CA569011A - Water soluble colour salts of monoazo dyestuffs - Google Patents
Water soluble colour salts of monoazo dyestuffsInfo
- Publication number
- CA569011A CA569011A CA569011A CA569011DA CA569011A CA 569011 A CA569011 A CA 569011A CA 569011 A CA569011 A CA 569011A CA 569011D A CA569011D A CA 569011DA CA 569011 A CA569011 A CA 569011A
- Authority
- CA
- Canada
- Prior art keywords
- water soluble
- monoazo dyestuffs
- soluble colour
- salts
- colour salts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical class [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B27/00—Preparations in which the azo group is formed in any way other than by diazotising and coupling, e.g. oxidation
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B44/00—Azo dyes containing onium groups
- C09B44/10—Azo dyes containing onium groups containing cyclammonium groups attached to an azo group by a carbon atom of the ring system
- C09B44/12—Azo dyes containing onium groups containing cyclammonium groups attached to an azo group by a carbon atom of the ring system having one nitrogen atom as the only ring hetero atom
- C09B44/126—Azo dyes containing onium groups containing cyclammonium groups attached to an azo group by a carbon atom of the ring system having one nitrogen atom as the only ring hetero atom in a six-membered ring, e.g. pyrridinium, quinolinium
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH793587X | 1955-01-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA569011A true CA569011A (en) | 1959-01-13 |
Family
ID=4537144
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA569011A Expired CA569011A (en) | 1955-01-28 | Water soluble colour salts of monoazo dyestuffs |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US2864813A (h) |
| BE (1) | BE544768A (h) |
| CA (1) | CA569011A (h) |
| CH (1) | CH340928A (h) |
| DE (1) | DE1061923B (h) |
| FR (1) | FR1145752A (h) |
| GB (1) | GB793587A (h) |
| IT (1) | IT555459A (h) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE963176C (de) * | 1954-07-05 | 1957-05-02 | Basf Ag | Verfahren zur Herstellung von Azofarbstoffen |
| BE543605A (h) * | 1954-12-15 | |||
| DE1117233B (de) | 1955-06-14 | 1961-11-16 | Basf Ag | Verfahren zur Herstellung basischer sulfonsaeuregruppenfreier Azofarbstoffe |
| US2893816A (en) * | 1957-03-01 | 1959-07-07 | American Cyanamid Co | Polyacrylonitriles dyed with quaternized heterocyclic azo dyes |
| US3151106A (en) * | 1958-09-30 | 1964-09-29 | American Cyanamid Co | Pyridinium azo dyes and process for their production |
| US3051697A (en) * | 1958-10-06 | 1962-08-28 | American Cyanamid Co | Azomonazone n-oxides, production and deoxygenation |
| DE1151612B (de) * | 1959-04-17 | 1963-07-18 | Basf Ag | Verfahren zur Herstellung basischer Farbstoffe |
| US3118871A (en) * | 1960-12-12 | 1964-01-21 | American Cyanamid Co | Monazinium azo compounds |
| US3330617A (en) * | 1961-11-10 | 1967-07-11 | American Cyanamid Co | Polymeric fibers colored with cationic dyestuffs |
| US3312681A (en) * | 1961-11-10 | 1967-04-04 | American Cyanamid Co | Cationic 1-alkyl-3-(2-hydroxy-1-naphthylazo) pyridinium dyes |
| US3192195A (en) * | 1962-10-22 | 1965-06-29 | Du Pont | Azostyryl cationic dyes |
| LU70835A1 (h) * | 1974-08-30 | 1976-08-19 | ||
| LU71015A1 (h) * | 1974-09-27 | 1976-08-19 | ||
| CH606318A5 (h) * | 1974-10-29 | 1978-10-31 | Ciba Geigy Ag | |
| CH606300A5 (h) * | 1975-01-03 | 1978-10-31 | Ciba Geigy Ag | |
| US4138396A (en) * | 1975-01-03 | 1979-02-06 | Ciba-Geigy Corporation | Pyridyl-azo-indolyl cationic dyes |
| US4148642A (en) * | 1978-03-07 | 1979-04-10 | Eastman Kodak Company | Photographic products and processes employing nondiffusible 1-arylazo-4-isoquinolinol dye-releasing compounds |
| US4357411A (en) * | 1981-07-13 | 1982-11-02 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 2-(2-pyridylazo)-4,5-bis(tertiary amino)phenol black dye-releasing compounds and precursors thereof |
| US4357410A (en) * | 1981-07-13 | 1982-11-02 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazo(dialkylamino) phenol magenta dye-releasing compounds and precursors thereof |
| US4368248A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 2-(2-pyridylazo)-4,5-bis(tertiary amino)phenol black dye-releasing compounds and precursors thereof |
| US4368153A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 2-(2-pyridylazo)-4,5-bis(tertiary amino)phenol black dye-releasing compounds and precursors thereof |
| US4368154A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible bridged azoaminophenol magenta dye-releasing compounds and precursors thereof |
| US4368249A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazo(dialkylamino)phenol magenta dye-releasing compounds and precursors thereof |
| US4357412A (en) * | 1981-07-13 | 1982-11-02 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible bridged azoaminophenol magenta dye-releasing compounds and precursors thereof |
| US4366218A (en) * | 1981-07-13 | 1982-12-28 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible bridged azdaminophenol magenta dye-releasing compounds and precursors thereof |
| US4367174A (en) * | 1981-07-13 | 1983-01-04 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazo(dialkylamino)phenol magenta dye-releasing compounds and precursors thereof |
| US4562248A (en) * | 1983-11-25 | 1985-12-31 | Eastman Kodak Company | Azo dyes from unsubstituted or substituted 3-amino-pyridine and aryl or heterocyclic couplers |
| FR2920778B1 (fr) * | 2007-09-11 | 2009-10-30 | Oreal | Composes quinoliniums azoiques a motif disulfure/thiol, compositions les comprenant, procede de coloration de fibres keratiniques et dispositif. |
| FR2921382B1 (fr) | 2007-09-21 | 2009-10-30 | Oreal | Colorant derive de phenyl-pyridol[1,2-a]indolium thiol-disulfure, composition tinctoriale comprenant ce colorant, procede d'eclaircissement des matieres keratiniques a partir de ce colorant |
| FR2921258A1 (fr) * | 2007-09-24 | 2009-03-27 | Oreal | Composition tinctoriale comprenant au moins un precurseur incolore disulfures/thiol, proced de coloration a partir de la composition |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2022921A (en) * | 1931-11-07 | 1935-12-03 | Winthrop Chem Co Inc | Amino azo compound |
| DE622596C (de) * | 1932-12-09 | 1935-12-02 | I G Farbenindustrie Akt Ges | Verfahren zur Darstellung basischer Azoverbindungen der Chinolinreihe |
| US2135293A (en) * | 1936-08-20 | 1938-11-01 | Pyridium Corp | Medicinal azo dyes |
| US2283220A (en) * | 1939-06-02 | 1942-05-19 | Eastman Kodak Co | Azo compounds and material colored therewith |
| US2294390A (en) * | 1939-09-29 | 1942-09-01 | Pacific Foundry Company Ltd | Cremator |
| US2744105A (en) * | 1952-05-10 | 1956-05-01 | Du Pont | Azonitriles containing quaternary ammonium salt groups |
-
0
- BE BE544768D patent/BE544768A/xx unknown
- IT IT555459D patent/IT555459A/it unknown
- CA CA569011A patent/CA569011A/en not_active Expired
-
1955
- 1955-01-28 CH CH340928D patent/CH340928A/de unknown
-
1956
- 1956-01-23 US US560872A patent/US2864813A/en not_active Expired - Lifetime
- 1956-01-27 FR FR1145752D patent/FR1145752A/fr not_active Expired
- 1956-01-27 GB GB2739/56A patent/GB793587A/en not_active Expired
- 1956-01-27 DE DEG18866A patent/DE1061923B/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR1145752A (fr) | 1957-10-29 |
| GB793587A (en) | 1958-04-16 |
| BE544768A (h) | |
| IT555459A (h) | |
| US2864813A (en) | 1958-12-16 |
| CH340928A (de) | 1959-09-15 |
| DE1061923B (de) | 1959-07-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA569010A (en) | Water soluble colour salts of monoazo dyestuffs | |
| CA569011A (en) | Water soluble colour salts of monoazo dyestuffs | |
| CA570913A (en) | Water soluble dye salt | |
| CA511166A (en) | Azo dyestuffs | |
| MY6000044A (en) | New monoazo dyestuffs containing dichlorltriazinylamino groups | |
| AU209672B2 (en) | New monoazo dyestuffs | |
| AU211562B2 (en) | New monoazo dyestuffs | |
| AU211796B2 (en) | New monoazo dyestuffs | |
| CA511437A (en) | Metallizable monoazo dyestuffs | |
| CA512895A (en) | Azo dyestuffs | |
| AU1384755A (en) | New monoazo dyestuffs | |
| AU1384655A (en) | New monoazo dyestuffs | |
| AU1376655A (en) | New monoazo dyestuffs | |
| CA514853A (en) | Tetrakisazo dyestuffs | |
| CA519937A (en) | Monoazo dyestuffs of the pyrazolone series | |
| CA512203A (en) | Pigments from diazotized 2-chloro-5-aminoethylbenzene-4-sulfonic acid and 2-hydroxy-3-naphthoic acid | |
| CA515749A (en) | Manufacture of new disazo dyestuffs | |
| AU211062B2 (en) | Metallisable azo dyestuffs | |
| AU207849B2 (en) | Metallisable azo dyestuffs | |
| AU207755B2 (en) | Process forthe production of water soluble dye salts | |
| CA519267A (en) | Complex copper compounds of disazo dyestuffs | |
| CA512438A (en) | Water turbine | |
| AU1329855A (en) | Metallisable azo dyestuffs | |
| AU1146555A (en) | Metallisable azo dyestuffs | |
| AU1443755A (en) | Process forthe production of water soluble dye salts |