CH495983A - Verfahren zur Herstellung von linksdrehendem 4-(2-Hydroxy-3-isopropylaminopropoxy)indol - Google Patents
Verfahren zur Herstellung von linksdrehendem 4-(2-Hydroxy-3-isopropylaminopropoxy)indolInfo
- Publication number
- CH495983A CH495983A CH198768A CH198768A CH495983A CH 495983 A CH495983 A CH 495983A CH 198768 A CH198768 A CH 198768A CH 198768 A CH198768 A CH 198768A CH 495983 A CH495983 A CH 495983A
- Authority
- CH
- Switzerland
- Prior art keywords
- isopropylaminopropoxy
- levorotatory
- indole
- hydroxy
- preparation
- Prior art date
Links
- JZQKKSLKJUAGIC-UHFFFAOYSA-N pindolol Chemical compound CC(C)NCC(O)COC1=CC=CC2=C1C=CN2 JZQKKSLKJUAGIC-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (21)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH198768A CH495983A (de) | 1968-02-09 | 1968-02-09 | Verfahren zur Herstellung von linksdrehendem 4-(2-Hydroxy-3-isopropylaminopropoxy)indol |
| CH1858668A CH543505A (de) | 1968-02-09 | 1968-12-13 | Verfahren zur Herstellung neuer Indolderivate |
| US783745A US3471515A (en) | 1965-02-01 | 1968-12-13 | (2-hydroxy-3-substituted aminopropoxy)indoles |
| FR1598040D FR1598040A (h) | 1968-02-09 | 1968-12-23 | |
| GB1251716D GB1251716A (h) | 1968-02-09 | 1969-01-13 | |
| GB1252399D GB1252399A (h) | 1968-02-09 | 1969-01-13 | |
| SE00616/69A SE340621B (h) | 1968-02-09 | 1969-01-17 | |
| DK26869AA DK119110B (da) | 1968-02-09 | 1969-01-17 | Fremgangsmåde til fremstilling af venstredrejende indolderivater eller syreadditionssalte heraf. |
| NL6900797A NL6900797A (h) | 1968-02-09 | 1969-01-17 | |
| NO0209/69A NO125590B (h) | 1968-02-09 | 1969-01-20 | |
| FI690158A FI50972C (fi) | 1968-02-09 | 1969-01-20 | Menetelmä terapeuttisesti arvokkaiden, vasemmalle kiertävien indolijoh dannaisten valmistamiseksi. |
| DE1905881A DE1905881C2 (de) | 1968-02-09 | 1969-02-06 | Neue linksdrehende Indol-Derivate und ihre Säureadditionssalze, ihre Herstellung und sie enthaltende Heilmittel |
| IE156/69A IE32639B1 (en) | 1968-02-09 | 1969-02-06 | Indole derivatives and a process for the production thereof |
| IE1664/71A IE32640B1 (en) | 1968-02-09 | 1969-02-06 | An indole derivative and a process for the production thereof |
| AT128169A AT299188B (de) | 1968-02-09 | 1969-02-07 | Verfahren zur Herstellung von neuen linksdrehenden Indolderivaten und ihren Salzen |
| BE728142D BE728142A (h) | 1968-02-09 | 1969-02-07 | |
| BR206200/69A BR6906200D0 (pt) | 1968-02-09 | 1969-02-07 | Processo de fabricacao de novos compostos heterociclicos |
| IL31570A IL31570A (en) | 1968-02-09 | 1969-02-07 | Laevorotatory indole derivatives,their production and pharmaceutical compositions containing them |
| PL13161569A PL69674B1 (h) | 1968-02-09 | 1969-02-07 | |
| ES363361A ES363361A1 (es) | 1968-02-09 | 1969-02-07 | Procedimiento para la produccion de un derivado de indol- levogiro. |
| FR183290A FR8067M (h) | 1968-02-09 | 1969-03-18 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH198768A CH495983A (de) | 1968-02-09 | 1968-02-09 | Verfahren zur Herstellung von linksdrehendem 4-(2-Hydroxy-3-isopropylaminopropoxy)indol |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH495983A true CH495983A (de) | 1970-09-15 |
Family
ID=4223253
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH198768A CH495983A (de) | 1965-02-01 | 1968-02-09 | Verfahren zur Herstellung von linksdrehendem 4-(2-Hydroxy-3-isopropylaminopropoxy)indol |
Country Status (14)
| Country | Link |
|---|---|
| AT (1) | AT299188B (h) |
| BE (1) | BE728142A (h) |
| BR (1) | BR6906200D0 (h) |
| CH (1) | CH495983A (h) |
| DE (1) | DE1905881C2 (h) |
| DK (1) | DK119110B (h) |
| FI (1) | FI50972C (h) |
| FR (2) | FR1598040A (h) |
| GB (2) | GB1252399A (h) |
| IE (1) | IE32639B1 (h) |
| IL (1) | IL31570A (h) |
| NL (1) | NL6900797A (h) |
| NO (1) | NO125590B (h) |
| SE (1) | SE340621B (h) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4182911A (en) | 1973-11-09 | 1980-01-08 | Imperial Chemical Industries Limited | Optically-active 1-aryloxy-2-propanol intermediates of (S)-absolute configuration |
| DE2454198C2 (de) * | 1974-11-15 | 1986-08-07 | Knoll Ag, 6700 Ludwigshafen | Isochinolin-Derivate, Verfahren zu ihrer Herstellung und Arzneimittel |
| CA1116598A (en) * | 1977-07-13 | 1982-01-19 | William T. Comer | 3-indolyl-tertiary butylaminopropanols |
| DE2905053A1 (de) * | 1979-02-08 | 1980-08-14 | Schering Ag | Verfahren zur herstellung von 1-(2-methylindol-4-yloxy)-2.3-epoxypropan |
| DE3029980A1 (de) * | 1980-08-08 | 1982-03-11 | Boehringer Mannheim Gmbh, 6800 Mannheim | Indolderivate und verfahren zu ihrer herstellung |
| DE3030047A1 (de) * | 1980-08-08 | 1982-03-11 | Boehringer Mannheim Gmbh, 6800 Mannheim | Neue aminopropanol-derivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1129072A (en) * | 1966-02-01 | 1968-10-02 | Ici Ltd | Benzofuran and indole derivatives |
| NL131726C (h) * | 1965-02-01 |
-
1968
- 1968-02-09 CH CH198768A patent/CH495983A/de not_active IP Right Cessation
- 1968-12-23 FR FR1598040D patent/FR1598040A/fr not_active Expired
-
1969
- 1969-01-13 GB GB1252399D patent/GB1252399A/en not_active Expired
- 1969-01-13 GB GB1251716D patent/GB1251716A/en not_active Expired
- 1969-01-17 DK DK26869AA patent/DK119110B/da unknown
- 1969-01-17 NL NL6900797A patent/NL6900797A/xx unknown
- 1969-01-17 SE SE00616/69A patent/SE340621B/xx unknown
- 1969-01-20 FI FI690158A patent/FI50972C/fi active
- 1969-01-20 NO NO0209/69A patent/NO125590B/no unknown
- 1969-02-06 IE IE156/69A patent/IE32639B1/xx unknown
- 1969-02-06 DE DE1905881A patent/DE1905881C2/de not_active Expired
- 1969-02-07 IL IL31570A patent/IL31570A/en unknown
- 1969-02-07 AT AT128169A patent/AT299188B/de not_active IP Right Cessation
- 1969-02-07 BE BE728142D patent/BE728142A/xx not_active IP Right Cessation
- 1969-02-07 BR BR206200/69A patent/BR6906200D0/pt unknown
- 1969-03-18 FR FR183290A patent/FR8067M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IE32639B1 (en) | 1973-10-17 |
| FI50972C (fi) | 1976-09-10 |
| FR8067M (h) | 1970-07-06 |
| NL6900797A (h) | 1969-08-12 |
| NO125590B (h) | 1972-10-02 |
| SE340621B (h) | 1971-11-29 |
| FR1598040A (h) | 1970-06-29 |
| GB1252399A (h) | 1971-11-03 |
| AT299188B (de) | 1972-06-12 |
| DK119110B (da) | 1970-11-16 |
| BE728142A (h) | 1969-08-07 |
| DE1905881C2 (de) | 1984-03-08 |
| BR6906200D0 (pt) | 1973-02-27 |
| FI50972B (h) | 1976-05-31 |
| DE1905881A1 (de) | 1969-09-25 |
| GB1251716A (h) | 1971-10-27 |
| IL31570A0 (en) | 1969-11-12 |
| IL31570A (en) | 1972-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH505824A (de) | Verfahren zur Herstellung von in 3-Stellung substituierten Indolen | |
| CH513786A (de) | Verfahren zur Herstellung von Styrylnaphthalin-Derivaten | |
| CH510683A (de) | Verfahren zur Herstellung von Indol-Derivaten | |
| CH520160A (de) | Verfahren zur Herstellung von Thioninderivaten | |
| CH495983A (de) | Verfahren zur Herstellung von linksdrehendem 4-(2-Hydroxy-3-isopropylaminopropoxy)indol | |
| CH476726A (de) | Verfahren zur Herstellung von Indolderivaten | |
| CH462167A (de) | Verfahren zur Herstellung 3-substituierter Phthalimidine | |
| CH503045A (de) | Verfahren zur Herstellung von Isoindolderivaten | |
| CH542187A (de) | Verfahren zur Herstellung von Triazenderivaten | |
| CH532581A (de) | Verfahren zur Herstellung von 14-Hydroxynormorphinonderivaten | |
| CH460780A (de) | Verfahren zur Herstellung von 3-Amino-methyl-1,3,4,5-tetrahydrobenz(cd)indolen | |
| CH529132A (de) | Verfahren zur Herstellung von 3-Indolylacetamidderivaten | |
| AT288420B (de) | Verfahren zur Herstellung von Sulfonylharnstoffderivaten | |
| AT289780B (de) | Verfahren zur Herstellung von 3-substituierten 7-Aminocumarinen | |
| AT293377B (de) | Verfahren zur Herstellung von Indolderivaten | |
| CH519458A (de) | Verfahren zur Herstellung von Isoprenoidchinonderivaten | |
| CH518956A (de) | Verfahren zur Herstellung von Isochinuclidin-Derivaten | |
| CH472406A (de) | Verfahren zur Herstellung von Indolen | |
| CH462813A (de) | Verfahren zur Herstellung von Indolderivaten | |
| CH511243A (de) | Verfahren zur Herstellung von Diaminostilbenderivaten | |
| CH513863A (de) | Verfahren zur Herstellung von Benzomorphanderivaten | |
| CH507978A (de) | Verfahren zur Herstellung von 5-Nitrofuranderivaten | |
| CH529135A (de) | Verfahren zur Herstellung von Cycloalkanochinolonderivaten | |
| CH521949A (de) | Verfahren zur Herstellung von Formamido-cycloalkanderivaten | |
| CH517112A (de) | Verfahren zur Herstellung von N-Glykoluril-Derivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |