CA2615490A1 - Synthese stereoselective de cyclopentanones 3,4-disubstitues et composes correspondants - Google Patents
Synthese stereoselective de cyclopentanones 3,4-disubstitues et composes correspondants Download PDFInfo
- Publication number
- CA2615490A1 CA2615490A1 CA002615490A CA2615490A CA2615490A1 CA 2615490 A1 CA2615490 A1 CA 2615490A1 CA 002615490 A CA002615490 A CA 002615490A CA 2615490 A CA2615490 A CA 2615490A CA 2615490 A1 CA2615490 A1 CA 2615490A1
- Authority
- CA
- Canada
- Prior art keywords
- formula
- compound
- alkyl
- opposite enantiomer
- dimethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- -1 3,4-disubstituted cyclopentanones Chemical class 0.000 title claims abstract description 199
- 150000001875 compounds Chemical class 0.000 title claims abstract description 153
- 230000015572 biosynthetic process Effects 0.000 title description 6
- 230000000707 stereoselective effect Effects 0.000 title description 4
- 238000003786 synthesis reaction Methods 0.000 title description 4
- 238000000034 method Methods 0.000 claims abstract description 46
- 150000002148 esters Chemical group 0.000 claims abstract description 15
- 230000003301 hydrolyzing effect Effects 0.000 claims abstract description 6
- 239000000203 mixture Substances 0.000 claims description 70
- 150000003839 salts Chemical class 0.000 claims description 53
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims description 40
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 25
- 125000001424 substituent group Chemical group 0.000 claims description 19
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 17
- OTKFCIVOVKCFHR-UHFFFAOYSA-N (Methylsulfinyl)(methylthio)methane Chemical compound CSCS(C)=O OTKFCIVOVKCFHR-UHFFFAOYSA-N 0.000 claims description 16
- 125000003118 aryl group Chemical group 0.000 claims description 16
- 125000005843 halogen group Chemical group 0.000 claims description 16
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 238000004519 manufacturing process Methods 0.000 claims description 9
- AZIKIRHNHQJEMR-BQBZGAKWSA-N (3r,4s)-3,4-dimethyl-1-methylsulfanylcyclopentene Chemical compound CSC1=C[C@H](C)[C@@H](C)C1 AZIKIRHNHQJEMR-BQBZGAKWSA-N 0.000 claims description 8
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 8
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 8
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 8
- ZJHSCENKGUGQTI-KNTUYYKSSA-N (3s,4s)-3,4-dimethyl-1-methylsulfanyl-1-methylsulfinylcyclopentane Chemical compound CSC1(S(C)=O)C[C@H](C)[C@@H](C)C1 ZJHSCENKGUGQTI-KNTUYYKSSA-N 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 238000005984 hydrogenation reaction Methods 0.000 claims description 5
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 4
- 230000002829 reductive effect Effects 0.000 claims description 4
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims description 3
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 3
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 claims description 3
- ULSQSYZPZBSCCO-HBPOCXIASA-N (1r,2r,3s)-2,3-dimethyl-5-oxocyclopentane-1-carboxylic acid Chemical compound C[C@H]1CC(=O)[C@H](C(O)=O)[C@@H]1C ULSQSYZPZBSCCO-HBPOCXIASA-N 0.000 claims description 2
- ULSQSYZPZBSCCO-BFHQHQDPSA-N (1s,2r,3s)-2,3-dimethyl-5-oxocyclopentane-1-carboxylic acid Chemical compound C[C@H]1CC(=O)[C@@H](C(O)=O)[C@@H]1C ULSQSYZPZBSCCO-BFHQHQDPSA-N 0.000 claims description 2
- ULSQSYZPZBSCCO-YQGMFIQUSA-N (2r,3s)-2,3-dimethyl-5-oxocyclopentane-1-carboxylic acid Chemical compound C[C@H]1CC(=O)C(C(O)=O)[C@@H]1C ULSQSYZPZBSCCO-YQGMFIQUSA-N 0.000 claims description 2
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims description 2
- 239000003377 acid catalyst Substances 0.000 claims description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 2
- DFYXMRYQOSKTMH-SHYZEUOFSA-N methyl (1r,2r,3s)-2,3-dimethyl-5-oxocyclopentane-1-carboxylate Chemical compound COC(=O)[C@@H]1[C@H](C)[C@@H](C)CC1=O DFYXMRYQOSKTMH-SHYZEUOFSA-N 0.000 claims description 2
- DFYXMRYQOSKTMH-BBVRLYRLSA-N methyl (1s,2r,3s)-2,3-dimethyl-5-oxocyclopentane-1-carboxylate Chemical compound COC(=O)[C@H]1[C@H](C)[C@@H](C)CC1=O DFYXMRYQOSKTMH-BBVRLYRLSA-N 0.000 claims description 2
- DFYXMRYQOSKTMH-FWHJPCMOSA-N methyl (2r,3s)-2,3-dimethyl-5-oxocyclopentane-1-carboxylate Chemical compound COC(=O)C1[C@H](C)[C@@H](C)CC1=O DFYXMRYQOSKTMH-FWHJPCMOSA-N 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- QDRHSSOZDONJNQ-GEMLJDPKSA-M sodium;(3s,4s)-1-hydroxy-3,4-dimethylcyclopentane-1-sulfonate Chemical compound [Na+].C[C@H]1CC(O)(S([O-])(=O)=O)C[C@@H]1C QDRHSSOZDONJNQ-GEMLJDPKSA-M 0.000 claims description 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 23
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 20
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims 6
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 2
- 239000000463 material Substances 0.000 abstract description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 144
- 239000000243 solution Substances 0.000 description 94
- 229910001868 water Inorganic materials 0.000 description 79
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 65
- 239000002585 base Substances 0.000 description 61
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 51
- 238000006243 chemical reaction Methods 0.000 description 51
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical class O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 41
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 40
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 37
- 239000002253 acid Substances 0.000 description 35
- 239000002002 slurry Substances 0.000 description 31
- 239000011541 reaction mixture Substances 0.000 description 30
- 238000002360 preparation method Methods 0.000 description 28
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- 125000000217 alkyl group Chemical group 0.000 description 26
- ZMGMYCHEWPVBEL-WDSKDSINSA-N (3s,4s)-3,4-dimethylcyclopentan-1-one Chemical compound C[C@H]1CC(=O)C[C@@H]1C ZMGMYCHEWPVBEL-WDSKDSINSA-N 0.000 description 25
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 23
- 239000007787 solid Substances 0.000 description 23
- 238000010992 reflux Methods 0.000 description 20
- 239000010410 layer Substances 0.000 description 19
- 229910052757 nitrogen Inorganic materials 0.000 description 19
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 18
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- 235000019439 ethyl acetate Nutrition 0.000 description 18
- 239000003921 oil Substances 0.000 description 18
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 17
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 17
- 239000000047 product Substances 0.000 description 17
- 101150041968 CDC13 gene Proteins 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- ZMANZCXQSJIPKH-UHFFFAOYSA-N N,N-Diethylethanamine Substances CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 16
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 16
- XXXCFFZTHHSPND-ROUUACIJSA-N [(2r,3r)-2,3-dimethyl-4-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate Chemical compound C([C@H](C)[C@@H](C)COS(=O)(=O)C=1C=CC(C)=CC=1)OS(=O)(=O)C1=CC=C(C)C=C1 XXXCFFZTHHSPND-ROUUACIJSA-N 0.000 description 16
- UIYCHXAGWOYNNA-UHFFFAOYSA-N vinyl sulfide Chemical compound C=CSC=C UIYCHXAGWOYNNA-UHFFFAOYSA-N 0.000 description 16
- YGNOTSXXQFFAFO-RFZPGFLSSA-N (2r,3r)-4-methoxy-2,3-dimethyl-4-oxobutanoic acid Chemical compound COC(=O)[C@H](C)[C@@H](C)C(O)=O YGNOTSXXQFFAFO-RFZPGFLSSA-N 0.000 description 15
- 238000005160 1H NMR spectroscopy Methods 0.000 description 15
- 230000007062 hydrolysis Effects 0.000 description 15
- 238000006460 hydrolysis reaction Methods 0.000 description 15
- 230000009467 reduction Effects 0.000 description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 14
- 239000003054 catalyst Substances 0.000 description 14
- 239000012044 organic layer Substances 0.000 description 14
- 239000012071 phase Substances 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- SKQUTIPQJKQFRA-WDSKDSINSA-N (2r,3r)-2,3-dimethylbutane-1,4-diol Chemical compound OC[C@H](C)[C@@H](C)CO SKQUTIPQJKQFRA-WDSKDSINSA-N 0.000 description 13
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 13
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 13
- 239000012074 organic phase Substances 0.000 description 13
- 239000000758 substrate Substances 0.000 description 13
- 229910052717 sulfur Chemical group 0.000 description 13
- UVQYBUYGFBXQGO-SCSAIBSYSA-N (2r)-4-methoxy-2-methyl-4-oxobutanoic acid Chemical compound COC(=O)C[C@@H](C)C(O)=O UVQYBUYGFBXQGO-SCSAIBSYSA-N 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 12
- 125000004432 carbon atom Chemical group C* 0.000 description 12
- 238000004128 high performance liquid chromatography Methods 0.000 description 11
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- 239000001257 hydrogen Substances 0.000 description 11
- RCCPEORTSYDPMB-UHFFFAOYSA-N hydroxy benzenecarboximidothioate Chemical compound OSC(=N)C1=CC=CC=C1 RCCPEORTSYDPMB-UHFFFAOYSA-N 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 239000008346 aqueous phase Substances 0.000 description 10
- 125000000753 cycloalkyl group Chemical group 0.000 description 10
- 150000002009 diols Chemical class 0.000 description 10
- 239000012535 impurity Substances 0.000 description 10
- 239000002244 precipitate Substances 0.000 description 10
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 9
- 125000003545 alkoxy group Chemical group 0.000 description 9
- 238000001914 filtration Methods 0.000 description 9
- 239000000376 reactant Substances 0.000 description 9
- HXFIRQHMXJBTRV-QWWZWVQMSA-N (3r,4r)-3,4-dimethyloxolane-2,5-dione Chemical compound C[C@@H]1[C@@H](C)C(=O)OC1=O HXFIRQHMXJBTRV-QWWZWVQMSA-N 0.000 description 8
- CNCRBAYWBZGPBZ-YUMQZZPRSA-N (7s,8s)-7,8-dimethyl-2-azaspiro[4.4]nonan-3-one Chemical compound C1[C@H](C)[C@@H](C)CC11CC(=O)NC1 CNCRBAYWBZGPBZ-YUMQZZPRSA-N 0.000 description 8
- 238000005804 alkylation reaction Methods 0.000 description 8
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- 238000003828 vacuum filtration Methods 0.000 description 8
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- IUVMAUQEZFTTFB-YUMQZZPRSA-N Atagabalin Chemical compound C[C@H]1CC(CN)(CC(O)=O)C[C@@H]1C IUVMAUQEZFTTFB-YUMQZZPRSA-N 0.000 description 7
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 7
- 239000002168 alkylating agent Substances 0.000 description 7
- 229940100198 alkylating agent Drugs 0.000 description 7
- 125000002619 bicyclic group Chemical group 0.000 description 7
- QLHNVWKVWDIVIG-IUCAKERBSA-N ethyl 2-[(3s,4s)-3,4-dimethylcyclopentylidene]acetate Chemical compound CCOC(=O)C=C1C[C@H](C)[C@@H](C)C1 QLHNVWKVWDIVIG-IUCAKERBSA-N 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 238000002955 isolation Methods 0.000 description 7
- 230000008569 process Effects 0.000 description 7
- 125000006239 protecting group Chemical group 0.000 description 7
- 239000012453 solvate Substances 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- JDVPQXZIJDEHAN-UHFFFAOYSA-N succinamic acid Chemical compound NC(=O)CCC(O)=O JDVPQXZIJDEHAN-UHFFFAOYSA-N 0.000 description 7
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical class OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 7
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 238000005481 NMR spectroscopy Methods 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 125000003342 alkenyl group Chemical group 0.000 description 6
- 230000029936 alkylation Effects 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- 235000019441 ethanol Nutrition 0.000 description 6
- XFBFXEQNMLQECT-UWVGGRQHSA-N ethyl 2-[(3s,4s)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate Chemical compound CCOC(=O)CC1(C[N+]([O-])=O)C[C@H](C)[C@@H](C)C1 XFBFXEQNMLQECT-UWVGGRQHSA-N 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 125000002950 monocyclic group Chemical group 0.000 description 6
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 6
- 238000006467 substitution reaction Methods 0.000 description 6
- 238000010626 work up procedure Methods 0.000 description 6
- JSDLZYHSBDSAGZ-WDSKDSINSA-N (3s,4s)-3,4-dimethylhexanedioic acid Chemical compound OC(=O)C[C@H](C)[C@@H](C)CC(O)=O JSDLZYHSBDSAGZ-WDSKDSINSA-N 0.000 description 5
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 5
- 101100424627 Caenorhabditis elegans mec-12 gene Proteins 0.000 description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 5
- 125000000304 alkynyl group Chemical group 0.000 description 5
- 150000001408 amides Chemical group 0.000 description 5
- 125000000732 arylene group Chemical group 0.000 description 5
- 125000004429 atom Chemical group 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 5
- 125000001589 carboacyl group Chemical group 0.000 description 5
- 125000000000 cycloalkoxy group Chemical group 0.000 description 5
- 150000005690 diesters Chemical class 0.000 description 5
- 239000012065 filter cake Substances 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 150000002430 hydrocarbons Chemical group 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- 150000002576 ketones Chemical class 0.000 description 5
- 150000003951 lactams Chemical class 0.000 description 5
- LZWQNOHZMQIFBX-UHFFFAOYSA-N lithium;2-methylpropan-2-olate Chemical compound [Li+].CC(C)(C)[O-] LZWQNOHZMQIFBX-UHFFFAOYSA-N 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- XUYJLQHKOGNDPB-UHFFFAOYSA-N phosphonoacetic acid Chemical compound OC(=O)CP(O)(O)=O XUYJLQHKOGNDPB-UHFFFAOYSA-N 0.000 description 5
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 5
- 239000004810 polytetrafluoroethylene Substances 0.000 description 5
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 5
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 5
- 238000010791 quenching Methods 0.000 description 5
- KLZYRCVPDWTZLH-QWWZWVQMSA-N (2r,3r)-2,3-dimethylbutanedioic acid Chemical compound OC(=O)[C@H](C)[C@@H](C)C(O)=O KLZYRCVPDWTZLH-QWWZWVQMSA-N 0.000 description 4
- MSXVEPNJUHWQHW-UHFFFAOYSA-N 2-methylbutan-2-ol Chemical compound CCC(C)(C)O MSXVEPNJUHWQHW-UHFFFAOYSA-N 0.000 description 4
- FEJUGLKDZJDVFY-UHFFFAOYSA-N 9-borabicyclo[3.3.1]nonane Substances C1CCC2CCCC1B2 FEJUGLKDZJDVFY-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- 239000012455 biphasic mixture Substances 0.000 description 4
- 239000001273 butane Substances 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 230000015556 catabolic process Effects 0.000 description 4
- 239000003638 chemical reducing agent Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000006731 degradation reaction Methods 0.000 description 4
- KESZJEAHJIQHHK-YUMQZZPRSA-N dimethyl (3s,4s)-3,4-dimethylhexanedioate Chemical compound COC(=O)C[C@H](C)[C@@H](C)CC(=O)OC KESZJEAHJIQHHK-YUMQZZPRSA-N 0.000 description 4
- 239000012458 free base Substances 0.000 description 4
- 125000005842 heteroatom Chemical group 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 150000004677 hydrates Chemical class 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 231100000252 nontoxic Toxicity 0.000 description 4
- 230000003000 nontoxic effect Effects 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 4
- 239000011593 sulfur Chemical group 0.000 description 4
- RJJHPBFVCUFEDH-NXEZZACHSA-N (3R,4R)-3,4-di(propan-2-yl)hexanedioic acid Chemical compound C(C)(C)[C@@H](CC(=O)O)[C@H](CC(=O)O)C(C)C RJJHPBFVCUFEDH-NXEZZACHSA-N 0.000 description 3
- LYCITPKIKGAJFD-ROUUACIJSA-N (3s,4s)-3,4-dibenzylhexanedioic acid Chemical compound C([C@@H](CC(=O)O)[C@H](CC(O)=O)CC=1C=CC=CC=1)C1=CC=CC=C1 LYCITPKIKGAJFD-ROUUACIJSA-N 0.000 description 3
- XFXRDLHSCGJREW-YUMQZZPRSA-N (3s,4s)-3,4-diethylhexanedioic acid Chemical compound OC(=O)C[C@H](CC)[C@@H](CC)CC(O)=O XFXRDLHSCGJREW-YUMQZZPRSA-N 0.000 description 3
- RVBIBIQFCXCQJI-UWVGGRQHSA-N (3s,4s)-3,4-dipropylhexanedioic acid Chemical compound CCC[C@@H](CC(O)=O)[C@@H](CCC)CC(O)=O RVBIBIQFCXCQJI-UWVGGRQHSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 208000002193 Pain Diseases 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 238000013019 agitation Methods 0.000 description 3
- 125000005907 alkyl ester group Chemical group 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000000010 aprotic solvent Substances 0.000 description 3
- 239000011260 aqueous acid Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 229910000024 caesium carbonate Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- VILAVOFMIJHSJA-UHFFFAOYSA-N dicarbon monoxide Chemical compound [C]=C=O VILAVOFMIJHSJA-UHFFFAOYSA-N 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000004817 gas chromatography Methods 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 230000000155 isotopic effect Effects 0.000 description 3
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 3
- UPRXAOPZPSAYHF-UHFFFAOYSA-N lithium;cyclohexyl(propan-2-yl)azanide Chemical compound CC(C)N([Li])C1CCCCC1 UPRXAOPZPSAYHF-UHFFFAOYSA-N 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 235000005985 organic acids Nutrition 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Chemical group 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- IUBQJLUDMLPAGT-UHFFFAOYSA-N potassium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([K])[Si](C)(C)C IUBQJLUDMLPAGT-UHFFFAOYSA-N 0.000 description 3
- 125000004076 pyridyl group Chemical group 0.000 description 3
- 125000000714 pyrimidinyl group Chemical group 0.000 description 3
- 125000006413 ring segment Chemical group 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 3
- 235000010262 sodium metabisulphite Nutrition 0.000 description 3
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 3
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 description 3
- 238000005292 vacuum distillation Methods 0.000 description 3
- XMBSMMCPKFDGEO-ZETCQYMHSA-N (2s)-2-amino-5-[[amino-(2-methoxyethylamino)methylidene]amino]pentanoic acid Chemical compound COCCNC(=N)NCCC[C@H](N)C(O)=O XMBSMMCPKFDGEO-ZETCQYMHSA-N 0.000 description 2
- FEYLYTBPPCYZLO-YUMQZZPRSA-N (4s,5s)-4,5-dimethylcyclohexene Chemical compound C[C@H]1CC=CC[C@@H]1C FEYLYTBPPCYZLO-YUMQZZPRSA-N 0.000 description 2
- RKMGAJGJIURJSJ-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidine Chemical compound CC1(C)CCCC(C)(C)N1 RKMGAJGJIURJSJ-UHFFFAOYSA-N 0.000 description 2
- AMKGKYQBASDDJB-UHFFFAOYSA-N 9$l^{2}-borabicyclo[3.3.1]nonane Chemical compound C1CCC2CCCC1[B]2 AMKGKYQBASDDJB-UHFFFAOYSA-N 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- WQOXQRCZOLPYPM-UHFFFAOYSA-N Dimethyl disulfide Natural products CSSC WQOXQRCZOLPYPM-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 229910004373 HOAc Inorganic materials 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 238000006939 Krapcho dealkoxycarbonylation reaction Methods 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 2
- 229910004879 Na2S2O5 Inorganic materials 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 125000003865 brosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)S(*)(=O)=O 0.000 description 2
- HUCVOHYBFXVBRW-UHFFFAOYSA-M caesium hydroxide Chemical compound [OH-].[Cs+] HUCVOHYBFXVBRW-UHFFFAOYSA-M 0.000 description 2
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- SURQXAFEQWPFPV-UHFFFAOYSA-L iron(2+) sulfate heptahydrate Chemical compound O.O.O.O.O.O.O.[Fe+2].[O-]S([O-])(=O)=O SURQXAFEQWPFPV-UHFFFAOYSA-L 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Substances [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- ANYSGBYRTLOUPO-UHFFFAOYSA-N lithium tetramethylpiperidide Chemical compound [Li]N1C(C)(C)CCCC1(C)C ANYSGBYRTLOUPO-UHFFFAOYSA-N 0.000 description 2
- PKMBLJNMKINMSK-UHFFFAOYSA-N magnesium;azanide Chemical compound [NH2-].[NH2-].[Mg+2] PKMBLJNMKINMSK-UHFFFAOYSA-N 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 239000011733 molybdenum Substances 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 2
- 125000000160 oxazolidinyl group Chemical group 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 239000003880 polar aprotic solvent Substances 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 208000020016 psychiatric disease Diseases 0.000 description 2
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 125000003226 pyrazolyl group Chemical group 0.000 description 2
- 125000002098 pyridazinyl group Chemical group 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 238000012552 review Methods 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 208000019116 sleep disease Diseases 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 239000001384 succinic acid Substances 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- LVHMGUUYDATGPK-ZCFIWIBFSA-N (2R)-2-methyl-4-oxo-4-propoxybutanoic acid Chemical compound C(CC)OC(C[C@H](C(=O)O)C)=O LVHMGUUYDATGPK-ZCFIWIBFSA-N 0.000 description 1
- MGYUMVAIEXFVET-NXEZZACHSA-N (2R,3R)-2,3-di(propan-2-yl)butane-1,4-diol Chemical compound C(C)(C)[C@@H](CO)[C@H](CO)C(C)C MGYUMVAIEXFVET-NXEZZACHSA-N 0.000 description 1
- HSCLUIKEZDGKBP-HTQZYQBOSA-N (2R,3R)-2,3-di(propan-2-yl)butanedioic acid Chemical compound CC(C)[C@H]([C@@H](C(C)C)C(O)=O)C(O)=O HSCLUIKEZDGKBP-HTQZYQBOSA-N 0.000 description 1
- YBPZCVWEDDHNKO-QZTJIDSGSA-N (2R,3R)-2,3-dibenzyl-4-ethoxy-4-oxobutanoic acid Chemical compound C(C)OC([C@@H]([C@H](C(=O)O)CC1=CC=CC=C1)CC1=CC=CC=C1)=O YBPZCVWEDDHNKO-QZTJIDSGSA-N 0.000 description 1
- OWUUJFPCWLFCIT-ROUUACIJSA-N (2R,3R)-2,3-dibenzylbutane-1,4-diol Chemical compound C(C1=CC=CC=C1)[C@@H](CO)[C@H](CO)CC1=CC=CC=C1 OWUUJFPCWLFCIT-ROUUACIJSA-N 0.000 description 1
- VWLZGROLRVQREK-UWVGGRQHSA-N (2R,3R)-2,3-dipropylbutane-1,4-diol Chemical compound C(CC)[C@@H](CO)[C@H](CO)CCC VWLZGROLRVQREK-UWVGGRQHSA-N 0.000 description 1
- ZBHMFRUDZQIRQC-HTQZYQBOSA-N (2R,3R)-2,3-dipropylbutanedioic acid Chemical compound CCC[C@@H](C(O)=O)[C@H](C(O)=O)CCC ZBHMFRUDZQIRQC-HTQZYQBOSA-N 0.000 description 1
- OBDAIIXTYCFSCO-PHDIDXHHSA-N (2R,3R)-3-carbamoyl-2-ethylpentanoic acid Chemical compound C(C)[C@@H](C(=O)O)[C@H](C(=O)N)CC OBDAIIXTYCFSCO-PHDIDXHHSA-N 0.000 description 1
- KQNVLBWOGJEFEH-HTQZYQBOSA-N (2R,3R)-3-carbamoyl-4-methyl-2-propan-2-ylpentanoic acid Chemical compound C(C)(C)[C@@H](C(=O)O)[C@H](C(=O)N)C(C)C KQNVLBWOGJEFEH-HTQZYQBOSA-N 0.000 description 1
- HZZWAGIRDQSOHL-NXEZZACHSA-N (2R,3R)-3-ethoxycarbonyl-4-methyl-2-propan-2-ylpentanoic acid Chemical compound C(C)OC([C@@H]([C@H](C(=O)O)C(C)C)C(C)C)=O HZZWAGIRDQSOHL-NXEZZACHSA-N 0.000 description 1
- MQALJBDJHVOFQV-RKDXNWHRSA-N (2R,3R)-3-methoxycarbonyl-4-methyl-2-propan-2-ylpentanoic acid Chemical compound COC([C@@H]([C@H](C(=O)O)C(C)C)C(C)C)=O MQALJBDJHVOFQV-RKDXNWHRSA-N 0.000 description 1
- SFKQJPCVQOVRML-HZPDHXFCSA-N (2R,3R)-4-amino-2,3-dibenzyl-4-oxobutanoic acid Chemical compound C(C1=CC=CC=C1)[C@@H](C(=O)O)[C@H](C(=O)N)CC1=CC=CC=C1 SFKQJPCVQOVRML-HZPDHXFCSA-N 0.000 description 1
- OVIXQGZZZJERJO-SSDOTTSWSA-N (2r)-2-ethyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid Chemical compound CC[C@@H](C(O)=O)CC(=O)OC(C)(C)C OVIXQGZZZJERJO-SSDOTTSWSA-N 0.000 description 1
- PWVXWINMUNAXMV-RXMQYKEDSA-N (2r)-2-ethyl-4-methoxy-4-oxobutanoic acid Chemical compound CC[C@@H](C(O)=O)CC(=O)OC PWVXWINMUNAXMV-RXMQYKEDSA-N 0.000 description 1
- KBZLGNVOIXVBRG-SSDOTTSWSA-N (2r)-2-ethyl-4-oxo-4-propan-2-yloxybutanoic acid Chemical compound CC[C@@H](C(O)=O)CC(=O)OC(C)C KBZLGNVOIXVBRG-SSDOTTSWSA-N 0.000 description 1
- CJPLHGZBHLPEMF-SSDOTTSWSA-N (2r)-2-ethyl-4-oxo-4-propoxybutanoic acid Chemical compound CCCOC(=O)C[C@@H](CC)C(O)=O CJPLHGZBHLPEMF-SSDOTTSWSA-N 0.000 description 1
- PNYQNOLOLOSFFT-ZCFIWIBFSA-N (2r)-2-methyl-4-oxo-4-propan-2-yloxybutanoic acid Chemical compound CC(C)OC(=O)C[C@@H](C)C(O)=O PNYQNOLOLOSFFT-ZCFIWIBFSA-N 0.000 description 1
- IYHKSEAJJFRBPB-SCSAIBSYSA-N (2r)-4-amino-2-ethyl-4-oxobutanoic acid Chemical compound CC[C@@H](C(O)=O)CC(N)=O IYHKSEAJJFRBPB-SCSAIBSYSA-N 0.000 description 1
- APLDKCVZGJSYQQ-GSVOUGTGSA-N (2r)-4-amino-2-methyl-4-oxobutanoic acid Chemical compound OC(=O)[C@H](C)CC(N)=O APLDKCVZGJSYQQ-GSVOUGTGSA-N 0.000 description 1
- SYEZSTHVAHCCAH-ZCFIWIBFSA-N (2r)-4-ethoxy-2-ethyl-4-oxobutanoic acid Chemical compound CCOC(=O)C[C@@H](CC)C(O)=O SYEZSTHVAHCCAH-ZCFIWIBFSA-N 0.000 description 1
- NMEQTRDRCUBKRO-RXMQYKEDSA-N (2r)-4-ethoxy-2-methyl-4-oxobutanoic acid Chemical compound CCOC(=O)C[C@@H](C)C(O)=O NMEQTRDRCUBKRO-RXMQYKEDSA-N 0.000 description 1
- YBFKHWUAOSUKCQ-IAGOWNOFSA-N (2r,3r)-2,3-dibenzyl-4-methoxy-4-oxobutanoic acid Chemical compound C([C@@H](C(=O)OC)[C@@H](CC=1C=CC=CC=1)C(O)=O)C1=CC=CC=C1 YBFKHWUAOSUKCQ-IAGOWNOFSA-N 0.000 description 1
- UUTKSMWBUAJELT-HZPDHXFCSA-N (2r,3r)-2,3-dibenzylbutanedioic acid Chemical compound C([C@@H](C(=O)O)[C@@H](CC=1C=CC=CC=1)C(O)=O)C1=CC=CC=C1 UUTKSMWBUAJELT-HZPDHXFCSA-N 0.000 description 1
- ZCKVAJCGPPVONU-YUMQZZPRSA-N (2r,3r)-2,3-diethylbutane-1,4-diol Chemical compound CC[C@@H](CO)[C@@H](CC)CO ZCKVAJCGPPVONU-YUMQZZPRSA-N 0.000 description 1
- KJXMXCRSMLOXBM-PHDIDXHHSA-N (2r,3r)-2,3-diethylbutanedioic acid Chemical compound CC[C@@H](C(O)=O)[C@@H](CC)C(O)=O KJXMXCRSMLOXBM-PHDIDXHHSA-N 0.000 description 1
- JPKLXBPDMHOVEU-RNFRBKRXSA-N (2r,3r)-2-ethyl-3-methoxycarbonylpentanoic acid Chemical compound CC[C@@H](C(O)=O)[C@@H](CC)C(=O)OC JPKLXBPDMHOVEU-RNFRBKRXSA-N 0.000 description 1
- NQNIXDWPSIWVAP-HTQZYQBOSA-N (2r,3r)-3-ethoxycarbonyl-2-ethylpentanoic acid Chemical compound CCOC(=O)[C@H](CC)[C@@H](CC)C(O)=O NQNIXDWPSIWVAP-HTQZYQBOSA-N 0.000 description 1
- JFYLQLGODSYXBL-NXEZZACHSA-N (2r,3r)-3-ethoxycarbonyl-2-propylhexanoic acid Chemical compound CCC[C@@H](C(O)=O)[C@@H](CCC)C(=O)OCC JFYLQLGODSYXBL-NXEZZACHSA-N 0.000 description 1
- ULCFVKFDZDAVLH-RKDXNWHRSA-N (2r,3r)-3-methoxycarbonyl-2-propylhexanoic acid Chemical compound CCC[C@@H](C(O)=O)[C@@H](CCC)C(=O)OC ULCFVKFDZDAVLH-RKDXNWHRSA-N 0.000 description 1
- IIXKFEKAYWUBLH-QWWZWVQMSA-N (2r,3r)-4-amino-2,3-dimethyl-4-oxobutanoic acid Chemical compound NC(=O)[C@H](C)[C@@H](C)C(O)=O IIXKFEKAYWUBLH-QWWZWVQMSA-N 0.000 description 1
- IOCSHBKTNXJFRL-PHDIDXHHSA-N (2r,3r)-4-ethoxy-2,3-dimethyl-4-oxobutanoic acid Chemical compound CCOC(=O)[C@H](C)[C@@H](C)C(O)=O IOCSHBKTNXJFRL-PHDIDXHHSA-N 0.000 description 1
- KLZYRCVPDWTZLH-ZXZARUISSA-N (2r,3s)-2,3-dimethylbutanedioic acid Chemical compound OC(=O)[C@@H](C)[C@@H](C)C(O)=O KLZYRCVPDWTZLH-ZXZARUISSA-N 0.000 description 1
- YGNOTSXXQFFAFO-CRCLSJGQSA-N (2s,3r)-4-methoxy-2,3-dimethyl-4-oxobutanoic acid Chemical compound COC(=O)[C@H](C)[C@H](C)C(O)=O YGNOTSXXQFFAFO-CRCLSJGQSA-N 0.000 description 1
- VAHCTQJREWUVDL-QZTJIDSGSA-N (3R,4R)-3,4-dibenzylcyclopentan-1-one Chemical compound C(C1=CC=CC=C1)[C@@H]1CC(C[C@H]1CC1=CC=CC=C1)=O VAHCTQJREWUVDL-QZTJIDSGSA-N 0.000 description 1
- RKWQVULIHTWYPJ-HZPDHXFCSA-N (3R,4R)-3,4-dibenzyloxolane-2,5-dione Chemical compound C(C1=CC=CC=C1)[C@H]1C(OC([C@@H]1CC1=CC=CC=C1)=O)=O RKWQVULIHTWYPJ-HZPDHXFCSA-N 0.000 description 1
- AZQZDGHAWWDNLA-NXEZZACHSA-N (3R,4R)-3,4-dipropylcyclopentan-1-one Chemical compound C(CC)[C@@H]1CC(C[C@H]1CCC)=O AZQZDGHAWWDNLA-NXEZZACHSA-N 0.000 description 1
- DEIGPCOJAGCFOC-QWRGUYRKSA-N (3R,4S)-1-methylsulfanyl-3,4-dipropylcyclopentene Chemical compound C(CC)[C@H]1C=C(C[C@@H]1CCC)SC DEIGPCOJAGCFOC-QWRGUYRKSA-N 0.000 description 1
- AZQZDGHAWWDNLA-UWVGGRQHSA-N (3S,4S)-3,4-dipropylcyclopentan-1-one Chemical compound C(CC)[C@H]1CC(C[C@@H]1CCC)=O AZQZDGHAWWDNLA-UWVGGRQHSA-N 0.000 description 1
- LEZOBAAHHOIMQT-GHMZBOCLSA-N (3r,4r)-3,4-di(propan-2-yl)cyclopentan-1-one Chemical compound CC(C)[C@H]1CC(=O)C[C@@H]1C(C)C LEZOBAAHHOIMQT-GHMZBOCLSA-N 0.000 description 1
- IHGXMWDEMCLZPW-HTQZYQBOSA-N (3r,4r)-3,4-di(propan-2-yl)oxolane-2,5-dione Chemical compound CC(C)[C@@H]1[C@@H](C(C)C)C(=O)OC1=O IHGXMWDEMCLZPW-HTQZYQBOSA-N 0.000 description 1
- XISLEOYIFRZKLT-HTQZYQBOSA-N (3r,4r)-3,4-diethylcyclopentan-1-one Chemical compound CC[C@@H]1CC(=O)C[C@H]1CC XISLEOYIFRZKLT-HTQZYQBOSA-N 0.000 description 1
- WRAJQNMZXMXFND-PHDIDXHHSA-N (3r,4r)-3,4-diethyloxolane-2,5-dione Chemical compound CC[C@@H]1[C@@H](CC)C(=O)OC1=O WRAJQNMZXMXFND-PHDIDXHHSA-N 0.000 description 1
- ZMGMYCHEWPVBEL-PHDIDXHHSA-N (3r,4r)-3,4-dimethylcyclopentan-1-one Chemical compound C[C@@H]1CC(=O)C[C@H]1C ZMGMYCHEWPVBEL-PHDIDXHHSA-N 0.000 description 1
- PILVFCJUANNAIR-HTQZYQBOSA-N (3r,4r)-3,4-dipropyloxolane-2,5-dione Chemical compound CCC[C@@H]1[C@@H](CCC)C(=O)OC1=O PILVFCJUANNAIR-HTQZYQBOSA-N 0.000 description 1
- RXPIBCNEDKIHJQ-IUCAKERBSA-N (3r,4s)-3,4-diethyl-1-methylsulfanylcyclopentene Chemical compound CC[C@H]1CC(SC)=C[C@@H]1CC RXPIBCNEDKIHJQ-IUCAKERBSA-N 0.000 description 1
- NAHWWUSNEIHVGG-YSWZKLOHSA-N (3s,4s)-1-methylsulfanyl-1-methylsulfinyl-3,4-dipropylcyclopentane Chemical compound CCC[C@H]1CC(S(C)=O)(SC)C[C@@H]1CCC NAHWWUSNEIHVGG-YSWZKLOHSA-N 0.000 description 1
- LEZOBAAHHOIMQT-QWRGUYRKSA-N (3s,4s)-3,4-di(propan-2-yl)cyclopentan-1-one Chemical compound CC(C)[C@@H]1CC(=O)C[C@H]1C(C)C LEZOBAAHHOIMQT-QWRGUYRKSA-N 0.000 description 1
- VAHCTQJREWUVDL-ROUUACIJSA-N (3s,4s)-3,4-dibenzylcyclopentan-1-one Chemical compound C([C@H]1CC(C[C@@H]1CC=1C=CC=CC=1)=O)C1=CC=CC=C1 VAHCTQJREWUVDL-ROUUACIJSA-N 0.000 description 1
- HZJMDJFPIJHDTQ-SRQCHHPUSA-N (3s,4s)-3,4-diethyl-1-methylsulfanyl-1-methylsulfinylcyclopentane Chemical compound CC[C@H]1CC(S(C)=O)(SC)C[C@@H]1CC HZJMDJFPIJHDTQ-SRQCHHPUSA-N 0.000 description 1
- XISLEOYIFRZKLT-YUMQZZPRSA-N (3s,4s)-3,4-diethylcyclopentan-1-one Chemical compound CC[C@H]1CC(=O)C[C@@H]1CC XISLEOYIFRZKLT-YUMQZZPRSA-N 0.000 description 1
- PDVFSPNIEOYOQL-UHFFFAOYSA-N (4-methylphenyl)sulfonyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OS(=O)(=O)C1=CC=C(C)C=C1 PDVFSPNIEOYOQL-UHFFFAOYSA-N 0.000 description 1
- CFTZXUKOTFWBAD-VXGBXAGGSA-N (4R,5R)-4,5-di(propan-2-yl)cyclohexene Chemical compound CC(C)[C@H]1CC=CC[C@@H]1C(C)C CFTZXUKOTFWBAD-VXGBXAGGSA-N 0.000 description 1
- JMAGKFOALWSLJL-RYUDHWBXSA-N (4S,5S)-4,5-dipropylcyclohexene Chemical compound C(CC)[C@H]1CC=CC[C@@H]1CCC JMAGKFOALWSLJL-RYUDHWBXSA-N 0.000 description 1
- MTQQMDXYAFOQST-UWVGGRQHSA-N (4s,5s)-4,5-diethylcyclohexene Chemical compound CC[C@H]1CC=CC[C@@H]1CC MTQQMDXYAFOQST-UWVGGRQHSA-N 0.000 description 1
- CLSANVILGJMGRZ-PMACEKPBSA-N (7s,8s)-7,8-dibenzyl-2-azaspiro[4.4]nonan-3-one Chemical compound C1NC(=O)CC21C[C@H](CC=1C=CC=CC=1)[C@@H](CC=1C=CC=CC=1)C2 CLSANVILGJMGRZ-PMACEKPBSA-N 0.000 description 1
- TUTWNOXKDLKTEH-UWVGGRQHSA-N (7s,8s)-7,8-diethyl-2-azaspiro[4.4]nonan-3-one Chemical compound C1[C@H](CC)[C@@H](CC)CC11CC(=O)NC1 TUTWNOXKDLKTEH-UWVGGRQHSA-N 0.000 description 1
- AUFQGWYTLDNENM-RYUDHWBXSA-N (7s,8s)-7,8-dipropyl-2-azaspiro[4.4]nonan-3-one Chemical compound C1[C@H](CCC)[C@@H](CCC)CC11CC(=O)NC1 AUFQGWYTLDNENM-RYUDHWBXSA-N 0.000 description 1
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 description 1
- KYVBNYUBXIEUFW-UHFFFAOYSA-N 1,1,3,3-tetramethylguanidine Chemical compound CN(C)C(=N)N(C)C KYVBNYUBXIEUFW-UHFFFAOYSA-N 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- 125000005955 1H-indazolyl group Chemical group 0.000 description 1
- HCSBTDBGTNZOAB-UHFFFAOYSA-N 2,3-dinitrobenzoic acid Chemical compound OC(=O)C1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O HCSBTDBGTNZOAB-UHFFFAOYSA-N 0.000 description 1
- HBFZWKRCDVWGSA-PMACEKPBSA-N 2-[(3s,4s)-1-(aminomethyl)-3,4-dibenzylcyclopentyl]acetic acid Chemical compound C([C@H]1CC(C[C@@H]1CC=1C=CC=CC=1)(CC(O)=O)CN)C1=CC=CC=C1 HBFZWKRCDVWGSA-PMACEKPBSA-N 0.000 description 1
- KOPGUPUTANQKJY-UWVGGRQHSA-N 2-[(3s,4s)-1-(aminomethyl)-3,4-diethylcyclopentyl]acetic acid Chemical compound CC[C@H]1CC(CN)(CC(O)=O)C[C@@H]1CC KOPGUPUTANQKJY-UWVGGRQHSA-N 0.000 description 1
- VQALSSUYWHTVDP-RYUDHWBXSA-N 2-[(3s,4s)-1-(aminomethyl)-3,4-dipropylcyclopentyl]acetic acid Chemical compound CCC[C@H]1CC(CN)(CC(O)=O)C[C@@H]1CCC VQALSSUYWHTVDP-RYUDHWBXSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- CHZCERSEMVWNHL-UHFFFAOYSA-N 2-hydroxybenzonitrile Chemical compound OC1=CC=CC=C1C#N CHZCERSEMVWNHL-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 1
- PXACTUVBBMDKRW-UHFFFAOYSA-M 4-bromobenzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-M 0.000 description 1
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 description 1
- SPXOTSHWBDUUMT-UHFFFAOYSA-M 4-nitrobenzenesulfonate Chemical compound [O-][N+](=O)C1=CC=C(S([O-])(=O)=O)C=C1 SPXOTSHWBDUUMT-UHFFFAOYSA-M 0.000 description 1
- 125000002471 4H-quinolizinyl group Chemical group C=1(C=CCN2C=CC=CC12)* 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 208000019901 Anxiety disease Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- KQJGNBWRCPVRSL-QGZVFWFLSA-N C(C1=CC=CC=C1)S(=O)(=O)OC[C@@H](CCOS(=O)(=O)CC1=CC=CC=C1)C Chemical compound C(C1=CC=CC=C1)S(=O)(=O)OC[C@@H](CCOS(=O)(=O)CC1=CC=CC=C1)C KQJGNBWRCPVRSL-QGZVFWFLSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- 108090000312 Calcium Channels Proteins 0.000 description 1
- 102000003922 Calcium Channels Human genes 0.000 description 1
- 108091006146 Channels Proteins 0.000 description 1
- 241001432959 Chernes Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 108090000371 Esterases Proteins 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 238000006546 Horner-Wadsworth-Emmons reaction Methods 0.000 description 1
- 208000006083 Hypokinesia Diseases 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 229910013698 LiNH2 Inorganic materials 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 238000006845 Michael addition reaction Methods 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 208000013738 Sleep Initiation and Maintenance disease Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- WCQBIVUMZZFECU-WOJBJXKFSA-N [(1R,6R)-6-benzylcyclohex-3-en-1-yl]methylbenzene Chemical compound C(C1=CC=CC=C1)[C@H]1CC=CC[C@@H]1CC1=CC=CC=C1 WCQBIVUMZZFECU-WOJBJXKFSA-N 0.000 description 1
- HBSDPMJWSRMTOK-OALUTQOASA-N [(1s,2r)-2-benzyl-4-methylsulfanylcyclopent-3-en-1-yl]methylbenzene Chemical compound C([C@H]1C=C(C[C@@H]1CC=1C=CC=CC=1)SC)C1=CC=CC=C1 HBSDPMJWSRMTOK-OALUTQOASA-N 0.000 description 1
- VHBBIOCUMPIYDI-KYJUHHDHSA-N [(2R,3R)-2,3-dibenzyl-4-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate Chemical compound C(C1=CC=CC=C1)[C@@H](COS(=O)(=O)C1=CC=C(C=C1)C)[C@H](COS(=O)(=O)C1=CC=C(C=C1)C)CC1=CC=CC=C1 VHBBIOCUMPIYDI-KYJUHHDHSA-N 0.000 description 1
- VSVQTTLVMCEAEE-YUMQZZPRSA-N [(2R,3R)-2,3-dimethyl-4-methylsulfonyloxybutyl] methanesulfonate Chemical compound CS(=O)(=O)OC[C@@H]([C@H](COS(=O)(=O)C)C)C VSVQTTLVMCEAEE-YUMQZZPRSA-N 0.000 description 1
- SYPJFVVWIOEYPS-PMACEKPBSA-N [(2R,3R)-2-ethyl-3-[(4-methylphenyl)sulfonyloxymethyl]pentyl] 4-methylbenzenesulfonate Chemical compound C(C)[C@@H](COS(=O)(=O)C1=CC=C(C=C1)C)[C@H](COS(=O)(=O)C1=CC=C(C=C1)C)CC SYPJFVVWIOEYPS-PMACEKPBSA-N 0.000 description 1
- MFKXKJGGDPGYKY-VXKWHMMOSA-N [(2R,3R)-3-[(4-methylphenyl)sulfonyloxymethyl]-2-propylhexyl] 4-methylbenzenesulfonate Chemical compound C(CC)[C@@H](COS(=O)(=O)C1=CC=C(C=C1)C)[C@H](COS(=O)(=O)C1=CC=C(C=C1)C)CCC MFKXKJGGDPGYKY-VXKWHMMOSA-N 0.000 description 1
- XXXCFFZTHHSPND-HDICACEKSA-N [(2S,3R)-2,3-dimethyl-4-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate Chemical compound C[C@@H](COS(=O)(=O)C1=CC=C(C=C1)C)[C@@H](COS(=O)(=O)C1=CC=C(C=C1)C)C XXXCFFZTHHSPND-HDICACEKSA-N 0.000 description 1
- JCFRMVVSFQJNTK-PMACEKPBSA-N [(2r,3r)-2,3-dibenzyl-4-methylsulfonyloxybutyl] methanesulfonate Chemical compound C([C@@H](COS(=O)(=O)C)[C@H](COS(C)(=O)=O)CC=1C=CC=CC=1)C1=CC=CC=C1 JCFRMVVSFQJNTK-PMACEKPBSA-N 0.000 description 1
- CJMXHGKOVKJHAS-VXGBXAGGSA-N [(2r,3r)-4-methyl-3-(methylsulfonyloxymethyl)-2-propan-2-ylpentyl] methanesulfonate Chemical compound CS(=O)(=O)OC[C@H](C(C)C)[C@H](COS(C)(=O)=O)C(C)C CJMXHGKOVKJHAS-VXGBXAGGSA-N 0.000 description 1
- BBAWTPDTGRXPDG-UHFFFAOYSA-N [1,3]thiazolo[4,5-b]pyridine Chemical compound C1=CC=C2SC=NC2=N1 BBAWTPDTGRXPDG-UHFFFAOYSA-N 0.000 description 1
- JEDZLBFUGJTJGQ-UHFFFAOYSA-N [Na].COCCO[AlH]OCCOC Chemical compound [Na].COCCO[AlH]OCCOC JEDZLBFUGJTJGQ-UHFFFAOYSA-N 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001278 adipic acid derivatives Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000036506 anxiety Effects 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 238000009876 asymmetric hydrogenation reaction Methods 0.000 description 1
- 125000004931 azocinyl group Chemical group N1=C(C=CC=CC=C1)* 0.000 description 1
- 238000010945 base-catalyzed hydrolysis reactiony Methods 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000005512 benztetrazolyl group Chemical group 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000004623 carbolinyl group Chemical group 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- KVSASDOGYIBWTA-UHFFFAOYSA-N chloro benzoate Chemical compound ClOC(=O)C1=CC=CC=C1 KVSASDOGYIBWTA-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- VDANGULDQQJODZ-UHFFFAOYSA-N chloroprocaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1Cl VDANGULDQQJODZ-UHFFFAOYSA-N 0.000 description 1
- 229960002023 chloroprocaine Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 150000001935 cyclohexenes Chemical class 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 150000001940 cyclopentanes Chemical class 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004856 decahydroquinolinyl group Chemical group N1(CCCC2CCCCC12)* 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 229940043237 diethanolamine Drugs 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 description 1
- JMRYOSQOYJBDOI-UHFFFAOYSA-N dilithium;di(propan-2-yl)azanide Chemical compound [Li+].CC(C)[N-]C(C)C.CC(C)N([Li])C(C)C JMRYOSQOYJBDOI-UHFFFAOYSA-N 0.000 description 1
- HSUGRBWQSSZJOP-RTWAWAEBSA-N diltiazem Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=CC=C2S1 HSUGRBWQSSZJOP-RTWAWAEBSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 208000002173 dizziness Diseases 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000003821 enantio-separation Methods 0.000 description 1
- 206010015037 epilepsy Diseases 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- LHWWETDBWVTKJO-UHFFFAOYSA-N et3n triethylamine Chemical compound CCN(CC)CC.CCN(CC)CC LHWWETDBWVTKJO-UHFFFAOYSA-N 0.000 description 1
- ZMMJGEGLRURXTF-UHFFFAOYSA-N ethidium bromide Chemical compound [Br-].C12=CC(N)=CC=C2C2=CC=C(N)C=C2[N+](CC)=C1C1=CC=CC=C1 ZMMJGEGLRURXTF-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- QPMJENKZJUFOON-PLNGDYQASA-N ethyl (z)-3-chloro-2-cyano-4,4,4-trifluorobut-2-enoate Chemical class CCOC(=O)C(\C#N)=C(/Cl)C(F)(F)F QPMJENKZJUFOON-PLNGDYQASA-N 0.000 description 1
- JSTYEMXGZXCVTQ-KBPBESRZSA-N ethyl 2-[(3S,4S)-1-(nitromethyl)-3,4-dipropylcyclopentyl]acetate Chemical compound CCC[C@H]1CC(CC(=O)OCC)(C[N+]([O-])=O)C[C@@H]1CCC JSTYEMXGZXCVTQ-KBPBESRZSA-N 0.000 description 1
- DDIWFXRJARUMJI-VXKWHMMOSA-N ethyl 2-[(3S,4S)-3,4-dibenzyl-1-(nitromethyl)cyclopentyl]acetate Chemical compound CCOC(=O)CC1(C[N+]([O-])=O)C[C@H](CC2=CC=CC=C2)[C@@H](CC2=CC=CC=C2)C1 DDIWFXRJARUMJI-VXKWHMMOSA-N 0.000 description 1
- DJQYAWKWZLMERV-FGZHOGPDSA-N ethyl 2-[(3S,4S)-3,4-dibenzylcyclopentylidene]acetate Chemical compound C(C)OC(C=C1C[C@H]([C@@H](C1)CC1=CC=CC=C1)CC1=CC=CC=C1)=O DJQYAWKWZLMERV-FGZHOGPDSA-N 0.000 description 1
- GJPRZDAQIYKKSN-RYUDHWBXSA-N ethyl 2-[(3S,4S)-3,4-diethyl-1-(nitromethyl)cyclopentyl]acetate Chemical compound C(C)OC(CC1(C[C@@H]([C@H](C1)CC)CC)C[N+](=O)[O-])=O GJPRZDAQIYKKSN-RYUDHWBXSA-N 0.000 description 1
- BDUAXGOJQVHISH-RYUDHWBXSA-N ethyl 2-[(3S,4S)-3,4-diethylcyclopentylidene]acetate Chemical compound C(C)OC(C=C1C[C@@H]([C@H](C1)CC)CC)=O BDUAXGOJQVHISH-RYUDHWBXSA-N 0.000 description 1
- UVECLJDRPFNRRQ-UHFFFAOYSA-N ethyl trifluoromethanesulfonate Chemical compound CCOS(=O)(=O)C(F)(F)F UVECLJDRPFNRRQ-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000011790 ferrous sulphate Substances 0.000 description 1
- 235000003891 ferrous sulphate Nutrition 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000010575 fractional recrystallization Methods 0.000 description 1
- 238000013467 fragmentation Methods 0.000 description 1
- 238000006062 fragmentation reaction Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005549 heteroarylene group Chemical group 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000003483 hypokinetic effect Effects 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 125000004926 indolenyl group Chemical group 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 206010022437 insomnia Diseases 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- 208000002551 irritable bowel syndrome Diseases 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 description 1
- 125000005438 isoindazolyl group Chemical group 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229940001447 lactate Drugs 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Inorganic materials [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 1
- AHNJTQYTRPXLLG-UHFFFAOYSA-N lithium;diethylazanide Chemical compound [Li+].CC[N-]CC AHNJTQYTRPXLLG-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 238000006140 methanolysis reaction Methods 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- BBPAUJPBUNNHGW-QWRGUYRKSA-N methyl 2-[(3S,4S)-3,4-diethyl-1-(nitromethyl)cyclopentyl]acetate Chemical compound CC[C@H]1CC(CC(=O)OC)(C[N+]([O-])=O)C[C@@H]1CC BBPAUJPBUNNHGW-QWRGUYRKSA-N 0.000 description 1
- UKUCVBJQRHEMPM-QWRGUYRKSA-N methyl 2-[(3S,4S)-3,4-diethylcyclopentylidene]acetate Chemical compound COC(C=C1C[C@@H]([C@H](C1)CC)CC)=O UKUCVBJQRHEMPM-QWRGUYRKSA-N 0.000 description 1
- ZALVWYZBENPWAM-IUCAKERBSA-N methyl 2-[(3s,4s)-3,4-dimethyl-1-(nitromethyl)cyclopentyl]acetate Chemical compound COC(=O)CC1(C[N+]([O-])=O)C[C@H](C)[C@@H](C)C1 ZALVWYZBENPWAM-IUCAKERBSA-N 0.000 description 1
- UYHUIPQFTGQJCG-YUMQZZPRSA-N methyl 2-[(3s,4s)-3,4-dimethylcyclopentylidene]acetate Chemical compound COC(=O)C=C1C[C@H](C)[C@@H](C)C1 UYHUIPQFTGQJCG-YUMQZZPRSA-N 0.000 description 1
- SPOBDGSSOMVLHP-STQMWFEESA-N methyl 2-[(3s,4s)-3,4-dipropylcyclopentylidene]acetate Chemical compound CCC[C@H]1CC(=CC(=O)OC)C[C@@H]1CCC SPOBDGSSOMVLHP-STQMWFEESA-N 0.000 description 1
- PVSJXEDBEXYLML-UHFFFAOYSA-N methyl 2-[bis(2,2,2-trifluoroethoxy)phosphoryl]acetate Chemical compound COC(=O)CP(=O)(OCC(F)(F)F)OCC(F)(F)F PVSJXEDBEXYLML-UHFFFAOYSA-N 0.000 description 1
- SIGOIUCRXKUEIG-UHFFFAOYSA-N methyl 2-dimethoxyphosphorylacetate Chemical compound COC(=O)CP(=O)(OC)OC SIGOIUCRXKUEIG-UHFFFAOYSA-N 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- OIRDBPQYVWXNSJ-UHFFFAOYSA-N methyl trifluoromethansulfonate Chemical compound COS(=O)(=O)C(F)(F)F OIRDBPQYVWXNSJ-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 125000001736 nosyl group Chemical group S(=O)(=O)(C1=CC=C([N+](=O)[O-])C=C1)* 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 125000004930 octahydroisoquinolinyl group Chemical group C1(NCCC2CCCC=C12)* 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-M octanoate Chemical compound CCCCCCCC([O-])=O WWZKQHOCKIZLMA-UHFFFAOYSA-M 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- QNNHQVPFZIFNFK-UHFFFAOYSA-N oxazolo[4,5-b]pyridine Chemical compound C1=CC=C2OC=NC2=N1 QNNHQVPFZIFNFK-UHFFFAOYSA-N 0.000 description 1
- 125000003544 oxime group Chemical group 0.000 description 1
- 238000010979 pH adjustment Methods 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- 125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000005954 phenoxathiinyl group Chemical group 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000001725 pyrenyl group Chemical group 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 229940116351 sebacate Drugs 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-L sebacate(2-) Chemical compound [O-]C(=O)CCCCCCCCC([O-])=O CXMXRPHRNRROMY-UHFFFAOYSA-L 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000012419 sodium bis(2-methoxyethoxy)aluminum hydride Substances 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- XMVONEAAOPAGAO-UHFFFAOYSA-N sodium tungstate Chemical compound [Na+].[Na+].[O-][W]([O-])(=O)=O XMVONEAAOPAGAO-UHFFFAOYSA-N 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- TYFQFVWCELRYAO-UHFFFAOYSA-L suberate(2-) Chemical compound [O-]C(=O)CCCCCCC([O-])=O TYFQFVWCELRYAO-UHFFFAOYSA-L 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000004627 thianthrenyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3SC12)* 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 125000006168 tricyclic group Chemical group 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 229910052722 tritium Inorganic materials 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 150000008127 vinyl sulfides Chemical class 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000003021 water soluble solvent Substances 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/51—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition
- C07C45/518—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition involving transformation of sulfur-containing compounds to >C = O groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/01—Sulfonic acids
- C07C309/25—Sulfonic acids having sulfo groups bound to carbon atoms of rings other than six-membered aromatic rings of a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C319/00—Preparation of thiols, sulfides, hydropolysulfides or polysulfides
- C07C319/14—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides
- C07C319/20—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides by reactions not involving the formation of sulfide groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C321/00—Thiols, sulfides, hydropolysulfides or polysulfides
- C07C321/22—Thiols, sulfides, hydropolysulfides, or polysulfides having thio groups bound to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/64—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton
- C07C323/65—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton containing sulfur atoms of sulfone or sulfoxide groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/09—Preparation of carboxylic acids or their salts, halides or anhydrides from carboxylic acid esters or lactones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/30—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group
- C07C67/333—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group by isomerisation; by change of size of the carbon skeleton
- C07C67/343—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/74—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring
- C07C69/757—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07B—GENERAL METHODS OF ORGANIC CHEMISTRY; APPARATUS THEREFOR
- C07B2200/00—Indexing scheme relating to specific properties of organic compounds
- C07B2200/07—Optical isomers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/08—Systems containing only non-condensed rings with a five-membered ring the ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US70023505P | 2005-07-18 | 2005-07-18 | |
US60/700,235 | 2005-07-18 | ||
PCT/IB2006/002060 WO2007010387A2 (fr) | 2005-07-18 | 2006-07-13 | Synthese stereoselective de cyclopentanones 3,4-disubstitues et composes correspondants |
Publications (1)
Publication Number | Publication Date |
---|---|
CA2615490A1 true CA2615490A1 (fr) | 2007-01-25 |
Family
ID=37487704
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CA002615490A Abandoned CA2615490A1 (fr) | 2005-07-18 | 2006-07-13 | Synthese stereoselective de cyclopentanones 3,4-disubstitues et composes correspondants |
Country Status (6)
Country | Link |
---|---|
EP (1) | EP1912936A2 (fr) |
JP (1) | JP2007023040A (fr) |
AR (1) | AR057465A1 (fr) |
CA (1) | CA2615490A1 (fr) |
TW (1) | TW200745012A (fr) |
WO (1) | WO2007010387A2 (fr) |
Families Citing this family (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JP5858581B2 (ja) * | 2012-09-27 | 2016-02-10 | 国立大学法人 東京大学 | インドール3−カルボン酸類の製造方法 |
Family Cites Families (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE69834204T2 (de) * | 1997-10-27 | 2007-03-29 | Warner-Lambert Co. Llc | Zyklische aminosäuren und deren derivate als arzneimittel |
GB2364049A (en) * | 2000-06-28 | 2002-01-16 | Warner Lambert Co | Cyclic ketones and their use in the synthesis of amino acids |
-
2006
- 2006-07-13 WO PCT/IB2006/002060 patent/WO2007010387A2/fr not_active Application Discontinuation
- 2006-07-13 CA CA002615490A patent/CA2615490A1/fr not_active Abandoned
- 2006-07-13 EP EP06779907A patent/EP1912936A2/fr not_active Withdrawn
- 2006-07-17 TW TW095126012A patent/TW200745012A/zh unknown
- 2006-07-17 AR ARP060103055A patent/AR057465A1/es unknown
- 2006-07-18 JP JP2006195461A patent/JP2007023040A/ja active Pending
Also Published As
Publication number | Publication date |
---|---|
WO2007010387B1 (fr) | 2007-07-12 |
JP2007023040A (ja) | 2007-02-01 |
WO2007010387A3 (fr) | 2007-04-26 |
WO2007010387A2 (fr) | 2007-01-25 |
EP1912936A2 (fr) | 2008-04-23 |
TW200745012A (en) | 2007-12-16 |
AR057465A1 (es) | 2007-12-05 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US8367847B2 (en) | Production of monatin enantiomers | |
TWI405747B (zh) | 前喀巴林(pregabalin)及相關化合物之製法 | |
EP1879851B1 (fr) | Procede pour preparer de la pregabaline et des sels de celle-ci | |
WO1996040617A1 (fr) | Procede de preparation d'acide (s)-3-(aminomethyl)-5-methylhexanoique | |
CA2615490A1 (fr) | Synthese stereoselective de cyclopentanones 3,4-disubstitues et composes correspondants | |
WO2008155619A2 (fr) | Préparation d'acides aminés cycliques optiquement actifs | |
WO2006100606A2 (fr) | Preparation de precurseurs de beta-aminoacide par addition de markovnikov et condensation de knoevenagel a mediation assuree par de l'indium (iii) | |
US20090247743A1 (en) | Preparation of beta-amino acids having affinity for the alpha-2-delta protein | |
US20040266848A1 (en) | Preparation of N2-alkylated 1,2,3-triazoles | |
WO2006100568A1 (fr) | Preparation de $g(b)-amino-acides optiquement purs presentant une affinite avec la proteine alpha-2-delta | |
AU700091C (en) | Method of making (S)-3-(aminomethyl)-5-methylhexanoic acid | |
KR100843684B1 (ko) | 프레가발린 및 관련 화합물의 제조방법 | |
EP2684864A1 (fr) | Procédé de production d'ester d'acide 1-amino-2-vinylcyclopropanecarboxylique optiquement actif | |
KR20070019787A (ko) | 알파-2-델타 단백질에 대한 친화도를 갖는 베타-아미노산의제조 방법 |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
EEER | Examination request | ||
FZDE | Dead |