CH468998A - Verfahren zur Herstellung von 2,3-Dihydro-2,2-dimethyl-7-benzofuranyl-N-methylcarbamat - Google Patents
Verfahren zur Herstellung von 2,3-Dihydro-2,2-dimethyl-7-benzofuranyl-N-methylcarbamatInfo
- Publication number
- CH468998A CH468998A CH158566A CH158566A CH468998A CH 468998 A CH468998 A CH 468998A CH 158566 A CH158566 A CH 158566A CH 158566 A CH158566 A CH 158566A CH 468998 A CH468998 A CH 468998A
- Authority
- CH
- Switzerland
- Prior art keywords
- methylcarbamate
- benzofuranyl
- dihydro
- dimethyl
- preparation
- Prior art date
Links
- DUEPRVBVGDRKAG-UHFFFAOYSA-N carbofuran Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2 DUEPRVBVGDRKAG-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/01—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by replacing functional groups bound to a six-membered aromatic ring by hydroxy groups, e.g. by hydrolysis
- C07C37/055—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by replacing functional groups bound to a six-membered aromatic ring by hydroxy groups, e.g. by hydrolysis the substituted group being bound to oxygen, e.g. ether group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/86—Benzo [b] furans; Hydrogenated benzo [b] furans with an oxygen atom directly attached in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Furan Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US43045665A | 1965-02-04 | 1965-02-04 | |
| US43046165A | 1965-02-04 | 1965-02-04 | |
| US43046065A | 1965-02-04 | 1965-02-04 | |
| US430455A US3356690A (en) | 1965-02-04 | 1965-02-04 | Synthesis of 2, 3-dihydro-2, 2-dimethyl-7-benzofuranyl nu-methylcarbamate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH468998A true CH468998A (de) | 1969-02-28 |
Family
ID=27503784
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH158566A CH468998A (de) | 1965-02-04 | 1966-02-04 | Verfahren zur Herstellung von 2,3-Dihydro-2,2-dimethyl-7-benzofuranyl-N-methylcarbamat |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3356690A (OSRAM) |
| BE (1) | BE676025A (OSRAM) |
| BR (1) | BR6676881D0 (OSRAM) |
| CH (1) | CH468998A (OSRAM) |
| DE (1) | DE1543569B1 (OSRAM) |
| GB (2) | GB1139002A (OSRAM) |
| IL (1) | IL25034A (OSRAM) |
| NL (1) | NL6601012A (OSRAM) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3419579A (en) * | 1966-02-23 | 1968-12-31 | Fmc Corp | Synthesis of 2,3-dihydro-2,2-dimethyl-7-benzofuranol |
| US3455961A (en) * | 1966-02-23 | 1969-07-15 | Fmc Corp | Synthesis of 2,3-dihydro-2,2,4-trimethyl-7-benzofuranol |
| US4118400A (en) * | 1977-09-22 | 1978-10-03 | Fmc Corporation | Process for preparing 2,3-dihydro-7-benzofuranols and benzodioxole intermediate therefor |
| FR2461708A1 (fr) | 1979-07-18 | 1981-02-06 | Rhone Poulenc Agrochimie | Preparation de dihydrodimethylhydroxy-7 benzofurane |
| US4380654A (en) * | 1982-02-18 | 1983-04-19 | Fmc Corporation | Process for preparation of 2,3-dihydro-2,2-dimethyl-7-hydroxybenzofuran |
| JPS58174339A (ja) * | 1982-04-07 | 1983-10-13 | Mitsubishi Chem Ind Ltd | 2,2−ジハロ−6−ハロ−6−(1−ハロイソブチル)シクロヘキサノン |
| JPS6133183A (ja) * | 1984-07-25 | 1986-02-17 | Mitsubishi Chem Ind Ltd | 2,3−ジヒドロ−7−アミノベンゾフランの製造法 |
| US5017174A (en) * | 1990-01-18 | 1991-05-21 | Gowrylow Felicia B | Nursing pad |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2323781A (en) * | 1938-12-30 | 1943-07-06 | Rohm & Haas | Preparation of allyl alcohol and its homologues |
| US3073848A (en) * | 1958-10-14 | 1963-01-15 | Wasson Burton Kendall | Tetrahydrofurfuryl carbamates |
| NL131921C (OSRAM) * | 1963-06-28 |
-
1965
- 1965-02-04 US US430455A patent/US3356690A/en not_active Expired - Lifetime
-
1966
- 1966-01-23 IL IL25034A patent/IL25034A/xx unknown
- 1966-01-26 NL NL6601012A patent/NL6601012A/xx unknown
- 1966-02-02 BR BR176881/66A patent/BR6676881D0/pt unknown
- 1966-02-03 BE BE676025D patent/BE676025A/xx unknown
- 1966-02-03 GB GB14386/68A patent/GB1139002A/en not_active Expired
- 1966-02-03 DE DE19661543569 patent/DE1543569B1/de active Pending
- 1966-02-03 GB GB4715/66A patent/GB1139001A/en not_active Expired
- 1966-02-04 CH CH158566A patent/CH468998A/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3356690A (en) | 1967-12-05 |
| IL25034A (en) | 1970-05-21 |
| NL6601012A (OSRAM) | 1966-08-05 |
| BR6676881D0 (pt) | 1973-09-06 |
| BE676025A (OSRAM) | 1966-08-03 |
| GB1139002A (en) | 1969-01-08 |
| GB1139001A (en) | 1969-01-08 |
| DE1543569B1 (de) | 1971-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH487894A (de) | Verfahren zur Herstellung von 1,2,3,4-Tetrahydro-9-aminoacridinen | |
| AT271479B (de) | Verfahren zur Herstellung von 2,4-Diamino-5-benzylpyrimidinen | |
| CH493519A (de) | Verfahren zur Herstellung von 2,3-Pyridindiol | |
| CH485775A (de) | Verfahren zur Herstellung von 9-B-D-Ribofuranosyl-7-deazapurin-3',5'-cyclophosphaten | |
| CH485694A (de) | Verfahren zur Herstellung von 4,7a-Dimethyl-4-androstenen | |
| CH468998A (de) | Verfahren zur Herstellung von 2,3-Dihydro-2,2-dimethyl-7-benzofuranyl-N-methylcarbamat | |
| CH476718A (de) | Verfahren zur Herstellung von 2,3-Dihydro-2,2-dimethyl-7-benzofuranol | |
| AT270678B (de) | Verfahren zur Herstellung von 1,6-Dibrom-1,6-didesoxy-dulcit | |
| CH488682A (de) | Verfahren zur Herstellung von 4,9,11-Trienen der 19-Nor-androstanreihe | |
| CH459196A (de) | Verfahren zur Herstellung von 4,6-Pregnadienderivaten | |
| CH481919A (de) | Verfahren zur Herstellung von basisch substituierten Derivaten des 5,6-Dihydro-dibenz-(b,e)-azepin-6,11-dion-11-oxims | |
| CH482714A (de) | Verfahren zur Herstellung von substituierten 1,3,4-Oxathiazol-2-onen | |
| AT259771B (de) | Verfahren zur Herstellung von 6,7-Benzomorphanen | |
| CH471072A (de) | Verfahren zur Herstellung von 3,4-Dihydroxy-phenyl-alkanolaminen | |
| CH516548A (de) | Verfahren zur Herstellung von 2,3-Dihydro-2,2-dimethyl-7-acetamidobenzofuran | |
| CH480354A (de) | Verfahren zur Herstellung von substituierten 1,3-Oxathiol-2-onen | |
| CH481057A (de) | Verfahren zur Herstellung von 1,3-Diaminoadamantanen | |
| CH487170A (de) | Verfahren zur Herstellung von 1,4-Diazacycloheptanen | |
| CH467761A (de) | Verfahren zur Herstellung von 1,2-Epoxy-9B,10a-steroiden | |
| AT260894B (de) | Verfahren zur Herstellung von 1,4-Dicyanbuten-(2) | |
| CH471855A (de) | Verfahren zur Herstellung von 1,2-Dihydroxy-anthrachinonderivaten | |
| CH472395A (de) | Verfahren zur Herstellung von 5,(10),7-Dehydrosteroiden | |
| CH471799A (de) | Verfahren zur Herstellung von 1,4-Benzodiazepinen | |
| CH483415A (de) | Verfahren zur Herstellung von 3-Alkoxy-6-cyan-3,5-pregnadienen | |
| CH482638A (de) | Verfahren zur Herstellung von 1,3-Dicarbonylverbindungen |