CH308691A - Verfahren zur Herstellung von 4-(Sulfanilyl)-2,6-dimethoxypyrimidin. - Google Patents
Verfahren zur Herstellung von 4-(Sulfanilyl)-2,6-dimethoxypyrimidin.Info
- Publication number
- CH308691A CH308691A CH308691DA CH308691A CH 308691 A CH308691 A CH 308691A CH 308691D A CH308691D A CH 308691DA CH 308691 A CH308691 A CH 308691A
- Authority
- CH
- Switzerland
- Prior art keywords
- sulfanilyl
- dimethoxypyrimidine
- preparation
- Prior art date
Links
- ZSWPSPLCCMIQIS-UHFFFAOYSA-N 4-(2,6-dimethoxypyrimidin-4-yl)sulfonylaniline Chemical compound COC1=NC(OC)=CC(S(=O)(=O)C=2C=CC(N)=CC=2)=N1 ZSWPSPLCCMIQIS-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/69—Benzenesulfonamido-pyrimidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT308691X | 1951-09-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH308691A true CH308691A (de) | 1955-07-31 |
Family
ID=3671297
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH308691D CH308691A (de) | 1951-09-10 | 1952-09-02 | Verfahren zur Herstellung von 4-(Sulfanilyl)-2,6-dimethoxypyrimidin. |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2703800A (show.php) |
| CH (1) | CH308691A (show.php) |
| DE (1) | DE932009C (show.php) |
| GB (1) | GB719279A (show.php) |
| NL (1) | NL83022C (show.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3053827A (en) * | 1958-12-08 | 1962-09-11 | Ici Ltd | 4-sulfanilamido-2, 6-dihalopyrimidine derivatives |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB866843A (en) * | 1958-12-08 | 1961-05-03 | Ici Ltd | Sulphonamidopyrimidines |
| DE1101428B (de) * | 1959-07-08 | 1961-03-09 | Schering Ag | Verfahren zur Herstellung langwirkender Aminobenzolsulfonsaeure-amidderivate |
| US3055886A (en) * | 1960-02-12 | 1962-09-25 | American Cyanamid Co | Process for condensation of sulfanilamide with halodiazines |
| US3249603A (en) * | 1960-08-09 | 1966-05-03 | Hoffmann La Roche | Novel pyrimidine sulfanilamides and processes for their preparation |
| DE1175680B (de) * | 1961-02-22 | 1964-08-13 | Schering Ag | Verfahren zur Herstellung von 2-Sulfonamidopyrimidinderivaten |
| US3422098A (en) * | 1962-12-14 | 1969-01-14 | Ciba Geigy Corp | Sulfanilamido-pyrimidines |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2407966A (en) * | 1939-08-02 | 1946-09-17 | Sharp & Dohme Inc | Diazine compounds |
| US2478146A (en) * | 1940-12-26 | 1949-08-02 | American Cyanamid Co | Benzenesulfonylthiazoles and preparation of the same |
| BE477745A (show.php) * | 1941-07-25 | |||
| GB575005A (en) * | 1943-12-01 | 1946-01-30 | Francis Leslie Rose | New sulphanilamide derivatives |
| GB589040A (en) * | 1944-06-07 | 1947-06-10 | Siegfried Pickholz | Improvements in or relating to the production of sulphonamides |
-
0
- NL NL83022D patent/NL83022C/xx active
-
1952
- 1952-08-25 US US306296A patent/US2703800A/en not_active Expired - Lifetime
- 1952-09-02 CH CH308691D patent/CH308691A/de unknown
- 1952-09-05 GB GB22413/52A patent/GB719279A/en not_active Expired
- 1952-09-07 DE DEO2534A patent/DE932009C/de not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3053827A (en) * | 1958-12-08 | 1962-09-11 | Ici Ltd | 4-sulfanilamido-2, 6-dihalopyrimidine derivatives |
Also Published As
| Publication number | Publication date |
|---|---|
| US2703800A (en) | 1955-03-08 |
| NL83022C (show.php) | |
| GB719279A (en) | 1954-12-01 |
| DE932009C (de) | 1955-08-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH308691A (de) | Verfahren zur Herstellung von 4-(Sulfanilyl)-2,6-dimethoxypyrimidin. | |
| CH310646A (de) | Verfahren zur Herstellung von 3-(p-Oxy-phenyl)-6-carboxy-1,6-dimethyl-cyklohexan. | |
| CH307970A (de) | Verfahren zur Herstellung von Chlorfluoräthenen. | |
| CH322063A (de) | Verfahren zur Darstellung von 4-(Pyridin-3-carbonsäureamido bzw. -alkylamido)-2,3-dimethyl-1-phenyl-5-pyrazolon | |
| CH307008A (de) | Verfahren zur Herstellung von Lösungen von Polyacrylnitril. | |
| CH305417A (de) | Verfahren zur Herstellung von 5-Methyl-6-keto-perhydro-naphthalin-1,4-diol. | |
| CH305570A (de) | Verfahren zur Herstellung von 1-/aN-Diäthylaminoacetyl/-xylidid-(2,6). | |
| DK79070C (da) | Fremgangsmåde til fremstilling af I,4-dihydrazino-ftalaziner. | |
| AT184574B (de) | Verfahren zur Herstellung von 4-(p-Aminobenzolsulfonyl)-amino-2,6-dimethylpyrimidin | |
| AT185812B (de) | Verfahren zur Herstellung von 4-(p-Aminobenzolsulfonyl)-amino-2,6-dimethylpyrimidin | |
| DK77173C (da) | Fremgangsmåde til fremstilling af 1-(3',4'-dioksyfenyl)-2-aralkylamino-ætanoler-(1). | |
| DK77656C (da) | Fremgangsmåde til fremstilling af 1-(3',4'-dioksyfenyl)-2-aralkylaminopropanol-(1). | |
| DK77757C (da) | Fremgangsmåde til fremstilling af 1-(3',4'-dioksyfenyl)2-aralkyl-aminoætanoler-(1). | |
| DK78198C (da) | Fremgangsmåde til fremstilling af 1-(3',4'-dioksfenyl)-2-aralkylamino-propanoler-(1). | |
| DK79831C (da) | Fremgangsmåde til fremstilling af 1-(3',4'-dioksyfenyl)-2-aralkylamino-propanoler-(1). | |
| DK80281C (da) | Fremgangsmåde til fremstilling af 1-(3',4'-dioksyfenyl)-2-fenylalkylamino-propanoner-(1). | |
| DK81103C (da) | Fremgangsmåde til fremstilling af 1-(3',4'-dioksyfenyl)-2-fenylalkylamino-propanoner-(1). | |
| DK81918C (da) | Fremgangsmåde til fremstilling af 1-(3',4'-dioksyfenyl)-2-aralkylamino-propanoler-(1). | |
| DK82989C (da) | Fremgangsmåde til fremstilling af 1-(3',4'-dioksyfenyl)-2-fenylalkylamino-propanoner-(1). | |
| DK78130C (da) | Fremgangsmåde ti fremstilling af 2-metyl-3-fytyl-1,4-naftohydrokinon. | |
| DK78381C (da) | Fremgangsmåde til fremstilling af 2,5-dialkoxy-3,4-dihydroxy-tetrahydrofuraner. | |
| DK78768C (da) | Fremgangsmåde til fremstilling af 5,8-peroxyder af steroid-22-aldehyder. | |
| DK82180C (da) | Fremgangsmåde til fremstilling af 2,6-dioksopiperidiner. | |
| DK76563C (da) | Fremgangsmåde til fremstilling af d-treo-1-p-nitrofenyl-2-dikloracetamido-propandiol-1,3. | |
| DK81302C (da) | Fremgangsmåde til fremstilling af D,L-dihydro-nor-lysergyl-glycinamid. |