CH427398A - Triphenylzinnverbindungen enthaltende fungizide Präparate - Google Patents
Triphenylzinnverbindungen enthaltende fungizide PräparateInfo
- Publication number
- CH427398A CH427398A CH606961A CH606961A CH427398A CH 427398 A CH427398 A CH 427398A CH 606961 A CH606961 A CH 606961A CH 606961 A CH606961 A CH 606961A CH 427398 A CH427398 A CH 427398A
- Authority
- CH
- Switzerland
- Prior art keywords
- preparations containing
- fungicidal preparations
- triphenyltin compounds
- containing triphenyltin
- compounds
- Prior art date
Links
- 230000000855 fungicidal effect Effects 0.000 title 1
- 238000002360 preparation method Methods 0.000 title 1
- SBXWFLISHPUINY-UHFFFAOYSA-N triphenyltin Chemical class C1=CC=CC=C1[Sn](C=1C=CC=CC=1)C1=CC=CC=C1 SBXWFLISHPUINY-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/22—Tin compounds
- C07F7/2224—Compounds having one or more tin-oxygen linkages
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/22—Tin compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL252064 | 1960-05-27 | ||
| NL255046 | 1960-08-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH427398A true CH427398A (de) | 1966-12-31 |
Family
ID=26641722
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH606961A CH427398A (de) | 1960-05-27 | 1961-05-24 | Triphenylzinnverbindungen enthaltende fungizide Präparate |
Country Status (9)
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3268401A (en) * | 1966-08-23 | Vermiculite test | ||
| NL236826A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1959-03-05 | 1900-01-01 | ||
| CH427404A (de) * | 1962-05-25 | 1966-12-31 | Monsanto Co | Mittel zur Bekämpfung von Schädlingen, zur Behandlung von Kulturpflanzen oder Saatgut zwecks Wachstumssteigerung, und zur Vernichtung von unerwünschten Pflanzen |
| US3361554A (en) * | 1963-05-20 | 1968-01-02 | Monsanto Co | Method for preventing plant growth with organotin borates |
| US3247055A (en) * | 1963-10-28 | 1966-04-19 | Allied Chem | Insect chemosterilant |
| DE1542768C2 (de) * | 1964-05-16 | 1970-12-17 | Farbwerke Hoechst AG, vorm. Meister Lucius & Brüning, 6000 Frankfurt | Fungizide Mittel |
| US3483295A (en) * | 1967-11-24 | 1969-12-09 | Thompson Chem Co Hayward | The control of rice blast disease on rice plants using triphenyltin compounds |
| US3523961A (en) * | 1968-01-02 | 1970-08-11 | M & T Chemicals Inc | Process for preparing dioctyltin maleate |
| US3952105A (en) * | 1972-03-27 | 1976-04-20 | Scm Corporation | Organometallic agricultural fungicidal compositions and methods for making and using same |
| JPS5940124B2 (ja) * | 1978-01-20 | 1984-09-28 | イハラケミカル工業株式会社 | 水中生物付着防止剤 |
| US4581373A (en) * | 1983-01-19 | 1986-04-08 | The Dow Chemical Company | Derivatives of biologically active substituted tin compounds, emulsifiable concentrates of said derivatives and method of controlling plant infestations |
| DE3404253A1 (de) * | 1984-02-07 | 1985-08-08 | Lentia GmbH Chem. u. pharm. Erzeugnisse - Industriebedarf, 8000 München | 1,3,2-dioxaborinane |
| GB8918807D0 (en) * | 1989-08-17 | 1989-09-27 | Shell Int Research | A solid pesticidal formulation,a process for its preparation and the use thereof |
| WO1993022913A1 (en) * | 1992-05-12 | 1993-11-25 | Church & Dwight Company, Inc. | Blended fungicide compositions |
| AU3917393A (en) * | 1992-05-12 | 1993-12-13 | Church & Dwight Company, Inc. | Fungicide compositions |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2614061A (en) * | 1948-05-03 | 1952-10-14 | Sherwin Williams Co | Method of preparing ddt dispersions using carboxy methyl cellulose |
| US2721861A (en) * | 1951-10-01 | 1955-10-25 | Laurene O Paterson | Process of preparing an aluminum caseinate |
| US2836540A (en) * | 1952-03-19 | 1958-05-27 | Hardt Foundation | Pharmaceutical antacid composition |
| US2774710A (en) * | 1952-12-15 | 1956-12-18 | Organon | Pharmaceutical preparation for the treatment of hyperacidity |
| US2876160A (en) * | 1954-07-26 | 1959-03-03 | Corn Prod Refining Co | Starch matrix material containing imbedded material and process for preparing same |
| US2868820A (en) * | 1954-05-08 | 1959-01-13 | Wacker Chemie Gmbh | Preparation of hexaorganodistannoxane and triorganotin hydroxide |
| US2922738A (en) * | 1955-05-17 | 1960-01-26 | Exxon Research Engineering Co | Fungicidal compositions |
| DE1021627B (de) * | 1956-09-11 | 1957-12-27 | Hoechst Ag | Verfahren zum Behandeln von lebenden Pflanzen |
| US3031483A (en) * | 1957-11-18 | 1962-04-24 | Philips Corp | Method of producing organic tin compounds and preparations containing such compoundsfor combating noxious micro-organisms |
| NL256065A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1959-10-01 | |||
| US3062708A (en) * | 1960-01-04 | 1962-11-06 | Minnesota Mining & Mfg | Aromatic borane thallophyticides |
-
0
- BE BE604225D patent/BE604225A/xx unknown
- NL NL126846D patent/NL126846C/xx active
- NL NL128945D patent/NL128945C/xx active
- NL NL252064D patent/NL252064A/xx unknown
-
1961
- 1961-05-15 US US109805A patent/US3140977A/en not_active Expired - Lifetime
- 1961-05-24 DK DK211361AA patent/DK116103B/da unknown
- 1961-05-24 ES ES0267637A patent/ES267637A1/es not_active Expired
- 1961-05-24 GB GB18738/61A patent/GB986229A/en not_active Expired
- 1961-05-24 CH CH606961A patent/CH427398A/de unknown
- 1961-05-24 DE DEN20087A patent/DE1203532B/de active Pending
-
1964
- 1964-12-19 OA OA50921A patent/OA00835A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB986229A (en) | 1965-03-17 |
| DK116103B (da) | 1969-12-08 |
| US3140977A (en) | 1964-07-14 |
| BE604225A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| ES267637A1 (es) | 1961-11-16 |
| NL126846C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| NL128945C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| NL252064A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| DE1203532B (de) | 1965-10-21 |
| OA00835A (fr) | 1967-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT257267B (de) | Fungizide Zusammensetzung | |
| CH427398A (de) | Triphenylzinnverbindungen enthaltende fungizide Präparate | |
| FR1267479A (fr) | Aquarium | |
| AT255818B (de) | Mähdrescher | |
| CH411452A (fr) | Composition fongicide | |
| CH418054A (fr) | Composition fongicide | |
| MY6800100A (en) | Fungicidal preparations | |
| CH397832A (de) | Potentiometer | |
| AT221772B (de) | Abdeckung | |
| CH405004A (de) | Fungizides Mittel | |
| CH413408A (de) | Kreiselgerät | |
| CH407645A (fr) | Composition fongicide | |
| CH395628A (de) | Fungizidpräparate | |
| CH393824A (de) | Fungizides Mittel | |
| FR1292805A (fr) | Potentiomètre | |
| BR6133733D0 (pt) | Composicoes fungicidas | |
| AT224384B (de) | Fungizides Mittel | |
| AT244685B (de) | Fungizide Zusammensetzungen | |
| FR1268843A (fr) | Coussin-matelas antiseptique | |
| CH440825A (de) | Parasitizide Zusammensetzung | |
| CH378579A (de) | Sichel | |
| FR1249702A (fr) | Capsule | |
| AT247664B (de) | Fungizide Zusammensetzung | |
| FI35629A (fi) | Fungicid komposition | |
| ES87121Y (es) | Balanza compuesta |