CA3148713A1 - New treatments involving mirna-193a - Google Patents
New treatments involving mirna-193a Download PDFInfo
- Publication number
- CA3148713A1 CA3148713A1 CA3148713A CA3148713A CA3148713A1 CA 3148713 A1 CA3148713 A1 CA 3148713A1 CA 3148713 A CA3148713 A CA 3148713A CA 3148713 A CA3148713 A CA 3148713A CA 3148713 A1 CA3148713 A1 CA 3148713A1
- Authority
- CA
- Canada
- Prior art keywords
- mirna
- cancer
- use according
- pten
- seq
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000011282 treatment Methods 0.000 title abstract description 89
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 201
- 239000000203 mixture Substances 0.000 claims abstract description 89
- 230000014509 gene expression Effects 0.000 claims abstract description 64
- 230000002950 deficient Effects 0.000 claims abstract description 45
- 239000002679 microRNA Substances 0.000 claims abstract description 26
- 239000000556 agonist Substances 0.000 claims abstract description 23
- 102000014160 PTEN Phosphohydrolase Human genes 0.000 claims abstract description 14
- 108010011536 PTEN Phosphohydrolase Proteins 0.000 claims abstract description 14
- 108091070501 miRNA Proteins 0.000 claims abstract description 11
- -1 PTK2 Proteins 0.000 claims description 244
- 125000003729 nucleotide group Chemical group 0.000 claims description 118
- 239000002773 nucleotide Substances 0.000 claims description 116
- 201000011510 cancer Diseases 0.000 claims description 106
- 230000003278 mimic effect Effects 0.000 claims description 93
- 108091027558 IsomiR Proteins 0.000 claims description 88
- 210000004027 cell Anatomy 0.000 claims description 78
- 108090000623 proteins and genes Proteins 0.000 claims description 77
- 239000002243 precursor Substances 0.000 claims description 46
- 206010006187 Breast cancer Diseases 0.000 claims description 38
- 208000026310 Breast neoplasm Diseases 0.000 claims description 38
- 208000014018 liver neoplasm Diseases 0.000 claims description 31
- 201000007270 liver cancer Diseases 0.000 claims description 30
- 206010058467 Lung neoplasm malignant Diseases 0.000 claims description 28
- 239000003112 inhibitor Substances 0.000 claims description 28
- 201000001441 melanoma Diseases 0.000 claims description 27
- 208000020816 lung neoplasm Diseases 0.000 claims description 23
- 201000005202 lung cancer Diseases 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 20
- 206010009944 Colon cancer Diseases 0.000 claims description 19
- 210000001744 T-lymphocyte Anatomy 0.000 claims description 19
- 208000000236 Prostatic Neoplasms Diseases 0.000 claims description 18
- 206010060862 Prostate cancer Diseases 0.000 claims description 17
- 102000039446 nucleic acids Human genes 0.000 claims description 17
- 108020004707 nucleic acids Proteins 0.000 claims description 17
- 102100040685 14-3-3 protein zeta/delta Human genes 0.000 claims description 16
- 101000964898 Homo sapiens 14-3-3 protein zeta/delta Proteins 0.000 claims description 16
- 101001056180 Homo sapiens Induced myeloid leukemia cell differentiation protein Mcl-1 Proteins 0.000 claims description 15
- 102100026539 Induced myeloid leukemia cell differentiation protein Mcl-1 Human genes 0.000 claims description 15
- 239000002246 antineoplastic agent Substances 0.000 claims description 15
- 150000007523 nucleic acids Chemical class 0.000 claims description 15
- 208000008443 pancreatic carcinoma Diseases 0.000 claims description 15
- 206010061902 Pancreatic neoplasm Diseases 0.000 claims description 13
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 claims description 13
- 102100030708 GTPase KRas Human genes 0.000 claims description 12
- 101000688606 Homo sapiens Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Proteins 0.000 claims description 12
- 102100024242 Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Human genes 0.000 claims description 12
- 208000029742 colonic neoplasm Diseases 0.000 claims description 12
- 101000584612 Homo sapiens GTPase KRas Proteins 0.000 claims description 11
- 108091034117 Oligonucleotide Proteins 0.000 claims description 11
- 102100037263 3-phosphoinositide-dependent protein kinase 1 Human genes 0.000 claims description 10
- 101000600756 Homo sapiens 3-phosphoinositide-dependent protein kinase 1 Proteins 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 10
- 108010058546 Cyclin D1 Proteins 0.000 claims description 9
- 108010076010 Cystathionine beta-lyase Proteins 0.000 claims description 9
- 102100035813 E3 ubiquitin-protein ligase CBL Human genes 0.000 claims description 9
- 102100024165 G1/S-specific cyclin-D1 Human genes 0.000 claims description 9
- 208000002927 Hamartoma Diseases 0.000 claims description 9
- 206010038389 Renal cancer Diseases 0.000 claims description 9
- 208000024770 Thyroid neoplasm Diseases 0.000 claims description 9
- 150000002632 lipids Chemical class 0.000 claims description 9
- 101001120056 Homo sapiens Phosphatidylinositol 3-kinase regulatory subunit alpha Proteins 0.000 claims description 8
- 208000008839 Kidney Neoplasms Diseases 0.000 claims description 8
- 206010061535 Ovarian neoplasm Diseases 0.000 claims description 8
- 102100026169 Phosphatidylinositol 3-kinase regulatory subunit alpha Human genes 0.000 claims description 8
- 229940127089 cytotoxic agent Drugs 0.000 claims description 8
- 208000014829 head and neck neoplasm Diseases 0.000 claims description 8
- 201000010982 kidney cancer Diseases 0.000 claims description 8
- 201000002528 pancreatic cancer Diseases 0.000 claims description 8
- 201000002510 thyroid cancer Diseases 0.000 claims description 8
- 102100026550 Caspase-9 Human genes 0.000 claims description 7
- 101000983523 Homo sapiens Caspase-9 Proteins 0.000 claims description 7
- 206010033128 Ovarian cancer Diseases 0.000 claims description 7
- 206010039491 Sarcoma Diseases 0.000 claims description 7
- 201000010536 head and neck cancer Diseases 0.000 claims description 7
- 239000002105 nanoparticle Substances 0.000 claims description 7
- 102100028237 Breast cancer anti-estrogen resistance protein 1 Human genes 0.000 claims description 6
- 108010031504 Crk Associated Substrate Protein Proteins 0.000 claims description 6
- 102000012199 E3 ubiquitin-protein ligase Mdm2 Human genes 0.000 claims description 6
- 108050002772 E3 ubiquitin-protein ligase Mdm2 Proteins 0.000 claims description 6
- 101000578936 Homo sapiens Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Proteins 0.000 claims description 6
- 101001051714 Homo sapiens Ribosomal protein S6 kinase beta-2 Proteins 0.000 claims description 6
- 102100028327 Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Human genes 0.000 claims description 6
- 108010051742 Platelet-Derived Growth Factor beta Receptor Proteins 0.000 claims description 6
- 102100026547 Platelet-derived growth factor receptor beta Human genes 0.000 claims description 6
- 102100024917 Ribosomal protein S6 kinase beta-2 Human genes 0.000 claims description 6
- 230000007812 deficiency Effects 0.000 claims description 6
- 230000003394 haemopoietic effect Effects 0.000 claims description 6
- 230000036210 malignancy Effects 0.000 claims description 6
- 208000003174 Brain Neoplasms Diseases 0.000 claims description 5
- 238000006467 substitution reaction Methods 0.000 claims description 5
- 102000003745 Hepatocyte Growth Factor Human genes 0.000 claims description 4
- 108090000100 Hepatocyte Growth Factor Proteins 0.000 claims description 4
- 239000011230 binding agent Substances 0.000 claims description 4
- 238000000338 in vitro Methods 0.000 claims description 4
- 238000001727 in vivo Methods 0.000 claims description 4
- 101000868154 Homo sapiens Son of sevenless homolog 2 Proteins 0.000 claims description 3
- 102100032930 Son of sevenless homolog 2 Human genes 0.000 claims description 3
- 102100033663 Transforming growth factor beta receptor type 3 Human genes 0.000 claims description 3
- 108010079292 betaglycan Proteins 0.000 claims description 3
- 229940126638 Akt inhibitor Drugs 0.000 claims description 2
- 101000741929 Caenorhabditis elegans Serine/threonine-protein phosphatase 2A catalytic subunit Proteins 0.000 claims description 2
- 239000012828 PI3K inhibitor Substances 0.000 claims description 2
- 229930182558 Sterol Natural products 0.000 claims description 2
- 229940124302 mTOR inhibitor Drugs 0.000 claims description 2
- 239000003628 mammalian target of rapamycin inhibitor Substances 0.000 claims description 2
- 239000012022 methylating agents Substances 0.000 claims description 2
- 229940043441 phosphoinositide 3-kinase inhibitor Drugs 0.000 claims description 2
- 150000003904 phospholipids Chemical class 0.000 claims description 2
- 239000003197 protein kinase B inhibitor Substances 0.000 claims description 2
- 150000003432 sterols Chemical class 0.000 claims description 2
- 235000003702 sterols Nutrition 0.000 claims description 2
- 229920003169 water-soluble polymer Polymers 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 230000001105 regulatory effect Effects 0.000 abstract description 6
- 102100032543 Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN Human genes 0.000 description 100
- 101710132081 Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN Proteins 0.000 description 100
- 108091081021 Sense strand Proteins 0.000 description 62
- 230000000692 anti-sense effect Effects 0.000 description 59
- 230000000694 effects Effects 0.000 description 47
- 210000004881 tumor cell Anatomy 0.000 description 36
- 239000002585 base Substances 0.000 description 34
- 230000001965 increasing effect Effects 0.000 description 34
- 239000002777 nucleoside Substances 0.000 description 34
- 230000003247 decreasing effect Effects 0.000 description 30
- 230000002265 prevention Effects 0.000 description 28
- 230000001603 reducing effect Effects 0.000 description 28
- 108020004414 DNA Proteins 0.000 description 25
- 108091032973 (ribonucleotides)n+m Proteins 0.000 description 24
- 230000002829 reductive effect Effects 0.000 description 23
- 230000002401 inhibitory effect Effects 0.000 description 22
- 102100022464 5'-nucleotidase Human genes 0.000 description 19
- 125000003835 nucleoside group Chemical group 0.000 description 19
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 17
- 150000003833 nucleoside derivatives Chemical class 0.000 description 17
- MLDQJTXFUGDVEO-UHFFFAOYSA-N BAY-43-9006 Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=CC(NC(=O)NC=3C=C(C(Cl)=CC=3)C(F)(F)F)=CC=2)=C1 MLDQJTXFUGDVEO-UHFFFAOYSA-N 0.000 description 16
- 101000678236 Homo sapiens 5'-nucleotidase Proteins 0.000 description 16
- 239000005511 L01XE05 - Sorafenib Substances 0.000 description 16
- 108700011259 MicroRNAs Proteins 0.000 description 16
- 108010041388 Ribonucleotide Reductases Proteins 0.000 description 16
- 102000000505 Ribonucleotide Reductases Human genes 0.000 description 16
- 230000007423 decrease Effects 0.000 description 16
- 229960003787 sorafenib Drugs 0.000 description 16
- 229930012538 Paclitaxel Natural products 0.000 description 15
- 239000003814 drug Substances 0.000 description 15
- 230000006870 function Effects 0.000 description 15
- 229960001592 paclitaxel Drugs 0.000 description 15
- 230000035755 proliferation Effects 0.000 description 15
- 230000009467 reduction Effects 0.000 description 15
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 15
- 230000003827 upregulation Effects 0.000 description 15
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 14
- 238000002512 chemotherapy Methods 0.000 description 14
- 230000004048 modification Effects 0.000 description 14
- 238000012986 modification Methods 0.000 description 14
- 102100029722 Ectonucleoside triphosphate diphosphohydrolase 1 Human genes 0.000 description 13
- 101001012447 Homo sapiens Ectonucleoside triphosphate diphosphohydrolase 1 Proteins 0.000 description 13
- 101000635958 Homo sapiens Transforming growth factor beta-2 proprotein Proteins 0.000 description 13
- 208000008770 Multiple Hamartoma Syndrome Diseases 0.000 description 13
- 102100030737 Transforming growth factor beta-2 proprotein Human genes 0.000 description 13
- 206010073071 hepatocellular carcinoma Diseases 0.000 description 13
- 102000000905 Cadherin Human genes 0.000 description 12
- 108050007957 Cadherin Proteins 0.000 description 12
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 12
- 208000003721 Triple Negative Breast Neoplasms Diseases 0.000 description 12
- 229960003668 docetaxel Drugs 0.000 description 12
- 238000004519 manufacturing process Methods 0.000 description 12
- 208000022679 triple-negative breast carcinoma Diseases 0.000 description 12
- 102100032306 Aurora kinase B Human genes 0.000 description 11
- 201000009030 Carcinoma Diseases 0.000 description 11
- 102100034458 Hepatitis A virus cellular receptor 2 Human genes 0.000 description 11
- 101000798306 Homo sapiens Aurora kinase B Proteins 0.000 description 11
- 101000638886 Homo sapiens Urokinase-type plasminogen activator Proteins 0.000 description 11
- 102100025246 Neurogenic locus notch homolog protein 2 Human genes 0.000 description 11
- 108010029751 Notch2 Receptor Proteins 0.000 description 11
- 102100031358 Urokinase-type plasminogen activator Human genes 0.000 description 11
- 230000028993 immune response Effects 0.000 description 11
- 230000005764 inhibitory process Effects 0.000 description 11
- 108010025468 Cyclin-Dependent Kinase 6 Proteins 0.000 description 10
- 102100026804 Cyclin-dependent kinase 6 Human genes 0.000 description 10
- 101100381978 Mus musculus Braf gene Proteins 0.000 description 10
- 201000010099 disease Diseases 0.000 description 10
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 10
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 description 10
- 229960005277 gemcitabine Drugs 0.000 description 10
- 208000005017 glioblastoma Diseases 0.000 description 10
- 239000002829 mitogen activated protein kinase inhibitor Substances 0.000 description 10
- 230000035772 mutation Effects 0.000 description 10
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 10
- 235000018102 proteins Nutrition 0.000 description 10
- 102000004169 proteins and genes Human genes 0.000 description 10
- 210000003289 regulatory T cell Anatomy 0.000 description 10
- 102100039882 40S ribosomal protein S17 Human genes 0.000 description 9
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 9
- 101710083479 Hepatitis A virus cellular receptor 2 homolog Proteins 0.000 description 9
- 101000812077 Homo sapiens 40S ribosomal protein S17 Proteins 0.000 description 9
- 206010027476 Metastases Diseases 0.000 description 9
- 229920000776 Poly(Adenosine diphosphate-ribose) polymerase Polymers 0.000 description 9
- 229940126547 T-cell immunoglobulin mucin-3 Drugs 0.000 description 9
- 230000006907 apoptotic process Effects 0.000 description 9
- 201000008275 breast carcinoma Diseases 0.000 description 9
- 230000012292 cell migration Effects 0.000 description 9
- 230000003833 cell viability Effects 0.000 description 9
- 229960004316 cisplatin Drugs 0.000 description 9
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 9
- 230000003828 downregulation Effects 0.000 description 9
- 230000007705 epithelial mesenchymal transition Effects 0.000 description 9
- 229960002949 fluorouracil Drugs 0.000 description 9
- 231100000844 hepatocellular carcinoma Toxicity 0.000 description 9
- 108020004999 messenger RNA Proteins 0.000 description 9
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 9
- 235000000346 sugar Nutrition 0.000 description 9
- KKVYYGGCHJGEFJ-UHFFFAOYSA-N 1-n-(4-chlorophenyl)-6-methyl-5-n-[3-(7h-purin-6-yl)pyridin-2-yl]isoquinoline-1,5-diamine Chemical compound N=1C=CC2=C(NC=3C(=CC=CN=3)C=3C=4N=CNC=4N=CN=3)C(C)=CC=C2C=1NC1=CC=C(Cl)C=C1 KKVYYGGCHJGEFJ-UHFFFAOYSA-N 0.000 description 8
- 201000002847 Cowden syndrome Diseases 0.000 description 8
- 102100029375 Crk-like protein Human genes 0.000 description 8
- 102100037064 Cytoplasmic dynein 2 light intermediate chain 1 Human genes 0.000 description 8
- 101000919315 Homo sapiens Crk-like protein Proteins 0.000 description 8
- 101000954716 Homo sapiens Cytoplasmic dynein 2 light intermediate chain 1 Proteins 0.000 description 8
- 101001005155 Homo sapiens Leishmanolysin-like peptidase Proteins 0.000 description 8
- 101000599612 Homo sapiens Peroxisomal carnitine O-octanoyltransferase Proteins 0.000 description 8
- 101001121442 Homo sapiens Ubiquitin thioesterase OTU1 Proteins 0.000 description 8
- 102100026040 Leishmanolysin-like peptidase Human genes 0.000 description 8
- 102100037974 Peroxisomal carnitine O-octanoyltransferase Human genes 0.000 description 8
- 102100026369 Ubiquitin thioesterase OTU1 Human genes 0.000 description 8
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 8
- 229960004562 carboplatin Drugs 0.000 description 8
- 230000022131 cell cycle Effects 0.000 description 8
- 230000037361 pathway Effects 0.000 description 8
- 230000003405 preventing effect Effects 0.000 description 8
- 150000008163 sugars Chemical class 0.000 description 8
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 7
- GAGWJHPBXLXJQN-UORFTKCHSA-N Capecitabine Chemical compound C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](C)O1 GAGWJHPBXLXJQN-UORFTKCHSA-N 0.000 description 7
- GAGWJHPBXLXJQN-UHFFFAOYSA-N Capecitabine Natural products C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1C1C(O)C(O)C(C)O1 GAGWJHPBXLXJQN-UHFFFAOYSA-N 0.000 description 7
- 102000004190 Enzymes Human genes 0.000 description 7
- 108090000790 Enzymes Proteins 0.000 description 7
- 102100023374 Forkhead box protein M1 Human genes 0.000 description 7
- 101000907578 Homo sapiens Forkhead box protein M1 Proteins 0.000 description 7
- 101000590691 Homo sapiens MAGUK p55 subfamily member 2 Proteins 0.000 description 7
- 101000876829 Homo sapiens Protein C-ets-1 Proteins 0.000 description 7
- 101001134706 Homo sapiens Protein LIAT1 Proteins 0.000 description 7
- 101000575639 Homo sapiens Ribonucleoside-diphosphate reductase subunit M2 Proteins 0.000 description 7
- 101000760337 Homo sapiens Urokinase plasminogen activator surface receptor Proteins 0.000 description 7
- 101100193693 Kirsten murine sarcoma virus K-RAS gene Proteins 0.000 description 7
- 102100035251 Protein C-ets-1 Human genes 0.000 description 7
- 102100033315 Protein LIAT1 Human genes 0.000 description 7
- 102100026006 Ribonucleoside-diphosphate reductase subunit M2 Human genes 0.000 description 7
- 102100023085 Serine/threonine-protein kinase mTOR Human genes 0.000 description 7
- 108010065917 TOR Serine-Threonine Kinases Proteins 0.000 description 7
- 229940123237 Taxane Drugs 0.000 description 7
- 102100024689 Urokinase plasminogen activator surface receptor Human genes 0.000 description 7
- 229960005305 adenosine Drugs 0.000 description 7
- 229940034982 antineoplastic agent Drugs 0.000 description 7
- BMQGVNUXMIRLCK-OAGWZNDDSA-N cabazitaxel Chemical compound O([C@H]1[C@@H]2[C@]3(OC(C)=O)CO[C@@H]3C[C@@H]([C@]2(C(=O)[C@H](OC)C2=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=3C=CC=CC=3)C[C@]1(O)C2(C)C)C)OC)C(=O)C1=CC=CC=C1 BMQGVNUXMIRLCK-OAGWZNDDSA-N 0.000 description 7
- 229960001573 cabazitaxel Drugs 0.000 description 7
- 229960004117 capecitabine Drugs 0.000 description 7
- 229960004679 doxorubicin Drugs 0.000 description 7
- 229940088598 enzyme Drugs 0.000 description 7
- 230000001939 inductive effect Effects 0.000 description 7
- 229950005692 larotaxel Drugs 0.000 description 7
- SEFGUGYLLVNFIJ-QDRLFVHASA-N larotaxel dihydrate Chemical compound O.O.O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@@]23[C@H]1[C@@]1(CO[C@@H]1C[C@@H]2C3)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 SEFGUGYLLVNFIJ-QDRLFVHASA-N 0.000 description 7
- BWKDAMBGCPRVPI-ZQRPHVBESA-N ortataxel Chemical compound O([C@@H]1[C@]23OC(=O)O[C@H]2[C@@H](C(=C([C@@H](OC(C)=O)C(=O)[C@]2(C)[C@@H](O)C[C@H]4OC[C@]4([C@H]21)OC(C)=O)C3(C)C)C)OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)CC(C)C)C(=O)C1=CC=CC=C1 BWKDAMBGCPRVPI-ZQRPHVBESA-N 0.000 description 7
- 229950001094 ortataxel Drugs 0.000 description 7
- 229960001756 oxaliplatin Drugs 0.000 description 7
- DWAFYCQODLXJNR-BNTLRKBRSA-L oxaliplatin Chemical compound O1C(=O)C(=O)O[Pt]11N[C@@H]2CCCC[C@H]2N1 DWAFYCQODLXJNR-BNTLRKBRSA-L 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 230000001737 promoting effect Effects 0.000 description 7
- 230000004083 survival effect Effects 0.000 description 7
- MODVSQKJJIBWPZ-VLLPJHQWSA-N tesetaxel Chemical compound O([C@H]1[C@@H]2[C@]3(OC(C)=O)CO[C@@H]3CC[C@@]2(C)[C@H]2[C@@H](C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C(=CC=CN=4)F)C[C@]1(O)C3(C)C)O[C@H](O2)CN(C)C)C(=O)C1=CC=CC=C1 MODVSQKJJIBWPZ-VLLPJHQWSA-N 0.000 description 7
- 229950009016 tesetaxel Drugs 0.000 description 7
- 239000013598 vector Substances 0.000 description 7
- GPXBXXGIAQBQNI-UHFFFAOYSA-N vemurafenib Chemical group CCCS(=O)(=O)NC1=CC=C(F)C(C(=O)C=2C3=CC(=CN=C3NC=2)C=2C=CC(Cl)=CC=2)=C1F GPXBXXGIAQBQNI-UHFFFAOYSA-N 0.000 description 7
- 102100038902 Caspase-7 Human genes 0.000 description 6
- 102100039444 Cortexin-1 Human genes 0.000 description 6
- 102100025191 Cyclin-A2 Human genes 0.000 description 6
- 102100030270 Cysteine-rich hydrophobic domain-containing protein 1 Human genes 0.000 description 6
- 102100029584 DDB1- and CUL4-associated factor 4 Human genes 0.000 description 6
- 102100035890 Delta(24)-sterol reductase Human genes 0.000 description 6
- 102100035205 GA-binding protein subunit beta-1 Human genes 0.000 description 6
- 102100033713 Gamma-secretase subunit APH-1B Human genes 0.000 description 6
- 102100039330 HMG box-containing protein 1 Human genes 0.000 description 6
- 101000889207 Homo sapiens Cortexin-1 Proteins 0.000 description 6
- 101000934320 Homo sapiens Cyclin-A2 Proteins 0.000 description 6
- 101000991108 Homo sapiens Cysteine-rich hydrophobic domain-containing protein 1 Proteins 0.000 description 6
- 101000917421 Homo sapiens DDB1- and CUL4-associated factor 4 Proteins 0.000 description 6
- 101000929877 Homo sapiens Delta(24)-sterol reductase Proteins 0.000 description 6
- 101001022098 Homo sapiens GA-binding protein subunit beta-1 Proteins 0.000 description 6
- 101000733778 Homo sapiens Gamma-secretase subunit APH-1B Proteins 0.000 description 6
- 101001035846 Homo sapiens HMG box-containing protein 1 Proteins 0.000 description 6
- 101000616300 Homo sapiens Leucine zipper transcription factor-like protein 1 Proteins 0.000 description 6
- 101000793966 Homo sapiens Mitochondrial protein C2orf69 Proteins 0.000 description 6
- 101000950695 Homo sapiens Mitogen-activated protein kinase 8 Proteins 0.000 description 6
- 101001109682 Homo sapiens Nuclear receptor subfamily 6 group A member 1 Proteins 0.000 description 6
- 101000611943 Homo sapiens Programmed cell death protein 4 Proteins 0.000 description 6
- 101000937729 Homo sapiens Protein FAM227A Proteins 0.000 description 6
- 101000966243 Homo sapiens Protein LMBR1L Proteins 0.000 description 6
- 101001035676 Homo sapiens Pseudouridine-5'-phosphatase Proteins 0.000 description 6
- 101000692721 Homo sapiens RING finger protein 44 Proteins 0.000 description 6
- 101001047637 Homo sapiens Serine/threonine-protein kinase LATS2 Proteins 0.000 description 6
- 101000739911 Homo sapiens Sestrin-3 Proteins 0.000 description 6
- 101000652359 Homo sapiens Spermatogenesis-associated protein 2 Proteins 0.000 description 6
- 101000831940 Homo sapiens Stathmin Proteins 0.000 description 6
- 101000869535 Homo sapiens Sterile alpha motif domain-containing protein 15 Proteins 0.000 description 6
- 101000653432 Homo sapiens Tectonic-2 Proteins 0.000 description 6
- 101000626080 Homo sapiens Thyrotroph embryonic factor Proteins 0.000 description 6
- 101000645439 Homo sapiens Transmembrane protein 250 Proteins 0.000 description 6
- 101000679921 Homo sapiens Tumor necrosis factor receptor superfamily member 21 Proteins 0.000 description 6
- 101000830816 Homo sapiens Tumor protein p63-regulated gene 1-like protein Proteins 0.000 description 6
- 101000942290 Homo sapiens Uncharacterized protein CLBA1 Proteins 0.000 description 6
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 6
- 102100021803 Leucine zipper transcription factor-like protein 1 Human genes 0.000 description 6
- 206010025323 Lymphomas Diseases 0.000 description 6
- 102100029885 Mitochondrial protein C2orf69 Human genes 0.000 description 6
- 102100037808 Mitogen-activated protein kinase 8 Human genes 0.000 description 6
- 102100022670 Nuclear receptor subfamily 6 group A member 1 Human genes 0.000 description 6
- 102100040992 Programmed cell death protein 4 Human genes 0.000 description 6
- 102100027292 Protein FAM227A Human genes 0.000 description 6
- 102100040549 Protein LMBR1L Human genes 0.000 description 6
- 102100039391 Pseudouridine-5'-phosphatase Human genes 0.000 description 6
- 102100026352 RING finger protein 44 Human genes 0.000 description 6
- 208000006265 Renal cell carcinoma Diseases 0.000 description 6
- 108091006298 SLC2A3 Proteins 0.000 description 6
- 102100024043 Serine/threonine-protein kinase LATS2 Human genes 0.000 description 6
- 102100037575 Sestrin-3 Human genes 0.000 description 6
- 102100022722 Solute carrier family 2, facilitated glucose transporter member 3 Human genes 0.000 description 6
- 102100030254 Spermatogenesis-associated protein 2 Human genes 0.000 description 6
- 102100024237 Stathmin Human genes 0.000 description 6
- 102100032288 Sterile alpha motif domain-containing protein 15 Human genes 0.000 description 6
- 102100030745 Tectonic-2 Human genes 0.000 description 6
- 102100024729 Thyrotroph embryonic factor Human genes 0.000 description 6
- 102100025715 Transmembrane protein 250 Human genes 0.000 description 6
- 102100022205 Tumor necrosis factor receptor superfamily member 21 Human genes 0.000 description 6
- 102100024947 Tumor protein p63-regulated gene 1-like protein Human genes 0.000 description 6
- 102100032531 Uncharacterized protein CLBA1 Human genes 0.000 description 6
- 230000004913 activation Effects 0.000 description 6
- 230000000295 complement effect Effects 0.000 description 6
- UWKQSNNFCGGAFS-XIFFEERXSA-N irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 description 6
- 229960004768 irinotecan Drugs 0.000 description 6
- 208000032839 leukemia Diseases 0.000 description 6
- 201000005296 lung carcinoma Diseases 0.000 description 6
- 229960000485 methotrexate Drugs 0.000 description 6
- XAUDJQYHKZQPEU-KVQBGUIXSA-N 5-aza-2'-deoxycytidine Chemical compound O=C1N=C(N)N=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 XAUDJQYHKZQPEU-KVQBGUIXSA-N 0.000 description 5
- NMUSYJAQQFHJEW-KVTDHHQDSA-N 5-azacytidine Chemical compound O=C1N=C(N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 NMUSYJAQQFHJEW-KVTDHHQDSA-N 0.000 description 5
- AOCCBINRVIKJHY-UHFFFAOYSA-N Carmofur Chemical compound CCCCCCNC(=O)N1C=C(F)C(=O)NC1=O AOCCBINRVIKJHY-UHFFFAOYSA-N 0.000 description 5
- 208000012609 Cowden disease Diseases 0.000 description 5
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 5
- 102000053602 DNA Human genes 0.000 description 5
- 206010014733 Endometrial cancer Diseases 0.000 description 5
- 206010014759 Endometrial neoplasm Diseases 0.000 description 5
- 102100023387 Endoribonuclease Dicer Human genes 0.000 description 5
- 101000907904 Homo sapiens Endoribonuclease Dicer Proteins 0.000 description 5
- 101000896557 Homo sapiens Eukaryotic translation initiation factor 3 subunit B Proteins 0.000 description 5
- 239000003798 L01XE11 - Pazopanib Substances 0.000 description 5
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 description 5
- 102000004160 Phosphoric Monoester Hydrolases Human genes 0.000 description 5
- 108090000608 Phosphoric Monoester Hydrolases Proteins 0.000 description 5
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 5
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 5
- 208000009956 adenocarcinoma Diseases 0.000 description 5
- 230000000340 anti-metabolite Effects 0.000 description 5
- 229940100197 antimetabolite Drugs 0.000 description 5
- 239000002256 antimetabolite Substances 0.000 description 5
- 229960002756 azacitidine Drugs 0.000 description 5
- IIJQICKYWPGJDT-UHFFFAOYSA-L azane;cyclobutane-1,1-dicarboxylate;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound N.N.[Pt+2].OC(=O)C1(C([O-])=O)CCC1.OC(=O)C1(C([O-])=O)CCC1 IIJQICKYWPGJDT-UHFFFAOYSA-L 0.000 description 5
- KLNFSAOEKUDMFA-UHFFFAOYSA-N azanide;2-hydroxyacetic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OCC(O)=O KLNFSAOEKUDMFA-UHFFFAOYSA-N 0.000 description 5
- 229960003261 carmofur Drugs 0.000 description 5
- 210000001072 colon Anatomy 0.000 description 5
- 229960000684 cytarabine Drugs 0.000 description 5
- 229960002465 dabrafenib Drugs 0.000 description 5
- BFSMGDJOXZAERB-UHFFFAOYSA-N dabrafenib Chemical compound S1C(C(C)(C)C)=NC(C=2C(=C(NS(=O)(=O)C=3C(=CC=CC=3F)F)C=CC=2)F)=C1C1=CC=NC(N)=N1 BFSMGDJOXZAERB-UHFFFAOYSA-N 0.000 description 5
- 229960003603 decitabine Drugs 0.000 description 5
- ZWAOHEXOSAUJHY-ZIYNGMLESA-N doxifluridine Chemical compound O[C@@H]1[C@H](O)[C@@H](C)O[C@H]1N1C(=O)NC(=O)C(F)=C1 ZWAOHEXOSAUJHY-ZIYNGMLESA-N 0.000 description 5
- 229950005454 doxifluridine Drugs 0.000 description 5
- 229940079593 drug Drugs 0.000 description 5
- ODKNJVUHOIMIIZ-RRKCRQDMSA-N floxuridine Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(F)=C1 ODKNJVUHOIMIIZ-RRKCRQDMSA-N 0.000 description 5
- 229960000961 floxuridine Drugs 0.000 description 5
- 201000000459 head and neck squamous cell carcinoma Diseases 0.000 description 5
- 230000008629 immune suppression Effects 0.000 description 5
- 210000004072 lung Anatomy 0.000 description 5
- 208000037819 metastatic cancer Diseases 0.000 description 5
- 208000011575 metastatic malignant neoplasm Diseases 0.000 description 5
- 229950007221 nedaplatin Drugs 0.000 description 5
- 229960000639 pazopanib Drugs 0.000 description 5
- CUIHSIWYWATEQL-UHFFFAOYSA-N pazopanib Chemical compound C1=CC2=C(C)N(C)N=C2C=C1N(C)C(N=1)=CC=NC=1NC1=CC=C(C)C(S(N)(=O)=O)=C1 CUIHSIWYWATEQL-UHFFFAOYSA-N 0.000 description 5
- 229960005079 pemetrexed Drugs 0.000 description 5
- QOFFJEBXNKRSPX-ZDUSSCGKSA-N pemetrexed Chemical compound C1=N[C]2NC(N)=NC(=O)C2=C1CCC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 QOFFJEBXNKRSPX-ZDUSSCGKSA-N 0.000 description 5
- 229910052697 platinum Inorganic materials 0.000 description 5
- 229960005399 satraplatin Drugs 0.000 description 5
- 190014017285 satraplatin Chemical compound 0.000 description 5
- CYOHGALHFOKKQC-UHFFFAOYSA-N selumetinib Chemical compound OCCONC(=O)C=1C=C2N(C)C=NC2=C(F)C=1NC1=CC=C(Br)C=C1Cl CYOHGALHFOKKQC-UHFFFAOYSA-N 0.000 description 5
- 208000011580 syndromic disease Diseases 0.000 description 5
- 229960001674 tegafur Drugs 0.000 description 5
- WFWLQNSHRPWKFK-ZCFIWIBFSA-N tegafur Chemical compound O=C1NC(=O)C(F)=CN1[C@@H]1OCCC1 WFWLQNSHRPWKFK-ZCFIWIBFSA-N 0.000 description 5
- 229960004066 trametinib Drugs 0.000 description 5
- LIRYPHYGHXZJBZ-UHFFFAOYSA-N trametinib Chemical group CC(=O)NC1=CC=CC(N2C(N(C3CC3)C(=O)C3=C(NC=4C(=CC(I)=CC=4)F)N(C)C(=O)C(C)=C32)=O)=C1 LIRYPHYGHXZJBZ-UHFFFAOYSA-N 0.000 description 5
- 238000013518 transcription Methods 0.000 description 5
- 230000035897 transcription Effects 0.000 description 5
- 230000004614 tumor growth Effects 0.000 description 5
- 229960003862 vemurafenib Drugs 0.000 description 5
- 229960003048 vinblastine Drugs 0.000 description 5
- JXLYSJRDGCGARV-XQKSVPLYSA-N vincaleukoblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-XQKSVPLYSA-N 0.000 description 5
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 5
- 229960004528 vincristine Drugs 0.000 description 5
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 5
- GBABOYUKABKIAF-GHYRFKGUSA-N vinorelbine Chemical compound C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC GBABOYUKABKIAF-GHYRFKGUSA-N 0.000 description 5
- 229960002066 vinorelbine Drugs 0.000 description 5
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 4
- 102000040650 (ribonucleotides)n+m Human genes 0.000 description 4
- 101150092476 ABCA1 gene Proteins 0.000 description 4
- 102100038511 AT-rich interactive domain-containing protein 3A Human genes 0.000 description 4
- 108700005241 ATP Binding Cassette Transporter 1 Proteins 0.000 description 4
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 4
- 206010052747 Adenocarcinoma pancreas Diseases 0.000 description 4
- 102100039179 Ankyrin repeat domain-containing protein 46 Human genes 0.000 description 4
- 102100023189 Armadillo repeat-containing protein 3 Human genes 0.000 description 4
- 201000007815 Bannayan-Riley-Ruvalcaba syndrome Diseases 0.000 description 4
- 108010006654 Bleomycin Proteins 0.000 description 4
- 102100034799 CCAAT/enhancer-binding protein delta Human genes 0.000 description 4
- 102100035671 Cadherin EGF LAG seven-pass G-type receptor 3 Human genes 0.000 description 4
- 102100023073 Calcium-activated potassium channel subunit alpha-1 Human genes 0.000 description 4
- 102000011727 Caspases Human genes 0.000 description 4
- 108010076667 Caspases Proteins 0.000 description 4
- 102100033686 Cilia- and flagella-associated protein 70 Human genes 0.000 description 4
- 102100032370 Coiled-coil domain-containing protein 113 Human genes 0.000 description 4
- 102100026865 Cyclin-dependent kinase 5 activator 1 Human genes 0.000 description 4
- 102100031685 Cyclin-dependent kinase-like 2 Human genes 0.000 description 4
- 102000004127 Cytokines Human genes 0.000 description 4
- 108090000695 Cytokines Proteins 0.000 description 4
- 102100039224 Cytoplasmic polyadenylation element-binding protein 2 Human genes 0.000 description 4
- 102100029587 DDB1- and CUL4-associated factor 6 Human genes 0.000 description 4
- 102100025268 DENN domain-containing protein 2C Human genes 0.000 description 4
- 102100020986 DNA-binding protein RFX5 Human genes 0.000 description 4
- 102100029701 DnaJ homolog subfamily B member 5 Human genes 0.000 description 4
- 102100033363 Dual specificity tyrosine-phosphorylation-regulated kinase 1B Human genes 0.000 description 4
- 102100032244 Dynein axonemal heavy chain 1 Human genes 0.000 description 4
- 102100036516 Ectonucleoside triphosphate diphosphohydrolase 7 Human genes 0.000 description 4
- 102100023378 Fer-1-like protein 4 Human genes 0.000 description 4
- 102100041016 G-protein coupled receptor 157 Human genes 0.000 description 4
- 102100037121 GSK-3-binding protein FRAT2 Human genes 0.000 description 4
- 102100034264 Guanine nucleotide-binding protein G(i) subunit alpha-3 Human genes 0.000 description 4
- 102100027788 Histone-lysine N-methyltransferase KMT5C Human genes 0.000 description 4
- 102100020761 Homeobox protein Hox-C13 Human genes 0.000 description 4
- 101000808887 Homo sapiens AT-rich interactive domain-containing protein 3A Proteins 0.000 description 4
- 101000889428 Homo sapiens Ankyrin repeat domain-containing protein 46 Proteins 0.000 description 4
- 101000684962 Homo sapiens Armadillo repeat-containing protein 3 Proteins 0.000 description 4
- 101000945965 Homo sapiens CCAAT/enhancer-binding protein delta Proteins 0.000 description 4
- 101000715671 Homo sapiens Cadherin EGF LAG seven-pass G-type receptor 3 Proteins 0.000 description 4
- 101001049859 Homo sapiens Calcium-activated potassium channel subunit alpha-1 Proteins 0.000 description 4
- 101000855412 Homo sapiens Carbamoyl-phosphate synthase [ammonia], mitochondrial Proteins 0.000 description 4
- 101000741014 Homo sapiens Caspase-7 Proteins 0.000 description 4
- 101000944483 Homo sapiens Cilia- and flagella-associated protein 70 Proteins 0.000 description 4
- 101000868831 Homo sapiens Coiled-coil domain-containing protein 113 Proteins 0.000 description 4
- 101000777764 Homo sapiens Cyclin-dependent kinase-like 2 Proteins 0.000 description 4
- 101000745751 Homo sapiens Cytoplasmic polyadenylation element-binding protein 2 Proteins 0.000 description 4
- 101000917420 Homo sapiens DDB1- and CUL4-associated factor 6 Proteins 0.000 description 4
- 101000722278 Homo sapiens DENN domain-containing protein 2C Proteins 0.000 description 4
- 101001075432 Homo sapiens DNA-binding protein RFX5 Proteins 0.000 description 4
- 101000866011 Homo sapiens DnaJ homolog subfamily B member 5 Proteins 0.000 description 4
- 101000926738 Homo sapiens Dual specificity tyrosine-phosphorylation-regulated kinase 1B Proteins 0.000 description 4
- 101001016198 Homo sapiens Dynein axonemal heavy chain 1 Proteins 0.000 description 4
- 101000852006 Homo sapiens Ectonucleoside triphosphate diphosphohydrolase 7 Proteins 0.000 description 4
- 101000907567 Homo sapiens Fer-1-like protein 4 Proteins 0.000 description 4
- 101001039303 Homo sapiens G-protein coupled receptor 157 Proteins 0.000 description 4
- 101001029171 Homo sapiens GSK-3-binding protein FRAT2 Proteins 0.000 description 4
- 101000997034 Homo sapiens Guanine nucleotide-binding protein G(i) subunit alpha-3 Proteins 0.000 description 4
- 101001008824 Homo sapiens Histone-lysine N-methyltransferase KMT5C Proteins 0.000 description 4
- 101001002988 Homo sapiens Homeobox protein Hox-C13 Proteins 0.000 description 4
- 101000988834 Homo sapiens Hypoxanthine-guanine phosphoribosyltransferase Proteins 0.000 description 4
- 101001054807 Homo sapiens Importin subunit alpha-6 Proteins 0.000 description 4
- 101000960200 Homo sapiens Intraflagellar transport protein 140 homolog Proteins 0.000 description 4
- 101001010731 Homo sapiens Intraflagellar transport protein 81 homolog Proteins 0.000 description 4
- 101000945442 Homo sapiens Kelch domain-containing protein 3 Proteins 0.000 description 4
- 101001139112 Homo sapiens Krueppel-like factor 9 Proteins 0.000 description 4
- 101001017857 Homo sapiens Leucine-rich repeat and IQ domain-containing protein 1 Proteins 0.000 description 4
- 101000619602 Homo sapiens Leucine-rich repeat-containing protein 46 Proteins 0.000 description 4
- 101001036580 Homo sapiens Max dimerization protein 4 Proteins 0.000 description 4
- 101000969766 Homo sapiens Myelin protein zero-like protein 3 Proteins 0.000 description 4
- 101000983292 Homo sapiens N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Proteins 0.000 description 4
- 101000738387 Homo sapiens Neuropeptide-like protein C4orf48 Proteins 0.000 description 4
- 101001129705 Homo sapiens PH domain leucine-rich repeat-containing protein phosphatase 2 Proteins 0.000 description 4
- 101001074964 Homo sapiens Phytanoyl-CoA hydroxylase-interacting protein Proteins 0.000 description 4
- 101001000545 Homo sapiens Probable hydrolase PNKD Proteins 0.000 description 4
- 101000933604 Homo sapiens Protein BTG2 Proteins 0.000 description 4
- 101000598778 Homo sapiens Protein OSCP1 Proteins 0.000 description 4
- 101000984033 Homo sapiens Protein lin-28 homolog B Proteins 0.000 description 4
- 101000641111 Homo sapiens Protein transport protein Sec61 subunit alpha isoform 1 Proteins 0.000 description 4
- 101000769165 Homo sapiens Protein yippee-like 2 Proteins 0.000 description 4
- 101000841688 Homo sapiens Putative E3 ubiquitin-protein ligase UNKL Proteins 0.000 description 4
- 101001123814 Homo sapiens Serine/threonine-protein kinase Nek10 Proteins 0.000 description 4
- 101001123812 Homo sapiens Serine/threonine-protein kinase Nek11 Proteins 0.000 description 4
- 101000702102 Homo sapiens Sperm flagellar protein 2 Proteins 0.000 description 4
- 101000633119 Homo sapiens Stannin Proteins 0.000 description 4
- 101000861263 Homo sapiens Steroid 21-hydroxylase Proteins 0.000 description 4
- 101000653590 Homo sapiens TBC1 domain family member 17 Proteins 0.000 description 4
- 101000633617 Homo sapiens Thrombospondin-4 Proteins 0.000 description 4
- 101000712600 Homo sapiens Thyroid hormone receptor beta Proteins 0.000 description 4
- 101000659395 Homo sapiens Translin-associated factor X-interacting protein 1 Proteins 0.000 description 4
- 101000914187 Homo sapiens UPF0669 protein C6orf120 Proteins 0.000 description 4
- 101000906820 Homo sapiens Uncharacterized protein C9orf163 Proteins 0.000 description 4
- 101000915479 Homo sapiens Zinc finger MYND domain-containing protein 10 Proteins 0.000 description 4
- 101000788774 Homo sapiens Zinc finger and BTB domain-containing protein 3 Proteins 0.000 description 4
- 101000759241 Homo sapiens Zinc finger protein 138 Proteins 0.000 description 4
- 101000964710 Homo sapiens Zinc finger protein 404 Proteins 0.000 description 4
- 101000743805 Homo sapiens Zinc finger protein 680 Proteins 0.000 description 4
- 102100029098 Hypoxanthine-guanine phosphoribosyltransferase Human genes 0.000 description 4
- 102100027007 Importin subunit alpha-6 Human genes 0.000 description 4
- 102100039927 Intraflagellar transport protein 140 homolog Human genes 0.000 description 4
- 102100030001 Intraflagellar transport protein 81 homolog Human genes 0.000 description 4
- 102100033602 Kelch domain-containing protein 3 Human genes 0.000 description 4
- 102100020684 Krueppel-like factor 9 Human genes 0.000 description 4
- 102100033285 Leucine-rich repeat and IQ domain-containing protein 1 Human genes 0.000 description 4
- 102100022180 Leucine-rich repeat-containing protein 46 Human genes 0.000 description 4
- 208000022010 Lhermitte-Duclos disease Diseases 0.000 description 4
- 102100039515 Max dimerization protein 4 Human genes 0.000 description 4
- 229930192392 Mitomycin Natural products 0.000 description 4
- 102100021271 Myelin protein zero-like protein 3 Human genes 0.000 description 4
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 description 4
- 102100026873 N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Human genes 0.000 description 4
- 102100037897 Neuropeptide-like protein C4orf48 Human genes 0.000 description 4
- 102100031136 PH domain leucine-rich repeat-containing protein phosphatase 2 Human genes 0.000 description 4
- 101710178747 Phosphatidate cytidylyltransferase 1 Proteins 0.000 description 4
- 102100033616 Phospholipid-transporting ATPase ABCA1 Human genes 0.000 description 4
- 102100035962 Phytanoyl-CoA hydroxylase-interacting protein Human genes 0.000 description 4
- 206010035226 Plasma cell myeloma Diseases 0.000 description 4
- 102100035920 Probable hydrolase PNKD Human genes 0.000 description 4
- 102100026034 Protein BTG2 Human genes 0.000 description 4
- 102100037778 Protein OSCP1 Human genes 0.000 description 4
- 102100025459 Protein lin-28 homolog B Human genes 0.000 description 4
- 102100034271 Protein transport protein Sec61 subunit alpha isoform 1 Human genes 0.000 description 4
- 102100028367 Protein yippee-like 2 Human genes 0.000 description 4
- 208000007531 Proteus syndrome Diseases 0.000 description 4
- 102100029460 Putative E3 ubiquitin-protein ligase UNKL Human genes 0.000 description 4
- 238000011529 RT qPCR Methods 0.000 description 4
- 102100031075 Serine/threonine-protein kinase Chk2 Human genes 0.000 description 4
- 102100028774 Serine/threonine-protein kinase Nek10 Human genes 0.000 description 4
- 102100028775 Serine/threonine-protein kinase Nek11 Human genes 0.000 description 4
- 102100030317 Sperm flagellar protein 2 Human genes 0.000 description 4
- 208000000102 Squamous Cell Carcinoma of Head and Neck Diseases 0.000 description 4
- 102100029603 Stannin Human genes 0.000 description 4
- 102100029868 TBC1 domain family member 17 Human genes 0.000 description 4
- 102100033455 TGF-beta receptor type-2 Human genes 0.000 description 4
- BPEGJWRSRHCHSN-UHFFFAOYSA-N Temozolomide Chemical compound O=C1N(C)N=NC2=C(C(N)=O)N=CN21 BPEGJWRSRHCHSN-UHFFFAOYSA-N 0.000 description 4
- 102100029219 Thrombospondin-4 Human genes 0.000 description 4
- 102100033451 Thyroid hormone receptor beta Human genes 0.000 description 4
- 108010082684 Transforming Growth Factor-beta Type II Receptor Proteins 0.000 description 4
- 102100036215 Translin-associated factor X-interacting protein 1 Human genes 0.000 description 4
- 102100025761 UPF0669 protein C6orf120 Human genes 0.000 description 4
- 102100023835 Uncharacterized protein C9orf163 Human genes 0.000 description 4
- 102100028534 Zinc finger MYND domain-containing protein 10 Human genes 0.000 description 4
- 102100025348 Zinc finger and BTB domain-containing protein 3 Human genes 0.000 description 4
- 102100023394 Zinc finger protein 138 Human genes 0.000 description 4
- 102100040732 Zinc finger protein 404 Human genes 0.000 description 4
- 102100039056 Zinc finger protein 680 Human genes 0.000 description 4
- 230000003213 activating effect Effects 0.000 description 4
- 230000000259 anti-tumor effect Effects 0.000 description 4
- 229960001561 bleomycin Drugs 0.000 description 4
- OYVAGSVQBOHSSS-UAPAGMARSA-O bleomycin A2 Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-UAPAGMARSA-O 0.000 description 4
- 210000000481 breast Anatomy 0.000 description 4
- 230000030833 cell death Effects 0.000 description 4
- 210000003169 central nervous system Anatomy 0.000 description 4
- 210000005266 circulating tumour cell Anatomy 0.000 description 4
- WDDPHFBMKLOVOX-AYQXTPAHSA-N clofarabine Chemical compound C1=NC=2C(N)=NC(Cl)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1F WDDPHFBMKLOVOX-AYQXTPAHSA-N 0.000 description 4
- 229960003901 dacarbazine Drugs 0.000 description 4
- 230000003111 delayed effect Effects 0.000 description 4
- 238000012217 deletion Methods 0.000 description 4
- 230000037430 deletion Effects 0.000 description 4
- 238000001514 detection method Methods 0.000 description 4
- 230000004069 differentiation Effects 0.000 description 4
- 229960001842 estramustine Drugs 0.000 description 4
- FRPJXPJMRWBBIH-RBRWEJTLSA-N estramustine Chemical compound ClCCN(CCCl)C(=O)OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 FRPJXPJMRWBBIH-RBRWEJTLSA-N 0.000 description 4
- 230000037451 immune surveillance Effects 0.000 description 4
- 238000003364 immunohistochemistry Methods 0.000 description 4
- 230000000394 mitotic effect Effects 0.000 description 4
- 229960001156 mitoxantrone Drugs 0.000 description 4
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 description 4
- 108010064131 neuronal Cdk5 activator (p25-p35) Proteins 0.000 description 4
- 201000002094 pancreatic adenocarcinoma Diseases 0.000 description 4
- 208000015347 renal cell adenocarcinoma Diseases 0.000 description 4
- 238000003757 reverse transcription PCR Methods 0.000 description 4
- QFJCIRLUMZQUOT-HPLJOQBZSA-N sirolimus Chemical class C1C[C@@H](O)[C@H](OC)C[C@@H]1C[C@@H](C)[C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@](O)(O2)[C@H](C)CC[C@H]2C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(=O)C1 QFJCIRLUMZQUOT-HPLJOQBZSA-N 0.000 description 4
- 229960004964 temozolomide Drugs 0.000 description 4
- 238000002560 therapeutic procedure Methods 0.000 description 4
- RWQNBRDOKXIBIV-UHFFFAOYSA-N thymine Chemical compound CC1=CNC(=O)NC1=O RWQNBRDOKXIBIV-UHFFFAOYSA-N 0.000 description 4
- QQHMKNYGKVVGCZ-UHFFFAOYSA-N tipiracil Chemical compound N1C(=O)NC(=O)C(Cl)=C1CN1C(=N)CCC1 QQHMKNYGKVVGCZ-UHFFFAOYSA-N 0.000 description 4
- 229960002952 tipiracil Drugs 0.000 description 4
- 238000013519 translation Methods 0.000 description 4
- VSQQQLOSPVPRAZ-RRKCRQDMSA-N trifluridine Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(C(F)(F)F)=C1 VSQQQLOSPVPRAZ-RRKCRQDMSA-N 0.000 description 4
- 229960003962 trifluridine Drugs 0.000 description 4
- SPMVMDHWKHCIDT-UHFFFAOYSA-N 1-[2-chloro-4-[(6,7-dimethoxy-4-quinolinyl)oxy]phenyl]-3-(5-methyl-3-isoxazolyl)urea Chemical compound C=12C=C(OC)C(OC)=CC2=NC=CC=1OC(C=C1Cl)=CC=C1NC(=O)NC=1C=C(C)ON=1 SPMVMDHWKHCIDT-UHFFFAOYSA-N 0.000 description 3
- XUSKJHCMMWAAHV-SANMLTNESA-N 220913-32-6 Chemical compound C1=C(O)C=C2C([Si](C)(C)C(C)(C)C)=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 XUSKJHCMMWAAHV-SANMLTNESA-N 0.000 description 3
- NDMPLJNOPCLANR-UHFFFAOYSA-N 3,4-dihydroxy-15-(4-hydroxy-18-methoxycarbonyl-5,18-seco-ibogamin-18-yl)-16-methoxy-1-methyl-6,7-didehydro-aspidospermidine-3-carboxylic acid methyl ester Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 NDMPLJNOPCLANR-UHFFFAOYSA-N 0.000 description 3
- AOJJSUZBOXZQNB-VTZDEGQISA-N 4'-epidoxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-VTZDEGQISA-N 0.000 description 3
- XXJWYDDUDKYVKI-UHFFFAOYSA-N 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-7-[3-(1-pyrrolidinyl)propoxy]quinazoline Chemical compound COC1=CC2=C(OC=3C(=C4C=C(C)NC4=CC=3)F)N=CN=C2C=C1OCCCN1CCCC1 XXJWYDDUDKYVKI-UHFFFAOYSA-N 0.000 description 3
- TVZGACDUOSZQKY-LBPRGKRZSA-N 4-aminofolic acid Chemical compound C1=NC2=NC(N)=NC(N)=C2N=C1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 TVZGACDUOSZQKY-LBPRGKRZSA-N 0.000 description 3
- SRSGVKWWVXWSJT-ATVHPVEESA-N 5-[(z)-(5-fluoro-2-oxo-1h-indol-3-ylidene)methyl]-2,4-dimethyl-n-(2-pyrrolidin-1-ylethyl)-1h-pyrrole-3-carboxamide Chemical compound CC=1NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C(C)C=1C(=O)NCCN1CCCC1 SRSGVKWWVXWSJT-ATVHPVEESA-N 0.000 description 3
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 description 3
- 108010012934 Albumin-Bound Paclitaxel Proteins 0.000 description 3
- 102100022417 Aminoacyl tRNA synthase complex-interacting multifunctional protein 2 Human genes 0.000 description 3
- 206010003571 Astrocytoma Diseases 0.000 description 3
- 206010005003 Bladder cancer Diseases 0.000 description 3
- KLWPJMFMVPTNCC-UHFFFAOYSA-N Camptothecin Natural products CCC1(O)C(=O)OCC2=C1C=C3C4Nc5ccccc5C=C4CN3C2=O KLWPJMFMVPTNCC-UHFFFAOYSA-N 0.000 description 3
- 208000005623 Carcinogenesis Diseases 0.000 description 3
- 102100033682 Cilia- and flagella-associated protein 69 Human genes 0.000 description 3
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 3
- 102100024464 DDB1- and CUL4-associated factor 7 Human genes 0.000 description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 3
- 102100029906 Dolichol-phosphate mannosyltransferase subunit 3 Human genes 0.000 description 3
- HTIJFSOGRVMCQR-UHFFFAOYSA-N Epirubicin Natural products COc1cccc2C(=O)c3c(O)c4CC(O)(CC(OC5CC(N)C(=O)C(C)O5)c4c(O)c3C(=O)c12)C(=O)CO HTIJFSOGRVMCQR-UHFFFAOYSA-N 0.000 description 3
- 102100035977 Exostosin-like 2 Human genes 0.000 description 3
- 102100021654 Extracellular sulfatase Sulf-2 Human genes 0.000 description 3
- 102100036315 FAD-dependent oxidoreductase domain-containing protein 2 Human genes 0.000 description 3
- 102100027346 GTP cyclohydrolase 1 Human genes 0.000 description 3
- 201000010915 Glioblastoma multiforme Diseases 0.000 description 3
- 102100034221 Growth-regulated alpha protein Human genes 0.000 description 3
- 102100034523 Histone H4 Human genes 0.000 description 3
- 101000924727 Homo sapiens Alternative prion protein Proteins 0.000 description 3
- 101000755758 Homo sapiens Aminoacyl tRNA synthase complex-interacting multifunctional protein 2 Proteins 0.000 description 3
- 101000944490 Homo sapiens Cilia- and flagella-associated protein 69 Proteins 0.000 description 3
- 101000832322 Homo sapiens DDB1- and CUL4-associated factor 7 Proteins 0.000 description 3
- 101000864172 Homo sapiens Dolichol-phosphate mannosyltransferase subunit 3 Proteins 0.000 description 3
- 101000875558 Homo sapiens Exostosin-like 2 Proteins 0.000 description 3
- 101000820626 Homo sapiens Extracellular sulfatase Sulf-2 Proteins 0.000 description 3
- 101000930979 Homo sapiens FAD-dependent oxidoreductase domain-containing protein 2 Proteins 0.000 description 3
- 101000862581 Homo sapiens GTP cyclohydrolase 1 Proteins 0.000 description 3
- 101001069921 Homo sapiens Growth-regulated alpha protein Proteins 0.000 description 3
- 101001067880 Homo sapiens Histone H4 Proteins 0.000 description 3
- 101001015004 Homo sapiens Integrin beta-3 Proteins 0.000 description 3
- 101001019588 Homo sapiens Interleukin-17 receptor D Proteins 0.000 description 3
- 101000573901 Homo sapiens Major prion protein Proteins 0.000 description 3
- 101001103036 Homo sapiens Nuclear receptor ROR-alpha Proteins 0.000 description 3
- 101001087045 Homo sapiens Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN Proteins 0.000 description 3
- 101000685791 Homo sapiens Sperm acrosome-associated protein 9 Proteins 0.000 description 3
- 101000723893 Homo sapiens Zinc finger matrin-type protein 3 Proteins 0.000 description 3
- 101001098818 Homo sapiens cGMP-inhibited 3',5'-cyclic phosphodiesterase A Proteins 0.000 description 3
- XDXDZDZNSLXDNA-TZNDIEGXSA-N Idarubicin Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XDXDZDZNSLXDNA-TZNDIEGXSA-N 0.000 description 3
- XDXDZDZNSLXDNA-UHFFFAOYSA-N Idarubicin Natural products C1C(N)C(O)C(C)OC1OC1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2CC(O)(C(C)=O)C1 XDXDZDZNSLXDNA-UHFFFAOYSA-N 0.000 description 3
- 102100032999 Integrin beta-3 Human genes 0.000 description 3
- 208000005045 Interdigitating dendritic cell sarcoma Diseases 0.000 description 3
- 102100035015 Interleukin-17 receptor D Human genes 0.000 description 3
- 101710159002 L-lactate oxidase Proteins 0.000 description 3
- 239000002147 L01XE04 - Sunitinib Substances 0.000 description 3
- 239000002118 L01XE12 - Vandetanib Substances 0.000 description 3
- 239000002138 L01XE21 - Regorafenib Substances 0.000 description 3
- 102100034238 Linker for activation of T-cells family member 2 Human genes 0.000 description 3
- 102100025818 Major prion protein Human genes 0.000 description 3
- 208000034578 Multiple myelomas Diseases 0.000 description 3
- 102100039614 Nuclear receptor ROR-alpha Human genes 0.000 description 3
- 102000038030 PI3Ks Human genes 0.000 description 3
- 108091007960 PI3Ks Proteins 0.000 description 3
- KMSKQZKKOZQFFG-HSUXVGOQSA-N Pirarubicin Chemical compound O([C@H]1[C@@H](N)C[C@@H](O[C@H]1C)O[C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1CCCCO1 KMSKQZKKOZQFFG-HSUXVGOQSA-N 0.000 description 3
- 102100026858 Protein-lysine 6-oxidase Human genes 0.000 description 3
- 108010014608 Proto-Oncogene Proteins c-kit Proteins 0.000 description 3
- 102000016971 Proto-Oncogene Proteins c-kit Human genes 0.000 description 3
- 108020005093 RNA Precursors Proteins 0.000 description 3
- 229940127361 Receptor Tyrosine Kinase Inhibitors Drugs 0.000 description 3
- 108091006557 SLC30A7 Proteins 0.000 description 3
- 108091006238 SLC7A8 Proteins 0.000 description 3
- 102100031877 Signal recognition particle 54 kDa protein Human genes 0.000 description 3
- 101710187184 Signal recognition particle 54 kDa protein Proteins 0.000 description 3
- 101710150385 Signal recognition particle 54 kDa protein 1 Proteins 0.000 description 3
- 101710150383 Signal recognition particle 54 kDa protein 2 Proteins 0.000 description 3
- 101710150391 Signal recognition particle 54 kDa protein 3 Proteins 0.000 description 3
- 101710128823 Signal recognition particle 54 kDa protein homolog Proteins 0.000 description 3
- 208000000453 Skin Neoplasms Diseases 0.000 description 3
- 206010041067 Small cell lung cancer Diseases 0.000 description 3
- 102100023079 Sperm acrosome-associated protein 9 Human genes 0.000 description 3
- CBPNZQVSJQDFBE-FUXHJELOSA-N Temsirolimus Chemical compound C1C[C@@H](OC(=O)C(C)(CO)CO)[C@H](OC)C[C@@H]1C[C@@H](C)[C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@](O)(O2)[C@H](C)CC[C@H]2C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(=O)C1 CBPNZQVSJQDFBE-FUXHJELOSA-N 0.000 description 3
- 239000003819 Toceranib Substances 0.000 description 3
- IVTVGDXNLFLDRM-HNNXBMFYSA-N Tomudex Chemical compound C=1C=C2NC(C)=NC(=O)C2=CC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)S1 IVTVGDXNLFLDRM-HNNXBMFYSA-N 0.000 description 3
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 description 3
- 108091008605 VEGF receptors Proteins 0.000 description 3
- 102000009484 Vascular Endothelial Growth Factor Receptors Human genes 0.000 description 3
- 229940122803 Vinca alkaloid Drugs 0.000 description 3
- 102100028482 Zinc finger matrin-type protein 3 Human genes 0.000 description 3
- 102100021419 Zinc transporter 7 Human genes 0.000 description 3
- USZYSDMBJDPRIF-SVEJIMAYSA-N aclacinomycin A Chemical compound O([C@H]1[C@@H](O)C[C@@H](O[C@H]1C)O[C@H]1[C@H](C[C@@H](O[C@H]1C)O[C@H]1C[C@]([C@@H](C2=CC=3C(=O)C4=CC=CC(O)=C4C(=O)C=3C(O)=C21)C(=O)OC)(O)CC)N(C)C)[C@H]1CCC(=O)[C@H](C)O1 USZYSDMBJDPRIF-SVEJIMAYSA-N 0.000 description 3
- 229960004176 aclarubicin Drugs 0.000 description 3
- 239000002295 alkylating antineoplastic agent Substances 0.000 description 3
- 229960003896 aminopterin Drugs 0.000 description 3
- 229960002550 amrubicin Drugs 0.000 description 3
- VJZITPJGSQKZMX-XDPRQOKASA-N amrubicin Chemical compound O([C@H]1C[C@](CC2=C(O)C=3C(=O)C4=CC=CC=C4C(=O)C=3C(O)=C21)(N)C(=O)C)[C@H]1C[C@H](O)[C@H](O)CO1 VJZITPJGSQKZMX-XDPRQOKASA-N 0.000 description 3
- 230000033115 angiogenesis Effects 0.000 description 3
- 229960003005 axitinib Drugs 0.000 description 3
- RITAVMQDGBJQJZ-FMIVXFBMSA-N axitinib Chemical compound CNC(=O)C1=CC=CC=C1SC1=CC=C(C(\C=C\C=2N=CC=CC=2)=NN2)C2=C1 RITAVMQDGBJQJZ-FMIVXFBMSA-N 0.000 description 3
- 229950011276 belotecan Drugs 0.000 description 3
- LNHWXBUNXOXMRL-VWLOTQADSA-N belotecan Chemical compound C1=CC=C2C(CCNC(C)C)=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 LNHWXBUNXOXMRL-VWLOTQADSA-N 0.000 description 3
- 102100037093 cGMP-inhibited 3',5'-cyclic phosphodiesterase A Human genes 0.000 description 3
- 229940127093 camptothecin Drugs 0.000 description 3
- VSJKWCGYPAHWDS-FQEVSTJZSA-N camptothecin Chemical compound C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-FQEVSTJZSA-N 0.000 description 3
- 230000036952 cancer formation Effects 0.000 description 3
- 231100000504 carcinogenesis Toxicity 0.000 description 3
- 229960002412 cediranib Drugs 0.000 description 3
- 238000001516 cell proliferation assay Methods 0.000 description 3
- 230000001413 cellular effect Effects 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 229950002415 cositecan Drugs 0.000 description 3
- POADTFBBIXOWFJ-VWLOTQADSA-N cositecan Chemical compound C1=CC=C2C(CC[Si](C)(C)C)=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 POADTFBBIXOWFJ-VWLOTQADSA-N 0.000 description 3
- 229960004397 cyclophosphamide Drugs 0.000 description 3
- 229960000975 daunorubicin Drugs 0.000 description 3
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 3
- VSJKWCGYPAHWDS-UHFFFAOYSA-N dl-camptothecin Natural products C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)C5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-UHFFFAOYSA-N 0.000 description 3
- 239000003534 dna topoisomerase inhibitor Substances 0.000 description 3
- 239000012636 effector Substances 0.000 description 3
- 229960001904 epirubicin Drugs 0.000 description 3
- ZVYVPGLRVWUPMP-FYSMJZIKSA-N exatecan Chemical compound C1C[C@H](N)C2=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC3=CC(F)=C(C)C1=C32 ZVYVPGLRVWUPMP-FYSMJZIKSA-N 0.000 description 3
- 229950009429 exatecan Drugs 0.000 description 3
- 239000004052 folic acid antagonist Substances 0.000 description 3
- 239000012634 fragment Substances 0.000 description 3
- 238000001415 gene therapy Methods 0.000 description 3
- 229950009073 gimatecan Drugs 0.000 description 3
- UIVFUQKYVFCEKJ-OPTOVBNMSA-N gimatecan Chemical compound C1=CC=C2C(\C=N\OC(C)(C)C)=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UIVFUQKYVFCEKJ-OPTOVBNMSA-N 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 102000045726 human PTEN Human genes 0.000 description 3
- 229960000908 idarubicin Drugs 0.000 description 3
- 230000005934 immune activation Effects 0.000 description 3
- 210000000987 immune system Anatomy 0.000 description 3
- 230000006028 immune-suppresssive effect Effects 0.000 description 3
- 230000001506 immunosuppresive effect Effects 0.000 description 3
- 229940043355 kinase inhibitor Drugs 0.000 description 3
- 229960003784 lenvatinib Drugs 0.000 description 3
- WOSKHXYHFSIKNG-UHFFFAOYSA-N lenvatinib Chemical compound C=12C=C(C(N)=O)C(OC)=CC2=NC=CC=1OC(C=C1Cl)=CC=C1NC(=O)NC1CC1 WOSKHXYHFSIKNG-UHFFFAOYSA-N 0.000 description 3
- 210000004185 liver Anatomy 0.000 description 3
- RVFGKBWWUQOIOU-NDEPHWFRSA-N lurtotecan Chemical compound O=C([C@]1(O)CC)OCC(C(N2CC3=4)=O)=C1C=C2C3=NC1=CC=2OCCOC=2C=C1C=4CN1CCN(C)CC1 RVFGKBWWUQOIOU-NDEPHWFRSA-N 0.000 description 3
- 229950002654 lurtotecan Drugs 0.000 description 3
- 239000003550 marker Substances 0.000 description 3
- 230000009401 metastasis Effects 0.000 description 3
- 238000010172 mouse model Methods 0.000 description 3
- 230000009826 neoplastic cell growth Effects 0.000 description 3
- 229960004378 nintedanib Drugs 0.000 description 3
- XZXHXSATPCNXJR-ZIADKAODSA-N nintedanib Chemical compound O=C1NC2=CC(C(=O)OC)=CC=C2\C1=C(C=1C=CC=CC=1)\NC(C=C1)=CC=C1N(C)C(=O)CN1CCN(C)CC1 XZXHXSATPCNXJR-ZIADKAODSA-N 0.000 description 3
- 210000004940 nucleus Anatomy 0.000 description 3
- 230000002611 ovarian Effects 0.000 description 3
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 3
- 229960001221 pirarubicin Drugs 0.000 description 3
- OGSBUKJUDHAQEA-WMCAAGNKSA-N pralatrexate Chemical compound C1=NC2=NC(N)=NC(N)=C2N=C1CC(CC#C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OGSBUKJUDHAQEA-WMCAAGNKSA-N 0.000 description 3
- 229960000214 pralatrexate Drugs 0.000 description 3
- 108091007428 primary miRNA Proteins 0.000 description 3
- 108010043671 prostatic acid phosphatase Proteins 0.000 description 3
- 229960004432 raltitrexed Drugs 0.000 description 3
- 208000016691 refractory malignant neoplasm Diseases 0.000 description 3
- 229960004836 regorafenib Drugs 0.000 description 3
- FNHKPVJBJVTLMP-UHFFFAOYSA-N regorafenib Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C(F)C(NC(=O)NC=3C=C(C(Cl)=CC=3)C(F)(F)F)=CC=2)=C1 FNHKPVJBJVTLMP-UHFFFAOYSA-N 0.000 description 3
- 208000029922 reticulum cell sarcoma Diseases 0.000 description 3
- VHXNKPBCCMUMSW-FQEVSTJZSA-N rubitecan Chemical compound C1=CC([N+]([O-])=O)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VHXNKPBCCMUMSW-FQEVSTJZSA-N 0.000 description 3
- 229950009213 rubitecan Drugs 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 229950010746 selumetinib Drugs 0.000 description 3
- 229950003647 semaxanib Drugs 0.000 description 3
- WUWDLXZGHZSWQZ-WQLSENKSSA-N semaxanib Chemical compound N1C(C)=CC(C)=C1\C=C/1C2=CC=CC=C2NC\1=O WUWDLXZGHZSWQZ-WQLSENKSSA-N 0.000 description 3
- 208000000587 small cell lung carcinoma Diseases 0.000 description 3
- 238000010186 staining Methods 0.000 description 3
- 239000000126 substance Chemical class 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 229960001796 sunitinib Drugs 0.000 description 3
- WINHZLLDWRZWRT-ATVHPVEESA-N sunitinib Chemical compound CCN(CC)CCNC(=O)C1=C(C)NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C1C WINHZLLDWRZWRT-ATVHPVEESA-N 0.000 description 3
- 208000024891 symptom Diseases 0.000 description 3
- 229960000235 temsirolimus Drugs 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 210000001685 thyroid gland Anatomy 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- 229960000940 tivozanib Drugs 0.000 description 3
- 229960005048 toceranib Drugs 0.000 description 3
- 229940044693 topoisomerase inhibitor Drugs 0.000 description 3
- UCFGDBYHRUNTLO-QHCPKHFHSA-N topotecan Chemical compound C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UCFGDBYHRUNTLO-QHCPKHFHSA-N 0.000 description 3
- 229960000303 topotecan Drugs 0.000 description 3
- 230000032258 transport Effects 0.000 description 3
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 description 3
- 230000004906 unfolded protein response Effects 0.000 description 3
- 201000005112 urinary bladder cancer Diseases 0.000 description 3
- 229960005486 vaccine Drugs 0.000 description 3
- 229960000653 valrubicin Drugs 0.000 description 3
- ZOCKGBMQLCSHFP-KQRAQHLDSA-N valrubicin Chemical compound O([C@H]1C[C@](CC2=C(O)C=3C(=O)C4=CC=CC(OC)=C4C(=O)C=3C(O)=C21)(O)C(=O)COC(=O)CCCC)[C@H]1C[C@H](NC(=O)C(F)(F)F)[C@H](O)[C@H](C)O1 ZOCKGBMQLCSHFP-KQRAQHLDSA-N 0.000 description 3
- 229960000241 vandetanib Drugs 0.000 description 3
- UHTHHESEBZOYNR-UHFFFAOYSA-N vandetanib Chemical compound COC1=CC(C(/N=CN2)=N/C=3C(=CC(Br)=CC=3)F)=C2C=C1OCC1CCN(C)CC1 UHTHHESEBZOYNR-UHFFFAOYSA-N 0.000 description 3
- UGGWPQSBPIFKDZ-KOTLKJBCSA-N vindesine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(N)=O)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1N=C1[C]2C=CC=C1 UGGWPQSBPIFKDZ-KOTLKJBCSA-N 0.000 description 3
- 229960004355 vindesine Drugs 0.000 description 3
- NMDYYWFGPIMTKO-HBVLKOHWSA-N vinflunine Chemical compound C([C@@](C1=C(C2=CC=CC=C2N1)C1)(C2=C(OC)C=C3N(C)[C@@H]4[C@@]5(C3=C2)CCN2CC=C[C@]([C@@H]52)([C@H]([C@]4(O)C(=O)OC)OC(C)=O)CC)C(=O)OC)[C@H]2C[C@@H](C(C)(F)F)CN1C2 NMDYYWFGPIMTKO-HBVLKOHWSA-N 0.000 description 3
- 229960000922 vinflunine Drugs 0.000 description 3
- 229960000641 zorubicin Drugs 0.000 description 3
- FBTUMDXHSRTGRV-ALTNURHMSA-N zorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(\C)=N\NC(=O)C=1C=CC=CC=1)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 FBTUMDXHSRTGRV-ALTNURHMSA-N 0.000 description 3
- 102100030408 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Human genes 0.000 description 2
- VSNHCAURESNICA-NJFSPNSNSA-N 1-oxidanylurea Chemical compound N[14C](=O)NO VSNHCAURESNICA-NJFSPNSNSA-N 0.000 description 2
- 102100033875 3-oxo-5-alpha-steroid 4-dehydrogenase 2 Human genes 0.000 description 2
- 102100022030 39S ribosomal protein L24, mitochondrial Human genes 0.000 description 2
- 108010071258 4-hydroxy-2-oxoglutarate aldolase Proteins 0.000 description 2
- 102100027715 4-hydroxy-2-oxoglutarate aldolase, mitochondrial Human genes 0.000 description 2
- 102100039791 43 kDa receptor-associated protein of the synapse Human genes 0.000 description 2
- 102100028348 60S ribosomal protein L26 Human genes 0.000 description 2
- 102100041029 60S ribosomal protein L9 Human genes 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- 102100040077 A-kinase anchor protein 6 Human genes 0.000 description 2
- 102100023818 ADP-ribosylation factor 3 Human genes 0.000 description 2
- 102100022911 ADP-ribosylation factor-like protein 17 Human genes 0.000 description 2
- 102000017920 ADRB1 Human genes 0.000 description 2
- 102100031315 AP-2 complex subunit mu Human genes 0.000 description 2
- 102100036613 ATP-binding cassette sub-family A member 9 Human genes 0.000 description 2
- 102100028186 ATP-binding cassette sub-family C member 5 Human genes 0.000 description 2
- 102100025514 ATP-dependent 6-phosphofructokinase, platelet type Human genes 0.000 description 2
- 102100024738 ATP-dependent RNA helicase DDX19A Human genes 0.000 description 2
- 102100035972 ATPase GET3 Human genes 0.000 description 2
- 102100024825 ATPase MORC2 Human genes 0.000 description 2
- 102100025995 AarF domain-containing protein kinase 1 Human genes 0.000 description 2
- 102100028221 Abl interactor 2 Human genes 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- 102100022715 Acetyl-coenzyme A thioesterase Human genes 0.000 description 2
- 102100022097 Acid-sensing ion channel 3 Human genes 0.000 description 2
- 101710099898 Acid-sensing ion channel 3 Proteins 0.000 description 2
- 208000024893 Acute lymphoblastic leukemia Diseases 0.000 description 2
- 208000014697 Acute lymphocytic leukaemia Diseases 0.000 description 2
- 102100030959 Acyl-coenzyme A thioesterase MBLAC2 Human genes 0.000 description 2
- 102000007471 Adenosine A2A receptor Human genes 0.000 description 2
- 108010085277 Adenosine A2A receptor Proteins 0.000 description 2
- 102100040439 Adenylate kinase 4, mitochondrial Human genes 0.000 description 2
- 102100022958 Adenylate kinase 7 Human genes 0.000 description 2
- 230000007730 Akt signaling Effects 0.000 description 2
- 102100031969 Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1 Human genes 0.000 description 2
- 102100040433 Alpha-ketoglutarate-dependent dioxygenase alkB homolog 6 Human genes 0.000 description 2
- 102100037242 Amiloride-sensitive sodium channel subunit alpha Human genes 0.000 description 2
- 102100040181 Aminopeptidase Q Human genes 0.000 description 2
- 102100033900 Ankyrin repeat and SOCS box protein 13 Human genes 0.000 description 2
- 102100033328 Ankyrin repeat domain-containing protein 42 Human genes 0.000 description 2
- 102100022278 Arachidonate 5-lipoxygenase-activating protein Human genes 0.000 description 2
- 102100034225 Armadillo repeat-containing X-linked protein 1 Human genes 0.000 description 2
- 102100028494 Armadillo repeat-containing protein 12 Human genes 0.000 description 2
- 102100026424 Arrestin domain-containing protein 3 Human genes 0.000 description 2
- 102100022512 Ataxin-7-like protein 3B Human genes 0.000 description 2
- 102100039339 Atrial natriuretic peptide receptor 1 Human genes 0.000 description 2
- 102100026630 Aurora kinase C Human genes 0.000 description 2
- 102100026337 BAI1-associated protein 3 Human genes 0.000 description 2
- 101710049498 BAIAP3 Proteins 0.000 description 2
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 description 2
- 102100032434 BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 1 Human genes 0.000 description 2
- 108091032955 Bacterial small RNA Proteins 0.000 description 2
- 102100023051 Band 4.1-like protein 4B Human genes 0.000 description 2
- 102100021297 Bardet-Biedl syndrome 12 protein Human genes 0.000 description 2
- 102100027880 Basal body-orientation factor 1 Human genes 0.000 description 2
- 102100031680 Beta-catenin-interacting protein 1 Human genes 0.000 description 2
- 102000004219 Brain-derived neurotrophic factor Human genes 0.000 description 2
- 108090000715 Brain-derived neurotrophic factor Proteins 0.000 description 2
- 102100035747 Brain-enriched guanylate kinase-associated protein Human genes 0.000 description 2
- 102100024791 Breast cancer metastasis-suppressor 1-like protein Human genes 0.000 description 2
- 102100021935 C-C motif chemokine 26 Human genes 0.000 description 2
- 102100036150 C-X-C motif chemokine 5 Human genes 0.000 description 2
- 102100026194 C-type lectin domain family 2 member B Human genes 0.000 description 2
- 102100032954 C2 domain-containing protein 2 Human genes 0.000 description 2
- 102100036169 CAAX box protein 1 Human genes 0.000 description 2
- 102100028738 CAP-Gly domain-containing linker protein 3 Human genes 0.000 description 2
- 102100028742 CAP-Gly domain-containing linker protein 4 Human genes 0.000 description 2
- 102100031168 CCN family member 2 Human genes 0.000 description 2
- 101710036791 CEP192 Proteins 0.000 description 2
- 102100028637 CLOCK-interacting pacemaker Human genes 0.000 description 2
- 102100031974 CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 4 Human genes 0.000 description 2
- 102100038733 CREB3 regulatory factor Human genes 0.000 description 2
- 102100024151 Cadherin-16 Human genes 0.000 description 2
- 102100025331 Cadherin-8 Human genes 0.000 description 2
- 101000928995 Caenorhabditis elegans Putative deoxyribose-phosphate aldolase Proteins 0.000 description 2
- 102100026252 Calcium/calmodulin-dependent protein kinase II inhibitor 1 Human genes 0.000 description 2
- 102100025462 Calpain-12 Human genes 0.000 description 2
- 102100028801 Calsyntenin-1 Human genes 0.000 description 2
- 101001110283 Canis lupus familiaris Ras-related C3 botulinum toxin substrate 1 Proteins 0.000 description 2
- 102100030621 Carboxypeptidase A4 Human genes 0.000 description 2
- 208000010667 Carcinoma of liver and intrahepatic biliary tract Diseases 0.000 description 2
- 102100027946 Carnitine O-palmitoyltransferase 1, brain isoform Human genes 0.000 description 2
- 102100027306 Carotenoid-cleaving dioxygenase, mitochondrial Human genes 0.000 description 2
- 108090000397 Caspase 3 Proteins 0.000 description 2
- 108090000567 Caspase 7 Proteins 0.000 description 2
- 102100026089 Caspase recruitment domain-containing protein 9 Human genes 0.000 description 2
- 102100029855 Caspase-3 Human genes 0.000 description 2
- 102100024940 Cathepsin K Human genes 0.000 description 2
- 102100028061 Cation channel sperm-associated protein 3 Human genes 0.000 description 2
- 101710145225 Cation-independent mannose-6-phosphate receptor Proteins 0.000 description 2
- 102100037182 Cation-independent mannose-6-phosphate receptor Human genes 0.000 description 2
- 108010072135 Cell Adhesion Molecule-1 Proteins 0.000 description 2
- 102100024649 Cell adhesion molecule 1 Human genes 0.000 description 2
- 102100037677 Cell surface hyaluronidase Human genes 0.000 description 2
- 102100036178 Centrosomal protein of 192 kDa Human genes 0.000 description 2
- 206010008342 Cervix carcinoma Diseases 0.000 description 2
- 102100038164 Chromodomain-helicase-DNA-binding protein 9 Human genes 0.000 description 2
- 208000010833 Chronic myeloid leukaemia Diseases 0.000 description 2
- 102100034628 Cilia- and flagella-associated protein 206 Human genes 0.000 description 2
- 102100025658 Cilia- and flagella-associated protein 46 Human genes 0.000 description 2
- 102100025723 Cilia- and flagella-associated protein 54 Human genes 0.000 description 2
- 102100033684 Cilia- and flagella-associated protein 57 Human genes 0.000 description 2
- 102100026675 Ciliary-associated calcium-binding coiled-coil protein 1 Human genes 0.000 description 2
- 102100024946 Ciliogenesis-associated TTC17-interacting protein Human genes 0.000 description 2
- 102100034177 Clathrin coat assembly protein AP180 Human genes 0.000 description 2
- 102100038445 Claudin-2 Human genes 0.000 description 2
- 102100021216 Cleft lip and palate transmembrane protein 1 Human genes 0.000 description 2
- 102100035236 Coiled-coil domain-containing protein 146 Human genes 0.000 description 2
- 102100035229 Coiled-coil domain-containing protein 148 Human genes 0.000 description 2
- 102100023670 Coiled-coil domain-containing protein 191 Human genes 0.000 description 2
- 102100021981 Coiled-coil domain-containing protein 28A Human genes 0.000 description 2
- 102100032410 Coiled-coil domain-containing protein 30 Human genes 0.000 description 2
- 102100036616 Coiled-coil domain-containing protein 40 Human genes 0.000 description 2
- 102100026768 Coiled-coil domain-containing protein 71L Human genes 0.000 description 2
- 102100023707 Coiled-coil domain-containing protein 81 Human genes 0.000 description 2
- 102100031457 Collagen alpha-1(V) chain Human genes 0.000 description 2
- 102100031502 Collagen alpha-2(V) chain Human genes 0.000 description 2
- 102100024338 Collagen alpha-3(VI) chain Human genes 0.000 description 2
- 102100039551 Collagen triple helix repeat-containing protein 1 Human genes 0.000 description 2
- 102100033635 Collectrin Human genes 0.000 description 2
- 102100035321 Complement factor H-related protein 3 Human genes 0.000 description 2
- 102100033843 Condensin complex subunit 1 Human genes 0.000 description 2
- 102100040998 Conserved oligomeric Golgi complex subunit 6 Human genes 0.000 description 2
- 102100029386 Copine-7 Human genes 0.000 description 2
- 108010025464 Cyclin-Dependent Kinase 4 Proteins 0.000 description 2
- 108010016788 Cyclin-Dependent Kinase Inhibitor p21 Proteins 0.000 description 2
- 102100038252 Cyclin-G1 Human genes 0.000 description 2
- 102100038250 Cyclin-G2 Human genes 0.000 description 2
- 102100036252 Cyclin-dependent kinase 4 Human genes 0.000 description 2
- 102100033270 Cyclin-dependent kinase inhibitor 1 Human genes 0.000 description 2
- 108010019961 Cysteine-Rich Protein 61 Proteins 0.000 description 2
- 102000005889 Cysteine-Rich Protein 61 Human genes 0.000 description 2
- 108010074918 Cytochrome P-450 CYP1A1 Proteins 0.000 description 2
- 108010000561 Cytochrome P-450 CYP2C8 Proteins 0.000 description 2
- 102100031476 Cytochrome P450 1A1 Human genes 0.000 description 2
- 102100029359 Cytochrome P450 2C8 Human genes 0.000 description 2
- 102100026518 Cytochrome P450 2W1 Human genes 0.000 description 2
- 102100039223 Cytoplasmic polyadenylation element-binding protein 1 Human genes 0.000 description 2
- 102100039221 Cytoplasmic polyadenylation element-binding protein 3 Human genes 0.000 description 2
- NYHBQMYGNKIUIF-UHFFFAOYSA-N D-guanosine Natural products C1=2NC(N)=NC(=O)C=2N=CN1C1OC(CO)C(O)C1O NYHBQMYGNKIUIF-UHFFFAOYSA-N 0.000 description 2
- 102100033212 DAZ-associated protein 2 Human genes 0.000 description 2
- 102100024395 DCC-interacting protein 13-alpha Human genes 0.000 description 2
- 108091007703 DDX11-AS1 Proteins 0.000 description 2
- 102000012677 DET1 Human genes 0.000 description 2
- 101150113651 DET1 gene Proteins 0.000 description 2
- 102100024810 DNA (cytosine-5)-methyltransferase 3B Human genes 0.000 description 2
- 101710123222 DNA (cytosine-5)-methyltransferase 3B Proteins 0.000 description 2
- 102100020782 DNA polymerase delta subunit 3 Human genes 0.000 description 2
- 102100029905 DNA polymerase epsilon subunit 3 Human genes 0.000 description 2
- 108010092160 Dactinomycin Proteins 0.000 description 2
- 102100036504 Dehydrogenase/reductase SDR family member 9 Human genes 0.000 description 2
- 102100037802 Deoxyribose-phosphate aldolase Human genes 0.000 description 2
- 102100036969 Dipeptidyl peptidase 9 Human genes 0.000 description 2
- 102100035589 Distal membrane-arm assembly complex protein 2 Human genes 0.000 description 2
- 102100032246 Double zinc ribbon and ankyrin repeat-containing protein 1 Human genes 0.000 description 2
- 102100037574 Dual specificity protein phosphatase 18 Human genes 0.000 description 2
- 102100034430 Dual specificity protein phosphatase 19 Human genes 0.000 description 2
- 102100028987 Dual specificity protein phosphatase 2 Human genes 0.000 description 2
- 102100027272 Dual specificity protein phosphatase 8 Human genes 0.000 description 2
- 102100021071 Dynactin subunit 5 Human genes 0.000 description 2
- 102100038919 Dynein axonemal assembly factor 1 Human genes 0.000 description 2
- 102100024282 Dynein axonemal assembly factor 11 Human genes 0.000 description 2
- 102100038915 Dynein axonemal assembly factor 3 Human genes 0.000 description 2
- 102100031648 Dynein axonemal heavy chain 5 Human genes 0.000 description 2
- 102100031646 Dynein axonemal heavy chain 6 Human genes 0.000 description 2
- 102100029688 Dynein axonemal intermediate chain 3 Human genes 0.000 description 2
- 102100037734 Dynein regulatory complex protein 9 Human genes 0.000 description 2
- 102100025015 Dynein regulatory complex subunit 3 Human genes 0.000 description 2
- 102100033209 Dysbindin domain-containing protein 2 Human genes 0.000 description 2
- 102100020767 Dystrophin-related protein 2 Human genes 0.000 description 2
- 102100021820 E3 ubiquitin-protein ligase RNF4 Human genes 0.000 description 2
- 102100031960 E3 ubiquitin-protein ligase TRIM71 Human genes 0.000 description 2
- 102100028606 E3 ubiquitin-protein ligase ZNRF2 Human genes 0.000 description 2
- 102100020960 E3 ubiquitin-protein transferase RMND5A Human genes 0.000 description 2
- 102100037359 EF-hand calcium-binding domain-containing protein 13 Human genes 0.000 description 2
- 102100033910 EF-hand calcium-binding domain-containing protein 6 Human genes 0.000 description 2
- 102100023794 ETS domain-containing protein Elk-3 Human genes 0.000 description 2
- 102100023792 ETS domain-containing protein Elk-4 Human genes 0.000 description 2
- 102100032053 Elongation of very long chain fatty acids protein 4 Human genes 0.000 description 2
- 102100021597 Endoplasmic reticulum aminopeptidase 2 Human genes 0.000 description 2
- 102100030377 Endoplasmic reticulum metallopeptidase 1 Human genes 0.000 description 2
- 102100031863 Endoplasmic reticulum-Golgi intermediate compartment protein 2 Human genes 0.000 description 2
- 206010014967 Ependymoma Diseases 0.000 description 2
- 102100039608 Epidermal growth factor receptor kinase substrate 8-like protein 1 Human genes 0.000 description 2
- 208000031637 Erythroblastic Acute Leukemia Diseases 0.000 description 2
- 208000036566 Erythroleukaemia Diseases 0.000 description 2
- LRSFXIJGHRPOQQ-VZRQQIPSSA-N Estradiol mustard Chemical compound C([C@@H]1[C@@H](C2=CC=3)CC[C@]4([C@H]1CC[C@@H]4OC(=O)CC=1C=CC(=CC=1)N(CCCl)CCCl)C)CC2=CC=3OC(=O)CC1=CC=C(N(CCCl)CCCl)C=C1 LRSFXIJGHRPOQQ-VZRQQIPSSA-N 0.000 description 2
- HKVAMNSJSFKALM-GKUWKFKPSA-N Everolimus Chemical compound C1C[C@@H](OCCO)[C@H](OC)C[C@@H]1C[C@@H](C)[C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@](O)(O2)[C@H](C)CC[C@H]2C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(=O)C1 HKVAMNSJSFKALM-GKUWKFKPSA-N 0.000 description 2
- 102100029907 Exocyst complex component 6B Human genes 0.000 description 2
- 102100040672 F-box/WD repeat-containing protein 9 Human genes 0.000 description 2
- 102100022354 FAS-associated factor 2 Human genes 0.000 description 2
- 102100038665 FGGY carbohydrate kinase domain-containing protein Human genes 0.000 description 2
- 102100027868 FHF complex subunit HOOK interacting protein 1A Human genes 0.000 description 2
- 102100026118 Ferredoxin-fold anticodon-binding domain-containing protein 1 Human genes 0.000 description 2
- 102100027634 Fibronectin type 3 and ankyrin repeat domains protein 1 Human genes 0.000 description 2
- 102100027628 Fibrous sheath-interacting protein 1 Human genes 0.000 description 2
- 102100040305 Flagellum-associated coiled-coil domain-containing protein 1 Human genes 0.000 description 2
- 101001067614 Flaveria pringlei Serine hydroxymethyltransferase 2, mitochondrial Proteins 0.000 description 2
- 102100022627 Fructose-2,6-bisphosphatase Human genes 0.000 description 2
- 102100022148 G protein pathway suppressor 2 Human genes 0.000 description 2
- 102100023685 G protein-coupled receptor kinase 5 Human genes 0.000 description 2
- 102100026406 G/T mismatch-specific thymine DNA glycosylase Human genes 0.000 description 2
- 230000037059 G2/M phase arrest Effects 0.000 description 2
- 102100040301 GDNF family receptor alpha-3 Human genes 0.000 description 2
- 108091060519 GNAS-AS1 Proteins 0.000 description 2
- 102100023930 GREB1-like protein Human genes 0.000 description 2
- 102100028617 GRIP and coiled-coil domain-containing protein 2 Human genes 0.000 description 2
- 101710113436 GTPase KRas Proteins 0.000 description 2
- 206010051066 Gastrointestinal stromal tumour Diseases 0.000 description 2
- 102100039956 Geminin Human genes 0.000 description 2
- 206010018338 Glioma Diseases 0.000 description 2
- 102100036636 Glucose 1,6-bisphosphate synthase Human genes 0.000 description 2
- 102100021223 Glucosidase 2 subunit beta Human genes 0.000 description 2
- 102100023528 Glucoside xylosyltransferase 2 Human genes 0.000 description 2
- 102100033044 Glutathione peroxidase 2 Human genes 0.000 description 2
- 102100024404 Glycosyltransferase 8 domain-containing protein 2 Human genes 0.000 description 2
- 102100032558 Glypican-2 Human genes 0.000 description 2
- 102100032563 Golgin subfamily A member 1 Human genes 0.000 description 2
- 102100032560 Golgin subfamily A member 4 Human genes 0.000 description 2
- 102100023683 GrpE protein homolog 2, mitochondrial Human genes 0.000 description 2
- 102100039874 Guanine nucleotide-binding protein G(z) subunit alpha Human genes 0.000 description 2
- 102100024979 Guanine nucleotide-binding protein subunit beta-like protein 1 Human genes 0.000 description 2
- 102100033079 HLA class II histocompatibility antigen, DM alpha chain Human genes 0.000 description 2
- 108010050568 HLA-DM antigens Proteins 0.000 description 2
- 108700039143 HMGA2 Proteins 0.000 description 2
- 102100028006 Heme oxygenase 1 Human genes 0.000 description 2
- 102000048988 Hemochromatosis Human genes 0.000 description 2
- 108700022944 Hemochromatosis Proteins 0.000 description 2
- 206010073069 Hepatic cancer Diseases 0.000 description 2
- 108010007707 Hepatitis A Virus Cellular Receptor 2 Proteins 0.000 description 2
- 101150065637 Hfe gene Proteins 0.000 description 2
- 102100028999 High mobility group protein HMGI-C Human genes 0.000 description 2
- 102100039265 Histone H2A type 1-C Human genes 0.000 description 2
- 102100034533 Histone H2AX Human genes 0.000 description 2
- 102100030690 Histone H2B type 1-C/E/F/G/I Human genes 0.000 description 2
- 101150073387 Hmga2 gene Proteins 0.000 description 2
- 208000017604 Hodgkin disease Diseases 0.000 description 2
- 208000021519 Hodgkin lymphoma Diseases 0.000 description 2
- 208000010747 Hodgkins lymphoma Diseases 0.000 description 2
- 102100030339 Homeobox protein Hox-A10 Human genes 0.000 description 2
- 102100039545 Homeobox protein Hox-D11 Human genes 0.000 description 2
- 102100027875 Homeobox protein Nkx-2.5 Human genes 0.000 description 2
- 102100033791 Homeobox protein aristaless-like 3 Human genes 0.000 description 2
- 101000583049 Homo sapiens 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Proteins 0.000 description 2
- 101000640851 Homo sapiens 3-oxo-5-alpha-steroid 4-dehydrogenase 2 Proteins 0.000 description 2
- 101001107423 Homo sapiens 39S ribosomal protein L24, mitochondrial Proteins 0.000 description 2
- 101000744504 Homo sapiens 43 kDa receptor-associated protein of the synapse Proteins 0.000 description 2
- 101001080179 Homo sapiens 60S ribosomal protein L26 Proteins 0.000 description 2
- 101000890611 Homo sapiens A-kinase anchor protein 6 Proteins 0.000 description 2
- 101000684275 Homo sapiens ADP-ribosylation factor 3 Proteins 0.000 description 2
- 101000974511 Homo sapiens ADP-ribosylation factor-like protein 17 Proteins 0.000 description 2
- 101000796047 Homo sapiens AP-2 complex subunit mu Proteins 0.000 description 2
- 101000929667 Homo sapiens ATP-binding cassette sub-family A member 9 Proteins 0.000 description 2
- 101000986622 Homo sapiens ATP-binding cassette sub-family C member 5 Proteins 0.000 description 2
- 101000693765 Homo sapiens ATP-dependent 6-phosphofructokinase, platelet type Proteins 0.000 description 2
- 101000830459 Homo sapiens ATP-dependent RNA helicase DDX19A Proteins 0.000 description 2
- 101001074983 Homo sapiens ATPase GET3 Proteins 0.000 description 2
- 101001051808 Homo sapiens ATPase MORC2 Proteins 0.000 description 2
- 101000720055 Homo sapiens AarF domain-containing protein kinase 1 Proteins 0.000 description 2
- 101000724231 Homo sapiens Abl interactor 2 Proteins 0.000 description 2
- 101000678862 Homo sapiens Acetyl-coenzyme A thioesterase Proteins 0.000 description 2
- 101000583826 Homo sapiens Acyl-coenzyme A thioesterase MBLAC2 Proteins 0.000 description 2
- 101000614487 Homo sapiens Adenylate kinase 4, mitochondrial Proteins 0.000 description 2
- 101000975137 Homo sapiens Adenylate kinase 7 Proteins 0.000 description 2
- 101000703728 Homo sapiens Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1 Proteins 0.000 description 2
- 101000891530 Homo sapiens Alpha-ketoglutarate-dependent dioxygenase alkB homolog 6 Proteins 0.000 description 2
- 101000740448 Homo sapiens Amiloride-sensitive sodium channel subunit alpha Proteins 0.000 description 2
- 101000889673 Homo sapiens Aminopeptidase Q Proteins 0.000 description 2
- 101000925512 Homo sapiens Ankyrin repeat and SOCS box protein 13 Proteins 0.000 description 2
- 101000732369 Homo sapiens Ankyrin repeat domain-containing protein 42 Proteins 0.000 description 2
- 101000755875 Homo sapiens Arachidonate 5-lipoxygenase-activating protein Proteins 0.000 description 2
- 101000925943 Homo sapiens Armadillo repeat-containing X-linked protein 1 Proteins 0.000 description 2
- 101000769229 Homo sapiens Armadillo repeat-containing protein 12 Proteins 0.000 description 2
- 101000785775 Homo sapiens Arrestin domain-containing protein 3 Proteins 0.000 description 2
- 101000678094 Homo sapiens Ataxin-7-like protein 3B Proteins 0.000 description 2
- 101000961044 Homo sapiens Atrial natriuretic peptide receptor 1 Proteins 0.000 description 2
- 101000765862 Homo sapiens Aurora kinase C Proteins 0.000 description 2
- 101000798410 Homo sapiens BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 1 Proteins 0.000 description 2
- 101001049962 Homo sapiens Band 4.1-like protein 4B Proteins 0.000 description 2
- 101000894739 Homo sapiens Bardet-Biedl syndrome 12 protein Proteins 0.000 description 2
- 101000697681 Homo sapiens Basal body-orientation factor 1 Proteins 0.000 description 2
- 101000892264 Homo sapiens Beta-1 adrenergic receptor Proteins 0.000 description 2
- 101000993469 Homo sapiens Beta-catenin-interacting protein 1 Proteins 0.000 description 2
- 101000873920 Homo sapiens Brain-enriched guanylate kinase-associated protein Proteins 0.000 description 2
- 101000761835 Homo sapiens Breast cancer metastasis-suppressor 1-like protein Proteins 0.000 description 2
- 101000897493 Homo sapiens C-C motif chemokine 26 Proteins 0.000 description 2
- 101000947186 Homo sapiens C-X-C motif chemokine 5 Proteins 0.000 description 2
- 101000912618 Homo sapiens C-type lectin domain family 2 member B Proteins 0.000 description 2
- 101000867968 Homo sapiens C2 domain-containing protein 2 Proteins 0.000 description 2
- 101000947164 Homo sapiens CAAX box protein 1 Proteins 0.000 description 2
- 101000767055 Homo sapiens CAP-Gly domain-containing linker protein 3 Proteins 0.000 description 2
- 101000767061 Homo sapiens CAP-Gly domain-containing linker protein 4 Proteins 0.000 description 2
- 101100222250 Homo sapiens CATSPER3 gene Proteins 0.000 description 2
- 101000777550 Homo sapiens CCN family member 2 Proteins 0.000 description 2
- 101000766839 Homo sapiens CLOCK-interacting pacemaker Proteins 0.000 description 2
- 101000703754 Homo sapiens CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 4 Proteins 0.000 description 2
- 101000957828 Homo sapiens CREB3 regulatory factor Proteins 0.000 description 2
- 101000762246 Homo sapiens Cadherin-16 Proteins 0.000 description 2
- 101000935095 Homo sapiens Cadherin-8 Proteins 0.000 description 2
- 101000913913 Homo sapiens Calcium/calmodulin-dependent protein kinase II inhibitor 1 Proteins 0.000 description 2
- 101000984115 Homo sapiens Calpain-12 Proteins 0.000 description 2
- 101000916423 Homo sapiens Calsyntenin-1 Proteins 0.000 description 2
- 101000772572 Homo sapiens Carboxypeptidase A4 Proteins 0.000 description 2
- 101000859578 Homo sapiens Carnitine O-palmitoyltransferase 1, brain isoform Proteins 0.000 description 2
- 101000937734 Homo sapiens Carotenoid-cleaving dioxygenase, mitochondrial Proteins 0.000 description 2
- 101000983508 Homo sapiens Caspase recruitment domain-containing protein 9 Proteins 0.000 description 2
- 101000761509 Homo sapiens Cathepsin K Proteins 0.000 description 2
- 101000880605 Homo sapiens Cell surface hyaluronidase Proteins 0.000 description 2
- 101000883548 Homo sapiens Chromodomain-helicase-DNA-binding protein 9 Proteins 0.000 description 2
- 101000710053 Homo sapiens Cilia- and flagella-associated protein 206 Proteins 0.000 description 2
- 101000914166 Homo sapiens Cilia- and flagella-associated protein 46 Proteins 0.000 description 2
- 101000914221 Homo sapiens Cilia- and flagella-associated protein 54 Proteins 0.000 description 2
- 101000944495 Homo sapiens Cilia- and flagella-associated protein 57 Proteins 0.000 description 2
- 101000910924 Homo sapiens Ciliary-associated calcium-binding coiled-coil protein 1 Proteins 0.000 description 2
- 101000761406 Homo sapiens Ciliogenesis-associated TTC17-interacting protein Proteins 0.000 description 2
- 101000732333 Homo sapiens Clathrin coat assembly protein AP180 Proteins 0.000 description 2
- 101000882901 Homo sapiens Claudin-2 Proteins 0.000 description 2
- 101000750204 Homo sapiens Cleft lip and palate transmembrane protein 1 Proteins 0.000 description 2
- 101000737221 Homo sapiens Coiled-coil domain-containing protein 146 Proteins 0.000 description 2
- 101000737238 Homo sapiens Coiled-coil domain-containing protein 148 Proteins 0.000 description 2
- 101000978239 Homo sapiens Coiled-coil domain-containing protein 191 Proteins 0.000 description 2
- 101000896971 Homo sapiens Coiled-coil domain-containing protein 28A Proteins 0.000 description 2
- 101000868780 Homo sapiens Coiled-coil domain-containing protein 30 Proteins 0.000 description 2
- 101000715283 Homo sapiens Coiled-coil domain-containing protein 40 Proteins 0.000 description 2
- 101000910811 Homo sapiens Coiled-coil domain-containing protein 71L Proteins 0.000 description 2
- 101000978391 Homo sapiens Coiled-coil domain-containing protein 81 Proteins 0.000 description 2
- 101000941708 Homo sapiens Collagen alpha-1(V) chain Proteins 0.000 description 2
- 101000941594 Homo sapiens Collagen alpha-2(V) chain Proteins 0.000 description 2
- 101000909506 Homo sapiens Collagen alpha-3(VI) chain Proteins 0.000 description 2
- 101000746121 Homo sapiens Collagen triple helix repeat-containing protein 1 Proteins 0.000 description 2
- 101000945075 Homo sapiens Collectrin Proteins 0.000 description 2
- 101000878136 Homo sapiens Complement factor H-related protein 3 Proteins 0.000 description 2
- 101000710846 Homo sapiens Condensin complex subunit 1 Proteins 0.000 description 2
- 101000748957 Homo sapiens Conserved oligomeric Golgi complex subunit 6 Proteins 0.000 description 2
- 101000919214 Homo sapiens Copine-7 Proteins 0.000 description 2
- 101000884191 Homo sapiens Cyclin-G1 Proteins 0.000 description 2
- 101000884216 Homo sapiens Cyclin-G2 Proteins 0.000 description 2
- 101000855334 Homo sapiens Cytochrome P450 2W1 Proteins 0.000 description 2
- 101000745747 Homo sapiens Cytoplasmic polyadenylation element-binding protein 1 Proteins 0.000 description 2
- 101000745755 Homo sapiens Cytoplasmic polyadenylation element-binding protein 3 Proteins 0.000 description 2
- 101000871240 Homo sapiens DAZ-associated protein 2 Proteins 0.000 description 2
- 101001053277 Homo sapiens DCC-interacting protein 13-alpha Proteins 0.000 description 2
- 101000932004 Homo sapiens DNA polymerase delta subunit 3 Proteins 0.000 description 2
- 101000864175 Homo sapiens DNA polymerase epsilon subunit 3 Proteins 0.000 description 2
- 101000928746 Homo sapiens Dehydrogenase/reductase SDR family member 9 Proteins 0.000 description 2
- 101001053503 Homo sapiens Dihydropyrimidinase-related protein 2 Proteins 0.000 description 2
- 101000804945 Homo sapiens Dipeptidyl peptidase 9 Proteins 0.000 description 2
- 101000930307 Homo sapiens Distal membrane-arm assembly complex protein 2 Proteins 0.000 description 2
- 101001016174 Homo sapiens Double zinc ribbon and ankyrin repeat-containing protein 1 Proteins 0.000 description 2
- 101000881099 Homo sapiens Dual specificity protein phosphatase 18 Proteins 0.000 description 2
- 101000924027 Homo sapiens Dual specificity protein phosphatase 19 Proteins 0.000 description 2
- 101000838335 Homo sapiens Dual specificity protein phosphatase 2 Proteins 0.000 description 2
- 101001057604 Homo sapiens Dual specificity protein phosphatase 8 Proteins 0.000 description 2
- 101001041180 Homo sapiens Dynactin subunit 5 Proteins 0.000 description 2
- 101000955707 Homo sapiens Dynein axonemal assembly factor 1 Proteins 0.000 description 2
- 101000831210 Homo sapiens Dynein axonemal assembly factor 11 Proteins 0.000 description 2
- 101000955739 Homo sapiens Dynein axonemal assembly factor 3 Proteins 0.000 description 2
- 101000866368 Homo sapiens Dynein axonemal heavy chain 5 Proteins 0.000 description 2
- 101000866373 Homo sapiens Dynein axonemal heavy chain 6 Proteins 0.000 description 2
- 101000865953 Homo sapiens Dynein axonemal intermediate chain 3 Proteins 0.000 description 2
- 101000880811 Homo sapiens Dynein regulatory complex protein 9 Proteins 0.000 description 2
- 101000908408 Homo sapiens Dynein regulatory complex subunit 3 Proteins 0.000 description 2
- 101000871249 Homo sapiens Dysbindin domain-containing protein 2 Proteins 0.000 description 2
- 101000931797 Homo sapiens Dystrophin-related protein 2 Proteins 0.000 description 2
- 101001107086 Homo sapiens E3 ubiquitin-protein ligase RNF4 Proteins 0.000 description 2
- 101001064500 Homo sapiens E3 ubiquitin-protein ligase TRIM71 Proteins 0.000 description 2
- 101000915569 Homo sapiens E3 ubiquitin-protein ligase ZNRF2 Proteins 0.000 description 2
- 101000880228 Homo sapiens EF-hand calcium-binding domain-containing protein 13 Proteins 0.000 description 2
- 101000925416 Homo sapiens EF-hand calcium-binding domain-containing protein 6 Proteins 0.000 description 2
- 101001048716 Homo sapiens ETS domain-containing protein Elk-4 Proteins 0.000 description 2
- 101000921354 Homo sapiens Elongation of very long chain fatty acids protein 4 Proteins 0.000 description 2
- 101000898718 Homo sapiens Endoplasmic reticulum aminopeptidase 2 Proteins 0.000 description 2
- 101001063315 Homo sapiens Endoplasmic reticulum metallopeptidase 1 Proteins 0.000 description 2
- 101000920800 Homo sapiens Endoplasmic reticulum-Golgi intermediate compartment protein 2 Proteins 0.000 description 2
- 101000813988 Homo sapiens Epidermal growth factor receptor kinase substrate 8-like protein 1 Proteins 0.000 description 2
- 101001011230 Homo sapiens Exocyst complex component 6B Proteins 0.000 description 2
- 101000892315 Homo sapiens F-box/WD repeat-containing protein 9 Proteins 0.000 description 2
- 101000824586 Homo sapiens FAS-associated factor 2 Proteins 0.000 description 2
- 101001031630 Homo sapiens FGGY carbohydrate kinase domain-containing protein Proteins 0.000 description 2
- 101001060551 Homo sapiens FHF complex subunit HOOK interacting protein 1A Proteins 0.000 description 2
- 101000912983 Homo sapiens Ferredoxin-fold anticodon-binding domain-containing protein 1 Proteins 0.000 description 2
- 101000937169 Homo sapiens Fibronectin type 3 and ankyrin repeat domains protein 1 Proteins 0.000 description 2
- 101000862364 Homo sapiens Fibrous sheath-interacting protein 1 Proteins 0.000 description 2
- 101000891676 Homo sapiens Flagellum-associated coiled-coil domain-containing protein 1 Proteins 0.000 description 2
- 101000823456 Homo sapiens Fructose-2,6-bisphosphatase Proteins 0.000 description 2
- 101000900320 Homo sapiens G protein pathway suppressor 2 Proteins 0.000 description 2
- 101000829476 Homo sapiens G protein-coupled receptor kinase 5 Proteins 0.000 description 2
- 101000835738 Homo sapiens G/T mismatch-specific thymine DNA glycosylase Proteins 0.000 description 2
- 101001038376 Homo sapiens GDNF family receptor alpha-3 Proteins 0.000 description 2
- 101000904872 Homo sapiens GREB1-like protein Proteins 0.000 description 2
- 101001058870 Homo sapiens GRIP and coiled-coil domain-containing protein 2 Proteins 0.000 description 2
- 101000886596 Homo sapiens Geminin Proteins 0.000 description 2
- 101001072892 Homo sapiens Glucose 1,6-bisphosphate synthase Proteins 0.000 description 2
- 101001040875 Homo sapiens Glucosidase 2 subunit beta Proteins 0.000 description 2
- 101000906420 Homo sapiens Glucoside xylosyltransferase 2 Proteins 0.000 description 2
- 101000871129 Homo sapiens Glutathione peroxidase 2 Proteins 0.000 description 2
- 101000833040 Homo sapiens Glycosyltransferase 8 domain-containing protein 2 Proteins 0.000 description 2
- 101001014664 Homo sapiens Glypican-2 Proteins 0.000 description 2
- 101001014628 Homo sapiens Golgin subfamily A member 1 Proteins 0.000 description 2
- 101001014636 Homo sapiens Golgin subfamily A member 4 Proteins 0.000 description 2
- 101000829465 Homo sapiens GrpE protein homolog 2, mitochondrial Proteins 0.000 description 2
- 101000887490 Homo sapiens Guanine nucleotide-binding protein G(z) subunit alpha Proteins 0.000 description 2
- 101000830152 Homo sapiens Guanine nucleotide-binding protein subunit beta-like protein 1 Proteins 0.000 description 2
- 101001079623 Homo sapiens Heme oxygenase 1 Proteins 0.000 description 2
- 101001036109 Homo sapiens Histone H2A type 1-C Proteins 0.000 description 2
- 101001067891 Homo sapiens Histone H2AX Proteins 0.000 description 2
- 101001084682 Homo sapiens Histone H2B type 1-C/E/F/G/I Proteins 0.000 description 2
- 101001083164 Homo sapiens Homeobox protein Hox-A10 Proteins 0.000 description 2
- 101000962591 Homo sapiens Homeobox protein Hox-D11 Proteins 0.000 description 2
- 101000632197 Homo sapiens Homeobox protein Nkx-2.5 Proteins 0.000 description 2
- 101000779611 Homo sapiens Homeobox protein aristaless-like 3 Proteins 0.000 description 2
- 101001035137 Homo sapiens Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 1 protein Proteins 0.000 description 2
- 101001005187 Homo sapiens Hormone-sensitive lipase Proteins 0.000 description 2
- 101001037204 Homo sapiens Hydrocephalus-inducing protein homolog Proteins 0.000 description 2
- 101000993380 Homo sapiens Hypermethylated in cancer 1 protein Proteins 0.000 description 2
- 101000993376 Homo sapiens Hypermethylated in cancer 2 protein Proteins 0.000 description 2
- 101001003102 Homo sapiens Hypoxia up-regulated protein 1 Proteins 0.000 description 2
- 101001011420 Homo sapiens IQ domain-containing protein C Proteins 0.000 description 2
- 101000840540 Homo sapiens Iduronate 2-sulfatase Proteins 0.000 description 2
- 101000997670 Homo sapiens Integrin beta-8 Proteins 0.000 description 2
- 101001076319 Homo sapiens Interleukin-1 receptor-associated kinase 1-binding protein 1 Proteins 0.000 description 2
- 101001055334 Homo sapiens Intraflagellar transport protein 22 homolog Proteins 0.000 description 2
- 101001047190 Homo sapiens Inward rectifier potassium channel 16 Proteins 0.000 description 2
- 101000599886 Homo sapiens Isocitrate dehydrogenase [NADP], mitochondrial Proteins 0.000 description 2
- 101001032492 Homo sapiens Isthmin-2 Proteins 0.000 description 2
- 101001046985 Homo sapiens KN motif and ankyrin repeat domain-containing protein 1 Proteins 0.000 description 2
- 101000945436 Homo sapiens Kelch domain-containing protein 1 Proteins 0.000 description 2
- 101001027140 Homo sapiens Kelch domain-containing protein 7A Proteins 0.000 description 2
- 101001006821 Homo sapiens Kelch domain-containing protein 9 Proteins 0.000 description 2
- 101001049220 Homo sapiens Kelch-like protein 17 Proteins 0.000 description 2
- 101000975474 Homo sapiens Keratin, type I cytoskeletal 10 Proteins 0.000 description 2
- 101000971665 Homo sapiens Kinesin-like protein KIF17 Proteins 0.000 description 2
- 101000652814 Homo sapiens Lactosylceramide alpha-2,3-sialyltransferase Proteins 0.000 description 2
- 101001003581 Homo sapiens Lamin-B1 Proteins 0.000 description 2
- 101001023271 Homo sapiens Laminin subunit gamma-2 Proteins 0.000 description 2
- 101001008403 Homo sapiens Lebercilin-like protein Proteins 0.000 description 2
- 101001038405 Homo sapiens Leucine zipper putative tumor suppressor 3 Proteins 0.000 description 2
- 101000619636 Homo sapiens Leucine-rich repeat and guanylate kinase domain-containing protein Proteins 0.000 description 2
- 101001017864 Homo sapiens Leucine-rich repeat-containing protein 14 Proteins 0.000 description 2
- 101001004863 Homo sapiens Leucine-rich repeat-containing protein 29 Proteins 0.000 description 2
- 101001065857 Homo sapiens Leucine-rich repeat-containing protein 75B Proteins 0.000 description 2
- 101001005211 Homo sapiens Lipoyltransferase 1, mitochondrial Proteins 0.000 description 2
- 101000942701 Homo sapiens Liprin-alpha-3 Proteins 0.000 description 2
- 101000780208 Homo sapiens Long-chain-fatty-acid-CoA ligase 4 Proteins 0.000 description 2
- 101001038507 Homo sapiens Ly6/PLAUR domain-containing protein 3 Proteins 0.000 description 2
- 101001137987 Homo sapiens Lymphocyte activation gene 3 protein Proteins 0.000 description 2
- 101001088883 Homo sapiens Lysine-specific demethylase 5B Proteins 0.000 description 2
- 101001038001 Homo sapiens Lysophosphatidic acid receptor 2 Proteins 0.000 description 2
- 101000624625 Homo sapiens M-phase inducer phosphatase 1 Proteins 0.000 description 2
- 101001115426 Homo sapiens MAGUK p55 subfamily member 3 Proteins 0.000 description 2
- 101001014223 Homo sapiens MAPK/MAK/MRK overlapping kinase Proteins 0.000 description 2
- 101001115730 Homo sapiens MORN repeat-containing protein 1 Proteins 0.000 description 2
- 101000575048 Homo sapiens MTOR-associated protein MEAK7 Proteins 0.000 description 2
- 101001106413 Homo sapiens Macrophage-stimulating protein receptor Proteins 0.000 description 2
- 101000576320 Homo sapiens Max-binding protein MNT Proteins 0.000 description 2
- 101001027943 Homo sapiens Metallothionein-1F Proteins 0.000 description 2
- 101001013796 Homo sapiens Metallothionein-1M Proteins 0.000 description 2
- 101001013799 Homo sapiens Metallothionein-1X Proteins 0.000 description 2
- 101000573441 Homo sapiens Misshapen-like kinase 1 Proteins 0.000 description 2
- 101000976899 Homo sapiens Mitogen-activated protein kinase 15 Proteins 0.000 description 2
- 101001132883 Homo sapiens Mitoregulin Proteins 0.000 description 2
- 101000623712 Homo sapiens Motile sperm domain-containing protein 2 Proteins 0.000 description 2
- 101000968663 Homo sapiens MutS protein homolog 5 Proteins 0.000 description 2
- 101000957351 Homo sapiens Myc-associated zinc finger protein Proteins 0.000 description 2
- 101001128495 Homo sapiens Myeloid zinc finger 1 Proteins 0.000 description 2
- 101000584208 Homo sapiens Myosin light chain kinase 2, skeletal/cardiac muscle Proteins 0.000 description 2
- 101001116601 Homo sapiens Myotubularin-related protein 9 Proteins 0.000 description 2
- 101000829992 Homo sapiens N-acetylglucosamine-6-sulfatase Proteins 0.000 description 2
- 101000730680 Homo sapiens N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase Proteins 0.000 description 2
- 101000874528 Homo sapiens N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase 3 Proteins 0.000 description 2
- 101000685982 Homo sapiens NAD(+) hydrolase SARM1 Proteins 0.000 description 2
- 101000973447 Homo sapiens NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 8 Proteins 0.000 description 2
- 101000997257 Homo sapiens NF-kappa-B inhibitor-interacting Ras-like protein 1 Proteins 0.000 description 2
- 101000583057 Homo sapiens NGFI-A-binding protein 2 Proteins 0.000 description 2
- 101000601127 Homo sapiens NHL repeat-containing protein 3 Proteins 0.000 description 2
- 101100080329 Homo sapiens NIPSNAP3B gene Proteins 0.000 description 2
- 101000970025 Homo sapiens NUAK family SNF1-like kinase 2 Proteins 0.000 description 2
- 101000978730 Homo sapiens Nephrin Proteins 0.000 description 2
- 101000978743 Homo sapiens Nephrocystin-1 Proteins 0.000 description 2
- 101000637240 Homo sapiens Neurite extension and migration factor Proteins 0.000 description 2
- 101000581961 Homo sapiens Neurocalcin-delta Proteins 0.000 description 2
- 101001128911 Homo sapiens Neutral cholesterol ester hydrolase 1 Proteins 0.000 description 2
- 101000577309 Homo sapiens Notch-regulated ankyrin repeat-containing protein Proteins 0.000 description 2
- 101000836002 Homo sapiens Nuclear GTPase SLIP-GC Proteins 0.000 description 2
- 101000973615 Homo sapiens Nuclear envelope integral membrane protein 1 Proteins 0.000 description 2
- 101001121654 Homo sapiens Nuclear pore complex protein Nup50 Proteins 0.000 description 2
- 101000603420 Homo sapiens Nuclear pore complex-interacting protein family member A1 Proteins 0.000 description 2
- 101001109698 Homo sapiens Nuclear receptor subfamily 4 group A member 2 Proteins 0.000 description 2
- 101001108314 Homo sapiens Nuclear receptor-binding protein Proteins 0.000 description 2
- 101000577339 Homo sapiens Nuclear receptor-binding protein 2 Proteins 0.000 description 2
- 101001128742 Homo sapiens Nucleoside diphosphate kinase homolog 5 Proteins 0.000 description 2
- 101000991945 Homo sapiens Nucleotide triphosphate diphosphatase NUDT15 Proteins 0.000 description 2
- 101000958669 Homo sapiens Nucleus accumbens-associated protein 2 Proteins 0.000 description 2
- 101000720966 Homo sapiens Opsin-3 Proteins 0.000 description 2
- 101001137516 Homo sapiens Outer dense fiber protein 3-like protein 2 Proteins 0.000 description 2
- 101001131829 Homo sapiens P protein Proteins 0.000 description 2
- 101000873418 Homo sapiens P-selectin glycoprotein ligand 1 Proteins 0.000 description 2
- 101000988401 Homo sapiens PDZ and LIM domain protein 3 Proteins 0.000 description 2
- 101001071233 Homo sapiens PHD finger protein 1 Proteins 0.000 description 2
- 101000692633 Homo sapiens PIH1 domain-containing protein 2 Proteins 0.000 description 2
- 101001069727 Homo sapiens Paired mesoderm homeobox protein 1 Proteins 0.000 description 2
- 101001129178 Homo sapiens Patatin-like phospholipase domain-containing protein 6 Proteins 0.000 description 2
- 101001095963 Homo sapiens Patatin-like phospholipase domain-containing protein 7 Proteins 0.000 description 2
- 101000738243 Homo sapiens Patched domain-containing protein 4 Proteins 0.000 description 2
- 101001001817 Homo sapiens Pejvakin Proteins 0.000 description 2
- 101000859737 Homo sapiens Peptidase inhibitor R3HDML Proteins 0.000 description 2
- 101001073216 Homo sapiens Period circadian protein homolog 2 Proteins 0.000 description 2
- 101001098116 Homo sapiens Phosphatidylinositol 3-kinase regulatory subunit gamma Proteins 0.000 description 2
- 101000595868 Homo sapiens Phosphatidylinositol transfer protein beta isoform Proteins 0.000 description 2
- 101001074628 Homo sapiens Phosphatidylinositol-glycan biosynthesis class W protein Proteins 0.000 description 2
- 101000609532 Homo sapiens Phosphoinositide-3-kinase-interacting protein 1 Proteins 0.000 description 2
- 101000730665 Homo sapiens Phospholipase D1 Proteins 0.000 description 2
- 101000701363 Homo sapiens Phospholipid-transporting ATPase IC Proteins 0.000 description 2
- 101000981515 Homo sapiens Phospholysine phosphohistidine inorganic pyrophosphate phosphatase Proteins 0.000 description 2
- 101000745252 Homo sapiens Plasma membrane ascorbate-dependent reductase CYBRD1 Proteins 0.000 description 2
- 101001053641 Homo sapiens Plasma serine protease inhibitor Proteins 0.000 description 2
- 101000583702 Homo sapiens Pleckstrin homology-like domain family A member 2 Proteins 0.000 description 2
- 101001067184 Homo sapiens Plexin-A3 Proteins 0.000 description 2
- 101001049841 Homo sapiens Potassium channel subfamily K member 1 Proteins 0.000 description 2
- 101001077431 Homo sapiens Potassium voltage-gated channel subfamily H member 3 Proteins 0.000 description 2
- 101000610118 Homo sapiens Pre-B-cell leukemia transcription factor 4 Proteins 0.000 description 2
- 101000613207 Homo sapiens Pre-B-cell leukemia transcription factor-interacting protein 1 Proteins 0.000 description 2
- 101000617708 Homo sapiens Pregnancy-specific beta-1-glycoprotein 1 Proteins 0.000 description 2
- 101000617725 Homo sapiens Pregnancy-specific beta-1-glycoprotein 2 Proteins 0.000 description 2
- 101000687549 Homo sapiens Prickle-like protein 4 Proteins 0.000 description 2
- 101000690940 Homo sapiens Pro-adrenomedullin Proteins 0.000 description 2
- 101001109765 Homo sapiens Pro-neuregulin-3, membrane-bound isoform Proteins 0.000 description 2
- 101001072091 Homo sapiens ProSAAS Proteins 0.000 description 2
- 101001130147 Homo sapiens Probable D-lactate dehydrogenase, mitochondrial Proteins 0.000 description 2
- 101000795318 Homo sapiens Probable E3 ubiquitin-protein ligase TRIML2 Proteins 0.000 description 2
- 101000996785 Homo sapiens Probable G-protein coupled receptor 132 Proteins 0.000 description 2
- 101001069607 Homo sapiens Probable G-protein coupled receptor 75 Proteins 0.000 description 2
- 101001041337 Homo sapiens Probable imidazolonepropionase Proteins 0.000 description 2
- 101001033206 Homo sapiens Probable methyltransferase-like protein 25 Proteins 0.000 description 2
- 101000738940 Homo sapiens Proline-rich nuclear receptor coactivator 1 Proteins 0.000 description 2
- 101001072067 Homo sapiens Proprotein convertase subtilisin/kexin type 4 Proteins 0.000 description 2
- 101000830670 Homo sapiens Prosalusin Proteins 0.000 description 2
- 101000964373 Homo sapiens Protein Abitram Proteins 0.000 description 2
- 101000722261 Homo sapiens Protein BCAP Proteins 0.000 description 2
- 101000892008 Homo sapiens Protein CASC2, isoform 3 Proteins 0.000 description 2
- 101000947111 Homo sapiens Protein CASC2, isoforms 1/2 Proteins 0.000 description 2
- 101000710074 Homo sapiens Protein CFAP20DC Proteins 0.000 description 2
- 101000854595 Homo sapiens Protein FAM166C Proteins 0.000 description 2
- 101000918444 Homo sapiens Protein FAM217B Proteins 0.000 description 2
- 101001062784 Homo sapiens Protein FAM229A Proteins 0.000 description 2
- 101001005389 Homo sapiens Protein LTV1 homolog Proteins 0.000 description 2
- 101000995332 Homo sapiens Protein NDRG4 Proteins 0.000 description 2
- 101001094684 Homo sapiens Protein O-mannosyl-transferase 2 Proteins 0.000 description 2
- 101000740224 Homo sapiens Protein SCAI Proteins 0.000 description 2
- 101000652172 Homo sapiens Protein Smaug homolog 1 Proteins 0.000 description 2
- 101000861454 Homo sapiens Protein c-Fos Proteins 0.000 description 2
- 101000993776 Homo sapiens Protein inturned Proteins 0.000 description 2
- 101000984042 Homo sapiens Protein lin-28 homolog A Proteins 0.000 description 2
- 101001064515 Homo sapiens Protein lin-37 homolog Proteins 0.000 description 2
- 101000972890 Homo sapiens Protein naked cuticle homolog 2 Proteins 0.000 description 2
- 101001123047 Homo sapiens Protein phosphatase PTC7 homolog Proteins 0.000 description 2
- 101000702132 Homo sapiens Protein spinster homolog 1 Proteins 0.000 description 2
- 101000822459 Homo sapiens Protein transport protein Sec31A Proteins 0.000 description 2
- 101000822478 Homo sapiens Protein transport protein Sec31B Proteins 0.000 description 2
- 101000786203 Homo sapiens Protein yippee-like 5 Proteins 0.000 description 2
- 101000842302 Homo sapiens Protein-cysteine N-palmitoyltransferase HHAT Proteins 0.000 description 2
- 101000666171 Homo sapiens Protein-glutamine gamma-glutamyltransferase 2 Proteins 0.000 description 2
- 101001116937 Homo sapiens Protocadherin alpha-4 Proteins 0.000 description 2
- 101000610001 Homo sapiens Protocadherin beta-6 Proteins 0.000 description 2
- 101000601999 Homo sapiens Protocadherin gamma-C4 Proteins 0.000 description 2
- 101001072231 Homo sapiens Protocadherin-17 Proteins 0.000 description 2
- 101000590549 Homo sapiens Pseudouridylate synthase 7 homolog Proteins 0.000 description 2
- 101000744381 Homo sapiens Putative ankyrin repeat domain-containing protein 20A5 Proteins 0.000 description 2
- 101000615660 Homo sapiens Putative malate dehydrogenase 1B Proteins 0.000 description 2
- 101001106794 Homo sapiens Putative protein RFPL3S Proteins 0.000 description 2
- 101000801661 Homo sapiens Putative protein TPRXL Proteins 0.000 description 2
- 101000932580 Homo sapiens Putative uncharacterized protein C3orf49 Proteins 0.000 description 2
- 101000872223 Homo sapiens Putative uncharacterized protein H1-10-AS1 Proteins 0.000 description 2
- 101000878919 Homo sapiens Putative uncharacterized protein LINC02875 Proteins 0.000 description 2
- 101000906818 Homo sapiens Putative uncharacterized protein encoded by LINC00476 Proteins 0.000 description 2
- 101000906696 Homo sapiens Putative uncharacterized protein encoded by LINC01559 Proteins 0.000 description 2
- 101000600434 Homo sapiens Putative uncharacterized protein encoded by MIR7-3HG Proteins 0.000 description 2
- 101000915638 Homo sapiens Putative zinc finger protein 487 Proteins 0.000 description 2
- 101000723607 Homo sapiens Putative zinc finger protein 542 Proteins 0.000 description 2
- 101000818340 Homo sapiens Putative zinc finger protein 876 Proteins 0.000 description 2
- 101000681044 Homo sapiens RIB43A-like with coiled-coils protein 1 Proteins 0.000 description 2
- 101001079872 Homo sapiens RING finger protein 112 Proteins 0.000 description 2
- 101000734290 Homo sapiens RING finger protein 223 Proteins 0.000 description 2
- 101001103588 Homo sapiens RING finger protein 32 Proteins 0.000 description 2
- 101001111898 Homo sapiens RNA-binding protein 44 Proteins 0.000 description 2
- 101000621030 Homo sapiens Rab-like protein 2A Proteins 0.000 description 2
- 101000621037 Homo sapiens Rab-like protein 2B Proteins 0.000 description 2
- 101001106801 Homo sapiens Rab11 family-interacting protein 5 Proteins 0.000 description 2
- 101001096541 Homo sapiens Rac GTPase-activating protein 1 Proteins 0.000 description 2
- 101001094496 Homo sapiens Radial spoke head 1 homolog Proteins 0.000 description 2
- 101001096475 Homo sapiens Raftlin-2 Proteins 0.000 description 2
- 101000665509 Homo sapiens Ral GTPase-activating protein subunit alpha-1 Proteins 0.000 description 2
- 101001130505 Homo sapiens Ras GTPase-activating protein 2 Proteins 0.000 description 2
- 101001110313 Homo sapiens Ras-related C3 botulinum toxin substrate 2 Proteins 0.000 description 2
- 101000686246 Homo sapiens Ras-related protein R-Ras Proteins 0.000 description 2
- 101001130305 Homo sapiens Ras-related protein Rab-23 Proteins 0.000 description 2
- 101000620591 Homo sapiens Ras-related protein Rab-36 Proteins 0.000 description 2
- 101001079096 Homo sapiens Regulator of G-protein signaling 9-binding protein Proteins 0.000 description 2
- 101001092185 Homo sapiens Regulator of cell cycle RGCC Proteins 0.000 description 2
- 101000582404 Homo sapiens Replication factor C subunit 4 Proteins 0.000 description 2
- 101000742950 Homo sapiens Retinol dehydrogenase 5 Proteins 0.000 description 2
- 101000699848 Homo sapiens Retrotransposon Gag-like protein 8C Proteins 0.000 description 2
- 101001073409 Homo sapiens Retrotransposon-derived protein PEG10 Proteins 0.000 description 2
- 101000710013 Homo sapiens Reversion-inducing cysteine-rich protein with Kazal motifs Proteins 0.000 description 2
- 101000704874 Homo sapiens Rho family-interacting cell polarization regulator 2 Proteins 0.000 description 2
- 101000666634 Homo sapiens Rho-related GTP-binding protein RhoH Proteins 0.000 description 2
- 101000717377 Homo sapiens Ribokinase Proteins 0.000 description 2
- 101000726974 Homo sapiens Ribosomal protein S6 kinase-like 1 Proteins 0.000 description 2
- 101000984584 Homo sapiens Ribosome biogenesis protein BOP1 Proteins 0.000 description 2
- 101001088129 Homo sapiens Ropporin-1-like protein Proteins 0.000 description 2
- 101000655308 Homo sapiens S-adenosylmethionine sensor upstream of mTORC1 Proteins 0.000 description 2
- 101000707156 Homo sapiens SH2 domain-containing protein 4B Proteins 0.000 description 2
- 101000864837 Homo sapiens SIN3-HDAC complex-associated factor Proteins 0.000 description 2
- 101000651939 Homo sapiens SKI/DACH domain-containing protein 1 Proteins 0.000 description 2
- 101000642656 Homo sapiens STE20-related kinase adapter protein beta Proteins 0.000 description 2
- 101000820585 Homo sapiens SUN domain-containing ossification factor Proteins 0.000 description 2
- 101000936731 Homo sapiens Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Proteins 0.000 description 2
- 101000650822 Homo sapiens Semaphorin-4B Proteins 0.000 description 2
- 101000654696 Homo sapiens Semaphorin-4G Proteins 0.000 description 2
- 101000708009 Homo sapiens Sentrin-specific protease 8 Proteins 0.000 description 2
- 101001067604 Homo sapiens Serine hydroxymethyltransferase, mitochondrial Proteins 0.000 description 2
- 101000697591 Homo sapiens Serine/threonine-protein kinase 32A Proteins 0.000 description 2
- 101000600885 Homo sapiens Serine/threonine-protein kinase NIM1 Proteins 0.000 description 2
- 101000989953 Homo sapiens Serine/threonine-protein kinase haspin Proteins 0.000 description 2
- 101000621061 Homo sapiens Serum paraoxonase/arylesterase 2 Proteins 0.000 description 2
- 101000836394 Homo sapiens Sestrin-1 Proteins 0.000 description 2
- 101000631843 Homo sapiens Sex comb on midleg-like protein 1 Proteins 0.000 description 2
- 101000631848 Homo sapiens Sex comb on midleg-like protein 2 Proteins 0.000 description 2
- 101000688684 Homo sapiens Sideroflexin-5 Proteins 0.000 description 2
- 101000629635 Homo sapiens Signal recognition particle receptor subunit alpha Proteins 0.000 description 2
- 101000836892 Homo sapiens Small integral membrane protein 10-like protein 2A Proteins 0.000 description 2
- 101000684813 Homo sapiens Sodium channel subunit beta-1 Proteins 0.000 description 2
- 101000869448 Homo sapiens Solute carrier family 35 member E2A Proteins 0.000 description 2
- 101000685797 Homo sapiens Sperm acrosome membrane-associated protein 6 Proteins 0.000 description 2
- 101000824971 Homo sapiens Sperm surface protein Sp17 Proteins 0.000 description 2
- 101000629576 Homo sapiens Spermatogenesis-associated protein 33 Proteins 0.000 description 2
- 101000617130 Homo sapiens Stromal cell-derived factor 1 Proteins 0.000 description 2
- 101000687808 Homo sapiens Suppressor of cytokine signaling 2 Proteins 0.000 description 2
- 101000651041 Homo sapiens Swi5-dependent recombination DNA repair protein 1 homolog Proteins 0.000 description 2
- 101000664934 Homo sapiens Synaptogyrin-2 Proteins 0.000 description 2
- 101000664940 Homo sapiens Synaptogyrin-3 Proteins 0.000 description 2
- 101000585079 Homo sapiens Syntaxin-1B Proteins 0.000 description 2
- 101000697800 Homo sapiens Syntaxin-4 Proteins 0.000 description 2
- 101000595742 Homo sapiens TBC1 domain family member 3F Proteins 0.000 description 2
- 101000648827 Homo sapiens TPR and ankyrin repeat-containing protein 1 Proteins 0.000 description 2
- 101000714926 Homo sapiens Taste receptor type 2 member 14 Proteins 0.000 description 2
- 101000835705 Homo sapiens Tectonin beta-propeller repeat-containing protein 2 Proteins 0.000 description 2
- 101000658622 Homo sapiens Testis-specific Y-encoded-like protein 2 Proteins 0.000 description 2
- 101000659162 Homo sapiens Tetratricopeptide repeat protein 30A Proteins 0.000 description 2
- 101000659166 Homo sapiens Tetratricopeptide repeat protein 30B Proteins 0.000 description 2
- 101000801871 Homo sapiens Threonine synthase-like 1 Proteins 0.000 description 2
- 101000763314 Homo sapiens Thrombomodulin Proteins 0.000 description 2
- 101000633608 Homo sapiens Thrombospondin-3 Proteins 0.000 description 2
- 101000651305 Homo sapiens Tigger transposable element-derived protein 1 Proteins 0.000 description 2
- 101000785517 Homo sapiens Tight junction protein ZO-3 Proteins 0.000 description 2
- 101000637850 Homo sapiens Tolloid-like protein 2 Proteins 0.000 description 2
- 101000830675 Homo sapiens Torsin-2A Proteins 0.000 description 2
- 101000866298 Homo sapiens Transcription factor E2F8 Proteins 0.000 description 2
- 101001050297 Homo sapiens Transcription factor JunD Proteins 0.000 description 2
- 101000642517 Homo sapiens Transcription factor SOX-6 Proteins 0.000 description 2
- 101000674717 Homo sapiens Transcription initiation factor TFIID subunit 7-like Proteins 0.000 description 2
- 101000680036 Homo sapiens Transmembrane and ubiquitin-like domain-containing protein 1 Proteins 0.000 description 2
- 101000851518 Homo sapiens Transmembrane channel-like protein 7 Proteins 0.000 description 2
- 101000596302 Homo sapiens Transmembrane protein 150C Proteins 0.000 description 2
- 101000645399 Homo sapiens Transmembrane protein 160 Proteins 0.000 description 2
- 101000596324 Homo sapiens Transmembrane protein 229B Proteins 0.000 description 2
- 101000763481 Homo sapiens Transmembrane protein 245 Proteins 0.000 description 2
- 101000662951 Homo sapiens Transmembrane protein 88 Proteins 0.000 description 2
- 101000662967 Homo sapiens Transmembrane protein 91 Proteins 0.000 description 2
- 101000634975 Homo sapiens Tripartite motif-containing protein 29 Proteins 0.000 description 2
- 101000838463 Homo sapiens Tubulin alpha-1A chain Proteins 0.000 description 2
- 101000658478 Homo sapiens Tubulin monoglycylase TTLL3 Proteins 0.000 description 2
- 101000658492 Homo sapiens Tubulin polyglutamylase TTLL7 Proteins 0.000 description 2
- 101000830701 Homo sapiens Tubulin polyglutamylase complex subunit 1 Proteins 0.000 description 2
- 101000679406 Homo sapiens Tubulin polymerization-promoting protein family member 3 Proteins 0.000 description 2
- 101000610604 Homo sapiens Tumor necrosis factor receptor superfamily member 10B Proteins 0.000 description 2
- 101000836174 Homo sapiens Tumor protein p53-inducible nuclear protein 1 Proteins 0.000 description 2
- 101000939500 Homo sapiens UBX domain-containing protein 11 Proteins 0.000 description 2
- 101000798385 Homo sapiens UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9 Proteins 0.000 description 2
- 101000714648 Homo sapiens UPF0500 protein C1orf216 Proteins 0.000 description 2
- 101000956262 Homo sapiens UPF0692 protein C19orf54 Proteins 0.000 description 2
- 101000759935 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 49 Proteins 0.000 description 2
- 101000800310 Homo sapiens Ubiquitin domain-containing protein TINCR Proteins 0.000 description 2
- 101000671855 Homo sapiens Ubiquitin-associated and SH3 domain-containing protein A Proteins 0.000 description 2
- 101000942332 Homo sapiens Uncharacterized protein C11orf94 Proteins 0.000 description 2
- 101000900754 Homo sapiens Uncharacterized protein C14orf28 Proteins 0.000 description 2
- 101000896930 Homo sapiens Uncharacterized protein C17orf107 Proteins 0.000 description 2
- 101000932821 Homo sapiens Uncharacterized protein C1orf109 Proteins 0.000 description 2
- 101000725885 Homo sapiens Uncharacterized protein C20orf204 Proteins 0.000 description 2
- 101000983603 Homo sapiens Uncharacterized protein C2orf27A Proteins 0.000 description 2
- 101000715338 Homo sapiens Uncharacterized protein C3orf18 Proteins 0.000 description 2
- 101000914632 Homo sapiens Uncharacterized protein C8orf58 Proteins 0.000 description 2
- 101000889115 Homo sapiens Uncharacterized protein CXorf58 Proteins 0.000 description 2
- 101000875325 Homo sapiens Uncharacterized protein EXOC3-AS1 Proteins 0.000 description 2
- 101000747867 Homo sapiens Upstream-binding protein 1 Proteins 0.000 description 2
- 101000805943 Homo sapiens Usher syndrome type-1G protein Proteins 0.000 description 2
- 101000871915 Homo sapiens Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2 Proteins 0.000 description 2
- 101000852161 Homo sapiens Vesicle-associated membrane protein 8 Proteins 0.000 description 2
- 101000641959 Homo sapiens Villin-1 Proteins 0.000 description 2
- 101000803709 Homo sapiens Vitronectin Proteins 0.000 description 2
- 101000965721 Homo sapiens Volume-regulated anion channel subunit LRRC8A Proteins 0.000 description 2
- 101000804821 Homo sapiens WD repeat and SOCS box-containing protein 2 Proteins 0.000 description 2
- 101000650148 Homo sapiens WD repeat domain phosphoinositide-interacting protein 1 Proteins 0.000 description 2
- 101000667300 Homo sapiens WD repeat-containing protein 19 Proteins 0.000 description 2
- 101000743163 Homo sapiens WD repeat-containing protein 25 Proteins 0.000 description 2
- 101000955107 Homo sapiens WD repeat-containing protein 37 Proteins 0.000 description 2
- 101000803765 Homo sapiens WD repeat-containing protein 5B Proteins 0.000 description 2
- 101000650069 Homo sapiens WD repeat-containing protein 90 Proteins 0.000 description 2
- 101000814512 Homo sapiens X antigen family member 1 Proteins 0.000 description 2
- 101000915477 Homo sapiens Zinc finger MIZ domain-containing protein 1 Proteins 0.000 description 2
- 101000788675 Homo sapiens Zinc finger MYND domain-containing protein 19 Proteins 0.000 description 2
- 101000976595 Homo sapiens Zinc finger protein 107 Proteins 0.000 description 2
- 101000976594 Homo sapiens Zinc finger protein 117 Proteins 0.000 description 2
- 101000818890 Homo sapiens Zinc finger protein 19 Proteins 0.000 description 2
- 101000760288 Homo sapiens Zinc finger protein 2 Proteins 0.000 description 2
- 101000744946 Homo sapiens Zinc finger protein 214 Proteins 0.000 description 2
- 101000723750 Homo sapiens Zinc finger protein 23 Proteins 0.000 description 2
- 101000723758 Homo sapiens Zinc finger protein 25 Proteins 0.000 description 2
- 101000818781 Homo sapiens Zinc finger protein 257 Proteins 0.000 description 2
- 101000723899 Homo sapiens Zinc finger protein 287 Proteins 0.000 description 2
- 101000760212 Homo sapiens Zinc finger protein 33B Proteins 0.000 description 2
- 101000788750 Homo sapiens Zinc finger protein 347 Proteins 0.000 description 2
- 101000964453 Homo sapiens Zinc finger protein 354C Proteins 0.000 description 2
- 101000788732 Homo sapiens Zinc finger protein 367 Proteins 0.000 description 2
- 101000964455 Homo sapiens Zinc finger protein 385A Proteins 0.000 description 2
- 101000964709 Homo sapiens Zinc finger protein 396 Proteins 0.000 description 2
- 101000976620 Homo sapiens Zinc finger protein 41 homolog Proteins 0.000 description 2
- 101000976610 Homo sapiens Zinc finger protein 410 Proteins 0.000 description 2
- 101000818823 Homo sapiens Zinc finger protein 438 Proteins 0.000 description 2
- 101000782459 Homo sapiens Zinc finger protein 449 Proteins 0.000 description 2
- 101000915639 Homo sapiens Zinc finger protein 470 Proteins 0.000 description 2
- 101000744941 Homo sapiens Zinc finger protein 490 Proteins 0.000 description 2
- 101000744938 Homo sapiens Zinc finger protein 493 Proteins 0.000 description 2
- 101000802335 Homo sapiens Zinc finger protein 558 Proteins 0.000 description 2
- 101000976471 Homo sapiens Zinc finger protein 595 Proteins 0.000 description 2
- 101000976472 Homo sapiens Zinc finger protein 596 Proteins 0.000 description 2
- 101000976470 Homo sapiens Zinc finger protein 599 Proteins 0.000 description 2
- 101000818841 Homo sapiens Zinc finger protein 606 Proteins 0.000 description 2
- 101000818710 Homo sapiens Zinc finger protein 614 Proteins 0.000 description 2
- 101000818704 Homo sapiens Zinc finger protein 616 Proteins 0.000 description 2
- 101000782291 Homo sapiens Zinc finger protein 626 Proteins 0.000 description 2
- 101000723641 Homo sapiens Zinc finger protein 695 Proteins 0.000 description 2
- 101000723629 Homo sapiens Zinc finger protein 699 Proteins 0.000 description 2
- 101000723631 Homo sapiens Zinc finger protein 701 Proteins 0.000 description 2
- 101000760267 Homo sapiens Zinc finger protein 724 Proteins 0.000 description 2
- 101000964726 Homo sapiens Zinc finger protein 76 Proteins 0.000 description 2
- 101000964731 Homo sapiens Zinc finger protein 77 Proteins 0.000 description 2
- 101000976461 Homo sapiens Zinc finger protein 793 Proteins 0.000 description 2
- 101000976458 Homo sapiens Zinc finger protein 808 Proteins 0.000 description 2
- 101000782309 Homo sapiens Zinc finger protein 837 Proteins 0.000 description 2
- 101000785576 Homo sapiens Zinc finger protein 846 Proteins 0.000 description 2
- 101000785582 Homo sapiens Zinc finger protein 862 Proteins 0.000 description 2
- 101000976642 Homo sapiens Zinc finger protein ZIC 4 Proteins 0.000 description 2
- 101000864118 Homo sapiens Zinc finger protein neuro-d4 Proteins 0.000 description 2
- 101000859416 Homo sapiens cAMP-responsive element-binding protein-like 2 Proteins 0.000 description 2
- 101001046427 Homo sapiens cGMP-dependent protein kinase 2 Proteins 0.000 description 2
- 101000859024 Homo sapiens cTAGE family member 8 Proteins 0.000 description 2
- 101000680601 Homo sapiens tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A Proteins 0.000 description 2
- 101000615747 Homo sapiens tRNA-splicing endonuclease subunit Sen2 Proteins 0.000 description 2
- 102100039923 Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 1 protein Human genes 0.000 description 2
- 102100026020 Hormone-sensitive lipase Human genes 0.000 description 2
- 102100040204 Hydrocephalus-inducing protein homolog Human genes 0.000 description 2
- 102100031612 Hypermethylated in cancer 1 protein Human genes 0.000 description 2
- 102100031613 Hypermethylated in cancer 2 protein Human genes 0.000 description 2
- 102100020755 Hypoxia up-regulated protein 1 Human genes 0.000 description 2
- 102100029841 IQ domain-containing protein C Human genes 0.000 description 2
- 102100029199 Iduronate 2-sulfatase Human genes 0.000 description 2
- 102100035692 Importin subunit alpha-1 Human genes 0.000 description 2
- 102100033336 Integrin beta-8 Human genes 0.000 description 2
- 102100025957 Interleukin-1 receptor-associated kinase 1-binding protein 1 Human genes 0.000 description 2
- 108090000177 Interleukin-11 Proteins 0.000 description 2
- 102000003815 Interleukin-11 Human genes 0.000 description 2
- 108010002350 Interleukin-2 Proteins 0.000 description 2
- 102100026218 Intraflagellar transport protein 22 homolog Human genes 0.000 description 2
- 102100022774 Inward rectifier potassium channel 16 Human genes 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 102100037845 Isocitrate dehydrogenase [NADP], mitochondrial Human genes 0.000 description 2
- 102100038097 Isthmin-2 Human genes 0.000 description 2
- 101710013801 KIAA0513 Proteins 0.000 description 2
- 102100022891 KN motif and ankyrin repeat domain-containing protein 1 Human genes 0.000 description 2
- 102100033606 Kelch domain-containing protein 1 Human genes 0.000 description 2
- 102100037649 Kelch domain-containing protein 7A Human genes 0.000 description 2
- 102100027801 Kelch domain-containing protein 9 Human genes 0.000 description 2
- 102100023684 Kelch-like protein 17 Human genes 0.000 description 2
- 102100023970 Keratin, type I cytoskeletal 10 Human genes 0.000 description 2
- 102100021529 Kinesin-like protein KIF17 Human genes 0.000 description 2
- 102000017578 LAG3 Human genes 0.000 description 2
- 102100030928 Lactosylceramide alpha-2,3-sialyltransferase Human genes 0.000 description 2
- 102100026517 Lamin-B1 Human genes 0.000 description 2
- 102100035159 Laminin subunit gamma-2 Human genes 0.000 description 2
- 102100027437 Lebercilin-like protein Human genes 0.000 description 2
- 102100040300 Leucine zipper putative tumor suppressor 3 Human genes 0.000 description 2
- 102100022168 Leucine-rich repeat and guanylate kinase domain-containing protein Human genes 0.000 description 2
- 102100033287 Leucine-rich repeat-containing protein 14 Human genes 0.000 description 2
- 102100025967 Leucine-rich repeat-containing protein 29 Human genes 0.000 description 2
- 102100032096 Leucine-rich repeat-containing protein 75B Human genes 0.000 description 2
- 102100025853 Lipoyltransferase 1, mitochondrial Human genes 0.000 description 2
- 102100032892 Liprin-alpha-3 Human genes 0.000 description 2
- 102100034319 Long-chain-fatty-acid-CoA ligase 4 Human genes 0.000 description 2
- 101000964266 Loxosceles laeta Dermonecrotic toxin Proteins 0.000 description 2
- 102100040281 Ly6/PLAUR domain-containing protein 3 Human genes 0.000 description 2
- 102100033247 Lysine-specific demethylase 5B Human genes 0.000 description 2
- 102100040387 Lysophosphatidic acid receptor 2 Human genes 0.000 description 2
- 102100023326 M-phase inducer phosphatase 1 Human genes 0.000 description 2
- 102100023260 MAGUK p55 subfamily member 3 Human genes 0.000 description 2
- 102100031520 MAPK/MAK/MRK overlapping kinase Human genes 0.000 description 2
- 229940124647 MEK inhibitor Drugs 0.000 description 2
- 102100023290 MORN repeat-containing protein 1 Human genes 0.000 description 2
- 102100025533 MTOR-associated protein MEAK7 Human genes 0.000 description 2
- 102100021435 Macrophage-stimulating protein receptor Human genes 0.000 description 2
- 102100027754 Mast/stem cell growth factor receptor Kit Human genes 0.000 description 2
- 102100025169 Max-binding protein MNT Human genes 0.000 description 2
- XUMBMVFBXHLACL-UHFFFAOYSA-N Melanin Chemical compound O=C1C(=O)C(C2=CNC3=C(C(C(=O)C4=C32)=O)C)=C2C4=CNC2=C1C XUMBMVFBXHLACL-UHFFFAOYSA-N 0.000 description 2
- 102100037514 Metallothionein-1F Human genes 0.000 description 2
- 102100031783 Metallothionein-1M Human genes 0.000 description 2
- 102100031781 Metallothionein-1X Human genes 0.000 description 2
- 102100022259 Mevalonate kinase Human genes 0.000 description 2
- 108700040132 Mevalonate kinases Proteins 0.000 description 2
- 102100026287 Misshapen-like kinase 1 Human genes 0.000 description 2
- VFKZTMPDYBFSTM-KVTDHHQDSA-N Mitobronitol Chemical compound BrC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CBr VFKZTMPDYBFSTM-KVTDHHQDSA-N 0.000 description 2
- 102100032429 Mitochondrial coenzyme A transporter SLC25A42 Human genes 0.000 description 2
- 102100023483 Mitogen-activated protein kinase 15 Human genes 0.000 description 2
- 102100033799 Mitoregulin Human genes 0.000 description 2
- 102100023092 Motile sperm domain-containing protein 2 Human genes 0.000 description 2
- 102100021156 MutS protein homolog 5 Human genes 0.000 description 2
- 102100038750 Myc-associated zinc finger protein Human genes 0.000 description 2
- 208000033761 Myelogenous Chronic BCR-ABL Positive Leukemia Diseases 0.000 description 2
- 102100031827 Myeloid zinc finger 1 Human genes 0.000 description 2
- 102100030788 Myosin light chain kinase 2, skeletal/cardiac muscle Human genes 0.000 description 2
- 102100024941 Myotubularin-related protein 9 Human genes 0.000 description 2
- NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical compound C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 description 2
- CZSLEMCYYGEGKP-UHFFFAOYSA-N N-(2-chlorobenzyl)-1-(2,5-dimethylphenyl)benzimidazole-5-carboxamide Chemical compound CC1=CC=C(C)C(N2C3=CC=C(C=C3N=C2)C(=O)NCC=2C(=CC=CC=2)Cl)=C1 CZSLEMCYYGEGKP-UHFFFAOYSA-N 0.000 description 2
- 102100023282 N-acetylglucosamine-6-sulfatase Human genes 0.000 description 2
- 102100032979 N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase Human genes 0.000 description 2
- 102100035629 N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase 3 Human genes 0.000 description 2
- 102100023356 NAD(+) hydrolase SARM1 Human genes 0.000 description 2
- 102100022194 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 8 Human genes 0.000 description 2
- 108091007371 NEURL2 Proteins 0.000 description 2
- 102100034306 NF-kappa-B inhibitor-interacting Ras-like protein 1 Human genes 0.000 description 2
- 102100030391 NGFI-A-binding protein 2 Human genes 0.000 description 2
- 102100037365 NHL repeat-containing protein 3 Human genes 0.000 description 2
- 102100021733 NUAK family SNF1-like kinase 2 Human genes 0.000 description 2
- 206010061309 Neoplasm progression Diseases 0.000 description 2
- 102100023195 Nephrin Human genes 0.000 description 2
- 102100023187 Nephrocystin-1 Human genes 0.000 description 2
- 102100022164 Neuralized-like protein 2 Human genes 0.000 description 2
- 102100031810 Neurite extension and migration factor Human genes 0.000 description 2
- 102100027348 Neurocalcin-delta Human genes 0.000 description 2
- 102100032087 Neutral cholesterol ester hydrolase 1 Human genes 0.000 description 2
- 102100028809 Notch-regulated ankyrin repeat-containing protein Human genes 0.000 description 2
- 102000001759 Notch1 Receptor Human genes 0.000 description 2
- 108010029755 Notch1 Receptor Proteins 0.000 description 2
- 102100025495 Nuclear GTPase SLIP-GC Human genes 0.000 description 2
- 102100022220 Nuclear envelope integral membrane protein 1 Human genes 0.000 description 2
- 102100025447 Nuclear pore complex protein Nup50 Human genes 0.000 description 2
- 102100038845 Nuclear pore complex-interacting protein family member A1 Human genes 0.000 description 2
- 102100022676 Nuclear receptor subfamily 4 group A member 2 Human genes 0.000 description 2
- 102100021858 Nuclear receptor-binding protein Human genes 0.000 description 2
- 102100028790 Nuclear receptor-binding protein 2 Human genes 0.000 description 2
- 101710163270 Nuclease Proteins 0.000 description 2
- 108091028043 Nucleic acid sequence Proteins 0.000 description 2
- 102100032210 Nucleoside diphosphate kinase homolog 5 Human genes 0.000 description 2
- 102100030661 Nucleotide triphosphate diphosphatase NUDT15 Human genes 0.000 description 2
- 102100038140 Nucleus accumbens-associated protein 2 Human genes 0.000 description 2
- 102100025909 Opsin-3 Human genes 0.000 description 2
- 102100035689 Outer dense fiber protein 3-like protein 2 Human genes 0.000 description 2
- 102100034574 P protein Human genes 0.000 description 2
- 102100034925 P-selectin glycoprotein ligand 1 Human genes 0.000 description 2
- 102100029177 PDZ and LIM domain protein 3 Human genes 0.000 description 2
- 102100036879 PHD finger protein 1 Human genes 0.000 description 2
- 102100026507 PIH1 domain-containing protein 2 Human genes 0.000 description 2
- YZDJQTHVDDOVHR-UHFFFAOYSA-N PLX-4720 Chemical compound CCCS(=O)(=O)NC1=CC=C(F)C(C(=O)C=2C3=CC(Cl)=CN=C3NC=2)=C1F YZDJQTHVDDOVHR-UHFFFAOYSA-N 0.000 description 2
- 102100033786 Paired mesoderm homeobox protein 1 Human genes 0.000 description 2
- 102100031254 Patatin-like phospholipase domain-containing protein 6 Human genes 0.000 description 2
- 102100037990 Patatin-like phospholipase domain-containing protein 7 Human genes 0.000 description 2
- 102100037887 Patched domain-containing protein 4 Human genes 0.000 description 2
- 102100036328 Pejvakin Human genes 0.000 description 2
- 102100027818 Peptidase inhibitor R3HDML Human genes 0.000 description 2
- 102000017795 Perilipin-1 Human genes 0.000 description 2
- 108010067162 Perilipin-1 Proteins 0.000 description 2
- 102100035787 Period circadian protein homolog 2 Human genes 0.000 description 2
- 102100037553 Phosphatidylinositol 3-kinase regulatory subunit gamma Human genes 0.000 description 2
- 102100036063 Phosphatidylinositol transfer protein beta isoform Human genes 0.000 description 2
- 102100036253 Phosphatidylinositol-glycan biosynthesis class W protein Human genes 0.000 description 2
- 102100039472 Phosphoinositide-3-kinase-interacting protein 1 Human genes 0.000 description 2
- 102100030448 Phospholipid-transporting ATPase IC Human genes 0.000 description 2
- 102100024111 Phospholysine phosphohistidine inorganic pyrophosphate phosphatase Human genes 0.000 description 2
- 102100039902 Plasma membrane ascorbate-dependent reductase CYBRD1 Human genes 0.000 description 2
- 102100024078 Plasma serine protease inhibitor Human genes 0.000 description 2
- 102100030926 Pleckstrin homology-like domain family A member 2 Human genes 0.000 description 2
- 102100034386 Plexin-A3 Human genes 0.000 description 2
- 102100023242 Potassium channel subfamily K member 1 Human genes 0.000 description 2
- 102100025072 Potassium voltage-gated channel subfamily H member 3 Human genes 0.000 description 2
- 101710163348 Potassium voltage-gated channel subfamily H member 8 Proteins 0.000 description 2
- 102100040167 Pre-B-cell leukemia transcription factor 4 Human genes 0.000 description 2
- 102100040882 Pre-B-cell leukemia transcription factor-interacting protein 1 Human genes 0.000 description 2
- 208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 description 2
- 102100022019 Pregnancy-specific beta-1-glycoprotein 2 Human genes 0.000 description 2
- 102100024857 Prickle-like protein 4 Human genes 0.000 description 2
- 102100026651 Pro-adrenomedullin Human genes 0.000 description 2
- 102100022659 Pro-neuregulin-3, membrane-bound isoform Human genes 0.000 description 2
- 102100036366 ProSAAS Human genes 0.000 description 2
- 102100031708 Probable D-lactate dehydrogenase, mitochondrial Human genes 0.000 description 2
- 102100029704 Probable E3 ubiquitin-protein ligase TRIML2 Human genes 0.000 description 2
- 102100033838 Probable G-protein coupled receptor 132 Human genes 0.000 description 2
- 102100033860 Probable G-protein coupled receptor 75 Human genes 0.000 description 2
- 102100021059 Probable imidazolonepropionase Human genes 0.000 description 2
- 102100038292 Probable methyltransferase-like protein 25 Human genes 0.000 description 2
- 102100037394 Proline-rich nuclear receptor coactivator 1 Human genes 0.000 description 2
- 102100036371 Proprotein convertase subtilisin/kexin type 4 Human genes 0.000 description 2
- 102100040265 Protein Abitram Human genes 0.000 description 2
- 102100025312 Protein BCAP Human genes 0.000 description 2
- 102100035599 Protein CASC2, isoforms 1/2 Human genes 0.000 description 2
- 102100034625 Protein CFAP20DC Human genes 0.000 description 2
- 102100020939 Protein FAM166C Human genes 0.000 description 2
- 102100029118 Protein FAM217B Human genes 0.000 description 2
- 102100030544 Protein FAM229A Human genes 0.000 description 2
- 108091008611 Protein Kinase B Proteins 0.000 description 2
- 102100025932 Protein LTV1 homolog Human genes 0.000 description 2
- 102100034432 Protein NDRG4 Human genes 0.000 description 2
- 102100029575 Protein NipSnap homolog 3B Human genes 0.000 description 2
- 102100035490 Protein O-mannosyl-transferase 2 Human genes 0.000 description 2
- 102100037197 Protein SCAI Human genes 0.000 description 2
- 102100030591 Protein Smaug homolog 1 Human genes 0.000 description 2
- 102100027584 Protein c-Fos Human genes 0.000 description 2
- 102100031753 Protein inturned Human genes 0.000 description 2
- 102100025460 Protein lin-28 homolog A Human genes 0.000 description 2
- 102100031959 Protein lin-37 homolog Human genes 0.000 description 2
- 102100022619 Protein naked cuticle homolog 2 Human genes 0.000 description 2
- 102100028557 Protein phosphatase PTC7 homolog Human genes 0.000 description 2
- 102100030293 Protein spinster homolog 1 Human genes 0.000 description 2
- 102100022484 Protein transport protein Sec31A Human genes 0.000 description 2
- 102100022485 Protein transport protein Sec31B Human genes 0.000 description 2
- 102100025821 Protein yippee-like 5 Human genes 0.000 description 2
- 108091000532 Protein-Arginine Deiminase Type 1 Proteins 0.000 description 2
- 102100023222 Protein-arginine deiminase type-1 Human genes 0.000 description 2
- 102100030616 Protein-cysteine N-palmitoyltransferase HHAT Human genes 0.000 description 2
- 102100038095 Protein-glutamine gamma-glutamyltransferase 2 Human genes 0.000 description 2
- 208000014841 Proteus-like syndrome Diseases 0.000 description 2
- 102000052575 Proto-Oncogene Human genes 0.000 description 2
- 108700020978 Proto-Oncogene Proteins 0.000 description 2
- 102100024261 Protocadherin alpha-4 Human genes 0.000 description 2
- 102100039152 Protocadherin beta-6 Human genes 0.000 description 2
- 102100037557 Protocadherin gamma-C4 Human genes 0.000 description 2
- 102100036391 Protocadherin-17 Human genes 0.000 description 2
- 102100032494 Pseudouridylate synthase 7 homolog Human genes 0.000 description 2
- 102100039780 Putative ankyrin repeat domain-containing protein 20A5 Human genes 0.000 description 2
- 102100021320 Putative malate dehydrogenase 1B Human genes 0.000 description 2
- 102100021328 Putative protein RFPL3S Human genes 0.000 description 2
- 102100033613 Putative protein TPRXL Human genes 0.000 description 2
- 102100025719 Putative uncharacterized protein C3orf49 Human genes 0.000 description 2
- 102100033559 Putative uncharacterized protein H1-10-AS1 Human genes 0.000 description 2
- 102100037952 Putative uncharacterized protein LINC02875 Human genes 0.000 description 2
- 102100023767 Putative uncharacterized protein encoded by LINC00476 Human genes 0.000 description 2
- 102100023454 Putative uncharacterized protein encoded by LINC01559 Human genes 0.000 description 2
- 102100037401 Putative uncharacterized protein encoded by MIR7-3HG Human genes 0.000 description 2
- 102100029039 Putative zinc finger protein 487 Human genes 0.000 description 2
- 102100027807 Putative zinc finger protein 542 Human genes 0.000 description 2
- 102100021080 Putative zinc finger protein 876 Human genes 0.000 description 2
- 102100022315 RIB43A-like with coiled-coils protein 1 Human genes 0.000 description 2
- 102100028089 RING finger protein 112 Human genes 0.000 description 2
- 102100034811 RING finger protein 223 Human genes 0.000 description 2
- 102100039500 RING finger protein 32 Human genes 0.000 description 2
- 108091007868 RMND5A Proteins 0.000 description 2
- 102100023858 RNA-binding protein 44 Human genes 0.000 description 2
- 102100022841 Rab-like protein 2A Human genes 0.000 description 2
- 102100022836 Rab-like protein 2B Human genes 0.000 description 2
- 102100021330 Rab11 family-interacting protein 5 Human genes 0.000 description 2
- 102100037414 Rac GTPase-activating protein 1 Human genes 0.000 description 2
- 102100035089 Radial spoke head 1 homolog Human genes 0.000 description 2
- 102100037428 Raftlin-2 Human genes 0.000 description 2
- 102100038202 Ral GTPase-activating protein subunit alpha-1 Human genes 0.000 description 2
- 102100031427 Ras GTPase-activating protein 2 Human genes 0.000 description 2
- 102100022129 Ras-related C3 botulinum toxin substrate 2 Human genes 0.000 description 2
- 102100024683 Ras-related protein R-Ras Human genes 0.000 description 2
- 102100031522 Ras-related protein Rab-23 Human genes 0.000 description 2
- 102100022295 Ras-related protein Rab-36 Human genes 0.000 description 2
- 102100020981 Regulator of G-protein signaling 16 Human genes 0.000 description 2
- 101710148341 Regulator of G-protein signaling 16 Proteins 0.000 description 2
- 102100028148 Regulator of G-protein signaling 9-binding protein Human genes 0.000 description 2
- 102100035542 Regulator of cell cycle RGCC Human genes 0.000 description 2
- 102100030542 Replication factor C subunit 4 Human genes 0.000 description 2
- 102100038053 Retinol dehydrogenase 5 Human genes 0.000 description 2
- 102100035844 Retrotransposon-derived protein PEG10 Human genes 0.000 description 2
- 102100034634 Reversion-inducing cysteine-rich protein with Kazal motifs Human genes 0.000 description 2
- 102100032023 Rho family-interacting cell polarization regulator 2 Human genes 0.000 description 2
- 102100039643 Rho-related GTP-binding protein Rho6 Human genes 0.000 description 2
- 101710199571 Rho-related GTP-binding protein Rho6 Proteins 0.000 description 2
- 102100027611 Rho-related GTP-binding protein RhoB Human genes 0.000 description 2
- 102100038338 Rho-related GTP-binding protein RhoH Human genes 0.000 description 2
- 101150054980 Rhob gene Proteins 0.000 description 2
- 102100020783 Ribokinase Human genes 0.000 description 2
- 102100030864 Ribosomal protein S6 kinase-like 1 Human genes 0.000 description 2
- 102100027055 Ribosome biogenesis protein BOP1 Human genes 0.000 description 2
- 102100032261 Ropporin-1-like protein Human genes 0.000 description 2
- 108010055623 S-Phase Kinase-Associated Proteins Proteins 0.000 description 2
- 102100032896 S-adenosylmethionine sensor upstream of mTORC1 Human genes 0.000 description 2
- 102100034374 S-phase kinase-associated protein 2 Human genes 0.000 description 2
- 102100031769 SH2 domain-containing protein 4B Human genes 0.000 description 2
- 102100030066 SIN3-HDAC complex-associated factor Human genes 0.000 description 2
- 102100027349 SKI/DACH domain-containing protein 1 Human genes 0.000 description 2
- 108091006596 SLC15A5 Proteins 0.000 description 2
- 108091006479 SLC25A42 Proteins 0.000 description 2
- 108091006302 SLC2A14 Proteins 0.000 description 2
- 108091006957 SLC35D1 Proteins 0.000 description 2
- 108091006960 SLC35D2 Proteins 0.000 description 2
- 108091006952 SLC35E1 Proteins 0.000 description 2
- 108091006945 SLC39A13 Proteins 0.000 description 2
- 102000005039 SLC6A6 Human genes 0.000 description 2
- 108060007765 SLC6A6 Proteins 0.000 description 2
- 108091006660 SLC9A9 Proteins 0.000 description 2
- 108091006682 SLCO5A1 Proteins 0.000 description 2
- 108010017324 STAT3 Transcription Factor Proteins 0.000 description 2
- 102100035929 STE20-related kinase adapter protein beta Human genes 0.000 description 2
- 102100021651 SUN domain-containing ossification factor Human genes 0.000 description 2
- 102100027697 Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Human genes 0.000 description 2
- 102100030053 Secreted frizzled-related protein 3 Human genes 0.000 description 2
- 102100027717 Semaphorin-4B Human genes 0.000 description 2
- 102100032781 Semaphorin-4G Human genes 0.000 description 2
- 102100031407 Sentrin-specific protease 8 Human genes 0.000 description 2
- 102100034606 Serine hydroxymethyltransferase, mitochondrial Human genes 0.000 description 2
- 102100028032 Serine/threonine-protein kinase 32A Human genes 0.000 description 2
- 102100037345 Serine/threonine-protein kinase NIM1 Human genes 0.000 description 2
- 102100029332 Serine/threonine-protein kinase haspin Human genes 0.000 description 2
- 102100022824 Serum paraoxonase/arylesterase 2 Human genes 0.000 description 2
- 102100027288 Sestrin-1 Human genes 0.000 description 2
- 102100028817 Sex comb on midleg-like protein 1 Human genes 0.000 description 2
- 102100028816 Sex comb on midleg-like protein 2 Human genes 0.000 description 2
- 102100024224 Sideroflexin-5 Human genes 0.000 description 2
- 102100026900 Signal recognition particle receptor subunit alpha Human genes 0.000 description 2
- 102100024040 Signal transducer and activator of transcription 3 Human genes 0.000 description 2
- 102100027162 Small integral membrane protein 10-like protein 2A Human genes 0.000 description 2
- 102100023732 Sodium channel subunit beta-1 Human genes 0.000 description 2
- 102100029967 Sodium/hydrogen exchanger 9 Human genes 0.000 description 2
- 102100021492 Solute carrier family 15 member 5 Human genes 0.000 description 2
- 102100039672 Solute carrier family 2, facilitated glucose transporter member 14 Human genes 0.000 description 2
- 102100032275 Solute carrier family 35 member E1 Human genes 0.000 description 2
- 102100032276 Solute carrier family 35 member E2A Human genes 0.000 description 2
- 102100021990 Solute carrier organic anion transporter family member 5A1 Human genes 0.000 description 2
- 102100023081 Sperm acrosome membrane-associated protein 6 Human genes 0.000 description 2
- 102100022441 Sperm surface protein Sp17 Human genes 0.000 description 2
- 102100026835 Spermatogenesis-associated protein 33 Human genes 0.000 description 2
- 102100026760 StAR-related lipid transfer protein 7, mitochondrial Human genes 0.000 description 2
- 101150000240 Stard7 gene Proteins 0.000 description 2
- 208000005718 Stomach Neoplasms Diseases 0.000 description 2
- 102100021669 Stromal cell-derived factor 1 Human genes 0.000 description 2
- 102100024784 Suppressor of cytokine signaling 2 Human genes 0.000 description 2
- 102100027777 Swi5-dependent recombination DNA repair protein 1 homolog Human genes 0.000 description 2
- 102100038649 Synaptogyrin-2 Human genes 0.000 description 2
- 102100038648 Synaptogyrin-3 Human genes 0.000 description 2
- 102100029931 Syntaxin-1B Human genes 0.000 description 2
- 102100027975 Syntaxin-4 Human genes 0.000 description 2
- 102100036057 TBC1 domain family member 3F Human genes 0.000 description 2
- 102100028173 TPR and ankyrin repeat-containing protein 1 Human genes 0.000 description 2
- 102100036720 Taste receptor type 2 member 14 Human genes 0.000 description 2
- 102100026312 Tectonin beta-propeller repeat-containing protein 2 Human genes 0.000 description 2
- 102100034917 Testis-specific Y-encoded-like protein 2 Human genes 0.000 description 2
- 102100036173 Tetratricopeptide repeat protein 30A Human genes 0.000 description 2
- 102100036174 Tetratricopeptide repeat protein 30B Human genes 0.000 description 2
- 102100034752 Threonine synthase-like 1 Human genes 0.000 description 2
- 102100026966 Thrombomodulin Human genes 0.000 description 2
- 102100029524 Thrombospondin-3 Human genes 0.000 description 2
- IQFYYKKMVGJFEH-XLPZGREQSA-N Thymidine Chemical group O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 IQFYYKKMVGJFEH-XLPZGREQSA-N 0.000 description 2
- 102100027645 Tigger transposable element-derived protein 1 Human genes 0.000 description 2
- 102100026640 Tight junction protein ZO-3 Human genes 0.000 description 2
- 102100031997 Tolloid-like protein 2 Human genes 0.000 description 2
- 102100024608 Torsin-2A Human genes 0.000 description 2
- 102100031555 Transcription factor E2F8 Human genes 0.000 description 2
- 102100023118 Transcription factor JunD Human genes 0.000 description 2
- 102100036694 Transcription factor SOX-6 Human genes 0.000 description 2
- 102100021172 Transcription initiation factor TFIID subunit 7-like Human genes 0.000 description 2
- 102100022175 Transmembrane and ubiquitin-like domain-containing protein 1 Human genes 0.000 description 2
- 102100036766 Transmembrane channel-like protein 7 Human genes 0.000 description 2
- 102100035253 Transmembrane protein 150C Human genes 0.000 description 2
- 102100025772 Transmembrane protein 160 Human genes 0.000 description 2
- 102100035058 Transmembrane protein 229B Human genes 0.000 description 2
- 102100027012 Transmembrane protein 245 Human genes 0.000 description 2
- 102100037626 Transmembrane protein 88 Human genes 0.000 description 2
- 102100037638 Transmembrane protein 91 Human genes 0.000 description 2
- 102100029519 Tripartite motif-containing protein 29 Human genes 0.000 description 2
- 108010039203 Tripeptidyl-Peptidase 1 Proteins 0.000 description 2
- 102100034197 Tripeptidyl-peptidase 1 Human genes 0.000 description 2
- 102100028968 Tubulin alpha-1A chain Human genes 0.000 description 2
- 102100034859 Tubulin monoglycylase TTLL3 Human genes 0.000 description 2
- 102100034873 Tubulin polyglutamylase TTLL7 Human genes 0.000 description 2
- 102100024600 Tubulin polyglutamylase complex subunit 1 Human genes 0.000 description 2
- 102100022563 Tubulin polymerization-promoting protein Human genes 0.000 description 2
- 101710158555 Tubulin polymerization-promoting protein Proteins 0.000 description 2
- 102100022567 Tubulin polymerization-promoting protein family member 3 Human genes 0.000 description 2
- 102100040112 Tumor necrosis factor receptor superfamily member 10B Human genes 0.000 description 2
- 102100027224 Tumor protein p53-inducible nuclear protein 1 Human genes 0.000 description 2
- 102100029645 UBX domain-containing protein 11 Human genes 0.000 description 2
- 102100032439 UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9 Human genes 0.000 description 2
- 102100032285 UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Human genes 0.000 description 2
- 102100032284 UDP-glucuronic acid/UDP-N-acetylgalactosamine transporter Human genes 0.000 description 2
- 102100036355 UPF0500 protein C1orf216 Human genes 0.000 description 2
- 102100038574 UPF0692 protein C19orf54 Human genes 0.000 description 2
- 102100025044 Ubiquitin carboxyl-terminal hydrolase 49 Human genes 0.000 description 2
- 102100033084 Ubiquitin domain-containing protein TINCR Human genes 0.000 description 2
- 102100032540 Uncharacterized protein C11orf94 Human genes 0.000 description 2
- 102100022065 Uncharacterized protein C14orf28 Human genes 0.000 description 2
- 102100022042 Uncharacterized protein C17orf107 Human genes 0.000 description 2
- 102100025476 Uncharacterized protein C1orf109 Human genes 0.000 description 2
- 102100027599 Uncharacterized protein C20orf204 Human genes 0.000 description 2
- 102100026633 Uncharacterized protein C2orf27A Human genes 0.000 description 2
- 102100035826 Uncharacterized protein C3orf18 Human genes 0.000 description 2
- 102100027226 Uncharacterized protein C8orf58 Human genes 0.000 description 2
- 102100039404 Uncharacterized protein CXorf58 Human genes 0.000 description 2
- 102100036210 Uncharacterized protein EXOC3-AS1 Human genes 0.000 description 2
- 102100025702 Uncharacterized protein KIAA0513 Human genes 0.000 description 2
- 102100040065 Upstream-binding protein 1 Human genes 0.000 description 2
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 2
- 102100037929 Usher syndrome type-1G protein Human genes 0.000 description 2
- 208000006105 Uterine Cervical Neoplasms Diseases 0.000 description 2
- 102100033576 Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2 Human genes 0.000 description 2
- 108010017743 Vesicle-Associated Membrane Protein 1 Proteins 0.000 description 2
- 102100037105 Vesicle-associated membrane protein 1 Human genes 0.000 description 2
- 102100036505 Vesicle-associated membrane protein 8 Human genes 0.000 description 2
- 102100033419 Villin-1 Human genes 0.000 description 2
- 108700005077 Viral Genes Proteins 0.000 description 2
- 102100035140 Vitronectin Human genes 0.000 description 2
- 102100040985 Volume-regulated anion channel subunit LRRC8A Human genes 0.000 description 2
- 102100035329 WD repeat and SOCS box-containing protein 2 Human genes 0.000 description 2
- 108010020277 WD repeat containing planar cell polarity effector Proteins 0.000 description 2
- 102100027543 WD repeat domain phosphoinositide-interacting protein 1 Human genes 0.000 description 2
- 102100039744 WD repeat-containing protein 19 Human genes 0.000 description 2
- 102100038139 WD repeat-containing protein 25 Human genes 0.000 description 2
- 102100038947 WD repeat-containing protein 37 Human genes 0.000 description 2
- 102100035393 WD repeat-containing protein 5B Human genes 0.000 description 2
- 102100028209 WD repeat-containing protein 90 Human genes 0.000 description 2
- 102100039490 X antigen family member 1 Human genes 0.000 description 2
- 108091028063 ZEB2-AS1 Proteins 0.000 description 2
- 102100028535 Zinc finger MIZ domain-containing protein 1 Human genes 0.000 description 2
- 102100025103 Zinc finger MYND domain-containing protein 19 Human genes 0.000 description 2
- 102100023559 Zinc finger protein 107 Human genes 0.000 description 2
- 102100023566 Zinc finger protein 117 Human genes 0.000 description 2
- 102100021406 Zinc finger protein 19 Human genes 0.000 description 2
- 102100024687 Zinc finger protein 2 Human genes 0.000 description 2
- 102100039941 Zinc finger protein 214 Human genes 0.000 description 2
- 102100028395 Zinc finger protein 23 Human genes 0.000 description 2
- 102100028393 Zinc finger protein 25 Human genes 0.000 description 2
- 102100021371 Zinc finger protein 257 Human genes 0.000 description 2
- 102100028432 Zinc finger protein 287 Human genes 0.000 description 2
- 102100024657 Zinc finger protein 33B Human genes 0.000 description 2
- 102100025433 Zinc finger protein 347 Human genes 0.000 description 2
- 102100040311 Zinc finger protein 354C Human genes 0.000 description 2
- 102100025438 Zinc finger protein 367 Human genes 0.000 description 2
- 102100040308 Zinc finger protein 385A Human genes 0.000 description 2
- 102100040825 Zinc finger protein 396 Human genes 0.000 description 2
- 102100023551 Zinc finger protein 41 homolog Human genes 0.000 description 2
- 102100023547 Zinc finger protein 410 Human genes 0.000 description 2
- 102100021348 Zinc finger protein 438 Human genes 0.000 description 2
- 102100035865 Zinc finger protein 449 Human genes 0.000 description 2
- 102100029038 Zinc finger protein 470 Human genes 0.000 description 2
- 102100039947 Zinc finger protein 490 Human genes 0.000 description 2
- 102100039971 Zinc finger protein 493 Human genes 0.000 description 2
- 102100034656 Zinc finger protein 558 Human genes 0.000 description 2
- 102100023632 Zinc finger protein 595 Human genes 0.000 description 2
- 102100023613 Zinc finger protein 596 Human genes 0.000 description 2
- 102100023633 Zinc finger protein 599 Human genes 0.000 description 2
- 102100021357 Zinc finger protein 606 Human genes 0.000 description 2
- 102100021104 Zinc finger protein 614 Human genes 0.000 description 2
- 102100021124 Zinc finger protein 616 Human genes 0.000 description 2
- 102100035800 Zinc finger protein 626 Human genes 0.000 description 2
- 102100027855 Zinc finger protein 695 Human genes 0.000 description 2
- 102100027851 Zinc finger protein 699 Human genes 0.000 description 2
- 102100027857 Zinc finger protein 701 Human genes 0.000 description 2
- 102100024711 Zinc finger protein 724 Human genes 0.000 description 2
- 102100040710 Zinc finger protein 76 Human genes 0.000 description 2
- 102100040707 Zinc finger protein 77 Human genes 0.000 description 2
- 102100023625 Zinc finger protein 793 Human genes 0.000 description 2
- 102100023623 Zinc finger protein 808 Human genes 0.000 description 2
- 102100035781 Zinc finger protein 837 Human genes 0.000 description 2
- 102100026592 Zinc finger protein 846 Human genes 0.000 description 2
- 102100026487 Zinc finger protein 862 Human genes 0.000 description 2
- 102100023493 Zinc finger protein ZIC 4 Human genes 0.000 description 2
- 102100029859 Zinc finger protein neuro-d4 Human genes 0.000 description 2
- 102100032279 Zinc transporter ZIP13 Human genes 0.000 description 2
- AXWYROHIFVWHMR-UGTOYMOASA-N [(8r,9s,13s,14s)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6h-cyclopenta[a]phenanthren-3-yl] n,n-bis(2-chloroethyl)carbamate Chemical compound ClCCN(CCCl)C(=O)OC1=CC=C2[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CCC2=C1 AXWYROHIFVWHMR-UGTOYMOASA-N 0.000 description 2
- IFJUINDAXYAPTO-UUBSBJJBSA-N [(8r,9s,13s,14s,17s)-17-[2-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoyloxy]acetyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate Chemical compound C([C@@H]1[C@@H](C2=CC=3)CC[C@]4([C@H]1CC[C@@H]4OC(=O)COC(=O)CCCC=1C=CC(=CC=1)N(CCCl)CCCl)C)CC2=CC=3OC(=O)C1=CC=CC=C1 IFJUINDAXYAPTO-UUBSBJJBSA-N 0.000 description 2
- NRUFLTXGIPFVSH-KBVRNWHJSA-N [(8r,9s,13s,14s,17s)-3-[bis(2-chloroethyl)carbamoyloxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] (2s)-2-aminopropanoate Chemical compound C1CC2=CC(OC(=O)N(CCCl)CCCl)=CC=C2[C@@H]2[C@@H]1[C@@H]1CC[C@H](OC(=O)[C@@H](N)C)[C@@]1(C)CC2 NRUFLTXGIPFVSH-KBVRNWHJSA-N 0.000 description 2
- XMYKNCNAZKMVQN-NYYWCZLTSA-N [(e)-(3-aminopyridin-2-yl)methylideneamino]thiourea Chemical compound NC(=S)N\N=C\C1=NC=CC=C1N XMYKNCNAZKMVQN-NYYWCZLTSA-N 0.000 description 2
- JLCPHMBAVCMARE-UHFFFAOYSA-N [3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[3-[[3-[[3-[[3-[[3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl [5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate Polymers Cc1cn(C2CC(OP(O)(=O)OCC3OC(CC3OP(O)(=O)OCC3OC(CC3O)n3cnc4c3nc(N)[nH]c4=O)n3cnc4c3nc(N)[nH]c4=O)C(COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3CO)n3cnc4c(N)ncnc34)n3ccc(N)nc3=O)n3cnc4c(N)ncnc34)n3ccc(N)nc3=O)n3ccc(N)nc3=O)n3ccc(N)nc3=O)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cc(C)c(=O)[nH]c3=O)n3cc(C)c(=O)[nH]c3=O)n3ccc(N)nc3=O)n3cc(C)c(=O)[nH]c3=O)n3cnc4c3nc(N)[nH]c4=O)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)O2)c(=O)[nH]c1=O JLCPHMBAVCMARE-UHFFFAOYSA-N 0.000 description 2
- BOIZOYRDXIYMCY-OCEACIFDSA-N [4-[(e)-4-[4-[bis(2-chloroethyl)carbamoyloxy]phenyl]hex-3-en-3-yl]phenyl] n,n-bis(2-chloroethyl)carbamate Chemical compound C=1C=C(OC(=O)N(CCCl)CCCl)C=CC=1C(/CC)=C(\CC)C1=CC=C(OC(=O)N(CCCl)CCCl)C=C1 BOIZOYRDXIYMCY-OCEACIFDSA-N 0.000 description 2
- GTWGWCYJKHSRHO-UHFFFAOYSA-N [4-[4-[4-[2-[4-[bis(2-chloroethyl)amino]phenyl]acetyl]oxyphenyl]hexan-3-yl]phenyl] 2-[4-[bis(2-chloroethyl)amino]phenyl]acetate Chemical compound C=1C=C(OC(=O)CC=2C=CC(=CC=2)N(CCCl)CCCl)C=CC=1C(CC)C(CC)C(C=C1)=CC=C1OC(=O)CC1=CC=C(N(CCCl)CCCl)C=C1 GTWGWCYJKHSRHO-UHFFFAOYSA-N 0.000 description 2
- 229940022663 acetate Drugs 0.000 description 2
- 229930183665 actinomycin Natural products 0.000 description 2
- 208000021841 acute erythroid leukemia Diseases 0.000 description 2
- 229950009009 alestramustine Drugs 0.000 description 2
- 229960000473 altretamine Drugs 0.000 description 2
- RGHILYZRVFRRNK-UHFFFAOYSA-N anthracene-1,2-dione Chemical class C1=CC=C2C=C(C(C(=O)C=C3)=O)C3=CC2=C1 RGHILYZRVFRRNK-UHFFFAOYSA-N 0.000 description 2
- 229940045799 anthracyclines and related substance Drugs 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 229950006933 atrimustine Drugs 0.000 description 2
- 230000033228 biological regulation Effects 0.000 description 2
- 238000001574 biopsy Methods 0.000 description 2
- 101150048834 braF gene Proteins 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 102100027985 cAMP-responsive element-binding protein-like 2 Human genes 0.000 description 2
- 102100022421 cGMP-dependent protein kinase 2 Human genes 0.000 description 2
- 102100028059 cTAGE family member 8 Human genes 0.000 description 2
- 229940022399 cancer vaccine Drugs 0.000 description 2
- 238000009566 cancer vaccine Methods 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- WYUSVOMTXWRGEK-HBWVYFAYSA-N cefpodoxime Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC)C(O)=O)C(=O)C(=N/OC)\C1=CSC(N)=N1 WYUSVOMTXWRGEK-HBWVYFAYSA-N 0.000 description 2
- 230000021164 cell adhesion Effects 0.000 description 2
- 230000004709 cell invasion Effects 0.000 description 2
- 230000004663 cell proliferation Effects 0.000 description 2
- 201000010881 cervical cancer Diseases 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000035605 chemotaxis Effects 0.000 description 2
- CWJSHJJYOPWUGX-UHFFFAOYSA-N chlorpropham Chemical compound CC(C)OC(=O)NC1=CC=CC(Cl)=C1 CWJSHJJYOPWUGX-UHFFFAOYSA-N 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 229960000928 clofarabine Drugs 0.000 description 2
- 229940103380 clolar Drugs 0.000 description 2
- DDRJAANPRJIHGJ-UHFFFAOYSA-N creatinine Chemical compound CN1CC(=O)NC1=N DDRJAANPRJIHGJ-UHFFFAOYSA-N 0.000 description 2
- 239000003431 cross linking reagent Substances 0.000 description 2
- 230000016396 cytokine production Effects 0.000 description 2
- DTPCFIHYWYONMD-UHFFFAOYSA-N decaethylene glycol Chemical compound OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO DTPCFIHYWYONMD-UHFFFAOYSA-N 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 239000001177 diphosphate Substances 0.000 description 2
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 2
- 235000011180 diphosphates Nutrition 0.000 description 2
- 230000002222 downregulating effect Effects 0.000 description 2
- 230000002357 endometrial effect Effects 0.000 description 2
- 230000008995 epigenetic change Effects 0.000 description 2
- 210000002919 epithelial cell Anatomy 0.000 description 2
- 229950008601 estradiol mustard Drugs 0.000 description 2
- 229940011871 estrogen Drugs 0.000 description 2
- 239000000262 estrogen Substances 0.000 description 2
- 208000021045 exocrine pancreatic carcinoma Diseases 0.000 description 2
- 206010017758 gastric cancer Diseases 0.000 description 2
- 201000011243 gastrointestinal stromal tumor Diseases 0.000 description 2
- 230000013595 glycosylation Effects 0.000 description 2
- 238000006206 glycosylation reaction Methods 0.000 description 2
- 210000003128 head Anatomy 0.000 description 2
- UUVWYPNAQBNQJQ-UHFFFAOYSA-N hexamethylmelamine Chemical compound CN(C)C1=NC(N(C)C)=NC(N(C)C)=N1 UUVWYPNAQBNQJQ-UHFFFAOYSA-N 0.000 description 2
- 238000003384 imaging method Methods 0.000 description 2
- 238000009169 immunotherapy Methods 0.000 description 2
- 230000001976 improved effect Effects 0.000 description 2
- 230000002779 inactivation Effects 0.000 description 2
- 230000006698 induction Effects 0.000 description 2
- 230000006882 induction of apoptosis Effects 0.000 description 2
- 230000008595 infiltration Effects 0.000 description 2
- 238000001764 infiltration Methods 0.000 description 2
- 238000009830 intercalation Methods 0.000 description 2
- 108010011989 karyopherin alpha 2 Proteins 0.000 description 2
- 210000003734 kidney Anatomy 0.000 description 2
- 230000003902 lesion Effects 0.000 description 2
- 201000002250 liver carcinoma Diseases 0.000 description 2
- 239000012139 lysis buffer Substances 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- 210000002752 melanocyte Anatomy 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- GLVAUDGFNGKCSF-UHFFFAOYSA-N mercaptopurine Chemical compound S=C1NC=NC2=C1NC=N2 GLVAUDGFNGKCSF-UHFFFAOYSA-N 0.000 description 2
- 230000004060 metabolic process Effects 0.000 description 2
- 230000001394 metastastic effect Effects 0.000 description 2
- 206010061289 metastatic neoplasm Diseases 0.000 description 2
- 108091044731 miR-4519 stem-loop Proteins 0.000 description 2
- CFCUWKMKBJTWLW-BKHRDMLASA-N mithramycin Chemical compound O([C@@H]1C[C@@H](O[C@H](C)[C@H]1O)OC=1C=C2C=C3C[C@H]([C@@H](C(=O)C3=C(O)C2=C(O)C=1C)O[C@@H]1O[C@H](C)[C@@H](O)[C@H](O[C@@H]2O[C@H](C)[C@H](O)[C@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@@](C)(O)C3)C2)C1)[C@H](OC)C(=O)[C@@H](O)[C@@H](C)O)[C@H]1C[C@@H](O)[C@H](O)[C@@H](C)O1 CFCUWKMKBJTWLW-BKHRDMLASA-N 0.000 description 2
- 229960005485 mitobronitol Drugs 0.000 description 2
- 229960004857 mitomycin Drugs 0.000 description 2
- 101150091791 mvk gene Proteins 0.000 description 2
- URBXHNSZZLMBOT-UHFFFAOYSA-N n-[9-(4-fluoro-3,5,6-trihydroxyoxan-2-yl)purin-6-yl]benzamide Chemical compound OC1C(F)C(O)C(O)OC1N1C2=NC=NC(NC(=O)C=3C=CC=CC=3)=C2N=C1 URBXHNSZZLMBOT-UHFFFAOYSA-N 0.000 description 2
- 210000003739 neck Anatomy 0.000 description 2
- 230000002018 overexpression Effects 0.000 description 2
- 210000000496 pancreas Anatomy 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 229960000952 pipobroman Drugs 0.000 description 2
- NJBFOOCLYDNZJN-UHFFFAOYSA-N pipobroman Chemical compound BrCCC(=O)N1CCN(C(=O)CCBr)CC1 NJBFOOCLYDNZJN-UHFFFAOYSA-N 0.000 description 2
- 229960004403 pixantrone Drugs 0.000 description 2
- PEZPMAYDXJQYRV-UHFFFAOYSA-N pixantrone Chemical compound O=C1C2=CN=CC=C2C(=O)C2=C1C(NCCN)=CC=C2NCCN PEZPMAYDXJQYRV-UHFFFAOYSA-N 0.000 description 2
- 229960003171 plicamycin Drugs 0.000 description 2
- 229960004618 prednisone Drugs 0.000 description 2
- XOFYZVNMUHMLCC-ZPOLXVRWSA-N prednisone Chemical compound O=C1C=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 XOFYZVNMUHMLCC-ZPOLXVRWSA-N 0.000 description 2
- 238000009117 preventive therapy Methods 0.000 description 2
- CPTBDICYNRMXFX-UHFFFAOYSA-N procarbazine Chemical compound CNNCC1=CC=C(C(=O)NC(C)C)C=C1 CPTBDICYNRMXFX-UHFFFAOYSA-N 0.000 description 2
- 229960000624 procarbazine Drugs 0.000 description 2
- ZAHRKKWIAAJSAO-UHFFFAOYSA-N rapamycin Natural products COCC(O)C(=C/C(C)C(=O)CC(OC(=O)C1CCCCN1C(=O)C(=O)C2(O)OC(CC(OC)C(=CC=CC=CC(C)CC(C)C(=O)C)C)CCC2C)C(C)CC3CCC(O)C(C3)OC)C ZAHRKKWIAAJSAO-UHFFFAOYSA-N 0.000 description 2
- 230000007115 recruitment Effects 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 238000005204 segregation Methods 0.000 description 2
- 229960002930 sirolimus Drugs 0.000 description 2
- 201000011549 stomach cancer Diseases 0.000 description 2
- 230000001629 suppression Effects 0.000 description 2
- 102100022355 tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A Human genes 0.000 description 2
- 102100021774 tRNA-splicing endonuclease subunit Sen2 Human genes 0.000 description 2
- QFJCIRLUMZQUOT-UHFFFAOYSA-N temsirolimus Natural products C1CC(O)C(OC)CC1CC(C)C1OC(=O)C2CCCCN2C(=O)C(=O)C(O)(O2)C(C)CCC2CC(OC)C(C)=CC=CC=CC(C)CC(C)C(=O)C(OC)C(O)C(C)=CC(C)C(=O)C1 QFJCIRLUMZQUOT-UHFFFAOYSA-N 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 229940113082 thymine Drugs 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- 229960005526 triapine Drugs 0.000 description 2
- 238000001262 western blot Methods 0.000 description 2
- 230000029663 wound healing Effects 0.000 description 2
- JGSMCYNBVCGIHC-QPEQYQDCSA-N (3z)-3-[(4-hydroxyphenyl)methylidene]-5,6-dimethoxy-1h-indol-2-one Chemical compound C1=2C=C(OC)C(OC)=CC=2NC(=O)\C1=C/C1=CC=C(O)C=C1 JGSMCYNBVCGIHC-QPEQYQDCSA-N 0.000 description 1
- FPVKHBSQESCIEP-UHFFFAOYSA-N (8S)-3-(2-deoxy-beta-D-erythro-pentofuranosyl)-3,6,7,8-tetrahydroimidazo[4,5-d][1,3]diazepin-8-ol Natural products C1C(O)C(CO)OC1N1C(NC=NCC2O)=C2N=C1 FPVKHBSQESCIEP-UHFFFAOYSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- 102100025573 1-alkyl-2-acetylglycerophosphocholine esterase Human genes 0.000 description 1
- YABJJWZLRMPFSI-UHFFFAOYSA-N 1-methyl-5-[[2-[5-(trifluoromethyl)-1H-imidazol-2-yl]-4-pyridinyl]oxy]-N-[4-(trifluoromethyl)phenyl]-2-benzimidazolamine Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C=3NC(=CN=3)C(F)(F)F)=CC=C2N(C)C=1NC1=CC=C(C(F)(F)F)C=C1 YABJJWZLRMPFSI-UHFFFAOYSA-N 0.000 description 1
- 238000010176 18-FDG-positron emission tomography Methods 0.000 description 1
- ZCXUVYAZINUVJD-AHXZWLDOSA-N 2-deoxy-2-((18)F)fluoro-alpha-D-glucose Chemical compound OC[C@H]1O[C@H](O)[C@H]([18F])[C@@H](O)[C@@H]1O ZCXUVYAZINUVJD-AHXZWLDOSA-N 0.000 description 1
- ASJSAQIRZKANQN-CRCLSJGQSA-N 2-deoxy-D-ribose Chemical group OC[C@@H](O)[C@@H](O)CC=O ASJSAQIRZKANQN-CRCLSJGQSA-N 0.000 description 1
- 108020005345 3' Untranslated Regions Proteins 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- FWMNVWWHGCHHJJ-SKKKGAJSSA-N 4-amino-1-[(2r)-6-amino-2-[[(2r)-2-[[(2r)-2-[[(2r)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]piperidine-4-carboxylic acid Chemical compound C([C@H](C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCCN)C(=O)N1CCC(N)(CC1)C(O)=O)NC(=O)[C@H](N)CC=1C=CC=CC=1)C1=CC=CC=C1 FWMNVWWHGCHHJJ-SKKKGAJSSA-N 0.000 description 1
- 102100028626 4-hydroxyphenylpyruvate dioxygenase Human genes 0.000 description 1
- 108010068327 4-hydroxyphenylpyruvate dioxygenase Proteins 0.000 description 1
- 101710092702 47 kDa protein Proteins 0.000 description 1
- 108700004024 5'-Nucleotidase Proteins 0.000 description 1
- 102100033824 A-kinase anchor protein 12 Human genes 0.000 description 1
- 102100024120 AP-4 complex accessory subunit RUSC1 Human genes 0.000 description 1
- 101150009379 AS1 gene Proteins 0.000 description 1
- 102100023619 ATP synthase F(0) complex subunit B1, mitochondrial Human genes 0.000 description 1
- ZKHQWZAMYRWXGA-KQYNXXCUSA-J ATP(4-) Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O)[C@@H](O)[C@H]1O ZKHQWZAMYRWXGA-KQYNXXCUSA-J 0.000 description 1
- 208000004998 Abdominal Pain Diseases 0.000 description 1
- 102100033892 Actin-related protein 2/3 complex subunit 5 Human genes 0.000 description 1
- 208000036762 Acute promyelocytic leukaemia Diseases 0.000 description 1
- 102100025848 Acyl-coenzyme A thioesterase 8 Human genes 0.000 description 1
- 102100035990 Adenosine receptor A2a Human genes 0.000 description 1
- 102000009346 Adenosine receptors Human genes 0.000 description 1
- 108050000203 Adenosine receptors Proteins 0.000 description 1
- ZKHQWZAMYRWXGA-UHFFFAOYSA-N Adenosine triphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(=O)OP(O)(O)=O)C(O)C1O ZKHQWZAMYRWXGA-UHFFFAOYSA-N 0.000 description 1
- 102100032156 Adenylate cyclase type 9 Human genes 0.000 description 1
- 101150051188 Adora2a gene Proteins 0.000 description 1
- 102100032197 Alpha-crystallin A chain Human genes 0.000 description 1
- 102100024581 Alpha-taxilin Human genes 0.000 description 1
- 102100037325 Apolipoprotein L6 Human genes 0.000 description 1
- 101100339431 Arabidopsis thaliana HMGB2 gene Proteins 0.000 description 1
- 101100080548 Arabidopsis thaliana NRPB1 gene Proteins 0.000 description 1
- 101100207331 Arabidopsis thaliana TPPI gene Proteins 0.000 description 1
- 208000006820 Arthralgia Diseases 0.000 description 1
- 108010024976 Asparaginase Proteins 0.000 description 1
- 102000004228 Aurora kinase B Human genes 0.000 description 1
- 108090000749 Aurora kinase B Proteins 0.000 description 1
- 102000003989 Aurora kinases Human genes 0.000 description 1
- 108090000433 Aurora kinases Proteins 0.000 description 1
- 206010003805 Autism Diseases 0.000 description 1
- 208000020706 Autistic disease Diseases 0.000 description 1
- 208000010839 B-cell chronic lymphocytic leukemia Diseases 0.000 description 1
- 102100023046 Band 4.1-like protein 3 Human genes 0.000 description 1
- 208000011691 Burkitt lymphomas Diseases 0.000 description 1
- 125000004399 C1-C4 alkenyl group Chemical group 0.000 description 1
- 101150060120 C1qbp gene Proteins 0.000 description 1
- 102100032976 CCR4-NOT transcription complex subunit 6 Human genes 0.000 description 1
- 210000001266 CD8-positive T-lymphocyte Anatomy 0.000 description 1
- 108091007914 CDKs Proteins 0.000 description 1
- 102100032906 COBW domain-containing protein 3 Human genes 0.000 description 1
- 229940045513 CTLA4 antagonist Drugs 0.000 description 1
- 101100417166 Caenorhabditis elegans rpi-1 gene Proteins 0.000 description 1
- 102100033379 Carbohydrate sulfotransferase 14 Human genes 0.000 description 1
- 102000047934 Caspase-3/7 Human genes 0.000 description 1
- 108700037887 Caspase-3/7 Proteins 0.000 description 1
- 102100035370 Cat eye syndrome critical region protein 2 Human genes 0.000 description 1
- 102100026772 Cell cycle control protein 50A Human genes 0.000 description 1
- 102100031584 Cell division cycle-associated 7-like protein Human genes 0.000 description 1
- 101100324551 Chlamydomonas reinhardtii ARSA1 gene Proteins 0.000 description 1
- 102100028758 Chondroitin sulfate proteoglycan 5 Human genes 0.000 description 1
- 102100038220 Chromodomain-helicase-DNA-binding protein 6 Human genes 0.000 description 1
- PTOAARAWEBMLNO-KVQBGUIXSA-N Cladribine Chemical compound C1=NC=2C(N)=NC(Cl)=NC=2N1[C@H]1C[C@H](O)[C@@H](CO)O1 PTOAARAWEBMLNO-KVQBGUIXSA-N 0.000 description 1
- 102100026190 Class E basic helix-loop-helix protein 41 Human genes 0.000 description 1
- 102100038447 Claudin-4 Human genes 0.000 description 1
- 102100030871 Cleavage and polyadenylation specificity factor subunit 5 Human genes 0.000 description 1
- UDMBCSSLTHHNCD-UHFFFAOYSA-N Coenzym Q(11) Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(O)=O)C(O)C1O UDMBCSSLTHHNCD-UHFFFAOYSA-N 0.000 description 1
- 102100031160 Collagen alpha-1(XX) chain Human genes 0.000 description 1
- 208000001333 Colorectal Neoplasms Diseases 0.000 description 1
- 102100037078 Complement component 1 Q subcomponent-binding protein, mitochondrial Human genes 0.000 description 1
- 206010010774 Constipation Diseases 0.000 description 1
- 102100041019 Coordinator of PRMT5 and differentiation stimulator Human genes 0.000 description 1
- 102000003903 Cyclin-dependent kinases Human genes 0.000 description 1
- 108090000266 Cyclin-dependent kinases Proteins 0.000 description 1
- 108091028710 DLEU2 Proteins 0.000 description 1
- 230000006820 DNA synthesis Effects 0.000 description 1
- 241000702421 Dependoparvovirus Species 0.000 description 1
- 102100040577 Dermatan-sulfate epimerase-like protein Human genes 0.000 description 1
- 102100030215 Diacylglycerol kinase eta Human genes 0.000 description 1
- 206010012735 Diarrhoea Diseases 0.000 description 1
- 102100029579 Diphosphoinositol polyphosphate phosphohydrolase 1 Human genes 0.000 description 1
- 206010061818 Disease progression Diseases 0.000 description 1
- 102100027275 Dual specificity protein phosphatase 7 Human genes 0.000 description 1
- 102100029520 E3 ubiquitin-protein ligase TRIM31 Human genes 0.000 description 1
- 102100025020 E3 ubiquitin-protein ligase TRIM62 Human genes 0.000 description 1
- 238000002965 ELISA Methods 0.000 description 1
- 238000008157 ELISA kit Methods 0.000 description 1
- 102100032064 EMILIN-2 Human genes 0.000 description 1
- 101150084967 EPCAM gene Proteins 0.000 description 1
- 102100028779 Endonuclease 8-like 2 Human genes 0.000 description 1
- 102100031982 Ephrin type-B receptor 3 Human genes 0.000 description 1
- 102100021472 Equilibrative nucleoside transporter 3 Human genes 0.000 description 1
- 208000000461 Esophageal Neoplasms Diseases 0.000 description 1
- 241000206602 Eukaryota Species 0.000 description 1
- 102100021699 Eukaryotic translation initiation factor 3 subunit B Human genes 0.000 description 1
- 208000006168 Ewing Sarcoma Diseases 0.000 description 1
- 208000010201 Exanthema Diseases 0.000 description 1
- 102100040650 F-BAR and double SH3 domains protein 2 Human genes 0.000 description 1
- 102100026353 F-box-like/WD repeat-containing protein TBL1XR1 Human genes 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical group F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- 102100027581 Forkhead box protein P3 Human genes 0.000 description 1
- 102100035237 GA-binding protein alpha chain Human genes 0.000 description 1
- 101150004665 GCH1 gene Proteins 0.000 description 1
- DEZZLWQELQORIU-RELWKKBWSA-N GDC-0879 Chemical compound N=1N(CCO)C=C(C=2C=C3CCC(/C3=CC=2)=N\O)C=1C1=CC=NC=C1 DEZZLWQELQORIU-RELWKKBWSA-N 0.000 description 1
- 102100037156 Gap junction beta-2 protein Human genes 0.000 description 1
- 108700039691 Genetic Promoter Regions Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 102100025591 Glycerate kinase Human genes 0.000 description 1
- 102100037825 Glycosaminoglycan xylosylkinase Human genes 0.000 description 1
- 102100032191 Guanine nucleotide exchange factor VAV3 Human genes 0.000 description 1
- NYHBQMYGNKIUIF-UUOKFMHZSA-N Guanosine Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O NYHBQMYGNKIUIF-UUOKFMHZSA-N 0.000 description 1
- 108700010013 HMGB1 Proteins 0.000 description 1
- 101150021904 HMGB1 gene Proteins 0.000 description 1
- 101710088172 HTH-type transcriptional regulator RipA Proteins 0.000 description 1
- 206010019233 Headaches Diseases 0.000 description 1
- 102100037907 High mobility group protein B1 Human genes 0.000 description 1
- 102100021455 Histone deacetylase 3 Human genes 0.000 description 1
- 101000779382 Homo sapiens A-kinase anchor protein 12 Proteins 0.000 description 1
- 101000690135 Homo sapiens AP-4 complex accessory subunit RUSC1 Proteins 0.000 description 1
- 101000905623 Homo sapiens ATP synthase F(0) complex subunit B1, mitochondrial Proteins 0.000 description 1
- 101000925555 Homo sapiens Actin-related protein 2/3 complex subunit 5 Proteins 0.000 description 1
- 101000720381 Homo sapiens Acyl-coenzyme A thioesterase 8 Proteins 0.000 description 1
- 101000783751 Homo sapiens Adenosine receptor A2a Proteins 0.000 description 1
- 101000775499 Homo sapiens Adenylate cyclase type 9 Proteins 0.000 description 1
- 101000920937 Homo sapiens Alpha-crystallin A chain Proteins 0.000 description 1
- 101000760787 Homo sapiens Alpha-taxilin Proteins 0.000 description 1
- 101000806784 Homo sapiens Apolipoprotein L6 Proteins 0.000 description 1
- 101000952934 Homo sapiens Atrial natriuretic peptide-converting enzyme Proteins 0.000 description 1
- 101100218714 Homo sapiens BHLHE41 gene Proteins 0.000 description 1
- 101001049975 Homo sapiens Band 4.1-like protein 3 Proteins 0.000 description 1
- 101000942595 Homo sapiens CCR4-NOT transcription complex subunit 6 Proteins 0.000 description 1
- 101000797562 Homo sapiens COBW domain-containing protein 3 Proteins 0.000 description 1
- 101000943858 Homo sapiens Carbohydrate sulfotransferase 14 Proteins 0.000 description 1
- 101000737671 Homo sapiens Cat eye syndrome critical region protein 2 Proteins 0.000 description 1
- 101000910814 Homo sapiens Cell cycle control protein 50A Proteins 0.000 description 1
- 101000777638 Homo sapiens Cell division cycle-associated 7-like protein Proteins 0.000 description 1
- 101000916485 Homo sapiens Chondroitin sulfate proteoglycan 5 Proteins 0.000 description 1
- 101000883731 Homo sapiens Chromodomain-helicase-DNA-binding protein 5 Proteins 0.000 description 1
- 101000883736 Homo sapiens Chromodomain-helicase-DNA-binding protein 6 Proteins 0.000 description 1
- 101000882890 Homo sapiens Claudin-4 Proteins 0.000 description 1
- 101000727072 Homo sapiens Cleavage and polyadenylation specificity factor subunit 5 Proteins 0.000 description 1
- 101000940122 Homo sapiens Collagen alpha-1(XX) chain Proteins 0.000 description 1
- 101000748895 Homo sapiens Coordinator of PRMT5 and differentiation stimulator Proteins 0.000 description 1
- 101000816741 Homo sapiens Dermatan-sulfate epimerase-like protein Proteins 0.000 description 1
- 101000864599 Homo sapiens Diacylglycerol kinase eta Proteins 0.000 description 1
- 101000632920 Homo sapiens Diphosphoinositol polyphosphate phosphohydrolase 1 Proteins 0.000 description 1
- 101001057603 Homo sapiens Dual specificity protein phosphatase 7 Proteins 0.000 description 1
- 101000634974 Homo sapiens E3 ubiquitin-protein ligase TRIM31 Proteins 0.000 description 1
- 101000830236 Homo sapiens E3 ubiquitin-protein ligase TRIM62 Proteins 0.000 description 1
- 101000921278 Homo sapiens EMILIN-2 Proteins 0.000 description 1
- 101001123823 Homo sapiens Endonuclease 8-like 2 Proteins 0.000 description 1
- 101001064458 Homo sapiens Ephrin type-B receptor 3 Proteins 0.000 description 1
- 101000892420 Homo sapiens F-BAR and double SH3 domains protein 2 Proteins 0.000 description 1
- 101000835675 Homo sapiens F-box-like/WD repeat-containing protein TBL1XR1 Proteins 0.000 description 1
- 101000861452 Homo sapiens Forkhead box protein P3 Proteins 0.000 description 1
- 101001022105 Homo sapiens GA-binding protein alpha chain Proteins 0.000 description 1
- 101000954092 Homo sapiens Gap junction beta-2 protein Proteins 0.000 description 1
- 101000856267 Homo sapiens Glycerate kinase Proteins 0.000 description 1
- 101000805056 Homo sapiens Glycosaminoglycan xylosylkinase Proteins 0.000 description 1
- 101000775742 Homo sapiens Guanine nucleotide exchange factor VAV3 Proteins 0.000 description 1
- 101001038390 Homo sapiens Guided entry of tail-anchored proteins factor 1 Proteins 0.000 description 1
- 101000899282 Homo sapiens Histone deacetylase 3 Proteins 0.000 description 1
- 101001066074 Homo sapiens Integral membrane protein GPR137C Proteins 0.000 description 1
- 101000598002 Homo sapiens Interferon regulatory factor 1 Proteins 0.000 description 1
- 101001032345 Homo sapiens Interferon regulatory factor 8 Proteins 0.000 description 1
- 101001010600 Homo sapiens Interleukin-12 subunit alpha Proteins 0.000 description 1
- 101001045822 Homo sapiens Kelch-like protein 2 Proteins 0.000 description 1
- 101000971530 Homo sapiens Killer cell lectin-like receptor subfamily G member 2 Proteins 0.000 description 1
- 101001139115 Homo sapiens Krueppel-like factor 8 Proteins 0.000 description 1
- 101001043598 Homo sapiens Low-density lipoprotein receptor-related protein 4 Proteins 0.000 description 1
- 101001023359 Homo sapiens Lung adenoma susceptibility protein 2 Proteins 0.000 description 1
- 101001065550 Homo sapiens Lymphocyte antigen 6K Proteins 0.000 description 1
- 101001115719 Homo sapiens MORN repeat-containing protein 4 Proteins 0.000 description 1
- 101000578262 Homo sapiens Magnesium transporter NIPA1 Proteins 0.000 description 1
- 101001008874 Homo sapiens Mast/stem cell growth factor receptor Kit Proteins 0.000 description 1
- 101000831266 Homo sapiens Metalloproteinase inhibitor 4 Proteins 0.000 description 1
- 101000798951 Homo sapiens Mitochondrial import receptor subunit TOM20 homolog Proteins 0.000 description 1
- 101000624898 Homo sapiens Myb/SANT-like DNA-binding domain-containing protein 3 Proteins 0.000 description 1
- 101000584181 Homo sapiens Myosin light chain kinase family member 4 Proteins 0.000 description 1
- 101000927793 Homo sapiens Neuroepithelial cell-transforming gene 1 protein Proteins 0.000 description 1
- 101001111338 Homo sapiens Neurofilament heavy polypeptide Proteins 0.000 description 1
- 101000632159 Homo sapiens Ninjurin-2 Proteins 0.000 description 1
- 101000633516 Homo sapiens Nuclear receptor subfamily 2 group F member 6 Proteins 0.000 description 1
- 101000586302 Homo sapiens Oncostatin-M-specific receptor subunit beta Proteins 0.000 description 1
- 101000693238 Homo sapiens PDZ domain-containing protein 2 Proteins 0.000 description 1
- 101000604110 Homo sapiens Palmitoleoyl-protein carboxylesterase NOTUM Proteins 0.000 description 1
- 101000735219 Homo sapiens Paralemmin-3 Proteins 0.000 description 1
- 101001113469 Homo sapiens Partitioning defective 6 homolog alpha Proteins 0.000 description 1
- 101000935642 Homo sapiens Phosphoinositide 3-kinase adapter protein 1 Proteins 0.000 description 1
- 101000701522 Homo sapiens Phospholipid-transporting ATPase ID Proteins 0.000 description 1
- 101000701520 Homo sapiens Phospholipid-transporting ATPase IK Proteins 0.000 description 1
- 101000633511 Homo sapiens Photoreceptor-specific nuclear receptor Proteins 0.000 description 1
- 101000987238 Homo sapiens Platelet-activating factor acetylhydrolase 2, cytoplasmic Proteins 0.000 description 1
- 101001126074 Homo sapiens Pleckstrin homology domain-containing family A member 8 Proteins 0.000 description 1
- 101001002271 Homo sapiens Polypeptide N-acetylgalactosaminyltransferase 1 Proteins 0.000 description 1
- 101000829541 Homo sapiens Polypeptide N-acetylgalactosaminyltransferase 13 Proteins 0.000 description 1
- 101000829542 Homo sapiens Polypeptide N-acetylgalactosaminyltransferase 14 Proteins 0.000 description 1
- 101001124937 Homo sapiens Pre-mRNA-splicing factor 38B Proteins 0.000 description 1
- 101000915002 Homo sapiens Probable C-mannosyltransferase DPY19L1 Proteins 0.000 description 1
- 101001090551 Homo sapiens Proline-rich protein 5-like Proteins 0.000 description 1
- 101000848922 Homo sapiens Protein FAM72A Proteins 0.000 description 1
- 101000848917 Homo sapiens Protein FAM72D Proteins 0.000 description 1
- 101000788757 Homo sapiens Protein ZNF365 Proteins 0.000 description 1
- 101000652820 Homo sapiens Protein shisa-like-1 Proteins 0.000 description 1
- 101000613329 Homo sapiens Protocadherin alpha-C2 Proteins 0.000 description 1
- 101000629826 Homo sapiens RNA-binding E3 ubiquitin-protein ligase MEX3C Proteins 0.000 description 1
- 101001106787 Homo sapiens Refilin-B Proteins 0.000 description 1
- 101001077298 Homo sapiens Retinoblastoma-binding protein 5 Proteins 0.000 description 1
- 101001075558 Homo sapiens Rho GTPase-activating protein 29 Proteins 0.000 description 1
- 101000873614 Homo sapiens Secretory carrier-associated membrane protein 4 Proteins 0.000 description 1
- 101000683839 Homo sapiens Selenoprotein N Proteins 0.000 description 1
- 101000644537 Homo sapiens Sequestosome-1 Proteins 0.000 description 1
- 101000707474 Homo sapiens Serine incorporator 2 Proteins 0.000 description 1
- 101000984753 Homo sapiens Serine/threonine-protein kinase B-raf Proteins 0.000 description 1
- 101000732374 Homo sapiens Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B Proteins 0.000 description 1
- 101000703741 Homo sapiens Short stature homeobox protein 2 Proteins 0.000 description 1
- 101000631937 Homo sapiens Sodium- and chloride-dependent glycine transporter 2 Proteins 0.000 description 1
- 101000639975 Homo sapiens Sodium-dependent noradrenaline transporter Proteins 0.000 description 1
- 101000693269 Homo sapiens Sphingosine 1-phosphate receptor 3 Proteins 0.000 description 1
- 101000820457 Homo sapiens Stonin-2 Proteins 0.000 description 1
- 101000716994 Homo sapiens Suppressor APC domain-containing protein 2 Proteins 0.000 description 1
- 101000659071 Homo sapiens Synergin gamma Proteins 0.000 description 1
- 101000713606 Homo sapiens T-box transcription factor TBX20 Proteins 0.000 description 1
- 101000679548 Homo sapiens TOX high mobility group box family member 3 Proteins 0.000 description 1
- 101000657265 Homo sapiens Talanin Proteins 0.000 description 1
- 101000596772 Homo sapiens Transcription factor 7-like 1 Proteins 0.000 description 1
- 101000666382 Homo sapiens Transcription factor E2-alpha Proteins 0.000 description 1
- 101001121409 Homo sapiens Transcription factor Ovo-like 2 Proteins 0.000 description 1
- 101000775102 Homo sapiens Transcriptional coactivator YAP1 Proteins 0.000 description 1
- 101000764634 Homo sapiens Transmembrane gamma-carboxyglutamic acid protein 4 Proteins 0.000 description 1
- 101001012550 Homo sapiens Transmembrane protein 180 Proteins 0.000 description 1
- 101000638153 Homo sapiens Transmembrane protein with metallophosphoesterase domain Proteins 0.000 description 1
- 101001103033 Homo sapiens Tyrosine-protein kinase transmembrane receptor ROR2 Proteins 0.000 description 1
- 101000836261 Homo sapiens U4/U6.U5 tri-snRNP-associated protein 2 Proteins 0.000 description 1
- 101000760439 Homo sapiens UNC5C-like protein Proteins 0.000 description 1
- 101000761740 Homo sapiens Ubiquitin/ISG15-conjugating enzyme E2 L6 Proteins 0.000 description 1
- 101000850434 Homo sapiens V-type proton ATPase subunit B, brain isoform Proteins 0.000 description 1
- 101000771664 Homo sapiens WD repeat and FYVE domain-containing protein 2 Proteins 0.000 description 1
- 101000782174 Homo sapiens WD repeat-containing protein 82 Proteins 0.000 description 1
- 101000650042 Homo sapiens WD repeat-containing protein 97 Proteins 0.000 description 1
- 101100377226 Homo sapiens ZBTB16 gene Proteins 0.000 description 1
- 101000785626 Homo sapiens Zinc finger E-box-binding homeobox 1 Proteins 0.000 description 1
- 101000723833 Homo sapiens Zinc finger E-box-binding homeobox 2 Proteins 0.000 description 1
- 101000802348 Homo sapiens Zinc finger SWIM domain-containing protein 5 Proteins 0.000 description 1
- 101000781856 Homo sapiens Zinc finger protein 512B Proteins 0.000 description 1
- 101000931048 Homo sapiens Zinc finger protein DPF3 Proteins 0.000 description 1
- 101000702691 Homo sapiens Zinc finger protein SNAI1 Proteins 0.000 description 1
- 101000644602 Homo sapiens tRNA wybutosine-synthesizing protein 3 homolog Proteins 0.000 description 1
- 206010062904 Hormone-refractory prostate cancer Diseases 0.000 description 1
- 108010001336 Horseradish Peroxidase Proteins 0.000 description 1
- 208000035150 Hypercholesterolemia Diseases 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 102000037982 Immune checkpoint proteins Human genes 0.000 description 1
- 108091008036 Immune checkpoint proteins Proteins 0.000 description 1
- 208000005726 Inflammatory Breast Neoplasms Diseases 0.000 description 1
- 206010021980 Inflammatory carcinoma of the breast Diseases 0.000 description 1
- 102100031110 Integral membrane protein GPR137C Human genes 0.000 description 1
- 102100036981 Interferon regulatory factor 1 Human genes 0.000 description 1
- 102100038069 Interferon regulatory factor 8 Human genes 0.000 description 1
- 102100030698 Interleukin-12 subunit alpha Human genes 0.000 description 1
- 102100022120 Kelch-like protein 2 Human genes 0.000 description 1
- 102100021465 Killer cell lectin-like receptor subfamily G member 2 Human genes 0.000 description 1
- 102100020691 Krueppel-like factor 8 Human genes 0.000 description 1
- 102100021918 Low-density lipoprotein receptor-related protein 4 Human genes 0.000 description 1
- 102100035138 Lung adenoma susceptibility protein 2 Human genes 0.000 description 1
- 102100032129 Lymphocyte antigen 6K Human genes 0.000 description 1
- 208000031422 Lymphocytic Chronic B-Cell Leukemia Diseases 0.000 description 1
- 102100023289 MORN repeat-containing protein 4 Human genes 0.000 description 1
- 238000000719 MTS assay Methods 0.000 description 1
- 231100000070 MTS assay Toxicity 0.000 description 1
- 206010050183 Macrocephaly Diseases 0.000 description 1
- 102100028112 Magnesium transporter NIPA1 Human genes 0.000 description 1
- 101710087603 Mast/stem cell growth factor receptor Kit Proteins 0.000 description 1
- 208000000172 Medulloblastoma Diseases 0.000 description 1
- 208000035490 Megakaryoblastic Acute Leukemia Diseases 0.000 description 1
- 208000005767 Megalencephaly Diseases 0.000 description 1
- 206010027406 Mesothelioma Diseases 0.000 description 1
- 102100024289 Metalloproteinase inhibitor 4 Human genes 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 108010050345 Microphthalmia-Associated Transcription Factor Proteins 0.000 description 1
- 102100030157 Microphthalmia-associated transcription factor Human genes 0.000 description 1
- 102000029749 Microtubule Human genes 0.000 description 1
- 108091022875 Microtubule Proteins 0.000 description 1
- 102100036314 Mitochondrial cardiolipin hydrolase Human genes 0.000 description 1
- 101710168999 Mitochondrial cardiolipin hydrolase Proteins 0.000 description 1
- 102100034007 Mitochondrial import receptor subunit TOM20 homolog Human genes 0.000 description 1
- 102100030108 Mitochondrial ornithine transporter 1 Human genes 0.000 description 1
- 102000004232 Mitogen-Activated Protein Kinase Kinases Human genes 0.000 description 1
- 108090000744 Mitogen-Activated Protein Kinase Kinases Proteins 0.000 description 1
- 208000003445 Mouth Neoplasms Diseases 0.000 description 1
- 206010028116 Mucosal inflammation Diseases 0.000 description 1
- 201000010927 Mucositis Diseases 0.000 description 1
- 102100023254 Myb/SANT-like DNA-binding domain-containing protein 3 Human genes 0.000 description 1
- 201000003793 Myelodysplastic syndrome Diseases 0.000 description 1
- 102100030782 Myosin light chain kinase family member 4 Human genes 0.000 description 1
- 108050000637 N-cadherin Proteins 0.000 description 1
- 206010028813 Nausea Diseases 0.000 description 1
- 102000048850 Neoplasm Genes Human genes 0.000 description 1
- 108700019961 Neoplasm Genes Proteins 0.000 description 1
- 206010029260 Neuroblastoma Diseases 0.000 description 1
- 102100024007 Neurofilament heavy polypeptide Human genes 0.000 description 1
- 102100037571 Neurosecretory protein VGF Human genes 0.000 description 1
- 208000033755 Neutrophilic Chronic Leukemia Diseases 0.000 description 1
- 102100027889 Ninjurin-2 Human genes 0.000 description 1
- 102100029528 Nuclear receptor subfamily 2 group F member 6 Human genes 0.000 description 1
- 206010030124 Oedema peripheral Diseases 0.000 description 1
- 206010030155 Oesophageal carcinoma Diseases 0.000 description 1
- 102100030098 Oncostatin-M-specific receptor subunit beta Human genes 0.000 description 1
- 239000012270 PD-1 inhibitor Substances 0.000 description 1
- 239000012668 PD-1-inhibitor Substances 0.000 description 1
- 102100025646 PDZ domain-containing protein 2 Human genes 0.000 description 1
- 101150073900 PTEN gene Proteins 0.000 description 1
- 208000002193 Pain Diseases 0.000 description 1
- 102100038424 Palmitoleoyl-protein carboxylesterase NOTUM Human genes 0.000 description 1
- 102100035004 Paralemmin-3 Human genes 0.000 description 1
- 102100023711 Partitioning defective 6 homolog alpha Human genes 0.000 description 1
- 108010065129 Patched-1 Receptor Proteins 0.000 description 1
- 102100028238 Phosphoinositide 3-kinase adapter protein 1 Human genes 0.000 description 1
- 102100030474 Phospholipid-transporting ATPase ID Human genes 0.000 description 1
- 102100030472 Phospholipid-transporting ATPase IK Human genes 0.000 description 1
- 102000045595 Phosphoprotein Phosphatases Human genes 0.000 description 1
- 108700019535 Phosphoprotein Phosphatases Proteins 0.000 description 1
- 108091000080 Phosphotransferase Proteins 0.000 description 1
- 208000007913 Pituitary Neoplasms Diseases 0.000 description 1
- 201000005746 Pituitary adenoma Diseases 0.000 description 1
- 206010061538 Pituitary tumour benign Diseases 0.000 description 1
- 208000007452 Plasmacytoma Diseases 0.000 description 1
- 101100306008 Plasmodium falciparum (isolate CDC / Honduras) RPII gene Proteins 0.000 description 1
- 102100027932 Platelet-activating factor acetylhydrolase 2, cytoplasmic Human genes 0.000 description 1
- 102100029367 Pleckstrin homology domain-containing family A member 8 Human genes 0.000 description 1
- 101100146539 Podospora anserina RPS15 gene Proteins 0.000 description 1
- 108010061844 Poly(ADP-ribose) Polymerases Proteins 0.000 description 1
- 102000012338 Poly(ADP-ribose) Polymerases Human genes 0.000 description 1
- 102100020947 Polypeptide N-acetylgalactosaminyltransferase 1 Human genes 0.000 description 1
- 102100023209 Polypeptide N-acetylgalactosaminyltransferase 13 Human genes 0.000 description 1
- 102100023208 Polypeptide N-acetylgalactosaminyltransferase 14 Human genes 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- 101150104557 Ppargc1a gene Proteins 0.000 description 1
- 102100028693 Probable C-mannosyltransferase DPY19L1 Human genes 0.000 description 1
- 102100034734 Proline-rich protein 5-like Human genes 0.000 description 1
- 108700003766 Promyelocytic Leukemia Zinc Finger Proteins 0.000 description 1
- 102100035703 Prostatic acid phosphatase Human genes 0.000 description 1
- 102100034514 Protein FAM72A Human genes 0.000 description 1
- 102100034519 Protein FAM72D Human genes 0.000 description 1
- 102100025428 Protein ZNF365 Human genes 0.000 description 1
- 102100028680 Protein patched homolog 1 Human genes 0.000 description 1
- 102100030927 Protein shisa-like-1 Human genes 0.000 description 1
- 102100040878 Protocadherin alpha-C2 Human genes 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- 238000001190 Q-PCR Methods 0.000 description 1
- 102000001195 RAD51 Human genes 0.000 description 1
- 102100026872 RNA-binding E3 ubiquitin-protein ligase MEX3C Human genes 0.000 description 1
- 108010068097 Rad51 Recombinase Proteins 0.000 description 1
- 102100021327 Refilin-B Human genes 0.000 description 1
- 102100025192 Retinoblastoma-binding protein 5 Human genes 0.000 description 1
- 102100020899 Rho GTPase-activating protein 29 Human genes 0.000 description 1
- 108091006594 SLC15A1 Proteins 0.000 description 1
- 108091006692 SLC23A2 Proteins 0.000 description 1
- 108091006411 SLC25A15 Proteins 0.000 description 1
- 108091006505 SLC26A2 Proteins 0.000 description 1
- 108091006546 SLC29A3 Proteins 0.000 description 1
- 108091006549 SLC30A1 Proteins 0.000 description 1
- 108091006941 SLC39A10 Proteins 0.000 description 1
- 108091007570 SLC46A3 Proteins 0.000 description 1
- 108060009345 SORL1 Proteins 0.000 description 1
- 208000004337 Salivary Gland Neoplasms Diseases 0.000 description 1
- 206010061934 Salivary gland cancer Diseases 0.000 description 1
- 102100035899 Secretory carrier-associated membrane protein 4 Human genes 0.000 description 1
- 102100023781 Selenoprotein N Human genes 0.000 description 1
- 102100020814 Sequestosome-1 Human genes 0.000 description 1
- 102100031733 Serine incorporator 2 Human genes 0.000 description 1
- 102100027103 Serine/threonine-protein kinase B-raf Human genes 0.000 description 1
- 102100033329 Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B Human genes 0.000 description 1
- 108010089417 Sex Hormone-Binding Globulin Proteins 0.000 description 1
- 102100030758 Sex hormone-binding globulin Human genes 0.000 description 1
- 102100031976 Short stature homeobox protein 2 Human genes 0.000 description 1
- 102100028886 Sodium- and chloride-dependent glycine transporter 2 Human genes 0.000 description 1
- 102100021491 Solute carrier family 15 member 1 Human genes 0.000 description 1
- 102100034251 Solute carrier family 23 member 1 Human genes 0.000 description 1
- 102100032876 Solute carrier family 46 member 3 Human genes 0.000 description 1
- 102100025639 Sortilin-related receptor Human genes 0.000 description 1
- 102100025747 Sphingosine 1-phosphate receptor 3 Human genes 0.000 description 1
- 102100021684 Stonin-2 Human genes 0.000 description 1
- 102100030113 Sulfate transporter Human genes 0.000 description 1
- 102100020923 Suppressor APC domain-containing protein 2 Human genes 0.000 description 1
- 108700025695 Suppressor Genes Proteins 0.000 description 1
- 102100035600 Synergin gamma Human genes 0.000 description 1
- 230000010782 T cell mediated cytotoxicity Effects 0.000 description 1
- 102100036833 T-box transcription factor TBX20 Human genes 0.000 description 1
- 208000000389 T-cell leukemia Diseases 0.000 description 1
- 208000028530 T-cell lymphoblastic leukemia/lymphoma Diseases 0.000 description 1
- 206010042971 T-cell lymphoma Diseases 0.000 description 1
- 208000027585 T-cell non-Hodgkin lymphoma Diseases 0.000 description 1
- 102100022608 TOX high mobility group box family member 3 Human genes 0.000 description 1
- 101150006914 TRP1 gene Proteins 0.000 description 1
- 208000024313 Testicular Neoplasms Diseases 0.000 description 1
- 206010057644 Testis cancer Diseases 0.000 description 1
- RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical group OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 description 1
- 108091036066 Three prime untranslated region Proteins 0.000 description 1
- 102100035097 Transcription factor 7-like 1 Human genes 0.000 description 1
- 102100026385 Transcription factor Ovo-like 2 Human genes 0.000 description 1
- 102100031873 Transcriptional coactivator YAP1 Human genes 0.000 description 1
- 102100026222 Transmembrane gamma-carboxyglutamic acid protein 4 Human genes 0.000 description 1
- 102100029732 Transmembrane protein 180 Human genes 0.000 description 1
- 102100031992 Transmembrane protein with metallophosphoesterase domain Human genes 0.000 description 1
- LVTKHGUGBGNBPL-UHFFFAOYSA-N Trp-P-1 Chemical compound N1C2=CC=CC=C2C2=C1C(C)=C(N)N=C2C LVTKHGUGBGNBPL-UHFFFAOYSA-N 0.000 description 1
- 102000004243 Tubulin Human genes 0.000 description 1
- 108090000704 Tubulin Proteins 0.000 description 1
- 102100039094 Tyrosinase Human genes 0.000 description 1
- 108060008724 Tyrosinase Proteins 0.000 description 1
- 102100027243 U4/U6.U5 tri-snRNP-associated protein 2 Human genes 0.000 description 1
- 102100024742 UNC5C-like protein Human genes 0.000 description 1
- 102100024843 Ubiquitin/ISG15-conjugating enzyme E2 L6 Human genes 0.000 description 1
- 102100037111 Uracil-DNA glycosylase Human genes 0.000 description 1
- 101710160987 Uracil-DNA glycosylase Proteins 0.000 description 1
- 102100033476 V-type proton ATPase subunit B, brain isoform Human genes 0.000 description 1
- 101800003344 Vaccinia growth factor Proteins 0.000 description 1
- 101800001863 Variola growth factor Proteins 0.000 description 1
- 102100035071 Vimentin Human genes 0.000 description 1
- 108010065472 Vimentin Proteins 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- 206010047741 Vulval cancer Diseases 0.000 description 1
- 102100029471 WD repeat and FYVE domain-containing protein 2 Human genes 0.000 description 1
- 102100036550 WD repeat-containing protein 82 Human genes 0.000 description 1
- 102100028212 WD repeat-containing protein 97 Human genes 0.000 description 1
- 102100026457 Zinc finger E-box-binding homeobox 1 Human genes 0.000 description 1
- 102100028458 Zinc finger E-box-binding homeobox 2 Human genes 0.000 description 1
- 102100034655 Zinc finger SWIM domain-containing protein 5 Human genes 0.000 description 1
- 102100040314 Zinc finger and BTB domain-containing protein 16 Human genes 0.000 description 1
- 101710185494 Zinc finger protein Proteins 0.000 description 1
- 102100036647 Zinc finger protein 512B Human genes 0.000 description 1
- 102100023597 Zinc finger protein 816 Human genes 0.000 description 1
- 102100036296 Zinc finger protein DPF3 Human genes 0.000 description 1
- 102100030917 Zinc finger protein SNAI1 Human genes 0.000 description 1
- 102100034993 Zinc transporter 1 Human genes 0.000 description 1
- 102100035243 Zinc transporter ZIP10 Human genes 0.000 description 1
- 208000037833 acute lymphoblastic T-cell leukemia Diseases 0.000 description 1
- 208000013593 acute megakaryoblastic leukemia Diseases 0.000 description 1
- 208000020700 acute megakaryocytic leukemia Diseases 0.000 description 1
- UDMBCSSLTHHNCD-KQYNXXCUSA-N adenosine 5'-monophosphate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O UDMBCSSLTHHNCD-KQYNXXCUSA-N 0.000 description 1
- LNQVTSROQXJCDD-UHFFFAOYSA-N adenosine monophosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(CO)C(OP(O)(O)=O)C1O LNQVTSROQXJCDD-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 208000007502 anemia Diseases 0.000 description 1
- 208000036878 aneuploidy Diseases 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 230000000118 anti-neoplastic effect Effects 0.000 description 1
- 230000005809 anti-tumor immunity Effects 0.000 description 1
- 238000003782 apoptosis assay Methods 0.000 description 1
- METKIMKYRPQLGS-UHFFFAOYSA-N atenolol Chemical compound CC(C)NCC(O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000004900 autophagic degradation Effects 0.000 description 1
- 230000006399 behavior Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 210000001124 body fluid Anatomy 0.000 description 1
- 239000010839 body fluid Substances 0.000 description 1
- 201000011143 bone giant cell tumor Diseases 0.000 description 1
- GXJABQQUPOEUTA-RDJZCZTQSA-N bortezomib Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)B(O)O)NC(=O)C=1N=CC=NC=1)C1=CC=CC=C1 GXJABQQUPOEUTA-RDJZCZTQSA-N 0.000 description 1
- 229960001467 bortezomib Drugs 0.000 description 1
- 230000004712 cancer cell adhesion Effects 0.000 description 1
- 230000009702 cancer cell proliferation Effects 0.000 description 1
- 230000000711 cancerogenic effect Effects 0.000 description 1
- 231100000357 carcinogen Toxicity 0.000 description 1
- 239000003183 carcinogenic agent Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 230000024245 cell differentiation Effects 0.000 description 1
- 230000032823 cell division Effects 0.000 description 1
- 230000003915 cell function Effects 0.000 description 1
- 230000033077 cellular process Effects 0.000 description 1
- 230000005754 cellular signaling Effects 0.000 description 1
- 210000002230 centromere Anatomy 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- JCKYGMPEJWAADB-UHFFFAOYSA-N chlorambucil Chemical compound OC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 JCKYGMPEJWAADB-UHFFFAOYSA-N 0.000 description 1
- 229960004630 chlorambucil Drugs 0.000 description 1
- 208000006990 cholangiocarcinoma Diseases 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 230000002759 chromosomal effect Effects 0.000 description 1
- 210000000349 chromosome Anatomy 0.000 description 1
- 230000021572 chromosome movement towards spindle pole Effects 0.000 description 1
- 230000024321 chromosome segregation Effects 0.000 description 1
- 208000032852 chronic lymphocytic leukemia Diseases 0.000 description 1
- 201000010903 chronic neutrophilic leukemia Diseases 0.000 description 1
- 229960002436 cladribine Drugs 0.000 description 1
- 238000010367 cloning Methods 0.000 description 1
- 230000021615 conjugation Effects 0.000 description 1
- 239000003246 corticosteroid Substances 0.000 description 1
- 229960001334 corticosteroids Drugs 0.000 description 1
- 229940109239 creatinine Drugs 0.000 description 1
- 210000000805 cytoplasm Anatomy 0.000 description 1
- 210000004292 cytoskeleton Anatomy 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 239000005549 deoxyribonucleoside Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 230000005750 disease progression Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000009509 drug development Methods 0.000 description 1
- 108010047482 ectoATPase Proteins 0.000 description 1
- 210000000981 epithelium Anatomy 0.000 description 1
- 201000004101 esophageal cancer Diseases 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 229960005167 everolimus Drugs 0.000 description 1
- 201000005884 exanthem Diseases 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 235000013861 fat-free Nutrition 0.000 description 1
- 206010016256 fatigue Diseases 0.000 description 1
- 229960000390 fludarabine Drugs 0.000 description 1
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 description 1
- 238000001943 fluorescence-activated cell sorting Methods 0.000 description 1
- 201000003444 follicular lymphoma Diseases 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 231100000118 genetic alteration Toxicity 0.000 description 1
- 230000004077 genetic alteration Effects 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000002303 glucose derivatives Chemical class 0.000 description 1
- 201000009277 hairy cell leukemia Diseases 0.000 description 1
- 201000003911 head and neck carcinoma Diseases 0.000 description 1
- 231100000869 headache Toxicity 0.000 description 1
- 201000005787 hematologic cancer Diseases 0.000 description 1
- 230000007236 host immunity Effects 0.000 description 1
- 102000047924 human NR2E3 Human genes 0.000 description 1
- 210000005260 human cell Anatomy 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 208000006575 hypertriglyceridemia Diseases 0.000 description 1
- 210000002865 immune cell Anatomy 0.000 description 1
- 230000000415 inactivating effect Effects 0.000 description 1
- 201000004653 inflammatory breast carcinoma Diseases 0.000 description 1
- 108091008042 inhibitory receptors Proteins 0.000 description 1
- 210000004692 intercellular junction Anatomy 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000002372 labelling Methods 0.000 description 1
- 229960004942 lenalidomide Drugs 0.000 description 1
- GOTYRUGSSMKFNF-UHFFFAOYSA-N lenalidomide Chemical compound C1C=2C(N)=CC=CC=2C(=O)N1C1CCC(=O)NC1=O GOTYRUGSSMKFNF-UHFFFAOYSA-N 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 238000003670 luciferase enzyme activity assay Methods 0.000 description 1
- 210000004698 lymphocyte Anatomy 0.000 description 1
- 239000003120 macrolide antibiotic agent Substances 0.000 description 1
- 210000002540 macrophage Anatomy 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 230000035800 maturation Effects 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000021121 meiosis Effects 0.000 description 1
- 229960001428 mercaptopurine Drugs 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- ONCZDRURRATYFI-QTCHDTBASA-N methyl (2z)-2-methoxyimino-2-[2-[[(e)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetate Chemical compound CO\N=C(/C(=O)OC)C1=CC=CC=C1CO\N=C(/C)C1=CC=CC(C(F)(F)F)=C1 ONCZDRURRATYFI-QTCHDTBASA-N 0.000 description 1
- MMNNTJYFHUDSKL-UHFFFAOYSA-N methyl n-[6-[2-(5-chloro-2-methylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1h-benzimidazol-2-yl]carbamate Chemical compound C=1C=C2NC(NC(=O)OC)=NC2=CC=1C(C1=CC=CC=C1C1=O)(O)N1C1=CC(Cl)=CC=C1C MMNNTJYFHUDSKL-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 238000000386 microscopy Methods 0.000 description 1
- 210000004688 microtubule Anatomy 0.000 description 1
- 238000010232 migration assay Methods 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 230000011278 mitosis Effects 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 230000004899 motility Effects 0.000 description 1
- 238000002703 mutagenesis Methods 0.000 description 1
- 231100000350 mutagenesis Toxicity 0.000 description 1
- 208000025113 myeloid leukemia Diseases 0.000 description 1
- 201000000050 myeloid neoplasm Diseases 0.000 description 1
- 230000008693 nausea Effects 0.000 description 1
- 201000008026 nephroblastoma Diseases 0.000 description 1
- 206010061311 nervous system neoplasm Diseases 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000000174 oncolytic effect Effects 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 201000008968 osteosarcoma Diseases 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 229940121655 pd-1 inhibitor Drugs 0.000 description 1
- 229960002340 pentostatin Drugs 0.000 description 1
- FPVKHBSQESCIEP-JQCXWYLXSA-N pentostatin Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(N=CNC[C@H]2O)=C2N=C1 FPVKHBSQESCIEP-JQCXWYLXSA-N 0.000 description 1
- 210000005259 peripheral blood Anatomy 0.000 description 1
- 239000011886 peripheral blood Substances 0.000 description 1
- RLZZZVKAURTHCP-UHFFFAOYSA-N phenanthrene-3,4-diol Chemical compound C1=CC=C2C3=C(O)C(O)=CC=C3C=CC2=C1 RLZZZVKAURTHCP-UHFFFAOYSA-N 0.000 description 1
- 102000020233 phosphotransferase Human genes 0.000 description 1
- 208000021310 pituitary gland adenoma Diseases 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 1
- 238000010837 poor prognosis Methods 0.000 description 1
- 230000008092 positive effect Effects 0.000 description 1
- 238000002600 positron emission tomography Methods 0.000 description 1
- 229960005205 prednisolone Drugs 0.000 description 1
- OIGNJSKKLXVSLS-VWUMJDOOSA-N prednisolone Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OIGNJSKKLXVSLS-VWUMJDOOSA-N 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000005522 programmed cell death Effects 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 201000002025 prostate sarcoma Diseases 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000010814 radioimmunoprecipitation assay Methods 0.000 description 1
- 229940099538 rapamune Drugs 0.000 description 1
- 206010037844 rash Diseases 0.000 description 1
- 102000027426 receptor tyrosine kinases Human genes 0.000 description 1
- 108091008598 receptor tyrosine kinases Proteins 0.000 description 1
- 230000022983 regulation of cell cycle Effects 0.000 description 1
- 201000010174 renal carcinoma Diseases 0.000 description 1
- 230000008439 repair process Effects 0.000 description 1
- 230000008672 reprogramming Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 201000009410 rhabdomyosarcoma Diseases 0.000 description 1
- 239000002342 ribonucleoside Substances 0.000 description 1
- 239000002336 ribonucleotide Substances 0.000 description 1
- 229960004641 rituximab Drugs 0.000 description 1
- 238000011519 second-line treatment Methods 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- 201000000849 skin cancer Diseases 0.000 description 1
- 231100000046 skin rash Toxicity 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 238000002415 sodium dodecyl sulfate polyacrylamide gel electrophoresis Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 102100020794 tRNA wybutosine-synthesizing protein 3 homolog Human genes 0.000 description 1
- 230000008685 targeting Effects 0.000 description 1
- 229960005311 telbivudine Drugs 0.000 description 1
- 201000003120 testicular cancer Diseases 0.000 description 1
- 206010043554 thrombocytopenia Diseases 0.000 description 1
- 238000004324 time-proportional phase incrementation Methods 0.000 description 1
- 230000002103 transcriptional effect Effects 0.000 description 1
- 230000037426 transcriptional repression Effects 0.000 description 1
- 108091006107 transcriptional repressors Proteins 0.000 description 1
- 238000001890 transfection Methods 0.000 description 1
- 206010044412 transitional cell carcinoma Diseases 0.000 description 1
- 239000003656 tris buffered saline Substances 0.000 description 1
- 230000005909 tumor killing Effects 0.000 description 1
- 241000701161 unidentified adenovirus Species 0.000 description 1
- 241001529453 unidentified herpesvirus Species 0.000 description 1
- 241001430294 unidentified retrovirus Species 0.000 description 1
- 229940035893 uracil Drugs 0.000 description 1
- 208000019206 urinary tract infection Diseases 0.000 description 1
- 210000005048 vimentin Anatomy 0.000 description 1
- 239000013603 viral vector Substances 0.000 description 1
- 201000005102 vulva cancer Diseases 0.000 description 1
- 229940034727 zelboraf Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N15/00—Mutation or genetic engineering; DNA or RNA concerning genetic engineering, vectors, e.g. plasmids, or their isolation, preparation or purification; Use of hosts therefor
- C12N15/09—Recombinant DNA-technology
- C12N15/11—DNA or RNA fragments; Modified forms thereof; Non-coding nucleic acids having a biological activity
- C12N15/113—Non-coding nucleic acids modulating the expression of genes, e.g. antisense oligonucleotides; Antisense DNA or RNA; Triplex- forming oligonucleotides; Catalytic nucleic acids, e.g. ribozymes; Nucleic acids used in co-suppression or gene silencing
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K45/00—Medicinal preparations containing active ingredients not provided for in groups A61K31/00 - A61K41/00
- A61K45/06—Mixtures of active ingredients without chemical characterisation, e.g. antiphlogistics and cardiaca
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2310/00—Structure or type of the nucleic acid
- C12N2310/10—Type of nucleic acid
- C12N2310/14—Type of nucleic acid interfering nucleic acids [NA]
- C12N2310/141—MicroRNAs, miRNAs
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N2320/00—Applications; Uses
- C12N2320/30—Special therapeutic applications
- C12N2320/31—Combination therapy
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Genetics & Genomics (AREA)
- Chemical & Material Sciences (AREA)
- Biomedical Technology (AREA)
- Organic Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Biotechnology (AREA)
- General Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Zoology (AREA)
- Wood Science & Technology (AREA)
- Animal Behavior & Ethology (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Physics & Mathematics (AREA)
- Biochemistry (AREA)
- Plant Pathology (AREA)
- Biophysics (AREA)
- Microbiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Micro-Organisms Or Cultivation Processes Thereof (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP19191222 | 2019-08-12 | ||
| EP19191222.9 | 2019-08-12 | ||
| EP20160235.6 | 2020-02-28 | ||
| EP20160235 | 2020-02-28 | ||
| PCT/EP2020/055965 WO2021028081A1 (en) | 2019-08-12 | 2020-03-06 | New treatments involving mirna-193a |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA3148713A1 true CA3148713A1 (en) | 2021-02-18 |
Family
ID=69701219
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA3148713A Pending CA3148713A1 (en) | 2019-08-12 | 2020-03-06 | New treatments involving mirna-193a |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US20220275368A1 (enExample) |
| EP (1) | EP4013869A1 (enExample) |
| JP (1) | JP2022543555A (enExample) |
| CN (1) | CN114729358A (enExample) |
| AU (1) | AU2020327537A1 (enExample) |
| CA (1) | CA3148713A1 (enExample) |
| WO (1) | WO2021028081A1 (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP3976058A4 (en) * | 2019-06-03 | 2023-07-19 | Carmel-Haifa University Economic Corporation Ltd. | TREATMENT OF HEAD AND NECK CANCER IN HUMAN |
| AU2020327537A1 (en) * | 2019-08-12 | 2022-03-03 | Interna Technologies B.V. | New treatments involving miRNA-193a |
| CN114672558B (zh) * | 2021-12-29 | 2023-08-04 | 河北医科大学第三医院 | 肝癌药物仑伐替尼耐药机制的研究方法 |
| CN118678969A (zh) * | 2022-02-22 | 2024-09-20 | 株式会社食物流变功能研究所 | 抗癌剂及抗癌剂的筛选方法 |
| US20250333732A1 (en) * | 2022-05-23 | 2025-10-30 | Empirico Inc. | Treatment of sos2 related diseases and disorders |
| CN116850289B (zh) * | 2022-07-29 | 2025-10-28 | 东北大学 | Plk4靶向药物在治疗对铂类药物耐药型肿瘤中的应用 |
| CN117144008B (zh) * | 2023-08-31 | 2024-03-08 | 武汉科技大学 | 三阴性乳腺癌生物标志物及其应用 |
| WO2025111565A1 (en) * | 2023-11-22 | 2025-05-30 | Empirico Inc. | Treatment of sos2 related diseases and disorders |
| WO2025155574A1 (en) * | 2024-01-16 | 2025-07-24 | University Of Houston System, Board Of Regents | Modulation of akap12 signalosome |
| CN118671343B (zh) * | 2024-06-25 | 2025-04-29 | 南昌大学第一附属医院 | 一种头颈鳞状细胞癌分子标记物及其应用 |
| WO2026013165A1 (en) * | 2024-07-10 | 2026-01-15 | Université Libre de Bruxelles | Combination of ship2 inhibitor and plk1 inhibitor for use in the treatment of cancer |
| CN118987030B (zh) * | 2024-07-16 | 2025-05-30 | 广东医科大学附属医院 | 干预嗜碱性粒细胞exosc3在制备预防或治疗狼疮性肾炎药物中的应用 |
| CN119015428B (zh) * | 2024-10-29 | 2024-12-20 | 中国人民解放军总医院第三医学中心 | 一种敲低tmem91诱导肾癌细胞死亡和肿瘤免疫治疗肾癌的应用 |
| CN120989248B (zh) * | 2025-10-23 | 2025-12-23 | 山东第二医科大学 | 一种检测lncRNA标志物表达量的试剂在制备口腔鳞状细胞癌诊断产品或预后判断产品中的应用 |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2000000388A2 (en) | 1998-05-15 | 2000-01-06 | Tcs Engineering Services, Inc. | Enhanced aircraft cockpit configuration |
| US7220410B2 (en) | 2003-04-18 | 2007-05-22 | Galaxy Biotech, Llc | Monoclonal antibodies to hepatocyte growth factor |
| TWI476206B (zh) | 2003-07-18 | 2015-03-11 | Amgen Inc | 對肝細胞生長因子具專一性之結合劑 |
| FR2872704B1 (fr) | 2004-07-12 | 2007-11-02 | Laurent Schwartz | Pluritherapie contre le cancer |
| AR059922A1 (es) | 2006-04-01 | 2008-05-07 | Galaxy Biotech Llc | Anticuerpos monoclonales humanizados para el factor de crecimiento de hepatocitos |
| AU2007254853B2 (en) | 2006-06-02 | 2011-11-17 | Aveo Pharmaceuticals, Inc. | Hepatocyte growth factor (HGF) binding proteins |
| US7649083B2 (en) | 2006-06-02 | 2010-01-19 | Aveo Pharmaceuticals, Inc. | Hepatocyte growth factor (HGF) binding antibody |
| WO2008010558A1 (en) | 2006-07-20 | 2008-01-24 | Panasonic Corporation | Ultrasonic probe |
| WO2009091982A1 (en) | 2008-01-18 | 2009-07-23 | Alnylam Pharmaceuticals, Inc. | Mir-122 agonist |
| TW200948380A (en) | 2008-04-11 | 2009-12-01 | Galaxy Biotech Llc | Combination of HGF inhibitor and PTEN agonist to treat cancer |
| EP2591106A1 (en) * | 2010-07-06 | 2013-05-15 | InteRNA Technologies B.V. | Mirna and its diagnostic and therapeutic uses in diseases or conditions associated with melanoma, or in diseases or conditions associated with activated braf pathway |
| US8691750B2 (en) | 2011-05-17 | 2014-04-08 | Axolabs Gmbh | Lipids and compositions for intracellular delivery of biologically active compounds |
| EP3369818B1 (en) | 2011-12-22 | 2021-06-09 | InteRNA Technologies B.V. | Mirna for treating head and neck cancer |
| US20160193252A1 (en) * | 2013-08-14 | 2016-07-07 | Reneuron Limited | STEM CELL MICROPARTICLES AND miRNA |
| US11446398B2 (en) * | 2016-04-11 | 2022-09-20 | Obsidian Therapeutics, Inc. | Regulated biocircuit systems |
| WO2019106605A1 (en) | 2017-12-01 | 2019-06-06 | Board Of Regents, The University Of Texas System | Combination treatment for cancer |
| JP2021513508A (ja) * | 2018-02-12 | 2021-05-27 | インテアールエヌエー テクノロジーズ ビー.ヴイ.InteRNA Technologies B.V. | 抗がんマイクロrna及びその脂質製剤 |
| AU2020327537A1 (en) * | 2019-08-12 | 2022-03-03 | Interna Technologies B.V. | New treatments involving miRNA-193a |
| CN115461461A (zh) * | 2020-02-28 | 2022-12-09 | 因特尔纳技术有限公司 | 用于促进免疫原性细胞死亡的miRNA-193a |
-
2020
- 2020-03-06 AU AU2020327537A patent/AU2020327537A1/en not_active Abandoned
- 2020-03-06 US US17/630,457 patent/US20220275368A1/en not_active Abandoned
- 2020-03-06 CN CN202080070230.9A patent/CN114729358A/zh active Pending
- 2020-03-06 EP EP20707290.1A patent/EP4013869A1/en not_active Withdrawn
- 2020-03-06 WO PCT/EP2020/055965 patent/WO2021028081A1/en not_active Ceased
- 2020-03-06 JP JP2022505487A patent/JP2022543555A/ja active Pending
- 2020-03-06 CA CA3148713A patent/CA3148713A1/en active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| WO2021028081A1 (en) | 2021-02-18 |
| AU2020327537A1 (en) | 2022-03-03 |
| EP4013869A1 (en) | 2022-06-22 |
| US20220275368A1 (en) | 2022-09-01 |
| CN114729358A (zh) | 2022-07-08 |
| JP2022543555A (ja) | 2022-10-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US20220275368A1 (en) | New treatments involving mirna-193a | |
| Lopez-Otin et al. | Meta-hallmarks of aging and cancer | |
| Chen et al. | Cell cycle checkpoints cooperate to suppress DNA-and RNA-associated molecular pattern recognition and anti-tumor immune responses | |
| Limagne et al. | MEK inhibition overcomes chemoimmunotherapy resistance by inducing CXCL10 in cancer cells | |
| Gozuacik et al. | Autophagy-regulating microRNAs and cancer | |
| Zarredar et al. | Critical microRNAs in lung cancer: recent advances and potential applications | |
| US20170268001A1 (en) | Rnas with tumor radio/chemo-sensitizing and immunomodulatory properties and methods of their preparation and application | |
| KR20150139537A (ko) | 수지상 세포의 반응 유전자 발현, 물질의 조성물 및 이의 사용 방법 | |
| US10876115B2 (en) | Method for assaying MicroRNA, cancer therapeutic agent, and medical composition containing same for cancer therapy | |
| US20240009223A1 (en) | 6-thio-2'-deoxyguanosine (6-thio-dg) results in telomerase dependent telomere dysfunction and cell death in various models of therapy-resistant cancer cells | |
| Li et al. | Aurora A kinase inhibition induces accumulation of SCLC tumor cells in mitosis with restored interferon signaling to increase response to PD-L1 | |
| Hu et al. | Nanoparticle-enhanced proton beam immunoradiotherapy drives immune activation and durable tumor rejection | |
| Alshahrani et al. | Metabolic reprogramming by miRNAs in the tumor microenvironment: Focused on immunometabolism | |
| Huang et al. | Therapeutic targeting of non-oncogene dependencies in high-risk neuroblastoma | |
| CA3096930A1 (en) | Mirnas for treatment and in vitro diagnosis of drug resistant tumors | |
| Stankevicius et al. | Gene and miRNA expression profiles of mouse Lewis lung carcinoma LLC1 cells following single or fractionated dose irradiation | |
| US20230136088A1 (en) | miRNA-193a for Promoting Immunogenic Cell Death | |
| Sweet-Cordero et al. | The CLCF1-CNTFR axis drives an immunosuppressive tumor microenvironment and blockade enhances the effects of established cancer therapies | |
| Azizi et al. | Investigating the potential role of miR-451a as a tumor suppressor in immunogenic cell death induction and dendritic cell maturation in colorectal cancer cell lines | |
| Berezovsky | Platelet Derived Growth Factor Receptor Alpha (PDGFRA) Oncogene Dependency in Glioblastoma | |
| US11642362B2 (en) | Methods of inhibiting cell proliferation and METTL8 activity | |
| Zhao et al. | Dysregulation of B7 family | |
| US12173039B1 (en) | TPL2 inhibiting agents, uses thereof, and detection of TPL2 | |
| Buzzetti | Mechanisms of medulloblastoma vulnerability and new targeted therapies | |
| Leonardi | Study of molecular pathways modulating autophagy in lung tumor cells and their impact on NSCLC tumor progression |