CA2741667A1 - Antimicrobial n-chlorinated compositions - Google Patents
Antimicrobial n-chlorinated compositions Download PDFInfo
- Publication number
- CA2741667A1 CA2741667A1 CA2741667A CA2741667A CA2741667A1 CA 2741667 A1 CA2741667 A1 CA 2741667A1 CA 2741667 A CA2741667 A CA 2741667A CA 2741667 A CA2741667 A CA 2741667A CA 2741667 A1 CA2741667 A1 CA 2741667A1
- Authority
- CA
- Canada
- Prior art keywords
- chloride
- dichloroamino
- chloroamino
- methylbutyl
- ammonium chloride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 140
- 230000000845 anti-microbial effect Effects 0.000 title claims description 13
- 150000003839 salts Chemical class 0.000 claims abstract description 50
- 238000000034 method Methods 0.000 claims abstract description 31
- 239000004599 antimicrobial Substances 0.000 claims abstract description 8
- 239000000243 solution Substances 0.000 claims description 245
- 150000001875 compounds Chemical class 0.000 claims description 244
- 229910052757 nitrogen Inorganic materials 0.000 claims description 218
- 239000000725 suspension Substances 0.000 claims description 193
- 239000007787 solid Substances 0.000 claims description 186
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 154
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 137
- -1 3-(chloroamino)-3-methylbutyl Chemical group 0.000 claims description 108
- 229910052739 hydrogen Inorganic materials 0.000 claims description 61
- 125000000217 alkyl group Chemical group 0.000 claims description 56
- 125000003118 aryl group Chemical group 0.000 claims description 55
- 125000001072 heteroaryl group Chemical group 0.000 claims description 48
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 48
- 239000001257 hydrogen Substances 0.000 claims description 48
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 44
- 125000004404 heteroalkyl group Chemical group 0.000 claims description 33
- 208000015181 infectious disease Diseases 0.000 claims description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims description 22
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 22
- 239000006071 cream Substances 0.000 claims description 21
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 21
- 125000004429 atom Chemical group 0.000 claims description 20
- 150000002500 ions Chemical class 0.000 claims description 20
- 229910052801 chlorine Inorganic materials 0.000 claims description 19
- 230000000813 microbial effect Effects 0.000 claims description 18
- 229910052794 bromium Inorganic materials 0.000 claims description 14
- 229910052799 carbon Inorganic materials 0.000 claims description 14
- 239000000839 emulsion Substances 0.000 claims description 12
- 239000000843 powder Substances 0.000 claims description 12
- 239000000499 gel Substances 0.000 claims description 10
- 229910052698 phosphorus Inorganic materials 0.000 claims description 10
- 239000006210 lotion Substances 0.000 claims description 9
- 239000006072 paste Substances 0.000 claims description 8
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 7
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 7
- 229910052717 sulfur Inorganic materials 0.000 claims description 7
- 239000003937 drug carrier Substances 0.000 claims description 6
- 210000004400 mucous membrane Anatomy 0.000 claims description 6
- KPQXDCFELNBGME-UHFFFAOYSA-M n,n-dichloro-2-methyl-1-(4-methylmorpholin-4-ium-4-yl)propan-2-amine;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)C[N+]1(C)CCOCC1 KPQXDCFELNBGME-UHFFFAOYSA-M 0.000 claims description 6
- SOMPTWPVLIXLKQ-UHFFFAOYSA-M 2-(1-methylpiperidin-1-ium-1-yl)ethyl 3-(dichloroamino)-3-methylbutanoate;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CC(=O)OCC[N+]1(C)CCCCC1 SOMPTWPVLIXLKQ-UHFFFAOYSA-M 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- LVUGKWGVVMYQSW-UHFFFAOYSA-M 1-[4-[2-(dichloroamino)-2-methylpropyl]-4-methylpiperazin-4-ium-1-yl]ethanone;chloride Chemical compound [Cl-].CC(=O)N1CC[N+](C)(CC(C)(C)N(Cl)Cl)CC1 LVUGKWGVVMYQSW-UHFFFAOYSA-M 0.000 claims description 4
- VMOFIUDZRYATRG-UHFFFAOYSA-M 2-[4-[2-(dichloroamino)propan-2-yl]triazol-1-yl]ethyl-trimethylazanium;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)C1=CN(CC[N+](C)(C)C)N=N1 VMOFIUDZRYATRG-UHFFFAOYSA-M 0.000 claims description 4
- ZCOWIFNURMQKJU-UHFFFAOYSA-M [2-(dichloroamino)-2-methylpropyl]-dimethylsulfanium;chloride Chemical compound [Cl-].C[S+](C)CC(C)(C)N(Cl)Cl ZCOWIFNURMQKJU-UHFFFAOYSA-M 0.000 claims description 4
- 239000000443 aerosol Substances 0.000 claims description 4
- GWIUGRDUEQIQFY-UHFFFAOYSA-M n,n-dichloro-2-methyl-1-(1-methylpiperidin-1-ium-1-yl)propan-2-amine;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)C[N+]1(C)CCCCC1 GWIUGRDUEQIQFY-UHFFFAOYSA-M 0.000 claims description 4
- LZUZTPFINSGXOC-UHFFFAOYSA-M n,n-dichloro-2-methyl-4-(1,4,4-trimethylpiperidin-1-ium-1-yl)butan-2-amine;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CC[N+]1(C)CCC(C)(C)CC1 LZUZTPFINSGXOC-UHFFFAOYSA-M 0.000 claims description 4
- IOQNJOJBJMUHOU-UHFFFAOYSA-M n,n-dichloro-2-methyl-4-(1-methylazepan-1-ium-1-yl)butan-2-amine;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CC[N+]1(C)CCCCCC1 IOQNJOJBJMUHOU-UHFFFAOYSA-M 0.000 claims description 4
- BOPJCCASSPUXJK-UHFFFAOYSA-M n,n-dichloro-4-(4,4-difluoro-1-methylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CC[N+]1(C)CCC(F)(F)CC1 BOPJCCASSPUXJK-UHFFFAOYSA-M 0.000 claims description 4
- 239000002674 ointment Substances 0.000 claims description 4
- 230000029058 respiratory gaseous exchange Effects 0.000 claims description 4
- GYMMBUJBHHKGIU-UHFFFAOYSA-M 2-[4-[2-(chloroamino)propan-2-yl]triazol-1-yl]ethyl-trimethylazanium;chloride Chemical compound [Cl-].ClNC(C)(C)C1=CN(CC[N+](C)(C)C)N=N1 GYMMBUJBHHKGIU-UHFFFAOYSA-M 0.000 claims description 3
- YSKRJBAMULWUJP-UHFFFAOYSA-N 3-[1-(chloroamino)cyclohexyl]propyl-trimethylazanium Chemical compound C[N+](C)(C)CCCC1(NCl)CCCCC1 YSKRJBAMULWUJP-UHFFFAOYSA-N 0.000 claims description 3
- OFFRIFGMYLGRSS-UHFFFAOYSA-M 4-(1-azoniabicyclo[2.2.2]octan-1-yl)-n,n-dichloro-2-methylbutan-2-amine;methanesulfonate Chemical compound CS([O-])(=O)=O.C1CC2CC[N+]1(CCC(C)(C)N(Cl)Cl)CC2 OFFRIFGMYLGRSS-UHFFFAOYSA-M 0.000 claims description 3
- ZVJWWOBMZRNVSX-UHFFFAOYSA-M [3-(chloroamino)-3-methylbutyl]-(3-fluorophenyl)-dimethylazanium;chloride Chemical compound [Cl-].ClNC(C)(C)CC[N+](C)(C)C1=CC=CC(F)=C1 ZVJWWOBMZRNVSX-UHFFFAOYSA-M 0.000 claims description 3
- DEMXNHBOCAWHNN-UHFFFAOYSA-M [3-(chloroamino)-3-methylbutyl]-dimethylsulfanium;chloride Chemical compound [Cl-].C[S+](C)CCC(C)(C)NCl DEMXNHBOCAWHNN-UHFFFAOYSA-M 0.000 claims description 3
- OKDIYPHBJZLDAJ-UHFFFAOYSA-M [3-(chloroamino)-3-methylbutyl]-trimethylphosphanium;chloride Chemical compound [Cl-].ClNC(C)(C)CC[P+](C)(C)C OKDIYPHBJZLDAJ-UHFFFAOYSA-M 0.000 claims description 3
- GXQIEAGJYKTDKP-UHFFFAOYSA-N [4-(chloroamino)-4-propylheptyl]-trimethylazanium Chemical compound CCCC(CCC)(NCl)CCC[N+](C)(C)C GXQIEAGJYKTDKP-UHFFFAOYSA-N 0.000 claims description 3
- AXRFRMUBAWDOHG-UHFFFAOYSA-M [4-(dichloroamino)-4-methylpentyl]-trimethylphosphanium;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CCC[P+](C)(C)C AXRFRMUBAWDOHG-UHFFFAOYSA-M 0.000 claims description 3
- XLKGTTMXFXLSQF-UHFFFAOYSA-N [4-(dichloroamino)-4-propylheptyl]-trimethylazanium Chemical compound CCCC(CCC)(N(Cl)Cl)CCC[N+](C)(C)C XLKGTTMXFXLSQF-UHFFFAOYSA-N 0.000 claims description 3
- 230000000249 desinfective effect Effects 0.000 claims description 3
- JQILRJNCGLBMHZ-UHFFFAOYSA-M n,n-dichloro-2-methyl-4-(1-methylpyrrolidin-1-ium-1-yl)butan-2-amine;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CC[N+]1(C)CCCC1 JQILRJNCGLBMHZ-UHFFFAOYSA-M 0.000 claims description 3
- RUWVTHNZUNILSN-UHFFFAOYSA-M n-chloro-2-methyl-4-pyridin-1-ium-1-ylbutan-2-amine;chloride Chemical compound [Cl-].ClNC(C)(C)CC[N+]1=CC=CC=C1 RUWVTHNZUNILSN-UHFFFAOYSA-M 0.000 claims description 3
- 239000004053 dental implant Substances 0.000 claims description 2
- 239000000082 organ preservation Substances 0.000 claims description 2
- 210000002345 respiratory system Anatomy 0.000 claims description 2
- BMYXRDWPFUUMAW-UHFFFAOYSA-M [6-(dichloroamino)-4-hydroxy-6-methylheptyl]-trimethylazanium;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CC(O)CCC[N+](C)(C)C BMYXRDWPFUUMAW-UHFFFAOYSA-M 0.000 claims 2
- QTDDBOJSIZFCCW-UHFFFAOYSA-M n,n-dichloro-2-methyl-4-pyridin-1-ium-1-ylbutan-2-amine;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CC[N+]1=CC=CC=C1 QTDDBOJSIZFCCW-UHFFFAOYSA-M 0.000 claims 2
- HGAAUVBGQAGHDS-UHFFFAOYSA-M 1-[4-[2-(chloroamino)-2-methylpropyl]-4-methylpiperazin-4-ium-1-yl]ethanone;chloride Chemical compound [Cl-].CC(=O)N1CC[N+](C)(CC(C)(C)NCl)CC1 HGAAUVBGQAGHDS-UHFFFAOYSA-M 0.000 claims 1
- ROOGHAYNSNLPHN-UHFFFAOYSA-M 2-(1-methylpiperidin-1-ium-1-yl)ethyl 3-(chloroamino)-3-methylbutanoate;chloride Chemical compound [Cl-].ClNC(C)(C)CC(=O)OCC[N+]1(C)CCCCC1 ROOGHAYNSNLPHN-UHFFFAOYSA-M 0.000 claims 1
- MQJGXQZUGDMQIS-UHFFFAOYSA-N 2-[[2-(chloroamino)-2-methylpropyl]-dimethylazaniumyl]ethanesulfonate Chemical compound ClNC(C)(C)C[N+](C)(C)CCS([O-])(=O)=O MQJGXQZUGDMQIS-UHFFFAOYSA-N 0.000 claims 1
- MHDFEGKOSIVMHY-UHFFFAOYSA-N 2-[[2-(dichloroamino)-2-methylpropyl]-dimethylazaniumyl]ethanesulfonate Chemical compound ClN(Cl)C(C)(C)C[N+](C)(C)CCS([O-])(=O)=O MHDFEGKOSIVMHY-UHFFFAOYSA-N 0.000 claims 1
- VVCKIVOMVZVYEZ-UHFFFAOYSA-N 3-[1-(chloroamino)cyclopentyl]propyl-trimethylazanium Chemical compound C[N+](C)(C)CCCC1(NCl)CCCC1 VVCKIVOMVZVYEZ-UHFFFAOYSA-N 0.000 claims 1
- IGWQDLSZEXSYKC-UHFFFAOYSA-N 3-[1-(dichloroamino)cyclohexyl]propyl-trimethylazanium Chemical compound C[N+](C)(C)CCCC1(N(Cl)Cl)CCCCC1 IGWQDLSZEXSYKC-UHFFFAOYSA-N 0.000 claims 1
- HJKLCECPSXTFMP-UHFFFAOYSA-N 3-[1-(dichloroamino)cyclopentyl]propyl-trimethylazanium Chemical compound C[N+](C)(C)CCCC1(N(Cl)Cl)CCCC1 HJKLCECPSXTFMP-UHFFFAOYSA-N 0.000 claims 1
- WXXRALRSVOZVPF-UHFFFAOYSA-M 4-(1-azoniabicyclo[2.2.2]octan-1-yl)-n-chloro-2-methylbutan-2-amine;methanesulfonate Chemical compound CS([O-])(=O)=O.C1CC2CC[N+]1(CCC(C)(C)NCl)CC2 WXXRALRSVOZVPF-UHFFFAOYSA-M 0.000 claims 1
- ZLJAXCLKUOMAKP-UHFFFAOYSA-M [2-(chloroamino)-2-methylpropyl]-(3-fluorophenyl)-dimethylazanium;chloride Chemical compound [Cl-].ClNC(C)(C)C[N+](C)(C)C1=CC=CC(F)=C1 ZLJAXCLKUOMAKP-UHFFFAOYSA-M 0.000 claims 1
- IKSMEWQZHQUKMI-UHFFFAOYSA-M [2-(chloroamino)-2-methylpropyl]-trimethylphosphanium;chloride Chemical compound [Cl-].ClNC(C)(C)C[P+](C)(C)C IKSMEWQZHQUKMI-UHFFFAOYSA-M 0.000 claims 1
- MWKZQMZJZJGZNK-UHFFFAOYSA-M [2-(dichloroamino)-2-methylpropyl]-(3-fluorophenyl)-dimethylazanium;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)C[N+](C)(C)C1=CC=CC(F)=C1 MWKZQMZJZJGZNK-UHFFFAOYSA-M 0.000 claims 1
- UQHOHEWYSKFDSF-UHFFFAOYSA-M [2-(dichloroamino)-2-methylpropyl]-trimethylphosphanium;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)C[P+](C)(C)C UQHOHEWYSKFDSF-UHFFFAOYSA-M 0.000 claims 1
- BAHLGONMYOSODQ-UHFFFAOYSA-M [3-(chloroamino)-3-methylbutyl]-dimethyl-(3,3,3-trifluoropropyl)azanium;chloride Chemical compound [Cl-].ClNC(C)(C)CC[N+](C)(C)CCC(F)(F)F BAHLGONMYOSODQ-UHFFFAOYSA-M 0.000 claims 1
- SESVNIKJCJAPIH-UHFFFAOYSA-M [3-(chloroamino)-3-methylbutyl]-dodecyl-dimethylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)CCC(C)(C)NCl SESVNIKJCJAPIH-UHFFFAOYSA-M 0.000 claims 1
- SVUVQIMSAULGJO-UHFFFAOYSA-M [3-(chloroamino)-3-methylbutyl]-ethyl-dimethylazanium;chloride Chemical compound [Cl-].CC[N+](C)(C)CCC(C)(C)NCl SVUVQIMSAULGJO-UHFFFAOYSA-M 0.000 claims 1
- MZCFFKJRGKYHCO-UHFFFAOYSA-M [3-(chloroamino)-3-methylbutyl]-hexyl-dimethylazanium;chloride Chemical compound [Cl-].CCCCCC[N+](C)(C)CCC(C)(C)NCl MZCFFKJRGKYHCO-UHFFFAOYSA-M 0.000 claims 1
- XWFRLXJWPFPONW-UHFFFAOYSA-M [3-(dichloroamino)-3-methylbutyl]-(3-fluorophenyl)-dimethylazanium;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CC[N+](C)(C)C1=CC=CC(F)=C1 XWFRLXJWPFPONW-UHFFFAOYSA-M 0.000 claims 1
- XIUQMQXEFNRYOC-UHFFFAOYSA-M [3-(dichloroamino)-3-methylbutyl]-dimethyl-(3,3,3-trifluoropropyl)azanium;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CC[N+](C)(C)CCC(F)(F)F XIUQMQXEFNRYOC-UHFFFAOYSA-M 0.000 claims 1
- KBLRUVQWMJXUBL-UHFFFAOYSA-M [3-(dichloroamino)-3-methylbutyl]-dimethylsulfanium;chloride Chemical compound [Cl-].C[S+](C)CCC(C)(C)N(Cl)Cl KBLRUVQWMJXUBL-UHFFFAOYSA-M 0.000 claims 1
- QAWAWLVJBACXTO-UHFFFAOYSA-M [3-(dichloroamino)-3-methylbutyl]-dodecyl-dimethylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)CCC(C)(C)N(Cl)Cl QAWAWLVJBACXTO-UHFFFAOYSA-M 0.000 claims 1
- IJPUUSDBVWHITG-UHFFFAOYSA-M [3-(dichloroamino)-3-methylbutyl]-ethyl-dimethylazanium;chloride Chemical compound [Cl-].CC[N+](C)(C)CCC(C)(C)N(Cl)Cl IJPUUSDBVWHITG-UHFFFAOYSA-M 0.000 claims 1
- WJSRTBBOKZRWGU-UHFFFAOYSA-M [3-(dichloroamino)-3-methylbutyl]-hexyl-dimethylazanium;chloride Chemical compound [Cl-].CCCCCC[N+](C)(C)CCC(C)(C)N(Cl)Cl WJSRTBBOKZRWGU-UHFFFAOYSA-M 0.000 claims 1
- CRZAYEIDVJMNNC-UHFFFAOYSA-M [3-(dichloroamino)-3-methylbutyl]-trimethylphosphanium;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CC[P+](C)(C)C CRZAYEIDVJMNNC-UHFFFAOYSA-M 0.000 claims 1
- ICVCXWDNNTUJIO-UHFFFAOYSA-M [4-(chloroamino)-4-methylpentyl]-trimethylphosphanium;chloride Chemical compound [Cl-].ClNC(C)(C)CCC[P+](C)(C)C ICVCXWDNNTUJIO-UHFFFAOYSA-M 0.000 claims 1
- KBPAHRDAQXEKDT-UHFFFAOYSA-M [5-(chloroamino)-3-hydroxy-5-methylhexyl]-trimethylazanium;chloride Chemical compound [Cl-].ClNC(C)(C)CC(O)CC[N+](C)(C)C KBPAHRDAQXEKDT-UHFFFAOYSA-M 0.000 claims 1
- SUMZYZAOISWYGN-UHFFFAOYSA-M [5-(dichloroamino)-3-hydroxy-5-methylhexyl]-trimethylazanium;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CC(O)CC[N+](C)(C)C SUMZYZAOISWYGN-UHFFFAOYSA-M 0.000 claims 1
- QFAPUQKCUJDUKS-UHFFFAOYSA-M [6-(chloroamino)-4-fluoro-6-methylheptyl]-trimethylazanium;chloride Chemical compound [Cl-].ClNC(C)(C)CC(F)CCC[N+](C)(C)C QFAPUQKCUJDUKS-UHFFFAOYSA-M 0.000 claims 1
- RVYIEGPUNPWWSO-UHFFFAOYSA-M [6-(dichloroamino)-4-fluoro-6-methylheptyl]-trimethylazanium;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CC(F)CCC[N+](C)(C)C RVYIEGPUNPWWSO-UHFFFAOYSA-M 0.000 claims 1
- GVXYYRZMASRTPS-UHFFFAOYSA-N dimethylsulfanium chloride Chemical compound [Cl-].C[SH+]C GVXYYRZMASRTPS-UHFFFAOYSA-N 0.000 claims 1
- AXSBZJUXVPHFJT-UHFFFAOYSA-M n,n-dichloro-2-methyl-4-(1-methylpiperidin-1-ium-1-yl)butan-2-amine;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CC[N+]1(C)CCCCC1 AXSBZJUXVPHFJT-UHFFFAOYSA-M 0.000 claims 1
- CPNKVUSNCFZEEA-UHFFFAOYSA-M n,n-dichloro-2-methyl-4-(4-methylmorpholin-4-ium-4-yl)butan-2-amine;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CC[N+]1(C)CCOCC1 CPNKVUSNCFZEEA-UHFFFAOYSA-M 0.000 claims 1
- PQGHVNAJBSUUIL-UHFFFAOYSA-M n,n-dichloro-2-methyl-5-pyridin-1-ium-1-ylpentan-2-amine;chloride Chemical compound [Cl-].ClN(Cl)C(C)(C)CCC[N+]1=CC=CC=C1 PQGHVNAJBSUUIL-UHFFFAOYSA-M 0.000 claims 1
- SEHPLDLDSGWWRP-UHFFFAOYSA-M n-chloro-2-methyl-1-(1-methylpiperidin-1-ium-1-yl)propan-2-amine;chloride Chemical compound [Cl-].ClNC(C)(C)C[N+]1(C)CCCCC1 SEHPLDLDSGWWRP-UHFFFAOYSA-M 0.000 claims 1
- DRGSVJGJHXNWGM-UHFFFAOYSA-M n-chloro-2-methyl-1-(4-methylmorpholin-4-ium-4-yl)propan-2-amine;chloride Chemical compound [Cl-].ClNC(C)(C)C[N+]1(C)CCOCC1 DRGSVJGJHXNWGM-UHFFFAOYSA-M 0.000 claims 1
- CDWNOKXIWKZSJZ-UHFFFAOYSA-M n-chloro-2-methyl-4-(1,4,4-trimethylpiperidin-1-ium-1-yl)butan-2-amine;chloride Chemical compound [Cl-].ClNC(C)(C)CC[N+]1(C)CCC(C)(C)CC1 CDWNOKXIWKZSJZ-UHFFFAOYSA-M 0.000 claims 1
- UANXUGWCHRDJRK-UHFFFAOYSA-M n-chloro-2-methyl-4-(1-methylazepan-1-ium-1-yl)butan-2-amine;chloride Chemical compound [Cl-].ClNC(C)(C)CC[N+]1(C)CCCCCC1 UANXUGWCHRDJRK-UHFFFAOYSA-M 0.000 claims 1
- KHIJMPPAFXTZBN-UHFFFAOYSA-M n-chloro-2-methyl-4-(1-methylpiperidin-1-ium-1-yl)butan-2-amine;chloride Chemical compound [Cl-].ClNC(C)(C)CC[N+]1(C)CCCCC1 KHIJMPPAFXTZBN-UHFFFAOYSA-M 0.000 claims 1
- YORYNNDOULFLHR-UHFFFAOYSA-M n-chloro-2-methyl-4-(1-methylpyrrolidin-1-ium-1-yl)butan-2-amine;chloride Chemical compound [Cl-].ClNC(C)(C)CC[N+]1(C)CCCC1 YORYNNDOULFLHR-UHFFFAOYSA-M 0.000 claims 1
- HFAHZCBSSBAXKS-UHFFFAOYSA-M n-chloro-2-methyl-4-(4-methylmorpholin-4-ium-4-yl)butan-2-amine;chloride Chemical compound [Cl-].ClNC(C)(C)CC[N+]1(C)CCOCC1 HFAHZCBSSBAXKS-UHFFFAOYSA-M 0.000 claims 1
- SMYCFEODAWBRCO-UHFFFAOYSA-M n-chloro-2-methyl-5-pyridin-1-ium-1-ylpentan-2-amine;chloride Chemical compound [Cl-].ClNC(C)(C)CCC[N+]1=CC=CC=C1 SMYCFEODAWBRCO-UHFFFAOYSA-M 0.000 claims 1
- SHROQRXTRFLCGW-UHFFFAOYSA-M n-chloro-4-(4,4-difluoro-1-methylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine;chloride Chemical compound [Cl-].ClNC(C)(C)CC[N+]1(C)CCC(F)(F)CC1 SHROQRXTRFLCGW-UHFFFAOYSA-M 0.000 claims 1
- 150000001767 cationic compounds Chemical class 0.000 abstract description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 369
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 333
- 238000006243 chemical reaction Methods 0.000 description 244
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 171
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 149
- 239000003921 oil Substances 0.000 description 143
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 141
- 235000019198 oils Nutrition 0.000 description 140
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 100
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 96
- 239000011541 reaction mixture Substances 0.000 description 95
- 238000005160 1H NMR spectroscopy Methods 0.000 description 92
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 88
- 239000000706 filtrate Substances 0.000 description 87
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 81
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 81
- 239000012044 organic layer Substances 0.000 description 73
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 69
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 64
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 60
- 238000003756 stirring Methods 0.000 description 60
- 238000000746 purification Methods 0.000 description 58
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 51
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 51
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 50
- 235000019341 magnesium sulphate Nutrition 0.000 description 50
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 49
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 49
- 101150041968 CDC13 gene Proteins 0.000 description 47
- 229960000583 acetic acid Drugs 0.000 description 46
- 235000002639 sodium chloride Nutrition 0.000 description 44
- 238000005481 NMR spectroscopy Methods 0.000 description 41
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 41
- 239000007788 liquid Substances 0.000 description 41
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 40
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 40
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 38
- 239000000460 chlorine Substances 0.000 description 36
- 230000002829 reductive effect Effects 0.000 description 35
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 34
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 33
- 239000003960 organic solvent Substances 0.000 description 33
- 239000002904 solvent Substances 0.000 description 31
- 239000010779 crude oil Substances 0.000 description 30
- 239000012267 brine Substances 0.000 description 29
- 239000000463 material Substances 0.000 description 29
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 29
- 239000012230 colorless oil Substances 0.000 description 28
- 239000003607 modifier Substances 0.000 description 28
- 238000002835 absorbance Methods 0.000 description 26
- 150000001412 amines Chemical class 0.000 description 25
- 235000019441 ethanol Nutrition 0.000 description 25
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 25
- 229960004132 diethyl ether Drugs 0.000 description 24
- 239000006260 foam Substances 0.000 description 23
- 239000010410 layer Substances 0.000 description 23
- 238000012544 monitoring process Methods 0.000 description 23
- 229910000108 silver(I,III) oxide Inorganic materials 0.000 description 23
- 239000002585 base Substances 0.000 description 22
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 22
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 21
- 229940107816 ammonium iodide Drugs 0.000 description 20
- UTZLYIFQYGQUPA-UHFFFAOYSA-N benzyl 2,5-dioxopyrrolidine-1-carboxylate Chemical compound O=C1CCC(=O)N1C(=O)OCC1=CC=CC=C1 UTZLYIFQYGQUPA-UHFFFAOYSA-N 0.000 description 19
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
- 238000010828 elution Methods 0.000 description 18
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 17
- 239000012280 lithium aluminium hydride Substances 0.000 description 17
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 16
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 16
- 229910052740 iodine Inorganic materials 0.000 description 16
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 16
- WGNJSORDRMBRQO-UHFFFAOYSA-N 3-azido-3-methylbutanoyl chloride Chemical compound ClC(=O)CC(C)(C)N=[N+]=[N-] WGNJSORDRMBRQO-UHFFFAOYSA-N 0.000 description 15
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 15
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- 239000007864 aqueous solution Substances 0.000 description 14
- 125000006575 electron-withdrawing group Chemical group 0.000 description 14
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 12
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 150000007530 organic bases Chemical class 0.000 description 12
- 241000894006 Bacteria Species 0.000 description 11
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 11
- 238000010511 deprotection reaction Methods 0.000 description 11
- 238000005984 hydrogenation reaction Methods 0.000 description 11
- 125000006239 protecting group Chemical group 0.000 description 11
- 239000000126 substance Substances 0.000 description 11
- 238000003786 synthesis reaction Methods 0.000 description 11
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 11
- 235000019270 ammonium chloride Nutrition 0.000 description 10
- 239000003153 chemical reaction reagent Substances 0.000 description 10
- 239000013058 crude material Substances 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 9
- 230000001580 bacterial effect Effects 0.000 description 9
- 235000019253 formic acid Nutrition 0.000 description 9
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 9
- 229940073584 methylene chloride Drugs 0.000 description 9
- 239000012071 phase Substances 0.000 description 9
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 8
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 239000007900 aqueous suspension Substances 0.000 description 8
- PPHGMFCXSZCUDY-UHFFFAOYSA-N azanium;2,2-dimethylpropane;chloride Chemical compound [NH4+].[Cl-].CC(C)(C)C PPHGMFCXSZCUDY-UHFFFAOYSA-N 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 8
- 238000009472 formulation Methods 0.000 description 8
- 125000005843 halogen group Chemical group 0.000 description 8
- 125000005842 heteroatom Chemical group 0.000 description 8
- 150000002431 hydrogen Chemical class 0.000 description 8
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 8
- 239000003883 ointment base Substances 0.000 description 8
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 8
- 239000004810 polytetrafluoroethylene Substances 0.000 description 8
- 229910000029 sodium carbonate Inorganic materials 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- 241000700605 Viruses Species 0.000 description 7
- 239000002168 alkylating agent Substances 0.000 description 7
- 229940100198 alkylating agent Drugs 0.000 description 7
- 150000001408 amides Chemical class 0.000 description 7
- 150000003868 ammonium compounds Chemical class 0.000 description 7
- 150000001721 carbon Chemical group 0.000 description 7
- 125000001188 haloalkyl group Chemical group 0.000 description 7
- 238000002953 preparative HPLC Methods 0.000 description 7
- 150000003254 radicals Chemical class 0.000 description 7
- 230000009467 reduction Effects 0.000 description 7
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 7
- 210000001519 tissue Anatomy 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- FGLBSLMDCBOPQK-UHFFFAOYSA-N 2-nitropropane Chemical compound CC(C)[N+]([O-])=O FGLBSLMDCBOPQK-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 6
- 241000233866 Fungi Species 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 239000007868 Raney catalyst Substances 0.000 description 6
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 6
- 229910000564 Raney nickel Inorganic materials 0.000 description 6
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 6
- 229910000831 Steel Inorganic materials 0.000 description 6
- 206010052428 Wound Diseases 0.000 description 6
- 208000027418 Wounds and injury Diseases 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 125000003710 aryl alkyl group Chemical group 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 239000007822 coupling agent Substances 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 6
- QDUXDCXILAPLAG-UHFFFAOYSA-N hydron;1-methylpiperidine;chloride Chemical compound Cl.CN1CCCCC1 QDUXDCXILAPLAG-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 230000002265 prevention Effects 0.000 description 6
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- 239000010959 steel Substances 0.000 description 6
- 125000000542 sulfonic acid group Chemical group 0.000 description 6
- 150000003852 triazoles Chemical class 0.000 description 6
- YGDJVWUCJSIFOW-UHFFFAOYSA-M 2-[[3-(dichloroamino)-3-methylbutanoyl]-methylamino]ethyl-trimethylazanium;chloride Chemical compound [Cl-].C[N+](C)(C)CCN(C)C(=O)CC(C)(C)N(Cl)Cl YGDJVWUCJSIFOW-UHFFFAOYSA-M 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 5
- 206010017533 Fungal infection Diseases 0.000 description 5
- 208000031888 Mycoses Diseases 0.000 description 5
- 239000004264 Petrolatum Substances 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- 229940066842 petrolatum Drugs 0.000 description 5
- 235000019271 petrolatum Nutrition 0.000 description 5
- 150000003141 primary amines Chemical class 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 150000003536 tetrazoles Chemical class 0.000 description 5
- 238000004809 thin layer chromatography Methods 0.000 description 5
- 230000003612 virological effect Effects 0.000 description 5
- 229910052727 yttrium Inorganic materials 0.000 description 5
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 4
- GPWHFPWZAPOYNO-UHFFFAOYSA-N 3,3-dimethylbutan-1-amine Chemical compound CC(C)(C)CCN GPWHFPWZAPOYNO-UHFFFAOYSA-N 0.000 description 4
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 4
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 4
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 150000001350 alkyl halides Chemical class 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- 239000011260 aqueous acid Substances 0.000 description 4
- 239000012298 atmosphere Substances 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 4
- 229910000024 caesium carbonate Inorganic materials 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 210000004027 cell Anatomy 0.000 description 4
- 238000004140 cleaning Methods 0.000 description 4
- 238000011109 contamination Methods 0.000 description 4
- 150000002012 dioxanes Chemical class 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- 125000000524 functional group Chemical group 0.000 description 4
- 230000002140 halogenating effect Effects 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 230000000670 limiting effect Effects 0.000 description 4
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 4
- 244000005700 microbiome Species 0.000 description 4
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 150000003512 tertiary amines Chemical class 0.000 description 4
- QMGCGMCWRCSEPP-UHFFFAOYSA-N trimethylphosphane;hydrochloride Chemical compound [Cl-].C[PH+](C)C QMGCGMCWRCSEPP-UHFFFAOYSA-N 0.000 description 4
- DUQDEEVOZDZJGQ-UHFFFAOYSA-N (2,3-dimethylphenyl)azanium;chloride Chemical compound Cl.CC1=CC=CC(N)=C1C DUQDEEVOZDZJGQ-UHFFFAOYSA-N 0.000 description 3
- YILDCJXLCJVBSG-UHFFFAOYSA-M 1,1,2-trimethylpiperidin-1-ium chloride Chemical compound [Cl-].C[N+]1(C(CCCC1)C)C YILDCJXLCJVBSG-UHFFFAOYSA-M 0.000 description 3
- HZIDZQWETMAJGR-UHFFFAOYSA-N 1-iodo-4-methyl-4-nitropentane Chemical compound [O-][N+](=O)C(C)(C)CCCI HZIDZQWETMAJGR-UHFFFAOYSA-N 0.000 description 3
- ATPWZIFDHOCDQN-UHFFFAOYSA-N 1-methylazepane;hydrochloride Chemical compound Cl.CN1CCCCCC1 ATPWZIFDHOCDQN-UHFFFAOYSA-N 0.000 description 3
- QUMRLXXCRQWODL-UHFFFAOYSA-N 1-methylpiperazin-1-ium;chloride Chemical compound [Cl-].C[NH+]1CCNCC1 QUMRLXXCRQWODL-UHFFFAOYSA-N 0.000 description 3
- WIGRVUWJNPVKPB-UHFFFAOYSA-N 1-methylpyrrolidin-1-ium;chloride Chemical compound Cl.CN1CCCC1 WIGRVUWJNPVKPB-UHFFFAOYSA-N 0.000 description 3
- QWENRTYMTSOGBR-UHFFFAOYSA-N 1H-1,2,3-Triazole Chemical compound C=1C=NNN=1 QWENRTYMTSOGBR-UHFFFAOYSA-N 0.000 description 3
- PUTRBRSYIRVPJO-UHFFFAOYSA-N 2-(1-methylpiperidin-1-ium-1-yl)ethyl 3-amino-3-methylbutanoate;hydrochloride Chemical compound Cl.CC(C)(N)CC(=O)OCC[N+]1(C)CCCCC1 PUTRBRSYIRVPJO-UHFFFAOYSA-N 0.000 description 3
- LWWXMKUYEMJLEA-UHFFFAOYSA-N 2-[4-(2-aminopropan-2-yl)triazol-1-yl]ethyl-trimethylazanium;hydrochloride Chemical compound Cl.CC(C)(N)C1=CN(CC[N+](C)(C)C)N=N1 LWWXMKUYEMJLEA-UHFFFAOYSA-N 0.000 description 3
- FUILESZZJGTFIB-UHFFFAOYSA-M 2-methyl-1-(4-methylmorpholin-4-ium-4-yl)propan-2-amine;chloride Chemical compound [Cl-].CC(C)(N)C[N+]1(C)CCOCC1 FUILESZZJGTFIB-UHFFFAOYSA-M 0.000 description 3
- HGBYXYUFWAJPSP-UHFFFAOYSA-N 3-azido-3-methylbutanoic acid Chemical compound OC(=O)CC(C)(C)N=[N+]=[N-] HGBYXYUFWAJPSP-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 3
- 241000588724 Escherichia coli Species 0.000 description 3
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 229920002125 Sokalan® Polymers 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- FLNKWZNWHZDGRT-UHFFFAOYSA-N azane;dihydrochloride Chemical compound [NH4+].[NH4+].[Cl-].[Cl-] FLNKWZNWHZDGRT-UHFFFAOYSA-N 0.000 description 3
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 3
- 239000012455 biphasic mixture Substances 0.000 description 3
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 3
- 150000001718 carbodiimides Chemical class 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000012320 chlorinating reagent Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- 239000000645 desinfectant Substances 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 3
- 229940052303 ethers for general anesthesia Drugs 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthene Chemical compound C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 description 3
- 235000013305 food Nutrition 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000003349 gelling agent Substances 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 3
- BTJRKNUKPQBLAL-UHFFFAOYSA-N hydron;4-methylmorpholine;chloride Chemical compound Cl.CN1CCOCC1 BTJRKNUKPQBLAL-UHFFFAOYSA-N 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 230000002147 killing effect Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- OIKILSGKROZHOL-UHFFFAOYSA-N methanesulfonic acid;octane Chemical compound CS(O)(=O)=O.CCCCCCCC OIKILSGKROZHOL-UHFFFAOYSA-N 0.000 description 3
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 3
- CHVZPRDGLWBEMJ-UHFFFAOYSA-N n-chlorobenzenesulfonamide Chemical compound ClNS(=O)(=O)C1=CC=CC=C1 CHVZPRDGLWBEMJ-UHFFFAOYSA-N 0.000 description 3
- BXWNKGSJHAJOGX-UHFFFAOYSA-N n-hexadecyl alcohol Natural products CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 3
- 150000002828 nitro derivatives Chemical class 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 230000001590 oxidative effect Effects 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 244000052769 pathogen Species 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 150000004714 phosphonium salts Chemical class 0.000 description 3
- 239000003495 polar organic solvent Substances 0.000 description 3
- 239000002798 polar solvent Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 230000019254 respiratory burst Effects 0.000 description 3
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 3
- 150000003335 secondary amines Chemical class 0.000 description 3
- 238000000526 short-path distillation Methods 0.000 description 3
- 229910001923 silver oxide Inorganic materials 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- WAWXVZMPILGPPJ-UHFFFAOYSA-N tert-butyl n-(2-methyl-1-morpholin-4-ylpropan-2-yl)carbamate Chemical compound CC(C)(C)OC(=O)NC(C)(C)CN1CCOCC1 WAWXVZMPILGPPJ-UHFFFAOYSA-N 0.000 description 3
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 230000000699 topical effect Effects 0.000 description 3
- 230000009466 transformation Effects 0.000 description 3
- YWWDBCBWQNCYNR-UHFFFAOYSA-O trimethylphosphanium Chemical compound C[PH+](C)C YWWDBCBWQNCYNR-UHFFFAOYSA-O 0.000 description 3
- 230000002485 urinary effect Effects 0.000 description 3
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 2
- WBUCJSKGMVZDIH-UHFFFAOYSA-M (2-amino-2-methylpropyl)-dimethylsulfanium;chloride;hydrochloride Chemical compound Cl.[Cl-].C[S+](C)CC(C)(C)N WBUCJSKGMVZDIH-UHFFFAOYSA-M 0.000 description 2
- IUSARDYWEPUTPN-OZBXUNDUSA-N (2r)-n-[(2s,3r)-4-[[(4s)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-[3-(1,3-thiazol-2-yl)phenyl]butan-2-yl]-2-methoxypropanamide Chemical compound C([C@H](NC(=O)[C@@H](C)OC)[C@H](O)CN[C@@H]1C2=CC(CC(C)(C)C)=CN=C2OC2(CCC2)C1)C(C=1)=CC=CC=1C1=NC=CS1 IUSARDYWEPUTPN-OZBXUNDUSA-N 0.000 description 2
- YJLIKUSWRSEPSM-WGQQHEPDSA-N (2r,3r,4s,5r)-2-[6-amino-8-[(4-phenylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1CNC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O YJLIKUSWRSEPSM-WGQQHEPDSA-N 0.000 description 2
- VIJSPAIQWVPKQZ-BLECARSGSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-4,4-dimethylpentanoyl]amino]-4-methylpentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid Chemical compound NC(=N)NCCC[C@@H](C(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(C)=O VIJSPAIQWVPKQZ-BLECARSGSA-N 0.000 description 2
- NDPJVUZJJGDSIM-UHFFFAOYSA-M (4-amino-4-methylpentyl)-trimethylphosphanium;chloride;hydrochloride Chemical compound Cl.[Cl-].CC(C)(N)CCC[P+](C)(C)C NDPJVUZJJGDSIM-UHFFFAOYSA-M 0.000 description 2
- QAICVCDICOCBPB-UHFFFAOYSA-N (4-methyl-4-nitropentyl) methanesulfonate Chemical compound [O-][N+](=O)C(C)(C)CCCOS(C)(=O)=O QAICVCDICOCBPB-UHFFFAOYSA-N 0.000 description 2
- VUEGYUOUAAVYAS-JGGQBBKZSA-N (6ar,9s,10ar)-9-(dimethylsulfamoylamino)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline Chemical compound C1=CC([C@H]2C[C@@H](CN(C)[C@@H]2C2)NS(=O)(=O)N(C)C)=C3C2=CNC3=C1 VUEGYUOUAAVYAS-JGGQBBKZSA-N 0.000 description 2
- DHBXNPKRAUYBTH-UHFFFAOYSA-N 1,1-ethanedithiol Chemical compound CC(S)S DHBXNPKRAUYBTH-UHFFFAOYSA-N 0.000 description 2
- KQZLRWGGWXJPOS-NLFPWZOASA-N 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-[(4S,5R)-4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-5-methylcyclohexen-1-yl]pyrazolo[3,4-b]pyrazine-3-carbonitrile Chemical compound ClC1=C(C=CC(=C1)Cl)[C@@H](C)N1N=C(C=2C1=NC(=CN=2)C1=CC[C@@H]([C@@H](C1)C)N1[C@@H](CCC1)CO)C#N KQZLRWGGWXJPOS-NLFPWZOASA-N 0.000 description 2
- SZPIUEYWNAENMM-UHFFFAOYSA-N 1-[4-(2-methyl-2-nitropropyl)piperazin-1-yl]ethanone Chemical compound CC(=O)N1CCN(CC(C)(C)[N+]([O-])=O)CC1 SZPIUEYWNAENMM-UHFFFAOYSA-N 0.000 description 2
- LHJDUQLKHKZXLY-UHFFFAOYSA-M 1-methyl-1-(2-methyl-2-nitropropyl)piperidin-1-ium;iodide Chemical compound [I-].[O-][N+](=O)C(C)(C)C[N+]1(C)CCCCC1 LHJDUQLKHKZXLY-UHFFFAOYSA-M 0.000 description 2
- DVVGIUUJYPYENY-UHFFFAOYSA-N 1-methylpyridin-2-one Chemical compound CN1C=CC=CC1=O DVVGIUUJYPYENY-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 2
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Chemical compound C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 2
- HCCHELHEEAWJGT-UHFFFAOYSA-N 2,3,3-trimethyloctan-2-ylazanium;chloride Chemical compound [Cl-].CCCCCC(C)(C)C(C)(C)[NH3+] HCCHELHEEAWJGT-UHFFFAOYSA-N 0.000 description 2
- JWYLEUMTZRLTNS-UHFFFAOYSA-N 2-(1-methylpiperidin-1-ium-1-yl)ethyl 3-methyl-3-(phenylmethoxycarbonylamino)butanoate;iodide Chemical compound [I-].C=1C=CC=CC=1COC(=O)NC(C)(C)CC(=O)OCC[N+]1(C)CCCCC1 JWYLEUMTZRLTNS-UHFFFAOYSA-N 0.000 description 2
- KZTWONRVIPPDKH-UHFFFAOYSA-N 2-(piperidin-1-yl)ethanol Chemical compound OCCN1CCCCC1 KZTWONRVIPPDKH-UHFFFAOYSA-N 0.000 description 2
- XUYZQLVSEGBAFI-UHFFFAOYSA-N 2-[(3-amino-3-methylbutanoyl)-methylamino]ethyl-trimethylazanium;hydrochloride Chemical compound Cl.C[N+](C)(C)CCN(C)C(=O)CC(C)(C)N XUYZQLVSEGBAFI-UHFFFAOYSA-N 0.000 description 2
- OWRPOIQXVSILTB-UHFFFAOYSA-N 2-[methyl-(2-methyl-2-nitropropyl)amino]ethyl methanesulfonate Chemical compound [O-][N+](=O)C(C)(C)CN(C)CCOS(C)(=O)=O OWRPOIQXVSILTB-UHFFFAOYSA-N 0.000 description 2
- MPCYPANGNJKNPP-UHFFFAOYSA-M 2-azidoethyl(trimethyl)azanium bromide Chemical compound [Br-].C[N+](C)(C)CCN=[N+]=[N-] MPCYPANGNJKNPP-UHFFFAOYSA-M 0.000 description 2
- RKMRQBWPIYOIMI-UHFFFAOYSA-N 2-piperidin-1-ylethyl 3-methyl-3-(phenylmethoxycarbonylamino)butanoate Chemical compound C=1C=CC=CC=1COC(=O)NC(C)(C)CC(=O)OCCN1CCCCC1 RKMRQBWPIYOIMI-UHFFFAOYSA-N 0.000 description 2
- QWCFNSWBPRARHE-UHFFFAOYSA-N 3-amino-3-methyl-1-piperidin-1-ylbutan-1-one Chemical compound CC(C)(N)CC(=O)N1CCCCC1 QWCFNSWBPRARHE-UHFFFAOYSA-N 0.000 description 2
- PRHITFXVCRYMSG-UHFFFAOYSA-N 3-azido-3-methyl-n-(2,2,2-trifluoroethyl)butanamide Chemical compound [N-]=[N+]=NC(C)(C)CC(=O)NCC(F)(F)F PRHITFXVCRYMSG-UHFFFAOYSA-N 0.000 description 2
- PRHPDSPWDRBUPG-UHFFFAOYSA-N 3-azido-3-methylbutan-1-ol Chemical compound OCCC(C)(C)N=[N+]=[N-] PRHPDSPWDRBUPG-UHFFFAOYSA-N 0.000 description 2
- XXKPCWBWSNNHBM-UHFFFAOYSA-N 3-azido-n,n-dibutyl-3-methylbutanamide Chemical compound CCCCN(CCCC)C(=O)CC(C)(C)N=[N+]=[N-] XXKPCWBWSNNHBM-UHFFFAOYSA-N 0.000 description 2
- SOCPXSRNMZWPGM-UHFFFAOYSA-N 3-azido-n-[3-(dimethylamino)propyl]-n,3-dimethylbutanamide Chemical compound CN(C)CCCN(C)C(=O)CC(C)(C)N=[N+]=[N-] SOCPXSRNMZWPGM-UHFFFAOYSA-N 0.000 description 2
- GCSGFARTHOWTQW-UHFFFAOYSA-N 3-azido-n-butyl-n,3-dimethylbutanamide Chemical compound CCCCN(C)C(=O)CC(C)(C)N=[N+]=[N-] GCSGFARTHOWTQW-UHFFFAOYSA-N 0.000 description 2
- MMIJXMXPZNMBBH-UHFFFAOYSA-N 3-azido-n-ethyl-n,3-dimethylbutanamide Chemical compound CCN(C)C(=O)CC(C)(C)N=[N+]=[N-] MMIJXMXPZNMBBH-UHFFFAOYSA-N 0.000 description 2
- ZOPIIYAROJMIFO-UHFFFAOYSA-N 3-azido-n-hexyl-n,3-dimethylbutanamide Chemical compound CCCCCCN(C)C(=O)CC(C)(C)N=[N+]=[N-] ZOPIIYAROJMIFO-UHFFFAOYSA-N 0.000 description 2
- LVFPDQUAUOUBPO-UHFFFAOYSA-N 3-methyl-3-(phenylmethoxycarbonylamino)butanoic acid Chemical compound OC(=O)CC(C)(C)NC(=O)OCC1=CC=CC=C1 LVFPDQUAUOUBPO-UHFFFAOYSA-N 0.000 description 2
- YYPNJNDODFVZLE-UHFFFAOYSA-N 3-methylbut-2-enoic acid Chemical compound CC(C)=CC(O)=O YYPNJNDODFVZLE-UHFFFAOYSA-N 0.000 description 2
- QGSNPUZSBSSGQJ-UHFFFAOYSA-M 4-(4,4-difluoro-1-methylpiperidin-1-ium-1-yl)-2-methylbutan-2-amine;chloride;hydrochloride Chemical compound Cl.[Cl-].CC(C)(N)CC[N+]1(C)CCC(F)(F)CC1 QGSNPUZSBSSGQJ-UHFFFAOYSA-M 0.000 description 2
- DQAZPZIYEOGZAF-UHFFFAOYSA-N 4-ethyl-n-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]piperazine-1-carboxamide Chemical compound C1CN(CC)CCN1C(=O)NC(C(=CC1=NC=N2)OC)=CC1=C2NC1=CC=CC(C#C)=C1 DQAZPZIYEOGZAF-UHFFFAOYSA-N 0.000 description 2
- DBYMNHYVMTWSLQ-UHFFFAOYSA-N 4-methyl-4-nitropentan-1-ol Chemical compound [O-][N+](=O)C(C)(C)CCCO DBYMNHYVMTWSLQ-UHFFFAOYSA-N 0.000 description 2
- HCCNBKFJYUWLEX-UHFFFAOYSA-N 7-(6-methoxypyridin-3-yl)-1-(2-propoxyethyl)-3-(pyrazin-2-ylmethylamino)pyrido[3,4-b]pyrazin-2-one Chemical compound O=C1N(CCOCCC)C2=CC(C=3C=NC(OC)=CC=3)=NC=C2N=C1NCC1=CN=CC=N1 HCCNBKFJYUWLEX-UHFFFAOYSA-N 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- 208000035143 Bacterial infection Diseases 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- 241000222122 Candida albicans Species 0.000 description 2
- 229940126639 Compound 33 Drugs 0.000 description 2
- 229920000858 Cyclodextrin Polymers 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 241000606768 Haemophilus influenzae Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- BZORFPDSXLZWJF-UHFFFAOYSA-N N,N-dimethyl-1,4-phenylenediamine Chemical compound CN(C)C1=CC=C(N)C=C1 BZORFPDSXLZWJF-UHFFFAOYSA-N 0.000 description 2
- LVDRREOUMKACNJ-BKMJKUGQSA-N N-[(2R,3S)-2-(4-chlorophenyl)-1-(1,4-dimethyl-2-oxoquinolin-7-yl)-6-oxopiperidin-3-yl]-2-methylpropane-1-sulfonamide Chemical compound CC(C)CS(=O)(=O)N[C@H]1CCC(=O)N([C@@H]1c1ccc(Cl)cc1)c1ccc2c(C)cc(=O)n(C)c2c1 LVDRREOUMKACNJ-BKMJKUGQSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 241000588770 Proteus mirabilis Species 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 229910006069 SO3H Inorganic materials 0.000 description 2
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 2
- PNUZDKCDAWUEGK-CYZMBNFOSA-N Sitafloxacin Chemical compound C([C@H]1N)N(C=2C(=C3C(C(C(C(O)=O)=CN3[C@H]3[C@H](C3)F)=O)=CC=2F)Cl)CC11CC1 PNUZDKCDAWUEGK-CYZMBNFOSA-N 0.000 description 2
- 239000005708 Sodium hypochlorite Substances 0.000 description 2
- 241000191963 Staphylococcus epidermidis Species 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000004809 Teflon Substances 0.000 description 2
- 229920006362 Teflon® Polymers 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 108010059993 Vancomycin Proteins 0.000 description 2
- 208000036142 Viral infection Diseases 0.000 description 2
- LNUFLCYMSVYYNW-ZPJMAFJPSA-N [(2r,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[[(3s,5s,8r,9s,10s,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-disulfo Chemical compound O([C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@]4(CC[C@@H]3[C@@]2(C)CC1)C)[C@H](C)CCCC(C)C)[C@H]1O[C@H](COS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]1OS(O)(=O)=O LNUFLCYMSVYYNW-ZPJMAFJPSA-N 0.000 description 2
- PSLUFJFHTBIXMW-WYEYVKMPSA-N [(3r,4ar,5s,6s,6as,10s,10ar,10bs)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-6-(2-pyridin-2-ylethylcarbamoyloxy)-5,6,6a,8,9,10-hexahydro-2h-benzo[f]chromen-5-yl] acetate Chemical compound O([C@@H]1[C@@H]([C@]2(O[C@](C)(CC(=O)[C@]2(O)[C@@]2(C)[C@@H](O)CCC(C)(C)[C@@H]21)C=C)C)OC(=O)C)C(=O)NCCC1=CC=CC=N1 PSLUFJFHTBIXMW-WYEYVKMPSA-N 0.000 description 2
- WRDIRRBNWRDHJO-UHFFFAOYSA-N [4-(azepan-1-yl)-2-methyl-4-oxobutan-2-yl]-diazonioazanide Chemical compound [N-]=[N+]=NC(C)(C)CC(=O)N1CCCCCC1 WRDIRRBNWRDHJO-UHFFFAOYSA-N 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 125000004442 acylamino group Chemical group 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 238000007112 amidation reaction Methods 0.000 description 2
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 238000000065 atmospheric pressure chemical ionisation Methods 0.000 description 2
- CUFNKYGDVFVPHO-UHFFFAOYSA-N azulene Chemical compound C1=CC=CC2=CC=CC2=C1 CUFNKYGDVFVPHO-UHFFFAOYSA-N 0.000 description 2
- 208000022362 bacterial infectious disease Diseases 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- RDJXUEGITAVGFA-UHFFFAOYSA-N benzyl n-(2-methyl-1-sulfanylpropan-2-yl)carbamate Chemical compound SCC(C)(C)NC(=O)OCC1=CC=CC=C1 RDJXUEGITAVGFA-UHFFFAOYSA-N 0.000 description 2
- OMIYHIUYKXIOPF-UHFFFAOYSA-N benzyl n-(2-methyl-4-sulfanylbutan-2-yl)carbamate Chemical compound SCCC(C)(C)NC(=O)OCC1=CC=CC=C1 OMIYHIUYKXIOPF-UHFFFAOYSA-N 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 229960000541 cetyl alcohol Drugs 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- WDECIBYCCFPHNR-UHFFFAOYSA-N chrysene Chemical compound C1=CC=CC2=CC=C3C4=CC=CC=C4C=CC3=C21 WDECIBYCCFPHNR-UHFFFAOYSA-N 0.000 description 2
- 229940126543 compound 14 Drugs 0.000 description 2
- 229940125782 compound 2 Drugs 0.000 description 2
- 229940126214 compound 3 Drugs 0.000 description 2
- 229940125877 compound 31 Drugs 0.000 description 2
- 229940125807 compound 37 Drugs 0.000 description 2
- 229940126540 compound 41 Drugs 0.000 description 2
- 229940125844 compound 46 Drugs 0.000 description 2
- 229940126545 compound 53 Drugs 0.000 description 2
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical compound C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 2
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical compound C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- KTAVNSGNDRPPPV-UHFFFAOYSA-N diazonio-[4-[dodecyl(methyl)amino]-2-methyl-4-oxobutan-2-yl]azanide Chemical compound CCCCCCCCCCCCN(C)C(=O)CC(C)(C)N=[N+]=[N-] KTAVNSGNDRPPPV-UHFFFAOYSA-N 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000000132 electrospray ionisation Methods 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- BJXYHBKEQFQVES-NWDGAFQWSA-N enpatoran Chemical compound N[C@H]1CN(C[C@H](C1)C(F)(F)F)C1=C2C=CC=NC2=C(C=C1)C#N BJXYHBKEQFQVES-NWDGAFQWSA-N 0.000 description 2
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 2
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- 230000036541 health Effects 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 2
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical compound C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 2
- 229920002521 macromolecule Polymers 0.000 description 2
- 208000004396 mastitis Diseases 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- GSYSFVSGPABNNL-UHFFFAOYSA-N methyl 2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate Chemical group COC(=O)C(P(=O)(OC)OC)NC(=O)OCC1=CC=CC=C1 GSYSFVSGPABNNL-UHFFFAOYSA-N 0.000 description 2
- MROVMGGCWUQHMR-UHFFFAOYSA-N methyl 4-methyl-4-nitropentanoate Chemical compound COC(=O)CCC(C)(C)[N+]([O-])=O MROVMGGCWUQHMR-UHFFFAOYSA-N 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 2
- RDOWQLZANAYVLL-UHFFFAOYSA-N phenanthridine Chemical compound C1=CC=C2C3=CC=CC=C3C=NC2=C1 RDOWQLZANAYVLL-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 235000013772 propylene glycol Nutrition 0.000 description 2
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 2
- BBEAQIROQSPTKN-UHFFFAOYSA-N pyrene Chemical compound C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 BBEAQIROQSPTKN-UHFFFAOYSA-N 0.000 description 2
- SBYHFKPVCBCYGV-UHFFFAOYSA-N quinuclidine Chemical compound C1CC2CCN1CC2 SBYHFKPVCBCYGV-UHFFFAOYSA-N 0.000 description 2
- 210000000664 rectum Anatomy 0.000 description 2
- BMXQQRORRZIGDL-UHFFFAOYSA-N s-[2-[methyl-(2-methyl-2-nitropropyl)amino]ethyl] ethanethioate Chemical compound [O-][N+](=O)C(C)(C)CN(C)CCSC(C)=O BMXQQRORRZIGDL-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- 229960004274 stearic acid Drugs 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 238000004659 sterilization and disinfection Methods 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical compound NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 2
- RXPXPDDPWDNBGV-UHFFFAOYSA-N tert-butyl n-(2-methylbut-3-yn-2-yl)carbamate Chemical compound CC(C)(C)OC(=O)NC(C)(C)C#C RXPXPDDPWDNBGV-UHFFFAOYSA-N 0.000 description 2
- UGTPBIYSFIUIOW-UHFFFAOYSA-N tert-butyl n-[2-methyl-1-(4-methylmorpholin-4-ium-4-yl)propan-2-yl]carbamate;iodide Chemical compound [I-].CC(C)(C)OC(=O)NC(C)(C)C[N+]1(C)CCOCC1 UGTPBIYSFIUIOW-UHFFFAOYSA-N 0.000 description 2
- 150000003573 thiols Chemical class 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000002054 transplantation Methods 0.000 description 2
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 2
- NUIDGYXFCXBFMU-UHFFFAOYSA-M trimethyl-(4-methyl-4-nitropentyl)phosphanium;iodide Chemical compound [I-].[O-][N+](=O)C(C)(C)CCC[P+](C)(C)C NUIDGYXFCXBFMU-UHFFFAOYSA-M 0.000 description 2
- ASEWWTUJRGCUMH-UHFFFAOYSA-N trimethyl-[2-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]triazol-1-yl]ethyl]azanium;bromide Chemical compound [Br-].CC(C)(C)OC(=O)NC(C)(C)C1=CN(CC[N+](C)(C)C)N=N1 ASEWWTUJRGCUMH-UHFFFAOYSA-N 0.000 description 2
- DOWCSEBPSOTVRM-UHFFFAOYSA-N trimethyl-[2-[methyl-[3-methyl-3-(phenylmethoxycarbonylamino)butanoyl]amino]ethyl]azanium;iodide Chemical compound [I-].C[N+](C)(C)CCN(C)C(=O)CC(C)(C)NC(=O)OCC1=CC=CC=C1 DOWCSEBPSOTVRM-UHFFFAOYSA-N 0.000 description 2
- YWWDBCBWQNCYNR-UHFFFAOYSA-N trimethylphosphine Chemical compound CP(C)C YWWDBCBWQNCYNR-UHFFFAOYSA-N 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 208000019206 urinary tract infection Diseases 0.000 description 2
- 210000001215 vagina Anatomy 0.000 description 2
- 229910052720 vanadium Inorganic materials 0.000 description 2
- MYPYJXKWCTUITO-LYRMYLQWSA-N vancomycin Chemical compound O([C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC1=C2C=C3C=C1OC1=CC=C(C=C1Cl)[C@@H](O)[C@H](C(N[C@@H](CC(N)=O)C(=O)N[C@H]3C(=O)N[C@H]1C(=O)N[C@H](C(N[C@@H](C3=CC(O)=CC(O)=C3C=3C(O)=CC=C1C=3)C(O)=O)=O)[C@H](O)C1=CC=C(C(=C1)Cl)O2)=O)NC(=O)[C@@H](CC(C)C)NC)[C@H]1C[C@](C)(N)[C@H](O)[C@H](C)O1 MYPYJXKWCTUITO-LYRMYLQWSA-N 0.000 description 2
- 229960003165 vancomycin Drugs 0.000 description 2
- MYPYJXKWCTUITO-UHFFFAOYSA-N vancomycin Natural products O1C(C(=C2)Cl)=CC=C2C(O)C(C(NC(C2=CC(O)=CC(O)=C2C=2C(O)=CC=C3C=2)C(O)=O)=O)NC(=O)C3NC(=O)C2NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(CC(C)C)NC)C(O)C(C=C3Cl)=CC=C3OC3=CC2=CC1=C3OC1OC(CO)C(O)C(O)C1OC1CC(C)(N)C(O)C(C)O1 MYPYJXKWCTUITO-UHFFFAOYSA-N 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- QYYZXEPEVBXNNA-QGZVFWFLSA-N (1R)-2-acetyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methylsulfonyl-1,3-dihydroisoindole-1-carboxamide Chemical compound C(C)(=O)N1[C@H](C2=CC=C(C=C2C1)S(=O)(=O)C)C(=O)NC1=CC=C(C=C1)C(C(F)(F)F)(C(F)(F)F)O QYYZXEPEVBXNNA-QGZVFWFLSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 1
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 1
- STBLNCCBQMHSRC-BATDWUPUSA-N (2s)-n-[(3s,4s)-5-acetyl-7-cyano-4-methyl-1-[(2-methylnaphthalen-1-yl)methyl]-2-oxo-3,4-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide Chemical compound O=C1[C@@H](NC(=O)[C@H](C)NC)[C@H](C)N(C(C)=O)C2=CC(C#N)=CC=C2N1CC1=C(C)C=CC2=CC=CC=C12 STBLNCCBQMHSRC-BATDWUPUSA-N 0.000 description 1
- VLRXCZZAVKJQJS-UHFFFAOYSA-N (3-azido-3-methylbutyl) methanesulfonate Chemical compound [N-]=[N+]=NC(C)(C)CCOS(C)(=O)=O VLRXCZZAVKJQJS-UHFFFAOYSA-N 0.000 description 1
- UDQTXCHQKHIQMH-KYGLGHNPSA-N (3ar,5s,6s,7r,7ar)-5-(difluoromethyl)-2-(ethylamino)-5,6,7,7a-tetrahydro-3ah-pyrano[3,2-d][1,3]thiazole-6,7-diol Chemical compound S1C(NCC)=N[C@H]2[C@@H]1O[C@H](C(F)F)[C@@H](O)[C@@H]2O UDQTXCHQKHIQMH-KYGLGHNPSA-N 0.000 description 1
- YQOLEILXOBUDMU-KRWDZBQOSA-N (4R)-5-[(6-bromo-3-methyl-2-pyrrolidin-1-ylquinoline-4-carbonyl)amino]-4-(2-chlorophenyl)pentanoic acid Chemical compound CC1=C(C2=C(C=CC(=C2)Br)N=C1N3CCCC3)C(=O)NC[C@H](CCC(=O)O)C4=CC=CC=C4Cl YQOLEILXOBUDMU-KRWDZBQOSA-N 0.000 description 1
- STPKWKPURVSAJF-LJEWAXOPSA-N (4r,5r)-5-[4-[[4-(1-aza-4-azoniabicyclo[2.2.2]octan-4-ylmethyl)phenyl]methoxy]phenyl]-3,3-dibutyl-7-(dimethylamino)-1,1-dioxo-4,5-dihydro-2h-1$l^{6}-benzothiepin-4-ol Chemical compound O[C@H]1C(CCCC)(CCCC)CS(=O)(=O)C2=CC=C(N(C)C)C=C2[C@H]1C(C=C1)=CC=C1OCC(C=C1)=CC=C1C[N+]1(CC2)CCN2CC1 STPKWKPURVSAJF-LJEWAXOPSA-N 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- 125000003088 (fluoren-9-ylmethoxy)carbonyl group Chemical group 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- GARJMFRQLMUUDD-UHFFFAOYSA-N 1,1-dimethylpyrrolidin-1-ium Chemical compound C[N+]1(C)CCCC1 GARJMFRQLMUUDD-UHFFFAOYSA-N 0.000 description 1
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 1
- KKHFRAFPESRGGD-UHFFFAOYSA-N 1,3-dimethyl-7-[3-(n-methylanilino)propyl]purine-2,6-dione Chemical compound C1=NC=2N(C)C(=O)N(C)C(=O)C=2N1CCCN(C)C1=CC=CC=C1 KKHFRAFPESRGGD-UHFFFAOYSA-N 0.000 description 1
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 description 1
- KWULWMUTIBFSHV-UHFFFAOYSA-N 1-(2-methyl-2-nitropropyl)piperidine Chemical compound [O-][N+](=O)C(C)(C)CN1CCCCC1 KWULWMUTIBFSHV-UHFFFAOYSA-N 0.000 description 1
- TXZIIVGFRFMSPZ-UHFFFAOYSA-M 1-(3-azido-3-methylbutyl)-1-azoniabicyclo[2.2.2]octane;methanesulfonate Chemical compound CS([O-])(=O)=O.C1CC2CC[N+]1(CCC(C)(C)N=[N+]=[N-])CC2 TXZIIVGFRFMSPZ-UHFFFAOYSA-M 0.000 description 1
- WZZBNLYBHUDSHF-DHLKQENFSA-N 1-[(3s,4s)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone Chemical compound CC1=NC2=CN=C3C=C(F)C(C=4C(=CC(OC=5N=CC=CN=5)=CC=4)Cl)=CC3=C2N1[C@H]1CCN(C(=O)CO)C[C@@H]1F WZZBNLYBHUDSHF-DHLKQENFSA-N 0.000 description 1
- ONBQEOIKXPHGMB-VBSBHUPXSA-N 1-[2-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1OC1=CC(O)=CC(O)=C1C(=O)CCC1=CC=C(O)C=C1 ONBQEOIKXPHGMB-VBSBHUPXSA-N 0.000 description 1
- UGWAGLNYSITDOD-UHFFFAOYSA-M 1-[4-(2-amino-2-methylpropyl)-4-methylpiperazin-4-ium-1-yl]ethanone;chloride;hydrochloride Chemical compound Cl.[Cl-].CC(=O)N1CC[N+](C)(CC(C)(C)N)CC1 UGWAGLNYSITDOD-UHFFFAOYSA-M 0.000 description 1
- YARIAGJQEFUYLV-UHFFFAOYSA-N 1-[4-(2-amino-2-methylpropyl)piperazin-1-yl]ethanone;dihydrochloride Chemical compound Cl.Cl.CC(=O)N1CCN(CC(C)(C)N)CC1 YARIAGJQEFUYLV-UHFFFAOYSA-N 0.000 description 1
- UNILWMWFPHPYOR-KXEYIPSPSA-M 1-[6-[2-[3-[3-[3-[2-[2-[3-[[2-[2-[[(2r)-1-[[2-[[(2r)-1-[3-[2-[2-[3-[[2-(2-amino-2-oxoethoxy)acetyl]amino]propoxy]ethoxy]ethoxy]propylamino]-3-hydroxy-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-[(2r)-2,3-di(hexadecanoyloxy)propyl]sulfanyl-1-oxopropan-2-yl Chemical compound O=C1C(SCCC(=O)NCCCOCCOCCOCCCNC(=O)COCC(=O)N[C@@H](CSC[C@@H](COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)C(=O)NCC(=O)N[C@H](CO)C(=O)NCCCOCCOCCOCCCNC(=O)COCC(N)=O)CC(=O)N1CCNC(=O)CCCCCN\1C2=CC=C(S([O-])(=O)=O)C=C2CC/1=C/C=C/C=C/C1=[N+](CC)C2=CC=C(S([O-])(=O)=O)C=C2C1 UNILWMWFPHPYOR-KXEYIPSPSA-M 0.000 description 1
- RRQGZMDHLIAOLY-UHFFFAOYSA-N 1-bromopiperidine Chemical compound BrN1CCCCC1 RRQGZMDHLIAOLY-UHFFFAOYSA-N 0.000 description 1
- WPDRTZQNLRNDMG-UHFFFAOYSA-N 1-bromopyrrolidine Chemical compound BrN1CCCC1 WPDRTZQNLRNDMG-UHFFFAOYSA-N 0.000 description 1
- CIQJWKNJDQKPPO-UHFFFAOYSA-N 1-chloropiperidine Chemical compound ClN1CCCCC1 CIQJWKNJDQKPPO-UHFFFAOYSA-N 0.000 description 1
- RNSGBYUFHBXKPU-UHFFFAOYSA-N 1-chloropyrrolidine Chemical compound ClN1CCCC1 RNSGBYUFHBXKPU-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- PKDPUENCROCRCH-UHFFFAOYSA-N 1-piperazin-1-ylethanone Chemical compound CC(=O)N1CCNCC1 PKDPUENCROCRCH-UHFFFAOYSA-N 0.000 description 1
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 1
- MFJCPDOGFAYSTF-UHFFFAOYSA-N 1H-isochromene Chemical compound C1=CC=C2COC=CC2=C1 MFJCPDOGFAYSTF-UHFFFAOYSA-N 0.000 description 1
- AAQTWLBJPNLKHT-UHFFFAOYSA-N 1H-perimidine Chemical compound N1C=NC2=CC=CC3=CC=CC1=C32 AAQTWLBJPNLKHT-UHFFFAOYSA-N 0.000 description 1
- ODMMNALOCMNQJZ-UHFFFAOYSA-N 1H-pyrrolizine Chemical compound C1=CC=C2CC=CN21 ODMMNALOCMNQJZ-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 description 1
- JYWKEVKEKOTYEX-UHFFFAOYSA-N 2,6-dibromo-4-chloroiminocyclohexa-2,5-dien-1-one Chemical compound ClN=C1C=C(Br)C(=O)C(Br)=C1 JYWKEVKEKOTYEX-UHFFFAOYSA-N 0.000 description 1
- WGFNXGPBPIJYLI-UHFFFAOYSA-N 2,6-difluoro-3-[(3-fluorophenyl)sulfonylamino]-n-(3-methoxy-1h-pyrazolo[3,4-b]pyridin-5-yl)benzamide Chemical compound C1=C2C(OC)=NNC2=NC=C1NC(=O)C(C=1F)=C(F)C=CC=1NS(=O)(=O)C1=CC=CC(F)=C1 WGFNXGPBPIJYLI-UHFFFAOYSA-N 0.000 description 1
- NMMHHSLZJLPMEG-UHFFFAOYSA-N 2-(chloroamino)ethanesulfonic acid Chemical compound OS(=O)(=O)CCNCl NMMHHSLZJLPMEG-UHFFFAOYSA-N 0.000 description 1
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical class O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 description 1
- FMKGJQHNYMWDFJ-CVEARBPZSA-N 2-[[4-(2,2-difluoropropoxy)pyrimidin-5-yl]methylamino]-4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]pyrimidine-5-carbonitrile Chemical compound FC(COC1=NC=NC=C1CNC1=NC=C(C(=N1)N[C@H]1CC([C@H](CC1)O)(C)C)C#N)(C)F FMKGJQHNYMWDFJ-CVEARBPZSA-N 0.000 description 1
- MPBBTBBEDHNHRB-UHFFFAOYSA-N 2-[methyl-(2-methyl-2-nitropropyl)amino]ethanol Chemical compound OCCN(C)CC(C)(C)[N+]([O-])=O MPBBTBBEDHNHRB-UHFFFAOYSA-N 0.000 description 1
- TVTJUIAKQFIXCE-HUKYDQBMSA-N 2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynyl-1H-purine-6,8-dione Chemical compound NC=1NC(C=2N(C(N(C=2N=1)[C@@H]1O[C@@H]([C@H]([C@H]1O)F)CO)=O)CC#C)=O TVTJUIAKQFIXCE-HUKYDQBMSA-N 0.000 description 1
- UXGVMFHEKMGWMA-UHFFFAOYSA-N 2-benzofuran Chemical compound C1=CC=CC2=COC=C21 UXGVMFHEKMGWMA-UHFFFAOYSA-N 0.000 description 1
- JCXYZQUYVNLCTG-UHFFFAOYSA-N 2-methyl-1-morpholin-4-ylpropan-2-amine Chemical compound CC(C)(N)CN1CCOCC1 JCXYZQUYVNLCTG-UHFFFAOYSA-N 0.000 description 1
- JBYYREHWDRPCQH-UHFFFAOYSA-M 2-methyl-4-(1,4,4-trimethylpiperidin-1-ium-1-yl)butan-2-amine;chloride;hydrochloride Chemical compound Cl.[Cl-].CC(C)(N)CC[N+]1(C)CCC(C)(C)CC1 JBYYREHWDRPCQH-UHFFFAOYSA-M 0.000 description 1
- BLFRYLFPMLVCEW-UHFFFAOYSA-M 2-methyl-4-(1-methylazepan-1-ium-1-yl)butan-2-amine;chloride;hydrochloride Chemical compound Cl.[Cl-].CC(C)(N)CC[N+]1(C)CCCCCC1 BLFRYLFPMLVCEW-UHFFFAOYSA-M 0.000 description 1
- CJNSLMOCZSNHBG-UHFFFAOYSA-M 2-methyl-4-(1-methylpiperidin-1-ium-1-yl)butan-2-amine;chloride Chemical compound [Cl-].CC(C)(N)CC[N+]1(C)CCCCC1 CJNSLMOCZSNHBG-UHFFFAOYSA-M 0.000 description 1
- GBJXZZKYINNTCQ-UHFFFAOYSA-M 2-methyl-4-(1-methylpyrrolidin-1-ium-1-yl)butan-2-amine;chloride;hydrochloride Chemical compound Cl.[Cl-].CC(C)(N)CC[N+]1(C)CCCC1 GBJXZZKYINNTCQ-UHFFFAOYSA-M 0.000 description 1
- TXXOBOXKHJTCJN-UHFFFAOYSA-N 2-methyl-4-piperidin-1-ylbutan-2-amine Chemical compound CC(C)(N)CCN1CCCCC1 TXXOBOXKHJTCJN-UHFFFAOYSA-N 0.000 description 1
- NPSGZUYANLXYQA-UHFFFAOYSA-N 2-methyl-4-pyrrolidin-1-ylbutan-2-amine Chemical compound CC(C)(N)CCN1CCCC1 NPSGZUYANLXYQA-UHFFFAOYSA-N 0.000 description 1
- VUGCBIWQHSRQBZ-UHFFFAOYSA-N 2-methylbut-3-yn-2-amine Chemical compound CC(C)(N)C#C VUGCBIWQHSRQBZ-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- VHMICKWLTGFITH-UHFFFAOYSA-N 2H-isoindole Chemical compound C1=CC=CC2=CNC=C21 VHMICKWLTGFITH-UHFFFAOYSA-N 0.000 description 1
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
- AWGBKZRMLNVLAF-UHFFFAOYSA-N 3,5-dibromo-n,2-dihydroxybenzamide Chemical compound ONC(=O)C1=CC(Br)=CC(Br)=C1O AWGBKZRMLNVLAF-UHFFFAOYSA-N 0.000 description 1
- FNYAOERHBMZESV-UHFFFAOYSA-N 3-N-ethyl-3-N,3-dimethylbutane-1,3-diamine Chemical compound C(C)N(C(CCN)(C)C)C FNYAOERHBMZESV-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- MCDHJFRVNUXTBW-UHFFFAOYSA-N 3-azido-1-(4,4-dimethylpiperidin-1-yl)-3-methylbutan-1-one Chemical compound [N-]=[N+]=NC(C)(C)CC(=O)N1CCC(C)(C)CC1 MCDHJFRVNUXTBW-UHFFFAOYSA-N 0.000 description 1
- GEGGTJJBUWWHSN-UHFFFAOYSA-N 3-azido-3-methyl-1-pyrrolidin-1-ylbutan-1-one Chemical compound [N-]=[N+]=NC(C)(C)CC(=O)N1CCCC1 GEGGTJJBUWWHSN-UHFFFAOYSA-N 0.000 description 1
- NNKIALNXMULLCI-UHFFFAOYSA-N 3-azido-n,n-diethyl-3-methylbutanamide Chemical compound CCN(CC)C(=O)CC(C)(C)N=[N+]=[N-] NNKIALNXMULLCI-UHFFFAOYSA-N 0.000 description 1
- MJOUJKDTBGXKIU-UHFFFAOYSA-N 4,4-difluoropiperidine Chemical compound FC1(F)CCNCC1 MJOUJKDTBGXKIU-UHFFFAOYSA-N 0.000 description 1
- IECMOFZIMWVOAS-UHFFFAOYSA-N 4,4-dimethylpiperidine Chemical compound CC1(C)CCNCC1 IECMOFZIMWVOAS-UHFFFAOYSA-N 0.000 description 1
- OGEFXMIJHDYNBQ-UHFFFAOYSA-M 4-(1-azoniabicyclo[2.2.2]octan-1-yl)-2-methylbutan-2-amine;methanesulfonate;hydrochloride Chemical compound Cl.CS([O-])(=O)=O.C1CC2CC[N+]1(CCC(C)(N)C)CC2 OGEFXMIJHDYNBQ-UHFFFAOYSA-M 0.000 description 1
- XTCRUYVHJRLEII-UHFFFAOYSA-N 4-(4,4-difluoropiperidin-1-yl)-2-methylbutan-2-amine Chemical compound CC(C)(N)CCN1CCC(F)(F)CC1 XTCRUYVHJRLEII-UHFFFAOYSA-N 0.000 description 1
- DXAGCRNELJZCGW-UHFFFAOYSA-N 4-(4,4-dimethylpiperidin-1-yl)-2-methylbutan-2-amine Chemical compound CC(C)(N)CCN1CCC(C)(C)CC1 DXAGCRNELJZCGW-UHFFFAOYSA-N 0.000 description 1
- NZAQRZWBQUIBSF-UHFFFAOYSA-N 4-(4-sulfobutoxy)butane-1-sulfonic acid Chemical compound OS(=O)(=O)CCCCOCCCCS(O)(=O)=O NZAQRZWBQUIBSF-UHFFFAOYSA-N 0.000 description 1
- JKVMGGHPNDBTGP-UHFFFAOYSA-N 4-(azepan-1-yl)-2-methylbutan-2-amine Chemical compound CC(C)(N)CCN1CCCCCC1 JKVMGGHPNDBTGP-UHFFFAOYSA-N 0.000 description 1
- WYFCZWSWFGJODV-MIANJLSGSA-N 4-[[(1s)-2-[(e)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-5-(4-methyl-2-oxopiperazin-1-yl)-3,4-dihydro-1h-isoquinoline-1-carbonyl]amino]benzoic acid Chemical compound O=C1CN(C)CCN1C1=CC=CC2=C1CCN(C(=O)\C=C\C=1C(=CC=C(Cl)C=1F)N1N=NN=C1)[C@@H]2C(=O)NC1=CC=C(C(O)=O)C=C1 WYFCZWSWFGJODV-MIANJLSGSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- GDRVFDDBLLKWRI-UHFFFAOYSA-N 4H-quinolizine Chemical compound C1=CC=CN2CC=CC=C21 GDRVFDDBLLKWRI-UHFFFAOYSA-N 0.000 description 1
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
- RSIWALKZYXPAGW-NSHDSACASA-N 6-(3-fluorophenyl)-3-methyl-7-[(1s)-1-(7h-purin-6-ylamino)ethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one Chemical compound C=1([C@@H](NC=2C=3N=CNC=3N=CN=2)C)N=C2SC=C(C)N2C(=O)C=1C1=CC=CC(F)=C1 RSIWALKZYXPAGW-NSHDSACASA-N 0.000 description 1
- DISYDHABSCTQFK-UHFFFAOYSA-N 7-methoxy-2,3-dihydrochromen-4-one Chemical compound O=C1CCOC2=CC(OC)=CC=C21 DISYDHABSCTQFK-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 1
- 241000224422 Acanthamoeba Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000122230 Acinetobacter junii Species 0.000 description 1
- 208000002874 Acne Vulgaris Diseases 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 241000186046 Actinomyces Species 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 206010001076 Acute sinusitis Diseases 0.000 description 1
- 241000607528 Aeromonas hydrophila Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 241000834695 Auchenoglanis occidentalis Species 0.000 description 1
- 241000193738 Bacillus anthracis Species 0.000 description 1
- 241000194102 Bacillus intermedius Species 0.000 description 1
- 102100023006 Basic leucine zipper transcriptional factor ATF-like 2 Human genes 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000589513 Burkholderia cepacia Species 0.000 description 1
- 101100349268 Caenorhabditis elegans ntr-2 gene Proteins 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 206010007882 Cellulitis Diseases 0.000 description 1
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 229940127007 Compound 39 Drugs 0.000 description 1
- 206010010755 Conjunctivitis viral Diseases 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- PMPVIKIVABFJJI-UHFFFAOYSA-N Cyclobutane Chemical compound C1CCC1 PMPVIKIVABFJJI-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 1
- 201000003883 Cystic fibrosis Diseases 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- 108020004414 DNA Proteins 0.000 description 1
- 201000004624 Dermatitis Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 208000004145 Endometritis Diseases 0.000 description 1
- 208000004232 Enteritis Diseases 0.000 description 1
- 241000194033 Enterococcus Species 0.000 description 1
- 241000194032 Enterococcus faecalis Species 0.000 description 1
- 241000194031 Enterococcus faecium Species 0.000 description 1
- 241000709661 Enterovirus Species 0.000 description 1
- 241000283073 Equus caballus Species 0.000 description 1
- 201000000297 Erysipelas Diseases 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Chemical group 0.000 description 1
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 1
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 206010016936 Folliculitis Diseases 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 102000020897 Formins Human genes 0.000 description 1
- 108091022623 Formins Proteins 0.000 description 1
- 206010017553 Furuncle Diseases 0.000 description 1
- 241000223218 Fusarium Species 0.000 description 1
- 241001427367 Gardena Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 108700024827 HOC1 Proteins 0.000 description 1
- 208000004898 Herpes Labialis Diseases 0.000 description 1
- 101000903615 Homo sapiens Basic leucine zipper transcriptional factor ATF-like 2 Proteins 0.000 description 1
- 241000700588 Human alphaherpesvirus 1 Species 0.000 description 1
- 241000701074 Human alphaherpesvirus 2 Species 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- 206010021531 Impetigo Diseases 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- 241000186660 Lactobacillus Species 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- 241000270322 Lepidosauria Species 0.000 description 1
- 241000186779 Listeria monocytogenes Species 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- RJQXTJLFIWVMTO-TYNCELHUSA-N Methicillin Chemical compound COC1=CC=CC(OC)=C1C(=O)N[C@@H]1C(=O)N2[C@@H](C(O)=O)C(C)(C)S[C@@H]21 RJQXTJLFIWVMTO-TYNCELHUSA-N 0.000 description 1
- 241000289390 Monotremata Species 0.000 description 1
- 101100247628 Mus musculus Rcl1 gene Proteins 0.000 description 1
- NXTVQNIVUKXOIL-UHFFFAOYSA-N N-chlorotoluene-p-sulfonamide Chemical compound CC1=CC=C(S(=O)(=O)NCl)C=C1 NXTVQNIVUKXOIL-UHFFFAOYSA-N 0.000 description 1
- QCOGKXLOEWLIDC-UHFFFAOYSA-N N-methylbutylamine Chemical compound CCCCNC QCOGKXLOEWLIDC-UHFFFAOYSA-N 0.000 description 1
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 1
- PAMIQIKDUOTOBW-UHFFFAOYSA-N N-methylcyclohexylamine Natural products CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 1
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- QOVYHDHLFPKQQG-NDEPHWFRSA-N N[C@@H](CCC(=O)N1CCC(CC1)NC1=C2C=CC=CC2=NC(NCC2=CN(CCCNCCCNC3CCCCC3)N=N2)=N1)C(O)=O Chemical compound N[C@@H](CCC(=O)N1CCC(CC1)NC1=C2C=CC=CC2=NC(NCC2=CN(CCCNCCCNC3CCCCC3)N=N2)=N1)C(O)=O QOVYHDHLFPKQQG-NDEPHWFRSA-N 0.000 description 1
- 229920002274 Nalgene Polymers 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 206010030216 Oesophagitis Diseases 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 208000010195 Onychomycosis Diseases 0.000 description 1
- 206010067152 Oral herpes Diseases 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 208000005141 Otitis Diseases 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- 208000002606 Paramyxoviridae Infections Diseases 0.000 description 1
- 206010034016 Paronychia Diseases 0.000 description 1
- 241000009328 Perro Species 0.000 description 1
- 241000709664 Picornaviridae Species 0.000 description 1
- 241000233872 Pneumocystis carinii Species 0.000 description 1
- 206010035664 Pneumonia Diseases 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 244000110797 Polygonum persicaria Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 241000605862 Porphyromonas gingivalis Species 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 241000725643 Respiratory syncytial virus Species 0.000 description 1
- 101100178273 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) HOC1 gene Proteins 0.000 description 1
- 201000003176 Severe Acute Respiratory Syndrome Diseases 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 238000003477 Sonogashira cross-coupling reaction Methods 0.000 description 1
- 241000295644 Staphylococcaceae Species 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000193985 Streptococcus agalactiae Species 0.000 description 1
- 241001473878 Streptococcus infantarius Species 0.000 description 1
- 241000193998 Streptococcus pneumoniae Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 241001135235 Tannerella forsythia Species 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- SLGBZMMZGDRARJ-UHFFFAOYSA-N Triphenylene Natural products C1=CC=C2C3=CC=CC=C3C3=CC=CC=C3C2=C1 SLGBZMMZGDRARJ-UHFFFAOYSA-N 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 241000700618 Vaccinia virus Species 0.000 description 1
- 206010046914 Vaginal infection Diseases 0.000 description 1
- 208000005914 Viral Conjunctivitis Diseases 0.000 description 1
- 208000000260 Warts Diseases 0.000 description 1
- 241000710886 West Nile virus Species 0.000 description 1
- LJOOWESTVASNOG-UFJKPHDISA-N [(1s,3r,4ar,7s,8s,8as)-3-hydroxy-8-[2-[(4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2s)-2-methylbutanoate Chemical compound C([C@H]1[C@@H](C)C=C[C@H]2C[C@@H](O)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)CC1C[C@@H](O)CC(=O)O1 LJOOWESTVASNOG-UFJKPHDISA-N 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 125000004054 acenaphthylenyl group Chemical group C1(=CC2=CC=CC3=CC=CC1=C23)* 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- HXGDTGSAIMULJN-UHFFFAOYSA-N acetnaphthylene Natural products C1=CC(C=C2)=C3C2=CC=CC3=C1 HXGDTGSAIMULJN-UHFFFAOYSA-N 0.000 description 1
- 206010000496 acne Diseases 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000005466 alkylenyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 229940031955 anhydrous lanolin Drugs 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000000843 anti-fungal effect Effects 0.000 description 1
- 230000002924 anti-infective effect Effects 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 229940064004 antiseptic throat preparations Drugs 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 description 1
- 125000005018 aryl alkenyl group Chemical group 0.000 description 1
- 125000005015 aryl alkynyl group Chemical group 0.000 description 1
- 150000001502 aryl halides Chemical class 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 239000000305 astragalus gummifer gum Substances 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 210000003719 b-lymphocyte Anatomy 0.000 description 1
- 201000007032 bacterial conjunctivitis Diseases 0.000 description 1
- 208000002479 balanitis Diseases 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229960004365 benzoic acid Drugs 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- OZKPZYYJJBWUAR-UHFFFAOYSA-N benzyl n-(2-methyl-1-methylsulfanylpropan-2-yl)carbamate Chemical compound CSCC(C)(C)NC(=O)OCC1=CC=CC=C1 OZKPZYYJJBWUAR-UHFFFAOYSA-N 0.000 description 1
- WIJAVLNVMZKZMJ-UHFFFAOYSA-N benzyl n-(2-methyl-4-oxo-4-piperidin-1-ylbutan-2-yl)carbamate Chemical compound C=1C=CC=CC=1COC(=O)NC(C)(C)CC(=O)N1CCCCC1 WIJAVLNVMZKZMJ-UHFFFAOYSA-N 0.000 description 1
- FHUVXTAIPXCJLX-UHFFFAOYSA-N benzyl n-(2-methyl-4-piperidin-1-ylbutan-2-yl)carbamate Chemical compound C=1C=CC=CC=1COC(=O)NC(C)(C)CCN1CCCCC1 FHUVXTAIPXCJLX-UHFFFAOYSA-N 0.000 description 1
- GWPRDLOIQBOJJK-UHFFFAOYSA-N benzyl n-(2-methyl-4-pyrrolidin-1-ylbutan-2-yl)carbamate Chemical compound C=1C=CC=CC=1COC(=O)NC(C)(C)CCN1CCCC1 GWPRDLOIQBOJJK-UHFFFAOYSA-N 0.000 description 1
- KGNDCEVUMONOKF-UGPLYTSKSA-N benzyl n-[(2r)-1-[(2s,4r)-2-[[(2s)-6-amino-1-(1,3-benzoxazol-2-yl)-1,1-dihydroxyhexan-2-yl]carbamoyl]-4-[(4-methylphenyl)methoxy]pyrrolidin-1-yl]-1-oxo-4-phenylbutan-2-yl]carbamate Chemical compound C1=CC(C)=CC=C1CO[C@H]1CN(C(=O)[C@@H](CCC=2C=CC=CC=2)NC(=O)OCC=2C=CC=CC=2)[C@H](C(=O)N[C@@H](CCCCN)C(O)(O)C=2OC3=CC=CC=C3N=2)C1 KGNDCEVUMONOKF-UGPLYTSKSA-N 0.000 description 1
- UZXUTUUXMLFLBQ-UHFFFAOYSA-N benzyl n-[1-(4-acetyl-1-methylpiperazin-1-ium-1-yl)-2-methylpropan-2-yl]carbamate;iodide Chemical compound [I-].C1CN(C(=O)C)CC[N+]1(C)CC(C)(C)NC(=O)OCC1=CC=CC=C1 UZXUTUUXMLFLBQ-UHFFFAOYSA-N 0.000 description 1
- OWCJDQOAPLLJLA-UHFFFAOYSA-N benzyl n-[1-(4-acetylpiperazin-1-yl)-2-methylpropan-2-yl]carbamate Chemical compound C1CN(C(=O)C)CCN1CC(C)(C)NC(=O)OCC1=CC=CC=C1 OWCJDQOAPLLJLA-UHFFFAOYSA-N 0.000 description 1
- CMWIACINFRQZMF-UHFFFAOYSA-N benzyl n-[1-(dimethylamino)-2-methylpropan-2-yl]carbamate Chemical compound CN(C)CC(C)(C)NC(=O)OCC1=CC=CC=C1 CMWIACINFRQZMF-UHFFFAOYSA-N 0.000 description 1
- IUPYAKAELIJNPS-UHFFFAOYSA-N benzyl n-[2-methyl-4-(1,4,4-trimethylpiperidin-1-ium-1-yl)butan-2-yl]carbamate;iodide Chemical compound [I-].C=1C=CC=CC=1COC(=O)NC(C)(C)CC[N+]1(C)CCC(C)(C)CC1 IUPYAKAELIJNPS-UHFFFAOYSA-N 0.000 description 1
- XBYDBRIOZPRWEK-UHFFFAOYSA-N benzyl n-[2-methyl-4-(1-methylazepan-1-ium-1-yl)butan-2-yl]carbamate;chloride Chemical compound [Cl-].C=1C=CC=CC=1COC(=O)NC(C)(C)CC[N+]1(C)CCCCCC1 XBYDBRIOZPRWEK-UHFFFAOYSA-N 0.000 description 1
- JESNQRPBXGWNPF-UHFFFAOYSA-N benzyl n-[2-methyl-4-(1-methylpiperidin-1-ium-1-yl)butan-2-yl]carbamate;iodide Chemical compound [I-].C=1C=CC=CC=1COC(=O)NC(C)(C)CC[N+]1(C)CCCCC1 JESNQRPBXGWNPF-UHFFFAOYSA-N 0.000 description 1
- PYMHIEHHRZMSKM-UHFFFAOYSA-N benzyl n-[2-methyl-4-(1-methylpyrrolidin-1-ium-1-yl)butan-2-yl]carbamate;iodide Chemical compound [I-].C=1C=CC=CC=1COC(=O)NC(C)(C)CC[N+]1(C)CCCC1 PYMHIEHHRZMSKM-UHFFFAOYSA-N 0.000 description 1
- UNOJJKUAVFFZHY-UHFFFAOYSA-N benzyl n-[2-methyl-4-(2,2,2-trifluoroethylamino)butan-2-yl]carbamate Chemical compound FC(F)(F)CNCCC(C)(C)NC(=O)OCC1=CC=CC=C1 UNOJJKUAVFFZHY-UHFFFAOYSA-N 0.000 description 1
- QBZPJPWWWGRTHD-UHFFFAOYSA-N benzyl n-[4-(4,4-difluoro-1-methylpiperidin-1-ium-1-yl)-2-methylbutan-2-yl]carbamate;chloride Chemical compound [Cl-].C=1C=CC=CC=1COC(=O)NC(C)(C)CC[N+]1(C)CCC(F)(F)CC1 QBZPJPWWWGRTHD-UHFFFAOYSA-N 0.000 description 1
- OSQQQANFUZQHCR-UHFFFAOYSA-N benzyl n-[4-(4,4-difluoropiperidin-1-yl)-2-methylbutan-2-yl]carbamate Chemical compound C=1C=CC=CC=1COC(=O)NC(C)(C)CCN1CCC(F)(F)CC1 OSQQQANFUZQHCR-UHFFFAOYSA-N 0.000 description 1
- VLKWHNCCPRLQDY-UHFFFAOYSA-N benzyl n-[4-(4,4-dimethylpiperidin-1-yl)-2-methylbutan-2-yl]carbamate Chemical compound C=1C=CC=CC=1COC(=O)NC(C)(C)CCN1CCC(C)(C)CC1 VLKWHNCCPRLQDY-UHFFFAOYSA-N 0.000 description 1
- CYQUREMJDLKPHV-UHFFFAOYSA-N benzyl n-[4-(azepan-1-yl)-2-methylbutan-2-yl]carbamate Chemical compound C=1C=CC=CC=1COC(=O)NC(C)(C)CCN1CCCCCC1 CYQUREMJDLKPHV-UHFFFAOYSA-N 0.000 description 1
- WMLVLFFSJJQAIQ-UHFFFAOYSA-N benzyl n-[4-(dibutylamino)-2-methylbutan-2-yl]carbamate Chemical compound CCCCN(CCCC)CCC(C)(C)NC(=O)OCC1=CC=CC=C1 WMLVLFFSJJQAIQ-UHFFFAOYSA-N 0.000 description 1
- KWIQBFKUZFNYSF-UHFFFAOYSA-N benzyl n-[4-(diethylamino)-2-methylbutan-2-yl]carbamate Chemical compound CCN(CC)CCC(C)(C)NC(=O)OCC1=CC=CC=C1 KWIQBFKUZFNYSF-UHFFFAOYSA-N 0.000 description 1
- FEHFRBLHZQOWLO-UHFFFAOYSA-N benzyl n-[4-(dimethylamino)-2-methylbutan-2-yl]carbamate Chemical compound CN(C)CCC(C)(C)NC(=O)OCC1=CC=CC=C1 FEHFRBLHZQOWLO-UHFFFAOYSA-N 0.000 description 1
- DNNYGJXBBRSSFE-UHFFFAOYSA-N benzyl n-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-4-oxobutan-2-yl]carbamate Chemical compound CN(C)CCN(C)C(=O)CC(C)(C)NC(=O)OCC1=CC=CC=C1 DNNYGJXBBRSSFE-UHFFFAOYSA-N 0.000 description 1
- KIVGKKMJDLTWMR-UHFFFAOYSA-N benzyl n-[4-[3-(dimethylamino)propyl-methylamino]-2-methylbutan-2-yl]carbamate Chemical compound CN(C)CCCN(C)CCC(C)(C)NC(=O)OCC1=CC=CC=C1 KIVGKKMJDLTWMR-UHFFFAOYSA-N 0.000 description 1
- ANNBJECNDSMJTG-UHFFFAOYSA-N benzyl n-[4-[butyl(methyl)amino]-2-methylbutan-2-yl]carbamate Chemical compound CCCCN(C)CCC(C)(C)NC(=O)OCC1=CC=CC=C1 ANNBJECNDSMJTG-UHFFFAOYSA-N 0.000 description 1
- LKLYDUPPDZUFFH-UHFFFAOYSA-N benzyl n-[4-[cyclohexyl(methyl)amino]-2-methylbutan-2-yl]carbamate Chemical compound C1CCCCC1N(C)CCC(C)(C)NC(=O)OCC1=CC=CC=C1 LKLYDUPPDZUFFH-UHFFFAOYSA-N 0.000 description 1
- NPWVHGACCOZSQZ-UHFFFAOYSA-N benzyl n-[4-[dodecyl(methyl)amino]-2-methylbutan-2-yl]carbamate Chemical compound CCCCCCCCCCCCN(C)CCC(C)(C)NC(=O)OCC1=CC=CC=C1 NPWVHGACCOZSQZ-UHFFFAOYSA-N 0.000 description 1
- JOKMOJQANJFXTD-UHFFFAOYSA-N benzyl n-[4-[ethyl(methyl)amino]-2-methylbutan-2-yl]carbamate Chemical compound CCN(C)CCC(C)(C)NC(=O)OCC1=CC=CC=C1 JOKMOJQANJFXTD-UHFFFAOYSA-N 0.000 description 1
- LMSYCJWICXBLLX-UHFFFAOYSA-N benzyl n-[4-[hexyl(methyl)amino]-2-methylbutan-2-yl]carbamate Chemical compound CCCCCCN(C)CCC(C)(C)NC(=O)OCC1=CC=CC=C1 LMSYCJWICXBLLX-UHFFFAOYSA-N 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 206010006451 bronchitis Diseases 0.000 description 1
- DBWPVYGXYFONMR-UHFFFAOYSA-N butane-1,3-diamine Chemical compound [CH2]C(N)CCN DBWPVYGXYFONMR-UHFFFAOYSA-N 0.000 description 1
- OWBTYPJTUOEWEK-UHFFFAOYSA-N butane-2,3-diol Chemical compound CC(O)C(C)O OWBTYPJTUOEWEK-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229940095731 candida albicans Drugs 0.000 description 1
- 201000003984 candidiasis Diseases 0.000 description 1
- 229960001631 carbomer Drugs 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229940105329 carboxymethylcellulose Drugs 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 208000015114 central nervous system disease Diseases 0.000 description 1
- 210000000038 chest Anatomy 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 208000027157 chronic rhinosinusitis Diseases 0.000 description 1
- WCZVZNOTHYJIEI-UHFFFAOYSA-N cinnoline Chemical compound N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 description 1
- 238000001246 colloidal dispersion Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 229940125797 compound 12 Drugs 0.000 description 1
- 229940126142 compound 16 Drugs 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 229940126208 compound 22 Drugs 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 229940125851 compound 27 Drugs 0.000 description 1
- 229940127204 compound 29 Drugs 0.000 description 1
- 229940125878 compound 36 Drugs 0.000 description 1
- 229940125936 compound 42 Drugs 0.000 description 1
- 229940127113 compound 57 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 208000031513 cyst Diseases 0.000 description 1
- 201000003146 cystitis Diseases 0.000 description 1
- 230000020176 deacylation Effects 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- 229940075894 denatured ethanol Drugs 0.000 description 1
- KTHROPCPJGCLNI-UHFFFAOYSA-N diazonio-[4-(4,4-difluoropiperidin-1-yl)-2-methyl-4-oxobutan-2-yl]azanide Chemical compound [N-]=[N+]=NC(C)(C)CC(=O)N1CCC(F)(F)CC1 KTHROPCPJGCLNI-UHFFFAOYSA-N 0.000 description 1
- JSYGRUBHOCKMGQ-UHFFFAOYSA-N dichloramine Chemical compound ClNCl JSYGRUBHOCKMGQ-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- YVKDDDZOFGAQGJ-UHFFFAOYSA-N dimethyl-[2-methyl-2-(phenylmethoxycarbonylamino)propyl]sulfanium;iodide Chemical compound [I-].C[S+](C)CC(C)(C)NC(=O)OCC1=CC=CC=C1 YVKDDDZOFGAQGJ-UHFFFAOYSA-N 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 208000019258 ear infection Diseases 0.000 description 1
- 210000005069 ears Anatomy 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 150000002085 enols Chemical group 0.000 description 1
- 229940032049 enterococcus faecalis Drugs 0.000 description 1
- 210000003979 eosinophil Anatomy 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- TWAOQVMPIYQPKG-UHFFFAOYSA-N ethanone Chemical compound C[C+]=O TWAOQVMPIYQPKG-UHFFFAOYSA-N 0.000 description 1
- ANQVKHGDALCPFZ-UHFFFAOYSA-N ethyl 2-[6-(4-methylpiperazin-1-yl)-1h-benzimidazol-2-yl]acetate Chemical compound C1=C2NC(CC(=O)OCC)=NC2=CC=C1N1CCN(C)CC1 ANQVKHGDALCPFZ-UHFFFAOYSA-N 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000019688 fish Nutrition 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- RMBPEFMHABBEKP-UHFFFAOYSA-N fluorene Chemical compound C1=CC=C2C3=C[CH]C=CC3=CC2=C1 RMBPEFMHABBEKP-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 244000053095 fungal pathogen Species 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 208000007565 gingivitis Diseases 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 210000003714 granulocyte Anatomy 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 238000001631 haemodialysis Methods 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 230000000322 hemodialysis Effects 0.000 description 1
- 208000005252 hepatitis A Diseases 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- ZTUJDPKOHPKRMO-UHFFFAOYSA-N hydron;2,2,2-trifluoroethanamine;chloride Chemical compound Cl.NCC(F)(F)F ZTUJDPKOHPKRMO-UHFFFAOYSA-N 0.000 description 1
- 229920001477 hydrophilic polymer Polymers 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 1
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 1
- CUILPNURFADTPE-UHFFFAOYSA-N hypobromous acid Chemical compound BrO CUILPNURFADTPE-UHFFFAOYSA-N 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- HOBCFUWDNJPFHB-UHFFFAOYSA-N indolizine Chemical compound C1=CC=CN2C=CC=C21 HOBCFUWDNJPFHB-UHFFFAOYSA-N 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000002458 infectious effect Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 206010022000 influenza Diseases 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 210000001613 integumentary system Anatomy 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- 229940006461 iodide ion Drugs 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- GWVMLCQWXVFZCN-UHFFFAOYSA-N isoindoline Chemical compound C1=CC=C2CNCC2=C1 GWVMLCQWXVFZCN-UHFFFAOYSA-N 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 206010023332 keratitis Diseases 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229940045505 klebsiella pneumoniae Drugs 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229940039696 lactobacillus Drugs 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 description 1
- 239000002502 liposome Substances 0.000 description 1
- OVEHNNQXLPJPPL-UHFFFAOYSA-N lithium;n-propan-2-ylpropan-2-amine Chemical compound [Li].CC(C)NC(C)C OVEHNNQXLPJPPL-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical class [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 229960003085 meticillin Drugs 0.000 description 1
- 239000000693 micelle Substances 0.000 description 1
- 230000003641 microbiacidal effect Effects 0.000 description 1
- 239000004005 microsphere Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 208000008588 molluscum contagiosum Diseases 0.000 description 1
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 1
- 210000002864 mononuclear phagocyte Anatomy 0.000 description 1
- HVOYZOQVDYHUPF-UHFFFAOYSA-N n,n',n'-trimethylethane-1,2-diamine Chemical compound CNCCN(C)C HVOYZOQVDYHUPF-UHFFFAOYSA-N 0.000 description 1
- 229940088644 n,n-dimethylacrylamide Drugs 0.000 description 1
- YLGYACDQVQQZSW-UHFFFAOYSA-N n,n-dimethylprop-2-enamide Chemical compound CN(C)C(=O)C=C YLGYACDQVQQZSW-UHFFFAOYSA-N 0.000 description 1
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- OMEMQVZNTDHENJ-UHFFFAOYSA-N n-methyldodecan-1-amine Chemical compound CCCCCCCCCCCCNC OMEMQVZNTDHENJ-UHFFFAOYSA-N 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 210000000440 neutrophil Anatomy 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 231100000344 non-irritating Toxicity 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 235000014571 nuts Nutrition 0.000 description 1
- IIPIOWSSOUPIFE-UHFFFAOYSA-N o-[3-methyl-3-(phenylmethoxycarbonylamino)butyl] ethanethioate Chemical compound CC(=S)OCCC(C)(C)NC(=O)OCC1=CC=CC=C1 IIPIOWSSOUPIFE-UHFFFAOYSA-N 0.000 description 1
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N o-biphenylenemethane Natural products C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 235000021313 oleic acid Nutrition 0.000 description 1
- 239000003605 opacifier Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- GUVXZFRDPCKWEM-UHFFFAOYSA-N pentalene Chemical compound C1=CC2=CC=CC2=C1 GUVXZFRDPCKWEM-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 208000028169 periodontal disease Diseases 0.000 description 1
- 201000001245 periodontitis Diseases 0.000 description 1
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 description 1
- CSHWQDPOILHKBI-UHFFFAOYSA-N peryrene Natural products C1=CC(C2=CC=CC=3C2=C2C=CC=3)=C3C2=CC=CC3=C1 CSHWQDPOILHKBI-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- NQFOGDIWKQWFMN-UHFFFAOYSA-N phenalene Chemical compound C1=CC([CH]C=C2)=C3C2=CC=CC3=C1 NQFOGDIWKQWFMN-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Chemical group O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- LFGREXWGYUGZLY-UHFFFAOYSA-N phosphoryl Chemical group [P]=O LFGREXWGYUGZLY-UHFFFAOYSA-N 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920002503 polyoxyethylene-polyoxypropylene Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 230000002980 postoperative effect Effects 0.000 description 1
- TZLVRPLSVNESQC-UHFFFAOYSA-N potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- WSHYKIAQCMIPTB-UHFFFAOYSA-M potassium;2-oxo-3-(3-oxo-1-phenylbutyl)chromen-4-olate Chemical compound [K+].[O-]C=1C2=CC=CC=C2OC(=O)C=1C(CC(=O)C)C1=CC=CC=C1 WSHYKIAQCMIPTB-UHFFFAOYSA-M 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- CPNGPNLZQNNVQM-UHFFFAOYSA-N pteridine Chemical compound N1=CN=CC2=NC=CN=C21 CPNGPNLZQNNVQM-UHFFFAOYSA-N 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- USPWKWBDZOARPV-UHFFFAOYSA-N pyrazolidine Chemical compound C1CNNC1 USPWKWBDZOARPV-UHFFFAOYSA-N 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000001850 reproductive effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 206010039083 rhinitis Diseases 0.000 description 1
- IFDVTXPSSBZTIF-UHFFFAOYSA-N s-[2-methyl-2-(phenylmethoxycarbonylamino)propyl] ethanethioate Chemical compound CC(=O)SCC(C)(C)NC(=O)OCC1=CC=CC=C1 IFDVTXPSSBZTIF-UHFFFAOYSA-N 0.000 description 1
- IGSOPLSJQZLBFJ-UHFFFAOYSA-N s-[3-methyl-3-(phenylmethoxycarbonylamino)butyl] ethanethioate Chemical compound CC(=O)SCCC(C)(C)NC(=O)OCC1=CC=CC=C1 IGSOPLSJQZLBFJ-UHFFFAOYSA-N 0.000 description 1
- 239000008299 semisolid dosage form Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000004999 sex organ Anatomy 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- VFWRGKJLLYDFBY-UHFFFAOYSA-N silver;hydrate Chemical compound O.[Ag].[Ag] VFWRGKJLLYDFBY-UHFFFAOYSA-N 0.000 description 1
- 201000009890 sinusitis Diseases 0.000 description 1
- 201000010153 skin papilloma Diseases 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- PPASLZSBLFJQEF-RKJRWTFHSA-M sodium ascorbate Substances [Na+].OC[C@@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RKJRWTFHSA-M 0.000 description 1
- 235000010378 sodium ascorbate Nutrition 0.000 description 1
- 229960005055 sodium ascorbate Drugs 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- PPASLZSBLFJQEF-RXSVEWSESA-M sodium-L-ascorbate Chemical compound [Na+].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RXSVEWSESA-M 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 208000003265 stomatitis Diseases 0.000 description 1
- 229940031000 streptococcus pneumoniae Drugs 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- 230000000153 supplemental effect Effects 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 229950009390 symclosene Drugs 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229960003080 taurine Drugs 0.000 description 1
- GOPJCENSQSILMD-UHFFFAOYSA-N tert-butyl n-but-3-yn-2-yl-n-methylcarbamate Chemical compound C#CC(C)N(C)C(=O)OC(C)(C)C GOPJCENSQSILMD-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 201000005882 tinea unguium Diseases 0.000 description 1
- 210000003371 toe Anatomy 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005580 triphenylene group Chemical group 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 231100000397 ulcer Toxicity 0.000 description 1
- 241000701161 unidentified adenovirus Species 0.000 description 1
- 206010051250 ureteritis Diseases 0.000 description 1
- 210000003708 urethra Anatomy 0.000 description 1
- 208000000143 urethritis Diseases 0.000 description 1
- 229960005486 vaccine Drugs 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
- 239000000230 xanthan gum Substances 0.000 description 1
- 235000010493 xanthan gum Nutrition 0.000 description 1
- 229920001285 xanthan gum Polymers 0.000 description 1
- 229940082509 xanthan gum Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/04—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C229/06—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton
- C07C229/10—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton the nitrogen atom of the amino group being further bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings
- C07C229/12—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton the nitrogen atom of the amino group being further bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings to carbon atoms of acyclic carbon skeletons
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/13—Amines
- A61K31/14—Quaternary ammonium compounds, e.g. edrophonium, choline
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/02—Local antiseptics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/34—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/40—Esters of carbamic acids having oxygen atoms of carbamate groups bound to carbon atoms of six-membered aromatic rings
- C07C271/42—Esters of carbamic acids having oxygen atoms of carbamate groups bound to carbon atoms of six-membered aromatic rings with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/54—Esters of carbamic acids having oxygen atoms of carbamate groups bound to carbon atoms of six-membered aromatic rings with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Epidemiology (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Dermatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Hydrogenated Pyridines (AREA)
- Apparatus For Disinfection Or Sterilisation (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Materials For Medical Uses (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US11267408P | 2008-11-07 | 2008-11-07 | |
| US61/112,674 | 2008-11-07 | ||
| PCT/US2009/063652 WO2010054269A1 (en) | 2008-11-07 | 2009-11-06 | Antimicrobial n-chlorinated compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2741667A1 true CA2741667A1 (en) | 2010-05-14 |
Family
ID=42153282
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA2741667A Abandoned CA2741667A1 (en) | 2008-11-07 | 2009-11-06 | Antimicrobial n-chlorinated compositions |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US8278482B2 (OSRAM) |
| EP (1) | EP2341886B1 (OSRAM) |
| JP (1) | JP5599808B2 (OSRAM) |
| CA (1) | CA2741667A1 (OSRAM) |
| WO (1) | WO2010054269A1 (OSRAM) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2012054521A2 (en) * | 2010-10-19 | 2012-04-26 | Novabay Pharmaceuticlas, Inc. | Antimicrobial polyether and polyol compounds |
| US9028807B2 (en) | 2012-04-05 | 2015-05-12 | Ues, Inc. | Synthesis models for antimicrobial agents via the halogenation of organic/inorganic composites |
| MX2014013991A (es) * | 2012-05-17 | 2015-08-06 | Univ Manitoba | Compuestos biocidas y metodos para usar los mismos. |
| US9145352B2 (en) * | 2012-05-30 | 2015-09-29 | Universidad De Caldas | Quaternary N-(halomethyl) ammonium salts as therapeutic agents |
| MX364611B (es) * | 2013-03-15 | 2019-05-02 | Genzyme Corp | Poliamidas con funcionalidad amina. |
| US9468654B1 (en) | 2014-04-02 | 2016-10-18 | Ali Razavi | Drug delivery compositions and methods |
| JP6478775B2 (ja) * | 2014-05-15 | 2019-03-06 | キヤノン株式会社 | アミン化合物及びイオン導電剤、導電性樹脂組成物 |
| CN107935892B (zh) * | 2017-11-24 | 2020-06-02 | 万华化学集团股份有限公司 | 一种制备乙二胺基乙磺酸钠的方法 |
| EP4294183B1 (en) | 2021-02-17 | 2025-11-12 | Oxion Dental, LLC | Stabilized active oxygen-generating antiseptic compositions, irrigation solutions, and articles |
| CN113851683B (zh) * | 2021-08-27 | 2023-10-20 | 重庆大学 | 一种咔唑类聚芳烃哌啶阴离子交换膜的制备方法 |
| US20250325569A1 (en) * | 2022-04-13 | 2025-10-23 | Ohio State Innovation Foundation | Compositions and methods of making and use thereof |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4036843A (en) | 1975-11-14 | 1977-07-19 | Interx Research Corporation | Certain chloroamino esters of pyridine carboxylates and derivatives thereof |
| US4981926A (en) * | 1990-02-06 | 1991-01-01 | The Dow Chemical Company | Composition of epoxy resin, amino group-containing phosphonium catalyst and curing agent |
| US5026490A (en) * | 1990-08-08 | 1991-06-25 | Exxon Research & Engineering | Zwitterionic functionalized polymers as deflocculants in water based drilling fluids |
| CA2320556A1 (en) | 1999-09-29 | 2001-03-29 | Queen's University At Kingston | N,n-dichlorinated omega amino acids and uses thereof |
| PL1656095T3 (pl) | 2003-08-18 | 2014-04-30 | Novabay Pharmaceuticals Inc | N,n-dwuchlorowcowane kwasy aminowe i pochodne |
| TWI386201B (zh) | 2005-01-25 | 2013-02-21 | Novabay Pharmaceuticals Inc | N-鹵化胺基酸、n,n-二鹵化胺基酸與其衍生物;以及使用其之組合物與方法 |
| TW200843787A (en) * | 2006-12-29 | 2008-11-16 | Novabay Pharmaceuticals Inc | N-halogenated amino compounds and derivatives; compositions and methods of using them |
| EP2265267B1 (en) * | 2008-04-10 | 2016-09-21 | Waldemar Gottardi | Compositions comprising n-halogenated or n, n-dihalogenated amine for treatment and prophylaxis of bronchopulmonary infections |
| CN102176818A (zh) * | 2008-08-12 | 2011-09-07 | 诺华贝制药公司 | 抗微生物凝胶制剂 |
| US20100272783A1 (en) * | 2009-04-24 | 2010-10-28 | Novabay Pharmaceuticals, Inc. | Methods of Treating Infections of the Nail |
| EP2531026A4 (en) * | 2010-02-04 | 2013-09-25 | Novabay Pharmaceuticals Inc | ANTIMICROBIAL FORMULATIONS ON POLYSACCHARID BASE |
-
2009
- 2009-11-06 EP EP09825526.8A patent/EP2341886B1/en not_active Not-in-force
- 2009-11-06 CA CA2741667A patent/CA2741667A1/en not_active Abandoned
- 2009-11-06 US US12/614,347 patent/US8278482B2/en active Active - Reinstated
- 2009-11-06 WO PCT/US2009/063652 patent/WO2010054269A1/en not_active Ceased
- 2009-11-06 JP JP2011535709A patent/JP5599808B2/ja not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| EP2341886B1 (en) | 2015-08-26 |
| WO2010054269A1 (en) | 2010-05-14 |
| JP2012508251A (ja) | 2012-04-05 |
| JP5599808B2 (ja) | 2014-10-01 |
| US20100158818A1 (en) | 2010-06-24 |
| US8278482B2 (en) | 2012-10-02 |
| EP2341886A1 (en) | 2011-07-13 |
| EP2341886A4 (en) | 2012-08-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP2341886B1 (en) | Antimicrobial n-chlorinated compositions | |
| US7893109B2 (en) | N,N-dihalogenated amino acids and derivatives | |
| EP2120965B1 (en) | N-halogenated amino compounds and derivatives | |
| EP2341777B1 (en) | Antimicrobial oxazolidinone, hydantoin and imidazolidinone compositions | |
| CN103260402A (zh) | 抗微生物聚醚和多元醇化合物 | |
| ES2203316B1 (es) | R-(-)-1-(2-(7-cloro-benzo(b)tiofen-3-il-metoxi)-2-(2,4-dicloro-fenil)-etil)1h-imidazol. | |
| US8729112B2 (en) | Antimicrobial haloalkyl heterocycle compounds | |
| US20230028523A1 (en) | Lipophosphonoxins, their preparation and use | |
| KR20240123157A (ko) | 폴리아민이 결합된 아스코르브산 유도체 및 그 제조방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request |
Effective date: 20141103 |
|
| FZDE | Discontinued |
Effective date: 20170228 |