CA2588305A1 - Polyester polymer and copolymer compositions containing steel particles - Google Patents
Polyester polymer and copolymer compositions containing steel particles Download PDFInfo
- Publication number
- CA2588305A1 CA2588305A1 CA002588305A CA2588305A CA2588305A1 CA 2588305 A1 CA2588305 A1 CA 2588305A1 CA 002588305 A CA002588305 A CA 002588305A CA 2588305 A CA2588305 A CA 2588305A CA 2588305 A1 CA2588305 A1 CA 2588305A1
- Authority
- CA
- Canada
- Prior art keywords
- polyester
- steel
- polyester composition
- particles
- polymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000002245 particle Substances 0.000 title claims abstract description 237
- 229920000728 polyester Polymers 0.000 title claims abstract description 185
- 229910000831 Steel Inorganic materials 0.000 title claims abstract description 170
- 239000010959 steel Substances 0.000 title claims abstract description 170
- 239000000203 mixture Substances 0.000 title claims abstract description 141
- 229920000642 polymer Polymers 0.000 title claims abstract description 113
- 229920001577 copolymer Polymers 0.000 title abstract description 10
- 238000000034 method Methods 0.000 claims abstract description 63
- 230000008569 process Effects 0.000 claims abstract description 49
- 238000009826 distribution Methods 0.000 claims abstract description 16
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 45
- 239000012141 concentrate Substances 0.000 claims description 45
- 238000005886 esterification reaction Methods 0.000 claims description 40
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 39
- 229910001220 stainless steel Inorganic materials 0.000 claims description 39
- 239000010935 stainless steel Substances 0.000 claims description 37
- 230000032050 esterification Effects 0.000 claims description 36
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 35
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 35
- -1 polyethylene terephthalate Polymers 0.000 claims description 33
- 239000000155 melt Substances 0.000 claims description 31
- 239000007787 solid Substances 0.000 claims description 31
- 238000006068 polycondensation reaction Methods 0.000 claims description 29
- 239000003054 catalyst Substances 0.000 claims description 24
- 150000002009 diols Chemical class 0.000 claims description 24
- 230000006872 improvement Effects 0.000 claims description 23
- 229910052742 iron Inorganic materials 0.000 claims description 22
- 238000004519 manufacturing process Methods 0.000 claims description 20
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 19
- 229910052799 carbon Inorganic materials 0.000 claims description 18
- 229920001169 thermoplastic Polymers 0.000 claims description 18
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 16
- 229910052698 phosphorus Inorganic materials 0.000 claims description 16
- 239000011574 phosphorus Substances 0.000 claims description 16
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 13
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 13
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 12
- 239000000178 monomer Substances 0.000 claims description 12
- 239000004416 thermosoftening plastic Substances 0.000 claims description 12
- 239000011651 chromium Substances 0.000 claims description 11
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 10
- 229910052804 chromium Inorganic materials 0.000 claims description 10
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 9
- 235000013361 beverage Nutrition 0.000 claims description 9
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 claims description 7
- 239000007788 liquid Substances 0.000 claims description 7
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 7
- 229920000098 polyolefin Polymers 0.000 claims description 7
- 229910052710 silicon Inorganic materials 0.000 claims description 7
- 239000010703 silicon Substances 0.000 claims description 7
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 6
- 229910052759 nickel Inorganic materials 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 229920000515 polycarbonate Polymers 0.000 claims description 6
- 239000004417 polycarbonate Substances 0.000 claims description 6
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 5
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 5
- 229910052750 molybdenum Inorganic materials 0.000 claims description 5
- 239000011733 molybdenum Substances 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- MMINFSMURORWKH-UHFFFAOYSA-N 3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-2,7-dione Chemical group O=C1OCCOC(=O)C2=CC=C1C=C2 MMINFSMURORWKH-UHFFFAOYSA-N 0.000 claims description 2
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 238000002844 melting Methods 0.000 claims description 2
- 230000008018 melting Effects 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- 238000006116 polymerization reaction Methods 0.000 abstract description 15
- 238000000465 moulding Methods 0.000 abstract description 11
- 238000013329 compounding Methods 0.000 abstract description 6
- 238000004806 packaging method and process Methods 0.000 abstract description 6
- 150000001875 compounds Chemical class 0.000 description 38
- 239000008188 pellet Substances 0.000 description 31
- 239000000654 additive Substances 0.000 description 28
- 238000001746 injection moulding Methods 0.000 description 18
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 17
- 239000000843 powder Substances 0.000 description 16
- 239000000523 sample Substances 0.000 description 16
- 229910045601 alloy Inorganic materials 0.000 description 15
- 239000000956 alloy Substances 0.000 description 15
- 238000002425 crystallisation Methods 0.000 description 14
- 230000008025 crystallization Effects 0.000 description 14
- 230000000996 additive effect Effects 0.000 description 13
- 125000004432 carbon atom Chemical group C* 0.000 description 13
- 125000005487 naphthalate group Chemical group 0.000 description 13
- 238000000071 blow moulding Methods 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- 238000005259 measurement Methods 0.000 description 12
- 238000005516 engineering process Methods 0.000 description 10
- 239000000463 material Substances 0.000 description 10
- 229910052751 metal Inorganic materials 0.000 description 10
- 239000002184 metal Substances 0.000 description 10
- 229920001283 Polyalkylene terephthalate Polymers 0.000 description 9
- 229910052787 antimony Inorganic materials 0.000 description 9
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 230000001965 increasing effect Effects 0.000 description 8
- 238000002156 mixing Methods 0.000 description 8
- 238000005453 pelletization Methods 0.000 description 7
- 239000010453 quartz Substances 0.000 description 7
- 229920005989 resin Polymers 0.000 description 7
- 239000011347 resin Substances 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 238000000576 coating method Methods 0.000 description 6
- 150000001869 cobalt compounds Chemical class 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 150000002506 iron compounds Chemical class 0.000 description 6
- 150000002739 metals Chemical class 0.000 description 6
- 229910052755 nonmetal Inorganic materials 0.000 description 6
- 239000011112 polyethylene naphthalate Substances 0.000 description 6
- 239000002243 precursor Substances 0.000 description 6
- 238000012545 processing Methods 0.000 description 6
- 241000894007 species Species 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 238000010521 absorption reaction Methods 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 238000009833 condensation Methods 0.000 description 5
- 230000005494 condensation Effects 0.000 description 5
- 150000002843 nonmetals Chemical class 0.000 description 5
- 229920003023 plastic Polymers 0.000 description 5
- 239000004033 plastic Substances 0.000 description 5
- 229920003207 poly(ethylene-2,6-naphthalate) Polymers 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical group [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- 229910052719 titanium Inorganic materials 0.000 description 5
- 239000010936 titanium Substances 0.000 description 5
- 238000005809 transesterification reaction Methods 0.000 description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 4
- TXTQARDVRPFFHL-UHFFFAOYSA-N [Sb].[H][H] Chemical compound [Sb].[H][H] TXTQARDVRPFFHL-UHFFFAOYSA-N 0.000 description 4
- 230000005540 biological transmission Effects 0.000 description 4
- QPKOBORKPHRBPS-UHFFFAOYSA-N bis(2-hydroxyethyl) terephthalate Chemical compound OCCOC(=O)C1=CC=C(C(=O)OCCO)C=C1 QPKOBORKPHRBPS-UHFFFAOYSA-N 0.000 description 4
- 239000003086 colorant Substances 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 150000001991 dicarboxylic acids Chemical class 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 230000002708 enhancing effect Effects 0.000 description 4
- 238000001125 extrusion Methods 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 229920001281 polyalkylene Polymers 0.000 description 4
- 229920001225 polyester resin Polymers 0.000 description 4
- 239000004645 polyester resin Substances 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- 229910052718 tin Inorganic materials 0.000 description 4
- 238000002834 transmittance Methods 0.000 description 4
- 239000004609 Impact Modifier Substances 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- XUGISPSHIFXEHZ-GPJXBBLFSA-N [(3r,8s,9s,10r,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1h-cyclopenta[a]phenanthren-3-yl] acetate Chemical compound C1C=C2C[C@H](OC(C)=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 XUGISPSHIFXEHZ-GPJXBBLFSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Inorganic materials O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 230000003247 decreasing effect Effects 0.000 description 3
- 150000005690 diesters Chemical class 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 230000001788 irregular Effects 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000003303 reheating Methods 0.000 description 3
- 229910021332 silicide Inorganic materials 0.000 description 3
- 238000007655 standard test method Methods 0.000 description 3
- 230000000007 visual effect Effects 0.000 description 3
- VLDPXPPHXDGHEW-UHFFFAOYSA-N 1-chloro-2-dichlorophosphoryloxybenzene Chemical compound ClC1=CC=CC=C1OP(Cl)(Cl)=O VLDPXPPHXDGHEW-UHFFFAOYSA-N 0.000 description 2
- YIWUKEYIRIRTPP-UHFFFAOYSA-N 2-ethylhexan-1-ol Chemical compound CCCCC(CC)CO YIWUKEYIRIRTPP-UHFFFAOYSA-N 0.000 description 2
- LLLVZDVNHNWSDS-UHFFFAOYSA-N 4-methylidene-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione Chemical compound C1(C2=CC=C(C(=O)OC(=C)O1)C=C2)=O LLLVZDVNHNWSDS-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 229920001634 Copolyester Polymers 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000004721 Polyphenylene oxide Substances 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000006096 absorbing agent Substances 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- ZDINGUUTWDGGFF-UHFFFAOYSA-N antimony(5+) Chemical class [Sb+5] ZDINGUUTWDGGFF-UHFFFAOYSA-N 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 229920005601 base polymer Polymers 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006085 branching agent Substances 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 238000010924 continuous production Methods 0.000 description 2
- 230000000875 corresponding effect Effects 0.000 description 2
- QYQADNCHXSEGJT-UHFFFAOYSA-N cyclohexane-1,1-dicarboxylate;hydron Chemical compound OC(=O)C1(C(O)=O)CCCCC1 QYQADNCHXSEGJT-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 229910052732 germanium Inorganic materials 0.000 description 2
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 2
- 230000009477 glass transition Effects 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 2
- 229910052737 gold Inorganic materials 0.000 description 2
- 239000010931 gold Substances 0.000 description 2
- 229910052734 helium Inorganic materials 0.000 description 2
- 239000001307 helium Substances 0.000 description 2
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 2
- 238000005286 illumination Methods 0.000 description 2
- 238000002354 inductively-coupled plasma atomic emission spectroscopy Methods 0.000 description 2
- VAKIVKMUBMZANL-UHFFFAOYSA-N iron phosphide Chemical compound P.[Fe].[Fe].[Fe] VAKIVKMUBMZANL-UHFFFAOYSA-N 0.000 description 2
- WTFXARWRTYJXII-UHFFFAOYSA-N iron(2+);iron(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[O-2].[Fe+2].[Fe+3].[Fe+3] WTFXARWRTYJXII-UHFFFAOYSA-N 0.000 description 2
- SZVJSHCCFOBDDC-UHFFFAOYSA-N iron(II,III) oxide Inorganic materials O=[Fe]O[Fe]O[Fe]=O SZVJSHCCFOBDDC-UHFFFAOYSA-N 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical compound C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 2
- RXOHFPCZGPKIRD-UHFFFAOYSA-N naphthalene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(C(=O)O)=CC=C21 RXOHFPCZGPKIRD-UHFFFAOYSA-N 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- 239000002667 nucleating agent Substances 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 2
- 150000003014 phosphoric acid esters Chemical class 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920006149 polyester-amide block copolymer Polymers 0.000 description 2
- 229920000570 polyether Polymers 0.000 description 2
- 229920006146 polyetheresteramide block copolymer Polymers 0.000 description 2
- 239000002685 polymerization catalyst Substances 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- 238000010926 purge Methods 0.000 description 2
- 239000012925 reference material Substances 0.000 description 2
- 238000004626 scanning electron microscopy Methods 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 229910052711 selenium Inorganic materials 0.000 description 2
- 239000011669 selenium Substances 0.000 description 2
- FVBUAEGBCNSCDD-UHFFFAOYSA-N silicide(4-) Chemical compound [Si-4] FVBUAEGBCNSCDD-UHFFFAOYSA-N 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- 230000005476 size effect Effects 0.000 description 2
- 239000006104 solid solution Substances 0.000 description 2
- 238000007711 solidification Methods 0.000 description 2
- 230000008023 solidification Effects 0.000 description 2
- 229910052715 tantalum Inorganic materials 0.000 description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 2
- 238000003856 thermoforming Methods 0.000 description 2
- 239000011135 tin Substances 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- SRPWOOOHEPICQU-UHFFFAOYSA-N trimellitic anhydride Chemical compound OC(=O)C1=CC=C2C(=O)OC(=O)C2=C1 SRPWOOOHEPICQU-UHFFFAOYSA-N 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- 229910052720 vanadium Inorganic materials 0.000 description 2
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- FQXGHZNSUOHCLO-UHFFFAOYSA-N 2,2,4,4-tetramethyl-1,3-cyclobutanediol Chemical compound CC1(C)C(O)C(C)(C)C1O FQXGHZNSUOHCLO-UHFFFAOYSA-N 0.000 description 1
- YEVQZPWSVWZAOB-UHFFFAOYSA-N 2-(bromomethyl)-1-iodo-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(I)C(CBr)=C1 YEVQZPWSVWZAOB-UHFFFAOYSA-N 0.000 description 1
- YQPCHPBGAALCRT-UHFFFAOYSA-N 2-[1-(carboxymethyl)cyclohexyl]acetic acid Chemical compound OC(=O)CC1(CC(O)=O)CCCCC1 YQPCHPBGAALCRT-UHFFFAOYSA-N 0.000 description 1
- ICPXIRMAMWRMAD-UHFFFAOYSA-N 2-[3-[2-[3-(2-hydroxyethoxy)phenyl]propan-2-yl]phenoxy]ethanol Chemical compound C=1C=CC(OCCO)=CC=1C(C)(C)C1=CC=CC(OCCO)=C1 ICPXIRMAMWRMAD-UHFFFAOYSA-N 0.000 description 1
- WTPYFJNYAMXZJG-UHFFFAOYSA-N 2-[4-(2-hydroxyethoxy)phenoxy]ethanol Chemical compound OCCOC1=CC=C(OCCO)C=C1 WTPYFJNYAMXZJG-UHFFFAOYSA-N 0.000 description 1
- ODTQUKVFOLFLIQ-UHFFFAOYSA-N 2-[di(propan-2-yloxy)phosphorylmethyl-propan-2-yloxyphosphoryl]oxypropane Chemical compound CC(C)OP(=O)(OC(C)C)CP(=O)(OC(C)C)OC(C)C ODTQUKVFOLFLIQ-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- CDBAMNGURPMUTG-UHFFFAOYSA-N 4-[2-(4-hydroxycyclohexyl)propan-2-yl]cyclohexan-1-ol Chemical compound C1CC(O)CCC1C(C)(C)C1CCC(O)CC1 CDBAMNGURPMUTG-UHFFFAOYSA-N 0.000 description 1
- 229910000851 Alloy steel Inorganic materials 0.000 description 1
- 244000099147 Ananas comosus Species 0.000 description 1
- 235000007119 Ananas comosus Nutrition 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229910000975 Carbon steel Inorganic materials 0.000 description 1
- 239000004594 Masterbatch (MB) Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 1
- GTVWRXDRKAHEAD-UHFFFAOYSA-N Tris(2-ethylhexyl) phosphate Chemical compound CCCCC(CC)COP(=O)(OCC(CC)CCCC)OCC(CC)CCCC GTVWRXDRKAHEAD-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- RZJQYRCNDBMIAG-UHFFFAOYSA-N [Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Zn].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn] Chemical class [Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Cu].[Zn].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Ag].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn].[Sn] RZJQYRCNDBMIAG-UHFFFAOYSA-N 0.000 description 1
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 238000004164 analytical calibration Methods 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 229940058905 antimony compound for treatment of leishmaniasis and trypanosomiasis Drugs 0.000 description 1
- 150000001463 antimony compounds Chemical class 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- YXEDCURRROXRPL-UHFFFAOYSA-K bis[(2-hydroxyacetyl)oxy]stibanyl 2-hydroxyacetate Chemical class [Sb+3].OCC([O-])=O.OCC([O-])=O.OCC([O-])=O YXEDCURRROXRPL-UHFFFAOYSA-K 0.000 description 1
- 229920000402 bisphenol A polycarbonate polymer Polymers 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- HKVBBCCDZPKANJ-UHFFFAOYSA-N butane-1,4-diol;pentane-1,5-diol Chemical compound OCCCCO.OCCCCCO HKVBBCCDZPKANJ-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000010962 carbon steel Substances 0.000 description 1
- 235000012174 carbonated soft drink Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 229910001567 cementite Inorganic materials 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 description 1
- GAYAMOAYBXKUII-UHFFFAOYSA-L cobalt(2+);dibenzoate Chemical compound [Co+2].[O-]C(=O)C1=CC=CC=C1.[O-]C(=O)C1=CC=CC=C1 GAYAMOAYBXKUII-UHFFFAOYSA-L 0.000 description 1
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical class [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 230000002596 correlated effect Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000012864 cross contamination Methods 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- JVLRYPRBKSMEBF-UHFFFAOYSA-K diacetyloxystibanyl acetate Chemical compound [Sb+3].CC([O-])=O.CC([O-])=O.CC([O-])=O JVLRYPRBKSMEBF-UHFFFAOYSA-K 0.000 description 1
- CRHLEZORXKQUEI-UHFFFAOYSA-N dialuminum;cobalt(2+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[Al+3].[Al+3].[Co+2].[Co+2] CRHLEZORXKQUEI-UHFFFAOYSA-N 0.000 description 1
- 239000012975 dibutyltin dilaurate Substances 0.000 description 1
- 238000000113 differential scanning calorimetry Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- VONWDASPFIQPDY-UHFFFAOYSA-N dimethyl methylphosphonate Chemical compound COP(C)(=O)OC VONWDASPFIQPDY-UHFFFAOYSA-N 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000000295 emission spectrum Methods 0.000 description 1
- PCIBVZXUNDZWRL-UHFFFAOYSA-N ethylene glycol monophosphate Chemical compound OCCOP(O)(O)=O PCIBVZXUNDZWRL-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000010101 extrusion blow moulding Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000005113 hydroxyalkoxy group Chemical group 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 1
- 235000013980 iron oxide Nutrition 0.000 description 1
- VBMVTYDPPZVILR-UHFFFAOYSA-N iron(2+);oxygen(2-) Chemical class [O-2].[Fe+2] VBMVTYDPPZVILR-UHFFFAOYSA-N 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical class [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical group 0.000 description 1
- 239000002923 metal particle Substances 0.000 description 1
- 239000013528 metallic particle Substances 0.000 description 1
- 238000005272 metallurgy Methods 0.000 description 1
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 1
- 239000002086 nanomaterial Substances 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- ZJAOAACCNHFJAH-UHFFFAOYSA-N phosphonoformic acid Chemical class OC(=O)P(O)(O)=O ZJAOAACCNHFJAH-UHFFFAOYSA-N 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920005644 polyethylene terephthalate glycol copolymer Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 238000004663 powder metallurgy Methods 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000007712 rapid solidification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000001350 scanning transmission electron microscopy Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000012798 spherical particle Substances 0.000 description 1
- 229910052596 spinel Inorganic materials 0.000 description 1
- 239000011029 spinel Substances 0.000 description 1
- 229910052566 spinel group Inorganic materials 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000004627 transmission electron microscopy Methods 0.000 description 1
- STCOOQWBFONSKY-UHFFFAOYSA-N tributyl phosphate Chemical compound CCCCOP(=O)(OCCCC)OCCCC STCOOQWBFONSKY-UHFFFAOYSA-N 0.000 description 1
- 150000005691 triesters Chemical class 0.000 description 1
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 description 1
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- WVLBCYQITXONBZ-UHFFFAOYSA-N trimethyl phosphate Chemical compound COP(=O)(OC)OC WVLBCYQITXONBZ-UHFFFAOYSA-N 0.000 description 1
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 1
- WTLBZVNBAKMVDP-UHFFFAOYSA-N tris(2-butoxyethyl) phosphate Chemical compound CCCCOCCOP(=O)(OCCOCCCC)OCCOCCCC WTLBZVNBAKMVDP-UHFFFAOYSA-N 0.000 description 1
- 238000002371 ultraviolet--visible spectrum Methods 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/18—Oxygen-containing compounds, e.g. metal carbonyls
- C08K3/20—Oxides; Hydroxides
- C08K3/22—Oxides; Hydroxides of metals
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B29—WORKING OF PLASTICS; WORKING OF SUBSTANCES IN A PLASTIC STATE IN GENERAL
- B29B—PREPARATION OR PRETREATMENT OF THE MATERIAL TO BE SHAPED; MAKING GRANULES OR PREFORMS; RECOVERY OF PLASTICS OR OTHER CONSTITUENTS OF WASTE MATERIAL CONTAINING PLASTICS
- B29B9/00—Making granules
- B29B9/16—Auxiliary treatment of granules
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K7/00—Use of ingredients characterised by shape
- C08K7/16—Solid spheres
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L23/00—Compositions of homopolymers or copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond; Compositions of derivatives of such polymers
- C08L23/02—Compositions of homopolymers or copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond; Compositions of derivatives of such polymers not modified by chemical after-treatment
- C08L23/04—Homopolymers or copolymers of ethene
- C08L23/06—Polyethene
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B29—WORKING OF PLASTICS; WORKING OF SUBSTANCES IN A PLASTIC STATE IN GENERAL
- B29B—PREPARATION OR PRETREATMENT OF THE MATERIAL TO BE SHAPED; MAKING GRANULES OR PREFORMS; RECOVERY OF PLASTICS OR OTHER CONSTITUENTS OF WASTE MATERIAL CONTAINING PLASTICS
- B29B9/00—Making granules
- B29B9/16—Auxiliary treatment of granules
- B29B2009/165—Crystallizing granules
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polyesters Or Polycarbonates (AREA)
- Blow-Moulding Or Thermoforming Of Plastics Or The Like (AREA)
- Processing And Handling Of Plastics And Other Materials For Molding In General (AREA)
- Containers Having Bodies Formed In One Piece (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US11/005,689 US20060122300A1 (en) | 2004-12-07 | 2004-12-07 | Polyester polymer and copolymer compositions containing steel particles |
| US11/005,689 | 2004-12-07 | ||
| PCT/US2005/042471 WO2006062743A1 (en) | 2004-12-07 | 2005-11-22 | Polyester polymer and copolymer compositions containing steel particles |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2588305A1 true CA2588305A1 (en) | 2006-06-15 |
Family
ID=36575205
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002588305A Abandoned CA2588305A1 (en) | 2004-12-07 | 2005-11-22 | Polyester polymer and copolymer compositions containing steel particles |
Country Status (13)
| Country | Link |
|---|---|
| US (2) | US20060122300A1 (enExample) |
| EP (2) | EP1828293B1 (enExample) |
| JP (1) | JP2008523213A (enExample) |
| KR (1) | KR20070085804A (enExample) |
| CN (1) | CN101072819A (enExample) |
| AR (1) | AR052982A1 (enExample) |
| AT (1) | ATE427337T1 (enExample) |
| BR (1) | BRPI0518461A2 (enExample) |
| CA (1) | CA2588305A1 (enExample) |
| DE (1) | DE602005013694D1 (enExample) |
| MX (1) | MX2007006660A (enExample) |
| TW (1) | TW200628527A (enExample) |
| WO (1) | WO2006062743A1 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP3664252B2 (ja) * | 2002-11-19 | 2005-06-22 | ソニー株式会社 | 負極およびそれを用いた電池 |
| US20060051542A1 (en) * | 2004-09-03 | 2006-03-09 | Zhiyong Xia | Polyester polymer and copolymer compositions containing metallic molybdenum particles |
| US7300967B2 (en) * | 2004-11-12 | 2007-11-27 | Eastman Chemical Company | Polyester polymer and copolymer compositions containing metallic titanium particles |
| US8557950B2 (en) | 2005-06-16 | 2013-10-15 | Grupo Petrotemex, S.A. De C.V. | High intrinsic viscosity melt phase polyester polymers with acceptable acetaldehyde generation rates |
| KR100797760B1 (ko) | 2006-12-27 | 2008-01-23 | 호남석유화학 주식회사 | 재가열 성능이 우수한 폴리에스테르 조성물 및 이를포함하는 폴리에스테르 용기 |
| EP4396264A4 (en) * | 2021-08-31 | 2025-09-03 | Eastman Chem Co | PROCESS FOR PRODUCING A COPOLYESTER WITH A GERMANIUM CATALYST |
Family Cites Families (104)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3264255A (en) * | 1961-05-01 | 1966-08-02 | Ici Ltd | Color stabilization of polyethylene terephthalate with finely divided metals |
| US3420913A (en) * | 1967-02-07 | 1969-01-07 | Phillips Petroleum Co | Activated charcoal in rubber compounding |
| US3660328A (en) * | 1970-07-27 | 1972-05-02 | Pfizer | Dielectric films |
| US3733309A (en) * | 1970-11-30 | 1973-05-15 | Du Pont | Biaxially oriented poly(ethylene terephthalate)bottle |
| US3795601A (en) * | 1971-12-27 | 1974-03-05 | Ford Motor Co | Electrodiffused protective coating system |
| US3796601A (en) * | 1972-05-03 | 1974-03-12 | Fmc Corp | Pre-coronizing treatment for desizing glass fabric |
| US3867315A (en) * | 1973-02-12 | 1975-02-18 | Dow Chemical Co | Resinous compositions having high electroconductivity containing Cu and metal salts |
| JPS5729496B2 (enExample) * | 1973-05-10 | 1982-06-23 | ||
| US4085246A (en) * | 1975-06-18 | 1978-04-18 | E. I. Du Pont De Nemours And Company | Simulated granite and its preparation |
| US4097445A (en) * | 1976-02-02 | 1978-06-27 | Monsanto Company | Poly(ester-amide) hot melt adhesives containing spheroidal metal powders |
| US4185043A (en) * | 1976-08-16 | 1980-01-22 | Hitco | Polymers containing chemically bonded metal atoms |
| US4087482A (en) * | 1976-08-16 | 1978-05-02 | Hitco | Furfuryl alcohol modified polyester resins containing metal atoms |
| US4343922A (en) * | 1976-08-16 | 1982-08-10 | Hitco | Polymers containing chemically bonded metal atoms |
| US4250078A (en) * | 1979-03-19 | 1981-02-10 | Eastman Kodak Company | Thermoplastic polyester molding compositions |
| US4321298A (en) * | 1980-02-26 | 1982-03-23 | Hitco | Carbon fabrics sequentially resin coated with (1) a metal-containing composition and (2) a boron-containing composition are laminated and carbonized |
| FR2482971A1 (fr) * | 1980-05-20 | 1981-11-27 | Rhone Poulenc Ind | Polyesters pour emballages a usage alimentaire et leur procede d'obtention |
| US4520078A (en) * | 1981-06-08 | 1985-05-28 | Electric Power Research Institute, Inc. | Cores for electromagnetic apparatus and methods of fabrication |
| US4535118A (en) * | 1982-02-24 | 1985-08-13 | The Goodyear Tire & Rubber Company | High clarity, low haze polyesters having reduced infrared heat-up times |
| US4604303A (en) * | 1983-05-11 | 1986-08-05 | Nissan Chemical Industries, Ltd. | Polymer composition containing an organic metal complex and method for producing a metallized polymer from the polymer composition |
| US4654399A (en) * | 1983-06-02 | 1987-03-31 | The Goodyear Tire & Rubber Company | Composition and process for making an amber colored polyester |
| GB2153760B (en) * | 1984-02-10 | 1988-02-17 | Bates W & A Ltd | Feeding strip material in the manufacture of pneumatic tyres |
| JPH0717748B2 (ja) * | 1986-12-19 | 1995-03-01 | 川崎製鉄株式会社 | 芳香族ポリエステルアミド |
| US4745173A (en) * | 1987-02-24 | 1988-05-17 | Eastman Kodak Company | Condensation copolymers containing 2,5-diarylaminoterephthalic acid type colorants and products therefrom |
| US5310977A (en) * | 1989-02-03 | 1994-05-10 | Minnesota Mining And Manufacturing Company | Configured microwave susceptor |
| US5084491A (en) * | 1989-03-16 | 1992-01-28 | The Ohio University | Reinforcing glass ionomer dental filling material with stainless steel, or metals thereof |
| GB8926631D0 (en) * | 1989-11-24 | 1990-01-17 | Ici Plc | Polymer compositions |
| US5106942A (en) * | 1990-01-08 | 1992-04-21 | Eastman Kodak Company | Copolymerized methine colorant-polyester color concentrates |
| FR2658119B1 (fr) * | 1990-02-13 | 1992-06-05 | Sidel Sa | Procede et installation pour fabriquer des recipients, tels que des bouteilles, en polyethyleneterephtalate, resistant a des conditions thermiques relativement severes au cours de leur utilisation. |
| GB9013481D0 (en) * | 1990-06-15 | 1990-08-08 | Ici Plc | Polyester polymer products |
| US5318797A (en) * | 1990-06-20 | 1994-06-07 | Clarkson University | Coated particles, hollow particles, and process for manufacturing the same |
| US5300746A (en) * | 1990-11-08 | 1994-04-05 | Advanced Deposition Technologies, Inc. | Metallized microwave diffuser films |
| DE69224987T2 (de) * | 1991-06-10 | 1998-07-30 | Eastman Chem Co | Licht absorbierende polymere |
| US5220140A (en) * | 1991-06-17 | 1993-06-15 | Alcan International Limited | Susceptors for browning or crisping food in microwave ovens |
| US5906882A (en) * | 1992-02-28 | 1999-05-25 | Valente; Thomas J. | Dielectric materials high metallic content |
| US5258233A (en) * | 1992-04-02 | 1993-11-02 | Eastman Kodak Company | Polyester/polyamide blend having improved flavor retaining property and clarity |
| DE69402381T2 (de) * | 1993-08-17 | 1997-11-20 | Diafoil Hoechst Co Ltd | Polyesterfilm für höchst wärmeempfindliches Originalblatt für Schablonendruckverfahren |
| US5372864A (en) * | 1993-09-03 | 1994-12-13 | Eastman Chemical Company | Toners for polyesters |
| GB9415627D0 (en) * | 1994-08-01 | 1994-09-21 | Marshall James | Verification apparatus |
| US5539078A (en) * | 1994-12-14 | 1996-07-23 | Shell Oil Company | Process for manufacturing polyester copolymers |
| US5593740A (en) * | 1995-01-17 | 1997-01-14 | Synmatix Corporation | Method and apparatus for making carbon-encapsulated ultrafine metal particles |
| DE19503053B4 (de) * | 1995-02-01 | 2005-08-18 | Zimmer Ag | Verfahren zur direkten Herstellung von Polyester-Verpackungen |
| DE19513056B4 (de) * | 1995-04-07 | 2005-12-15 | Zimmer Ag | Titanhaltige Katalysatoren und Verfahren zur Herstellung von Polyester |
| US5608031A (en) * | 1995-11-30 | 1997-03-04 | Eastman Chemical Company | Polyesters modified with 1,4-cyclohexaned imethanol having high clarity prepared utilizing an antimony containing catalyst/stabilizer system |
| US5742223A (en) * | 1995-12-07 | 1998-04-21 | Raychem Corporation | Laminar non-linear device with magnetically aligned particles |
| US6031128A (en) * | 1995-12-30 | 2000-02-29 | Sunkyong Industries Co., Ltd. | Process for manufacturing terephthalic acid |
| US6197851B1 (en) * | 1996-08-30 | 2001-03-06 | Eastman Chemical Company | Polyester compositions containing near infrared absorbing materials to improve reheat |
| US6863988B2 (en) * | 1996-09-23 | 2005-03-08 | Bp Corporation North America Inc. | Oxygen scavenging monolayer bottles |
| JP2002516621A (ja) * | 1996-11-27 | 2002-06-04 | イーストマン ケミカル カンパニー | 光吸収性ポリマー組成物の製造方法 |
| US7097686B2 (en) * | 1997-02-24 | 2006-08-29 | Cabot Corporation | Nickel powders, methods for producing powders and devices fabricated from same |
| WO1998038243A1 (en) * | 1997-02-28 | 1998-09-03 | Johnson Robert Harlan Jr | High efficiency heating agents |
| US5940022A (en) * | 1997-04-10 | 1999-08-17 | Zexel Corporation | Electromagnetic wave absorber |
| US5925710A (en) * | 1997-04-23 | 1999-07-20 | Hoechst Celanese Corporation | Infrared absorbing polyester packaging polymer |
| DE19720505A1 (de) * | 1997-05-15 | 1998-11-19 | Hoechst Diafoil Gmbh | Biaxial orientierte Polyesterfolie mit hoher Sauerstoffbarriere, Verfahren zu deren Herstellung und Verwendung |
| DE19753378A1 (de) * | 1997-12-02 | 1999-06-10 | Lurgi Zimmer Ag | Verfahren zur Herstellung von Polyestern mit Mischkatalysatoren |
| ID21405A (id) * | 1997-12-02 | 1999-06-03 | Mitsubishi Chem Corp | Poliester, produk cetakan hembus regangnya dan metoda untuk memproduksi poliester |
| US6022920A (en) * | 1998-01-23 | 2000-02-08 | Eastman Chemical Company | Method for the production of clear bottles having improved reheat |
| US6503586B1 (en) * | 1998-02-25 | 2003-01-07 | Arteva North America S.A.R.L. | Title improved infrared absorbing polyester packaging polymer |
| DE19811790A1 (de) * | 1998-03-18 | 1999-09-23 | Bayer Ag | Nanopartikel enthaltende transparente Lackbindemittel mit verbesserter Verkratzungsbeständigkeit, ein Verfahren zur Herstellung sowie deren Verwendung |
| US6261656B1 (en) * | 1998-04-16 | 2001-07-17 | Plastic Technologies, Inc. | Co-layer preform having an infrared energy absorbing material added to the inner layer to effect preferential heating |
| WO2000000548A1 (en) * | 1998-06-26 | 2000-01-06 | Teijin Limited | Aromatic polyester compositions and method for producing molded articles and bottles therefrom |
| CA2245375C (en) * | 1998-08-19 | 2006-08-15 | Nova Chemicals Ltd. | Dual reactor polyethylene process using a phosphinimine catalyst |
| EP1043362A4 (en) * | 1998-10-26 | 2002-05-08 | Toray Industries | POLYESTER COMPOSITION, METHOD FOR THE PRODUCTION THEREOF AND POLYESTER FILM |
| US20020027314A1 (en) * | 1999-02-10 | 2002-03-07 | Nichols Carl S. | Thermoplastic polymers with improved infrared reheat properties |
| US6602568B2 (en) * | 1999-03-08 | 2003-08-05 | Plastic Technologies, Inc. | Co-layer preform having an infrared energy absorbing material added to the inner layer to effect preferential heating |
| US6258313B1 (en) * | 1999-05-04 | 2001-07-10 | Container Corporation International Inc. | Stretch blow molding process and apparatus for the manufacturing of plastic containers |
| US6440383B1 (en) * | 1999-06-24 | 2002-08-27 | Altair Nanomaterials Inc. | Processing aqueous titanium chloride solutions to ultrafine titanium dioxide |
| US6427826B1 (en) * | 1999-11-17 | 2002-08-06 | Ecolab Inc. | Container, such as a food or beverage container, lubrication method |
| US6440373B1 (en) * | 1999-10-15 | 2002-08-27 | Bel-Art Products, Inc. | Device for collecting and storing samples |
| DE19955192C2 (de) * | 1999-11-16 | 2003-04-17 | Arntz Beteiligungs Gmbh & Co | Verfahren zur Herstellung eines Strahlenschutzmaterials |
| US6660792B2 (en) * | 1999-12-21 | 2003-12-09 | M & G Usa Corporation | Process for fast heat-up polyesters |
| US6727372B2 (en) * | 2000-08-07 | 2004-04-27 | Eastman Chemical Company | Colorant compounds containing copolymerizable vinyl groups |
| US6274852B1 (en) * | 2000-10-11 | 2001-08-14 | Therm-O-Disc, Incorporated | Conductive polymer compositions containing N-N-M-phenylenedimaleimide and devices |
| US6933055B2 (en) * | 2000-11-08 | 2005-08-23 | Valspar Sourcing, Inc. | Multilayered package with barrier properties |
| US20040030029A1 (en) * | 2000-12-08 | 2004-02-12 | Stephen Weinhold | Polyester compositions for hot-fill containers |
| US6590069B2 (en) * | 2000-12-15 | 2003-07-08 | Wellman, Inc. | Methods of post-polymerization extruder injection in condensation polymer production |
| US6500890B2 (en) * | 2000-12-15 | 2002-12-31 | Wellman, Inc. | Polyester bottle resins having reduced frictional properties and methods for making the same |
| CN1271111C (zh) * | 2001-01-25 | 2006-08-23 | 三菱化学株式会社 | 聚酯树脂及由它制成的成形品,以及聚酯树脂的制造方法 |
| US6896830B2 (en) * | 2001-01-26 | 2005-05-24 | Eastman Kodak Company | Method of making injection molding articles having a marbled appearance |
| US6572810B2 (en) * | 2001-01-29 | 2003-06-03 | Eastman Kodak Company | Method of injection molding articles with improved physical properties |
| JP2002319787A (ja) * | 2001-02-15 | 2002-10-31 | Sumitomo Electric Ind Ltd | 電磁波吸収材料 |
| US7300690B2 (en) * | 2001-03-29 | 2007-11-27 | General Electric Company | Radial tilt reduced media |
| JP2002374092A (ja) * | 2001-06-15 | 2002-12-26 | Polymatech Co Ltd | 放熱性電波吸収体 |
| US20030017336A1 (en) * | 2001-07-16 | 2003-01-23 | Bar-Ilan Univeristy | Nanoscale metal particles and method of preparing same |
| US7687124B2 (en) * | 2001-07-26 | 2010-03-30 | M&G Usa Corporation | Oxygen-scavenging containers having low haze |
| US7740926B2 (en) * | 2001-07-26 | 2010-06-22 | M&G Usa Corporation | Oxygen-scavenging containers |
| US6780916B2 (en) * | 2001-07-26 | 2004-08-24 | M & G Usa Corporation | Oxygen-scavenging resin compositions having low haze |
| US6916354B2 (en) * | 2001-10-16 | 2005-07-12 | International Non-Toxic Composites Corp. | Tungsten/powdered metal/polymer high density non-toxic composites |
| TR200202198A2 (tr) * | 2002-09-13 | 2004-04-21 | Zafer Malazgirt | Laparoskopik ameliyatlardan sonra büyük trokar deliklerinin onariminda kullanilan yama-tikaç |
| US20040101642A1 (en) * | 2002-11-26 | 2004-05-27 | Quillen Donna Rice | Glassy carbon thermoplastic compositions |
| US6777048B2 (en) * | 2002-12-18 | 2004-08-17 | Eastman Chemical Company | Polyester compositions containing silicon carbide |
| US7303795B2 (en) * | 2003-03-13 | 2007-12-04 | Invista North America S.A. R.L. | Molding of polypropylene with enhanced reheat characteristics |
| US7041716B2 (en) * | 2003-07-11 | 2006-05-09 | National Research Council Of Canada | Cellulose filled thermoplastic composites |
| US20050058846A1 (en) * | 2003-09-16 | 2005-03-17 | Ryosuke Matsui | Polyester film |
| US20050165148A1 (en) * | 2004-01-28 | 2005-07-28 | Bogerd Jos V.D. | Infra-red radiation absorption articles and method of manufacture thereof |
| US7063377B2 (en) * | 2004-08-06 | 2006-06-20 | General Motors Corporation | Hood lift mechanisms utilizing active materials and methods of use |
| US7622153B2 (en) * | 2004-08-13 | 2009-11-24 | M&G Usa Corporation | Method of making vapour deposited oxygen-scavenging particles |
| US7662880B2 (en) * | 2004-09-03 | 2010-02-16 | Eastman Chemical Company | Polyester polymer and copolymer compositions containing metallic nickel particles |
| US20060110557A1 (en) * | 2004-09-03 | 2006-05-25 | Zhiyong Xia | Polyester polymer and copolymer compositions containing metallic tungsten particles |
| US7300967B2 (en) * | 2004-11-12 | 2007-11-27 | Eastman Chemical Company | Polyester polymer and copolymer compositions containing metallic titanium particles |
| US20060105129A1 (en) * | 2004-11-12 | 2006-05-18 | Zhiyong Xia | Polyester polymer and copolymer compositions containing titanium carbide particles |
| US7932345B2 (en) * | 2005-09-16 | 2011-04-26 | Grupo Petrotemex, S.A. De C.V. | Aluminum containing polyester polymers having low acetaldehyde generation rates |
| US8431202B2 (en) * | 2005-09-16 | 2013-04-30 | Grupo Petrotemex, S.A. De C.V. | Aluminum/alkaline or alkali/titanium containing polyesters having improved reheat, color and clarity |
| US7745512B2 (en) * | 2005-09-16 | 2010-06-29 | Eastman Chemical Company | Polyester polymer and copolymer compositions containing carbon-coated iron particles |
| US20080058495A1 (en) * | 2006-09-05 | 2008-03-06 | Donna Rice Quillen | Polyester polymer and copolymer compositions containing titanium and yellow colorants |
-
2004
- 2004-12-07 US US11/005,689 patent/US20060122300A1/en not_active Abandoned
-
2005
- 2005-11-22 CN CNA2005800417752A patent/CN101072819A/zh active Pending
- 2005-11-22 WO PCT/US2005/042471 patent/WO2006062743A1/en not_active Ceased
- 2005-11-22 JP JP2007545504A patent/JP2008523213A/ja not_active Withdrawn
- 2005-11-22 BR BRPI0518461-4A patent/BRPI0518461A2/pt not_active IP Right Cessation
- 2005-11-22 MX MX2007006660A patent/MX2007006660A/es unknown
- 2005-11-22 KR KR1020077012729A patent/KR20070085804A/ko not_active Withdrawn
- 2005-11-22 AR ARP050104890A patent/AR052982A1/es not_active Application Discontinuation
- 2005-11-22 DE DE602005013694T patent/DE602005013694D1/de not_active Expired - Lifetime
- 2005-11-22 EP EP05849260A patent/EP1828293B1/en not_active Expired - Lifetime
- 2005-11-22 AT AT05849260T patent/ATE427337T1/de not_active IP Right Cessation
- 2005-11-22 EP EP08014777A patent/EP1997846A1/en not_active Withdrawn
- 2005-11-22 CA CA002588305A patent/CA2588305A1/en not_active Abandoned
- 2005-12-06 TW TW094142870A patent/TW200628527A/zh unknown
-
2006
- 2006-03-10 US US11/372,819 patent/US20060205854A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| WO2006062743A1 (en) | 2006-06-15 |
| EP1997846A1 (en) | 2008-12-03 |
| US20060205854A1 (en) | 2006-09-14 |
| DE602005013694D1 (de) | 2009-05-14 |
| KR20070085804A (ko) | 2007-08-27 |
| JP2008523213A (ja) | 2008-07-03 |
| BRPI0518461A2 (pt) | 2008-11-18 |
| CN101072819A (zh) | 2007-11-14 |
| AR052982A1 (es) | 2007-04-18 |
| US20060122300A1 (en) | 2006-06-08 |
| TW200628527A (en) | 2006-08-16 |
| ATE427337T1 (de) | 2009-04-15 |
| EP1828293B1 (en) | 2009-04-01 |
| EP1828293A1 (en) | 2007-09-05 |
| MX2007006660A (es) | 2007-06-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US7300967B2 (en) | Polyester polymer and copolymer compositions containing metallic titanium particles | |
| EP1784447B1 (en) | Polyester polymer and copolymer compositions containing metallic tungsten particles | |
| US20060052504A1 (en) | Polyester polymer and copolymer compositions containing metallic nickel particles | |
| EP1809691B1 (en) | Polyester polymer and copolymer compositions containing titanium carbide particles | |
| US7745512B2 (en) | Polyester polymer and copolymer compositions containing carbon-coated iron particles | |
| US7776942B2 (en) | Polyester polymer and copolymer compositions containing particles of titanium nitride and carbon-coated iron | |
| EP1828293B1 (en) | Polyester polymer and copolymer compositions containing steel particles | |
| US20060051542A1 (en) | Polyester polymer and copolymer compositions containing metallic molybdenum particles | |
| US20060177614A1 (en) | Polyester polymer and copolymer compositions containing metallic tantalum particles | |
| EP1794225A1 (en) | Polyester polymer and copolymer compositions containing metallic molybdenum particles |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Discontinued |