2[C@@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-LHHVKLHASA-N 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- QMGVPVSNSZLJIA-UHFFFAOYSA-N Nux Vomica Natural products C1C2C3C4N(C=5C6=CC=CC=5)C(=O)CC3OCC=C2CN2C1C46CC2 QMGVPVSNSZLJIA-UHFFFAOYSA-N 0.000 claims description 2
- RRKTZKIUPZVBMF-IBTVXLQLSA-N brucine Chemical compound O([C@@H]1[C@H]([C@H]2C3)[C@@H]4N(C(C1)=O)C=1C=C(C(=CC=11)OC)OC)CC=C2CN2[C@@H]3[C@]41CC2 RRKTZKIUPZVBMF-IBTVXLQLSA-N 0.000 claims description 2
- RRKTZKIUPZVBMF-UHFFFAOYSA-N brucine Natural products C1=2C=C(OC)C(OC)=CC=2N(C(C2)=O)C3C(C4C5)C2OCC=C4CN2C5C31CC2 RRKTZKIUPZVBMF-UHFFFAOYSA-N 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 229960001404 quinidine Drugs 0.000 claims description 2
- 238000010992 reflux Methods 0.000 claims description 2
- 239000002585 base Substances 0.000 claims 2
- 150000001294 alanine derivatives Chemical class 0.000 claims 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 1
- 238000002425 crystallisation Methods 0.000 claims 1
- 230000008025 crystallization Effects 0.000 claims 1
- 150000002500 ions Chemical class 0.000 claims 1
- 125000003410 quininyl group Chemical group 0.000 claims 1
- QNAYBMKLOCPYGJ-UHFFFAOYSA-N Alanine Chemical compound CC([NH3+])C([O-])=O QNAYBMKLOCPYGJ-UHFFFAOYSA-N 0.000 abstract description 6
- 238000006243 chemical reaction Methods 0.000 abstract description 5
- UYTSRQMXRROFPU-VMNATFBRSA-N 2-amino-2-deuterio-3-fluoropropanoic acid Chemical compound FCC(N)([2H])C(O)=O UYTSRQMXRROFPU-VMNATFBRSA-N 0.000 abstract description 3
- 230000002378 acidificating effect Effects 0.000 abstract description 2
- UYTSRQMXRROFPU-UHFFFAOYSA-N 2-azaniumyl-3-fluoropropanoate Chemical compound FCC(N)C(O)=O UYTSRQMXRROFPU-UHFFFAOYSA-N 0.000 abstract 1
- 229950010030 dl-alanine Drugs 0.000 abstract 1
- 230000000873 masking effect Effects 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical group CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- UYTSRQMXRROFPU-LIIDHCAMSA-N (2s)-2-amino-2-deuterio-3-fluoropropanoic acid Chemical compound FC[C@](N)([2H])C(O)=O UYTSRQMXRROFPU-LIIDHCAMSA-N 0.000 description 3
- QNAYBMKLOCPYGJ-UWTATZPHSA-N D-alanine Chemical compound C[C@@H](N)C(O)=O QNAYBMKLOCPYGJ-UWTATZPHSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 229960003767 alanine Drugs 0.000 description 3
- UYTSRQMXRROFPU-UWTATZPHSA-N (2s)-2-amino-3-fluoropropanoic acid Chemical compound FC[C@@H](N)C(O)=O UYTSRQMXRROFPU-UWTATZPHSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 150000001371 alpha-amino acids Chemical class 0.000 description 1
- 235000008206 alpha-amino acids Nutrition 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000011033 desalting Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C227/00—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C227/14—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton from compounds containing already amino and carboxyl groups or derivatives thereof
- C07C227/18—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton from compounds containing already amino and carboxyl groups or derivatives thereof by reactions involving amino or carboxyl groups, e.g. hydrolysis of esters or amides, by formation of halides, salts or esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C227/00—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C227/30—Preparation of optical isomers
- C07C227/34—Preparation of optical isomers by separation of optical isomers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/04—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C229/06—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton
- C07C229/08—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton the nitrogen atom of the amino group being further bound to hydrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/04—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C229/22—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated the carbon skeleton being further substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/34—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton containing six-membered aromatic rings
- C07C229/36—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton containing six-membered aromatic rings with at least one amino group and one carboxyl group bound to the same carbon atom of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton
- C07C237/04—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
- C07C237/06—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/42—Separation; Purification; Stabilisation; Use of additives
- C07C51/487—Separation; Purification; Stabilisation; Use of additives by treatment giving rise to chemical modification
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07B—GENERAL METHODS OF ORGANIC CHEMISTRY; APPARATUS THEREFOR
- C07B2200/00—Indexing scheme relating to specific properties of organic compounds
- C07B2200/07—Optical isomers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Analytical Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Fire-Extinguishing Compositions (AREA)
- Peptides Or Proteins (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/664,328 US4048224A (en) | 1976-03-05 | 1976-03-05 | Process for resolving alanine, 3-fluoro and 2-deutero-3-fluoro-DL-alanine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS195327B2 true CS195327B2 (en) | 1980-01-31 |
Family
ID=24665546
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS771133A CS195327B2 (en) | 1976-03-05 | 1977-02-21 | Process for cleavage of dl-mixtures of compounds of alanine |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4048224A (OSRAM) |
| JP (1) | JPS52106814A (OSRAM) |
| AT (1) | AT348501B (OSRAM) |
| CS (1) | CS195327B2 (OSRAM) |
| DD (1) | DD129642A5 (OSRAM) |
| DK (1) | DK67477A (OSRAM) |
| ES (1) | ES456379A1 (OSRAM) |
| FI (1) | FI770493A7 (OSRAM) |
| HU (1) | HU172989B (OSRAM) |
| NL (1) | NL7701643A (OSRAM) |
| NO (1) | NO770524L (OSRAM) |
| PL (1) | PL105883B1 (OSRAM) |
| PT (1) | PT66225B (OSRAM) |
| SE (1) | SE7701710L (OSRAM) |
| SU (1) | SU786887A3 (OSRAM) |
| YU (1) | YU49477A (OSRAM) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2749203C2 (de) * | 1977-11-03 | 1981-12-17 | Riedel-De Haen Ag, 3016 Seelze | Verfahren zur Racematspaltung von DL-alpha-Aminocarbonsäuren und diastereomere Salze |
| FR2430413A1 (fr) * | 1978-07-07 | 1980-02-01 | Anvar | Procede de preparation d'alpha-aminoacides optiquement actifs, et leurs derives |
| US4264590A (en) * | 1979-05-23 | 1981-04-28 | Abbott Laboratories | Antibacterial peptide |
| US4582931A (en) * | 1984-12-24 | 1986-04-15 | Merck & Co., Inc. | Preparation of 2-Deutero-D-serine |
| KR200234713Y1 (ko) | 1998-12-31 | 2001-11-22 | 구자홍 | 전동압축기의프레임지지장치 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3028395A (en) * | 1955-03-28 | 1962-04-03 | Parke Davis & Co | Process for the resolution of optically active acids |
| US3381031A (en) * | 1962-04-18 | 1968-04-30 | Univ Australian | Resolution of racemic amino acids |
-
1976
- 1976-03-05 US US05/664,328 patent/US4048224A/en not_active Expired - Lifetime
-
1977
- 1977-02-15 FI FI770493A patent/FI770493A7/fi not_active Application Discontinuation
- 1977-02-16 NL NL7701643A patent/NL7701643A/xx not_active Application Discontinuation
- 1977-02-16 DK DK67477A patent/DK67477A/da unknown
- 1977-02-16 SE SE7701710A patent/SE7701710L/xx unknown
- 1977-02-17 NO NO770524A patent/NO770524L/no unknown
- 1977-02-21 CS CS771133A patent/CS195327B2/cs unknown
- 1977-02-22 SU SU772454448A patent/SU786887A3/ru active
- 1977-02-22 YU YU00494/77A patent/YU49477A/xx unknown
- 1977-02-23 PT PT66225A patent/PT66225B/pt unknown
- 1977-02-28 ES ES456379A patent/ES456379A1/es not_active Expired
- 1977-03-02 AT AT138277A patent/AT348501B/de not_active IP Right Cessation
- 1977-03-02 DD DD7700197629A patent/DD129642A5/xx unknown
- 1977-03-03 JP JP2228177A patent/JPS52106814A/ja active Pending
- 1977-03-03 PL PL1977196414A patent/PL105883B1/pl unknown
- 1977-03-04 HU HU77ME00002047A patent/HU172989B/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI770493A7 (OSRAM) | 1977-09-06 |
| PT66225A (en) | 1977-03-01 |
| DD129642A5 (de) | 1978-02-01 |
| PL105883B1 (pl) | 1979-11-30 |
| PT66225B (en) | 1979-01-17 |
| SE7701710L (sv) | 1977-09-06 |
| JPS52106814A (en) | 1977-09-07 |
| NO770524L (no) | 1977-09-06 |
| AT348501B (de) | 1979-02-26 |
| DK67477A (da) | 1977-09-06 |
| ATA138277A (de) | 1978-07-15 |
| YU49477A (en) | 1982-06-30 |
| ES456379A1 (es) | 1978-04-16 |
| US4048224A (en) | 1977-09-13 |
| HU172989B (hu) | 1979-01-28 |
| NL7701643A (nl) | 1977-09-07 |
| SU786887A3 (ru) | 1980-12-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU604553B2 (en) | Azithromycin dihydrate | |
| US4224239A (en) | Process for preparing optically active amino acid or mandelic acid | |
| US2528267A (en) | Eobeet j | |
| US4757069A (en) | Pyridazodiazepine derivatives | |
| US4319040A (en) | Process for the production of optically active threo-3-(3,4-dihydroxyphenyl)serine | |
| EP0594099B1 (en) | Process for the purification of crude clavulanic acid | |
| EP0592643B1 (en) | Pleuromutilin derivatives | |
| US4914208A (en) | Optically active salts of a substituted thiazolidine-4-carboxylate and 3-chloro-2-hydroxypropyltrimethyl ammonium, their preparation and use | |
| CS195327B2 (en) | Process for cleavage of dl-mixtures of compounds of alanine | |
| CZ285157B6 (cs) | Způsob čištění 1-[N2-((S)-ethoxykarbonyl)-3-fenylpropyl)-N6-trifluoracetyl]-L-lysyl-L-prolinu | |
| EP0169300B1 (en) | Process for preparation of alpha-alkyl amino acids | |
| EP0253571B1 (en) | Process for resolution and race mization of amines with acidic alpha-hydrogens | |
| US4325886A (en) | Optical resolution of acylthiopropionic acid | |
| US4812478A (en) | Derivatives of L-amino acyl L-carnitine, process for their preparation and pharmaceutical compositions having hepatoprotecting activity containing same | |
| KR910004175B1 (ko) | 약리적 작용을 갖는 피리다진 유도체의 제조방법 | |
| CS254334B2 (en) | Method of phenylalanine derivatives production | |
| WO1985003932A1 (en) | Novel diastereomer salts of phenylalanine and n-acyl derivatives thereof and process for the separation of optically active phenylalanine and n-acyl derivatives thereof | |
| US4205183A (en) | Facile method for isolating resolved amino acids | |
| GB2169600A (en) | Process for preparing a basic thioether and the salt thereof | |
| EP0437566B1 (en) | Phenyl-glycine derivatives | |
| JP2507505B2 (ja) | セファロスポリン誘導体の新規製造方法 | |
| US5280122A (en) | Resolution of 2-benzyl-4-piperidone-succinic acid | |
| US4285884A (en) | Process for resolution of racemic DL-α-aminocarboxylic acids | |
| US4954624A (en) | Process for the production of cephalosporin derivatives | |
| US2766286A (en) | Process for the resolution of racemic threo-1-phenyl-2-amino-1. 3-propanediol |