CA2283787A1 - Golf ball comprising a metal, ceramic, or composite mantle or inner layer - Google Patents
Golf ball comprising a metal, ceramic, or composite mantle or inner layer Download PDFInfo
- Publication number
- CA2283787A1 CA2283787A1 CA002283787A CA2283787A CA2283787A1 CA 2283787 A1 CA2283787 A1 CA 2283787A1 CA 002283787 A CA002283787 A CA 002283787A CA 2283787 A CA2283787 A CA 2283787A CA 2283787 A1 CA2283787 A1 CA 2283787A1
- Authority
- CA
- Canada
- Prior art keywords
- mantle
- golf ball
- core
- spherical
- materials
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 229910052751 metal Inorganic materials 0.000 title claims abstract description 78
- 239000002184 metal Substances 0.000 title claims abstract description 77
- 239000000919 ceramic Substances 0.000 title claims abstract description 40
- 239000002131 composite material Substances 0.000 title abstract description 40
- 238000000034 method Methods 0.000 claims abstract description 60
- 239000000758 substrate Substances 0.000 claims abstract description 54
- 238000004519 manufacturing process Methods 0.000 claims abstract description 7
- 239000000463 material Substances 0.000 claims description 107
- 239000011162 core material Substances 0.000 claims description 100
- 229920000554 ionomer Polymers 0.000 claims description 60
- 239000000203 mixture Substances 0.000 claims description 55
- 239000002253 acid Substances 0.000 claims description 49
- -1 polyethylene Polymers 0.000 claims description 39
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 26
- 239000011521 glass Substances 0.000 claims description 26
- 229920001577 copolymer Polymers 0.000 claims description 25
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 claims description 24
- 229910010271 silicon carbide Inorganic materials 0.000 claims description 24
- 229920001187 thermosetting polymer Polymers 0.000 claims description 20
- 238000000151 deposition Methods 0.000 claims description 19
- 239000007788 liquid Substances 0.000 claims description 19
- 229920001971 elastomer Polymers 0.000 claims description 17
- 239000004593 Epoxy Substances 0.000 claims description 15
- 229920001778 nylon Polymers 0.000 claims description 14
- 239000004677 Nylon Substances 0.000 claims description 13
- 229910052759 nickel Inorganic materials 0.000 claims description 13
- 229910000831 Steel Inorganic materials 0.000 claims description 12
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 12
- 239000010959 steel Substances 0.000 claims description 12
- 239000012815 thermoplastic material Substances 0.000 claims description 12
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 11
- 239000000806 elastomer Substances 0.000 claims description 11
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 9
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 9
- 229910045601 alloy Inorganic materials 0.000 claims description 9
- 239000000956 alloy Substances 0.000 claims description 9
- 229910052804 chromium Inorganic materials 0.000 claims description 9
- 239000011651 chromium Substances 0.000 claims description 9
- 229920000728 polyester Polymers 0.000 claims description 9
- 239000012779 reinforcing material Substances 0.000 claims description 9
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 8
- 239000004743 Polypropylene Substances 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 229920001155 polypropylene Polymers 0.000 claims description 8
- 239000010936 titanium Substances 0.000 claims description 8
- 229910001000 nickel titanium Inorganic materials 0.000 claims description 7
- 229910052719 titanium Inorganic materials 0.000 claims description 7
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 claims description 6
- 229920001707 polybutylene terephthalate Polymers 0.000 claims description 6
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 6
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 6
- 239000002243 precursor Substances 0.000 claims description 6
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 claims description 5
- 239000004698 Polyethylene Substances 0.000 claims description 5
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 claims description 5
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 claims description 5
- 239000004417 polycarbonate Substances 0.000 claims description 5
- 229920000515 polycarbonate Polymers 0.000 claims description 5
- 229910052580 B4C Inorganic materials 0.000 claims description 4
- 229920000106 Liquid crystal polymer Polymers 0.000 claims description 4
- 239000004977 Liquid-crystal polymers (LCPs) Substances 0.000 claims description 4
- 239000004793 Polystyrene Substances 0.000 claims description 4
- 229910000323 aluminium silicate Inorganic materials 0.000 claims description 4
- 239000004760 aramid Substances 0.000 claims description 4
- INAHAJYZKVIDIZ-UHFFFAOYSA-N boron carbide Chemical compound B12B3B4C32B41 INAHAJYZKVIDIZ-UHFFFAOYSA-N 0.000 claims description 4
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 4
- 230000009969 flowable effect Effects 0.000 claims description 4
- 229920000573 polyethylene Polymers 0.000 claims description 4
- 239000000377 silicon dioxide Substances 0.000 claims description 4
- HUAUNKAZQWMVFY-UHFFFAOYSA-M sodium;oxocalcium;hydroxide Chemical compound [OH-].[Na+].[Ca]=O HUAUNKAZQWMVFY-UHFFFAOYSA-M 0.000 claims description 4
- 244000025254 Cannabis sativa Species 0.000 claims description 3
- 235000012766 Cannabis sativa ssp. sativa var. sativa Nutrition 0.000 claims description 3
- 235000012765 Cannabis sativa ssp. sativa var. spontanea Nutrition 0.000 claims description 3
- 240000000491 Corchorus aestuans Species 0.000 claims description 3
- 235000011777 Corchorus aestuans Nutrition 0.000 claims description 3
- 235000010862 Corchorus capsularis Nutrition 0.000 claims description 3
- 229920000742 Cotton Polymers 0.000 claims description 3
- 241000219146 Gossypium Species 0.000 claims description 3
- 235000004431 Linum usitatissimum Nutrition 0.000 claims description 3
- 229920003235 aromatic polyamide Polymers 0.000 claims description 3
- 235000009120 camo Nutrition 0.000 claims description 3
- 235000005607 chanvre indien Nutrition 0.000 claims description 3
- 239000011487 hemp Substances 0.000 claims description 3
- 229920002223 polystyrene Polymers 0.000 claims description 3
- 229920000877 Melamine resin Polymers 0.000 claims description 2
- 239000004642 Polyimide Substances 0.000 claims description 2
- 229920000265 Polyparaphenylene Polymers 0.000 claims description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 claims description 2
- 229920000570 polyether Polymers 0.000 claims description 2
- 229920001721 polyimide Polymers 0.000 claims description 2
- 229920001296 polysiloxane Polymers 0.000 claims description 2
- SCUZVMOVTVSBLE-UHFFFAOYSA-N prop-2-enenitrile;styrene Chemical compound C=CC#N.C=CC1=CC=CC=C1 SCUZVMOVTVSBLE-UHFFFAOYSA-N 0.000 claims description 2
- 229920000638 styrene acrylonitrile Polymers 0.000 claims description 2
- 229920001567 vinyl ester resin Polymers 0.000 claims description 2
- 241000208202 Linaceae Species 0.000 claims 2
- 229920002292 Nylon 6 Polymers 0.000 claims 2
- 229920000571 Nylon 11 Polymers 0.000 claims 1
- YWJUZWOHLHBWQY-UHFFFAOYSA-N decanedioic acid;hexane-1,6-diamine Chemical compound NCCCCCCN.OC(=O)CCCCCCCCC(O)=O YWJUZWOHLHBWQY-UHFFFAOYSA-N 0.000 claims 1
- 150000002739 metals Chemical class 0.000 abstract description 17
- 239000010410 layer Substances 0.000 description 124
- 239000011347 resin Substances 0.000 description 38
- 229920005989 resin Polymers 0.000 description 38
- 239000000835 fiber Substances 0.000 description 33
- 239000011159 matrix material Substances 0.000 description 23
- 230000001413 cellular effect Effects 0.000 description 22
- 239000007789 gas Substances 0.000 description 18
- 230000008569 process Effects 0.000 description 17
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 16
- 230000006835 compression Effects 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 238000000576 coating method Methods 0.000 description 15
- 235000019589 hardness Nutrition 0.000 description 15
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 14
- 238000007906 compression Methods 0.000 description 14
- 239000007921 spray Substances 0.000 description 14
- 238000001704 evaporation Methods 0.000 description 13
- 238000000465 moulding Methods 0.000 description 13
- 230000002787 reinforcement Effects 0.000 description 13
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 12
- 239000005977 Ethylene Substances 0.000 description 12
- 229920003182 Surlyn® Polymers 0.000 description 12
- 239000007787 solid Substances 0.000 description 11
- 238000004544 sputter deposition Methods 0.000 description 11
- 238000010521 absorption reaction Methods 0.000 description 10
- 238000005229 chemical vapour deposition Methods 0.000 description 10
- 239000011248 coating agent Substances 0.000 description 10
- 230000008021 deposition Effects 0.000 description 10
- 239000003365 glass fiber Substances 0.000 description 10
- 238000010438 heat treatment Methods 0.000 description 10
- 229920001169 thermoplastic Polymers 0.000 description 10
- 239000004416 thermosoftening plastic Substances 0.000 description 10
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 9
- 230000008020 evaporation Effects 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 230000005484 gravity Effects 0.000 description 8
- 239000011701 zinc Substances 0.000 description 8
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 7
- 239000004917 carbon fiber Substances 0.000 description 7
- 150000001768 cations Chemical class 0.000 description 7
- 239000002245 particle Substances 0.000 description 7
- 238000004804 winding Methods 0.000 description 7
- 229910052725 zinc Inorganic materials 0.000 description 7
- 239000012298 atmosphere Substances 0.000 description 6
- 238000000748 compression moulding Methods 0.000 description 6
- 239000000945 filler Substances 0.000 description 6
- 239000000499 gel Substances 0.000 description 6
- 238000001746 injection moulding Methods 0.000 description 6
- 230000000704 physical effect Effects 0.000 description 6
- 229920003023 plastic Polymers 0.000 description 6
- 239000004033 plastic Substances 0.000 description 6
- 229920006380 polyphenylene oxide Polymers 0.000 description 6
- 239000004814 polyurethane Substances 0.000 description 6
- 229920002635 polyurethane Polymers 0.000 description 6
- 239000005060 rubber Substances 0.000 description 6
- 229920002725 thermoplastic elastomer Polymers 0.000 description 6
- 229920000049 Carbon (fiber) Polymers 0.000 description 5
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 5
- 239000004734 Polyphenylene sulfide Substances 0.000 description 5
- 238000013459 approach Methods 0.000 description 5
- 229910052786 argon Inorganic materials 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 238000009713 electroplating Methods 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 238000007733 ion plating Methods 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 229910000734 martensite Inorganic materials 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 229920002857 polybutadiene Polymers 0.000 description 5
- 229920000069 polyphenylene sulfide Polymers 0.000 description 5
- 238000012545 processing Methods 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- 239000004696 Poly ether ether ketone Substances 0.000 description 4
- 239000005062 Polybutadiene Substances 0.000 description 4
- 239000004697 Polyetherimide Substances 0.000 description 4
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- 239000000306 component Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 238000010894 electron beam technology Methods 0.000 description 4
- 239000003822 epoxy resin Substances 0.000 description 4
- 230000004907 flux Effects 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 150000002978 peroxides Chemical class 0.000 description 4
- 229920000647 polyepoxide Polymers 0.000 description 4
- 229920002530 polyetherether ketone Polymers 0.000 description 4
- 229920001601 polyetherimide Polymers 0.000 description 4
- 229920000098 polyolefin Polymers 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229920001897 terpolymer Polymers 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 4
- 229910052721 tungsten Inorganic materials 0.000 description 4
- 239000010937 tungsten Substances 0.000 description 4
- 150000003751 zinc Chemical class 0.000 description 4
- 239000004711 α-olefin Substances 0.000 description 4
- 239000004604 Blowing Agent Substances 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 3
- 229920002614 Polyether block amide Polymers 0.000 description 3
- 229910001219 R-phase Inorganic materials 0.000 description 3
- 239000004433 Thermoplastic polyurethane Substances 0.000 description 3
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 3
- 238000010276 construction Methods 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- KHYBPSFKEHXSLX-UHFFFAOYSA-N iminotitanium Chemical compound [Ti]=N KHYBPSFKEHXSLX-UHFFFAOYSA-N 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 229910052750 molybdenum Inorganic materials 0.000 description 3
- 239000011733 molybdenum Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 229910052573 porcelain Inorganic materials 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 239000003870 refractory metal Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229920002803 thermoplastic polyurethane Polymers 0.000 description 3
- 230000009466 transformation Effects 0.000 description 3
- MTPVUVINMAGMJL-UHFFFAOYSA-N trimethyl(1,1,2,2,2-pentafluoroethyl)silane Chemical compound C[Si](C)(C)C(F)(F)C(F)(F)F MTPVUVINMAGMJL-UHFFFAOYSA-N 0.000 description 3
- 238000001771 vacuum deposition Methods 0.000 description 3
- LTPBRCUWZOMYOC-UHFFFAOYSA-N Beryllium oxide Chemical compound O=[Be] LTPBRCUWZOMYOC-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 229920002943 EPDM rubber Polymers 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 229910000760 Hardened steel Inorganic materials 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- 229920002302 Nylon 6,6 Polymers 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 239000004695 Polyether sulfone Substances 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 229920000297 Rayon Polymers 0.000 description 2
- 229910052581 Si3N4 Inorganic materials 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 230000004075 alteration Effects 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 239000002216 antistatic agent Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000011449 brick Substances 0.000 description 2
- 238000009924 canning Methods 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 229910010293 ceramic material Inorganic materials 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- KZHJGOXRZJKJNY-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Si]=O.O=[Al]O[Al]=O.O=[Al]O[Al]=O.O=[Al]O[Al]=O KZHJGOXRZJKJNY-UHFFFAOYSA-N 0.000 description 2
- 238000007598 dipping method Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000010891 electric arc Methods 0.000 description 2
- 229920006336 epoxy molding compound Polymers 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- 229920001903 high density polyethylene Polymers 0.000 description 2
- 239000004700 high-density polyethylene Substances 0.000 description 2
- 239000012943 hotmelt Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 239000011256 inorganic filler Substances 0.000 description 2
- 229910003475 inorganic filler Inorganic materials 0.000 description 2
- 229910017053 inorganic salt Inorganic materials 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 238000001465 metallisation Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 239000012778 molding material Substances 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 229910052863 mullite Inorganic materials 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920006149 polyester-amide block copolymer Polymers 0.000 description 2
- 229920006393 polyether sulfone Polymers 0.000 description 2
- 229920001955 polyphenylene ether Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000002964 rayon Substances 0.000 description 2
- 239000011226 reinforced ceramic Substances 0.000 description 2
- 239000011208 reinforced composite material Substances 0.000 description 2
- 239000011342 resin composition Substances 0.000 description 2
- 229910001285 shape-memory alloy Inorganic materials 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 230000007103 stamina Effects 0.000 description 2
- 229910052715 tantalum Inorganic materials 0.000 description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000001721 transfer moulding Methods 0.000 description 2
- 229910052720 vanadium Inorganic materials 0.000 description 2
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 2
- 238000009834 vaporization Methods 0.000 description 2
- 230000008016 vaporization Effects 0.000 description 2
- 238000003466 welding Methods 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- 150000007934 α,β-unsaturated carboxylic acids Chemical class 0.000 description 2
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- SZTBMYHIYNGYIA-UHFFFAOYSA-N 2-chloroacrylic acid Chemical compound OC(=O)C(Cl)=C SZTBMYHIYNGYIA-UHFFFAOYSA-N 0.000 description 1
- WROUWQQRXUBECT-UHFFFAOYSA-N 2-ethylacrylic acid Chemical compound CCC(=C)C(O)=O WROUWQQRXUBECT-UHFFFAOYSA-N 0.000 description 1
- NBOCQTNZUPTTEI-UHFFFAOYSA-N 4-[4-(hydrazinesulfonyl)phenoxy]benzenesulfonohydrazide Chemical compound C1=CC(S(=O)(=O)NN)=CC=C1OC1=CC=C(S(=O)(=O)NN)C=C1 NBOCQTNZUPTTEI-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 229910018507 Al—Ni Inorganic materials 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 239000004156 Azodicarbonamide Substances 0.000 description 1
- 229910052582 BN Inorganic materials 0.000 description 1
- PZNSFCLAULLKQX-UHFFFAOYSA-N Boron nitride Chemical compound N#B PZNSFCLAULLKQX-UHFFFAOYSA-N 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical group [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229910000881 Cu alloy Inorganic materials 0.000 description 1
- 229910017535 Cu-Al-Ni Inorganic materials 0.000 description 1
- MWRWFPQBGSZWNV-UHFFFAOYSA-N Dinitrosopentamethylenetetramine Chemical compound C1N2CN(N=O)CN1CN(N=O)C2 MWRWFPQBGSZWNV-UHFFFAOYSA-N 0.000 description 1
- 239000004716 Ethylene/acrylic acid copolymer Substances 0.000 description 1
- RYECOJGRJDOGPP-UHFFFAOYSA-N Ethylurea Chemical compound CCNC(N)=O RYECOJGRJDOGPP-UHFFFAOYSA-N 0.000 description 1
- 241000490229 Eucephalus Species 0.000 description 1
- 238000005033 Fourier transform infrared spectroscopy Methods 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229920000271 Kevlar® Polymers 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 240000002636 Manilkara bidentata Species 0.000 description 1
- 239000004594 Masterbatch (MB) Substances 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- 229910020968 MoSi2 Inorganic materials 0.000 description 1
- 229910000990 Ni alloy Inorganic materials 0.000 description 1
- FAIIFDPAEUKBEP-UHFFFAOYSA-N Nilvadipine Chemical compound COC(=O)C1=C(C#N)NC(C)=C(C(=O)OC(C)C)C1C1=CC=CC([N+]([O-])=O)=C1 FAIIFDPAEUKBEP-UHFFFAOYSA-N 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- 229930182556 Polyacetal Natural products 0.000 description 1
- 241001501288 Polymeria Species 0.000 description 1
- 241000206607 Porphyra umbilicalis Species 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 101710185016 Proteasome-activating nucleotidase 1 Proteins 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229910001069 Ti alloy Inorganic materials 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 description 1
- HZEWFHLRYVTOIW-UHFFFAOYSA-N [Ti].[Ni] Chemical compound [Ti].[Ni] HZEWFHLRYVTOIW-UHFFFAOYSA-N 0.000 description 1
- JBYDEEJRPNLAST-UHFFFAOYSA-N [Zn].[Zn].[Na].[Na].[Zn].[Na] Chemical compound [Zn].[Zn].[Na].[Na].[Zn].[Na] JBYDEEJRPNLAST-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 229920006243 acrylic copolymer Polymers 0.000 description 1
- 230000001464 adherent effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229920006231 aramid fiber Polymers 0.000 description 1
- XOZUGNYVDXMRKW-AATRIKPKSA-N azodicarbonamide Chemical compound NC(=O)\N=N\C(N)=O XOZUGNYVDXMRKW-AATRIKPKSA-N 0.000 description 1
- 235000019399 azodicarbonamide Nutrition 0.000 description 1
- IRERQBUNZFJFGC-UHFFFAOYSA-L azure blue Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[S-]S[S-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-] IRERQBUNZFJFGC-UHFFFAOYSA-L 0.000 description 1
- 235000016302 balata Nutrition 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 229920005601 base polymer Polymers 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- YXTPWUNVHCYOSP-UHFFFAOYSA-N bis($l^{2}-silanylidene)molybdenum Chemical compound [Si]=[Mo]=[Si] YXTPWUNVHCYOSP-UHFFFAOYSA-N 0.000 description 1
- 238000005422 blasting Methods 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 238000000071 blow moulding Methods 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- FQNHWXHRAUXLFU-UHFFFAOYSA-N carbon monoxide;tungsten Chemical group [W].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] FQNHWXHRAUXLFU-UHFFFAOYSA-N 0.000 description 1
- 238000010000 carbonizing Methods 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000012159 carrier gas Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000011153 ceramic matrix composite Substances 0.000 description 1
- 238000010382 chemical cross-linking Methods 0.000 description 1
- 238000005234 chemical deposition Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229920003193 cis-1,4-polybutadiene polymer Polymers 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- 239000004595 color masterbatch Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 229910052878 cordierite Inorganic materials 0.000 description 1
- 239000008358 core component Substances 0.000 description 1
- 239000012792 core layer Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000005137 deposition process Methods 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 125000004386 diacrylate group Chemical group 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 229920003244 diene elastomer Polymers 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- JSKIRARMQDRGJZ-UHFFFAOYSA-N dimagnesium dioxido-bis[(1-oxido-3-oxo-2,4,6,8,9-pentaoxa-1,3-disila-5,7-dialuminabicyclo[3.3.1]nonan-7-yl)oxy]silane Chemical compound [Mg++].[Mg++].[O-][Si]([O-])(O[Al]1O[Al]2O[Si](=O)O[Si]([O-])(O1)O2)O[Al]1O[Al]2O[Si](=O)O[Si]([O-])(O1)O2 JSKIRARMQDRGJZ-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- JJPWLZKJCBVHRG-UHFFFAOYSA-N ethene;prop-2-enoic acid;zinc Chemical compound [Zn].C=C.OC(=O)C=C JJPWLZKJCBVHRG-UHFFFAOYSA-N 0.000 description 1
- 229920006242 ethylene acrylic acid copolymer Polymers 0.000 description 1
- 229920006226 ethylene-acrylic acid Polymers 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000002241 glass-ceramic Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 229920005669 high impact polystyrene Polymers 0.000 description 1
- 239000004797 high-impact polystyrene Substances 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 239000010720 hydraulic oil Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 239000000017 hydrogel Substances 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 238000010884 ion-beam technique Methods 0.000 description 1
- 239000004761 kevlar Substances 0.000 description 1
- 239000004850 liquid epoxy resins (LERs) Substances 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 235000014380 magnesium carbonate Nutrition 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000010128 melt processing Methods 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 239000007769 metal material Substances 0.000 description 1
- 229920003145 methacrylic acid copolymer Polymers 0.000 description 1
- 229940117841 methacrylic acid copolymer Drugs 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical compound Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000004005 microsphere Substances 0.000 description 1
- PZRHRDRVRGEVNW-UHFFFAOYSA-N milrinone Chemical compound N1C(=O)C(C#N)=CC(C=2C=CN=CC=2)=C1C PZRHRDRVRGEVNW-UHFFFAOYSA-N 0.000 description 1
- 229960003574 milrinone Drugs 0.000 description 1
- 229910021344 molybdenum silicide Inorganic materials 0.000 description 1
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 description 1
- MOFOBJHOKRNACT-UHFFFAOYSA-N nickel silver Chemical compound [Ni].[Ag] MOFOBJHOKRNACT-UHFFFAOYSA-N 0.000 description 1
- 239000010956 nickel silver Substances 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- HDKLIZDXVUCLHQ-UHFFFAOYSA-N non-3-en-2-one Chemical compound CCCCCC=CC(C)=O HDKLIZDXVUCLHQ-UHFFFAOYSA-N 0.000 description 1
- 239000012811 non-conductive material Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 229910001732 osumilite Inorganic materials 0.000 description 1
- 238000010422 painting Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 229920003208 poly(ethylene sulfide) Polymers 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229920005644 polyethylene terephthalate glycol copolymer Polymers 0.000 description 1
- 229920001228 polyisocyanate Polymers 0.000 description 1
- 239000005056 polyisocyanate Substances 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 239000012254 powdered material Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- ARJOQCYCJMAIFR-UHFFFAOYSA-N prop-2-enoyl prop-2-enoate Chemical compound C=CC(=O)OC(=O)C=C ARJOQCYCJMAIFR-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- 238000000009 pyrolysis mass spectrometry Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- LMCILKQUBHEOPB-UHFFFAOYSA-M sodium;ethene;prop-2-enoate Chemical compound [Na+].C=C.[O-]C(=O)C=C LMCILKQUBHEOPB-UHFFFAOYSA-M 0.000 description 1
- 239000007779 soft material Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 229910002076 stabilized zirconia Inorganic materials 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000011145 styrene acrylonitrile resin Substances 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 235000019587 texture Nutrition 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 238000009757 thermoplastic moulding Methods 0.000 description 1
- 229920002397 thermoplastic olefin Polymers 0.000 description 1
- 238000010136 thermoset moulding Methods 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- XROWMBWRMNHXMF-UHFFFAOYSA-J titanium tetrafluoride Chemical compound [F-].[F-].[F-].[F-].[Ti+4] XROWMBWRMNHXMF-UHFFFAOYSA-J 0.000 description 1
- KPGXUAIFQMJJFB-UHFFFAOYSA-H tungsten hexachloride Chemical compound Cl[W](Cl)(Cl)(Cl)(Cl)Cl KPGXUAIFQMJJFB-UHFFFAOYSA-H 0.000 description 1
- NXHILIPIEUBEPD-UHFFFAOYSA-H tungsten hexafluoride Chemical compound F[W](F)(F)(F)(F)F NXHILIPIEUBEPD-UHFFFAOYSA-H 0.000 description 1
- 235000013799 ultramarine blue Nutrition 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- QYEGVGMKHFXVEZ-UHFFFAOYSA-N zinc Chemical compound [Zn].[Zn].[Zn] QYEGVGMKHFXVEZ-UHFFFAOYSA-N 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
- 229960001763 zinc sulfate Drugs 0.000 description 1
- 229910000368 zinc sulfate Inorganic materials 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B45/00—Apparatus or methods for manufacturing balls
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B37/00—Solid balls; Rigid hollow balls; Marbles
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B37/00—Solid balls; Rigid hollow balls; Marbles
- A63B37/0003—Golf balls
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B37/00—Solid balls; Rigid hollow balls; Marbles
- A63B37/02—Special cores
- A63B37/08—Liquid cores; Plastic cores
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B37/00—Solid balls; Rigid hollow balls; Marbles
- A63B37/12—Special coverings, i.e. outer layer material
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B37/00—Solid balls; Rigid hollow balls; Marbles
- A63B37/02—Special cores
- A63B37/08—Liquid cores; Plastic cores
- A63B2037/085—Liquid cores; Plastic cores liquid, jellylike
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B2209/00—Characteristics of used materials
- A63B2209/08—Characteristics of used materials magnetic
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B37/00—Solid balls; Rigid hollow balls; Marbles
- A63B37/0003—Golf balls
- A63B37/0023—Covers
- A63B37/0029—Physical properties
- A63B37/0037—Flexural modulus; Bending stiffness
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B37/00—Solid balls; Rigid hollow balls; Marbles
- A63B37/0003—Golf balls
- A63B37/0038—Intermediate layers, e.g. inner cover, outer core, mantle
- A63B37/0039—Intermediate layers, e.g. inner cover, outer core, mantle characterised by the material
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B37/00—Solid balls; Rigid hollow balls; Marbles
- A63B37/0003—Golf balls
- A63B37/0038—Intermediate layers, e.g. inner cover, outer core, mantle
- A63B37/004—Physical properties
- A63B37/0045—Thickness
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B37/00—Solid balls; Rigid hollow balls; Marbles
- A63B37/0003—Golf balls
- A63B37/005—Cores
- A63B37/0051—Materials other than polybutadienes; Constructional details
- A63B37/0052—Liquid cores
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B37/00—Solid balls; Rigid hollow balls; Marbles
- A63B37/0003—Golf balls
- A63B37/007—Characteristics of the ball as a whole
- A63B37/0072—Characteristics of the ball as a whole with a specified number of layers
- A63B37/0076—Multi-piece balls, i.e. having two or more intermediate layers
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B43/00—Balls with special arrangements
Landscapes
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Physical Education & Sports Medicine (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Laminated Bodies (AREA)
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US4212097P | 1997-03-28 | 1997-03-28 | |
| US4243097P | 1997-03-28 | 1997-03-28 | |
| US60/042,430 | 1997-03-28 | ||
| US60/042,120 | 1997-03-28 | ||
| US09/027,482 US6142887A (en) | 1996-09-16 | 1998-02-20 | Golf ball comprising a metal, ceramic, or composite mantle or inner layer |
| US09/027,482 | 1998-02-20 | ||
| PCT/US1998/006180 WO1999036130A1 (en) | 1997-03-28 | 1998-03-27 | Golf ball comprising a metal, ceramic, or composite mantle or inner layer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2283787A1 true CA2283787A1 (en) | 1999-07-22 |
Family
ID=27363019
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002283787A Abandoned CA2283787A1 (en) | 1997-03-28 | 1998-03-27 | Golf ball comprising a metal, ceramic, or composite mantle or inner layer |
Country Status (6)
| Country | Link |
|---|---|
| US (2) | US6142887A (enExample) |
| JP (1) | JP4169799B2 (enExample) |
| AU (1) | AU738596B2 (enExample) |
| CA (1) | CA2283787A1 (enExample) |
| GB (1) | GB2337939B (enExample) |
| WO (1) | WO1999036130A1 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US11673027B2 (en) | 2020-07-07 | 2023-06-13 | Acushnet Company | Golf ball incorporating functionalized inorganic aluminosilicate ceramic microspheres in at least one core layer |
Families Citing this family (115)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6142887A (en) * | 1996-09-16 | 2000-11-07 | Spalding Sports Worldwide, Inc. | Golf ball comprising a metal, ceramic, or composite mantle or inner layer |
| US6494795B2 (en) * | 2001-03-23 | 2002-12-17 | Acushnet Company | Golf ball and a method for controlling the spin rate of same |
| US6852044B2 (en) | 1995-06-07 | 2005-02-08 | Acushnet Company | Multi-layered core golf ball |
| US6547677B2 (en) | 1995-06-07 | 2003-04-15 | Acushnet Company | Multi-layered core golf ball |
| US7255656B2 (en) * | 1995-06-07 | 2007-08-14 | Acushnet Company | Multi-layer core golf ball |
| US6786838B2 (en) | 1995-06-07 | 2004-09-07 | Acushnet Company | Golf ball with multi-layered core |
| US6270429B1 (en) * | 1996-09-16 | 2001-08-07 | Spalding Sports Worldwide, Inc. | Crosslinked foam as filler in an inner layer or core of a multi-component golf ball |
| US6004225A (en) * | 1997-01-21 | 1999-12-21 | Owens; Timothy M. | Golf ball |
| US6991563B2 (en) * | 2001-03-23 | 2006-01-31 | Acushnet Company | Perimeter weighted golf ball |
| US6988962B2 (en) * | 1997-10-03 | 2006-01-24 | Acushnet Company | Multi-layered core golf ball |
| US7074137B2 (en) | 1997-10-03 | 2006-07-11 | Acushnet Company | Golf ball |
| US6981926B2 (en) * | 1997-10-03 | 2006-01-03 | Acushnet Company | Multi-layered core golf ball |
| US6012991A (en) | 1998-01-05 | 2000-01-11 | Taylor Made Golf Company, Inc. | Golf ball with improved intermediate layer |
| AU764335B2 (en) * | 1999-05-14 | 2003-08-14 | Sri Sports Limited | Painted golf ball |
| JP2000350794A (ja) * | 1999-06-14 | 2000-12-19 | Sumitomo Rubber Ind Ltd | ゴルフボール |
| DE19962570A1 (de) * | 1999-12-23 | 2001-07-05 | Basf Ag | Herstellung thermoplastischer Formmassen unter Verwendung von Magnesiumoxid |
| US7708654B2 (en) * | 2002-05-29 | 2010-05-04 | Acushnet Company | Foam-core golf balls |
| US6692380B2 (en) | 2001-03-23 | 2004-02-17 | Acushnet Company | Golf ball with high density center |
| US7452291B2 (en) * | 2001-03-23 | 2008-11-18 | Acushnet Company | Foam-core golf balls |
| US6685580B2 (en) | 2001-03-23 | 2004-02-03 | Acushnet Company | Three-layer cover for a golf ball including a thin dense layer |
| US7331878B2 (en) * | 2004-02-06 | 2008-02-19 | Acushnet Company | Multi-layer golf ball having velocity gradient from slower center to faster cover |
| US6533682B2 (en) | 2001-03-23 | 2003-03-18 | Acushnet Company | Golf ball |
| US6852042B2 (en) * | 2001-03-23 | 2005-02-08 | Acushnet Company | Golf ball |
| US7651415B2 (en) | 2001-03-23 | 2010-01-26 | Acushnet Company | Variable density core golf balls |
| US6832963B2 (en) * | 2001-03-23 | 2004-12-21 | Acushnet Company | Golf ball covers comprising modulus adjusting fillers |
| US6743123B2 (en) * | 2001-03-23 | 2004-06-01 | Acushnet Company | Golf ball having a high moment of inertia and low driver spin rate |
| US7357735B2 (en) * | 2001-03-23 | 2008-04-15 | Acushnet Company | Fully-neutralized ionomers for use in golf ball having a large core and a thin, dense layer |
| US20060128858A1 (en) * | 2001-06-26 | 2006-06-15 | Sullivan Michael J | Highly-neutralized thermoplastic copolymer center for improved multi-layer core golf ball |
| US20070270244A1 (en) | 2001-11-28 | 2007-11-22 | Sullivan Michael J | Multi-Layer Golf Ball |
| US7744493B2 (en) * | 2001-11-28 | 2010-06-29 | Acushnet Company | Multi-layer core golf ball |
| US9339694B2 (en) * | 2001-11-28 | 2016-05-17 | Acushnet Company | Multi-layer golf ball |
| US8702535B2 (en) * | 2001-11-28 | 2014-04-22 | Acushnet Company | Multi-layered core golf ball |
| US7014575B2 (en) * | 2001-11-28 | 2006-03-21 | Acushnet Company | Golf ball with multi-layered core |
| US9539470B2 (en) * | 2001-11-28 | 2017-01-10 | Acushnet Company | Multi-layer golf ball |
| US6846248B2 (en) * | 2001-12-13 | 2005-01-25 | Callaway Golf Company | Golf ball having a controlled weight distribution about a designated spin axis and a method of making same |
| US6755753B2 (en) | 2001-12-13 | 2004-06-29 | Callaway Golf Company | Golf ball having a controlled variable moment of inertia |
| US20050215718A1 (en) * | 2002-01-04 | 2005-09-29 | Murali Rajagopalan | Nanocomposite ethylene copolymer compositions for golf balls |
| US7314896B2 (en) * | 2002-01-04 | 2008-01-01 | Acushnet Company | Nano-particulate blends with fully-neutralized ionomeric polymers for golf ball layers |
| US6899642B2 (en) | 2002-03-21 | 2005-05-31 | Acushnet Company | Golf ball with a layer including composite material and a method for making such a golf ball |
| US7300364B2 (en) * | 2004-02-06 | 2007-11-27 | Acushnet Company | Multi-layer golf ball having velocity gradient from faster center to slower cover |
| US8715110B2 (en) * | 2003-05-19 | 2014-05-06 | Acushnet Company | Foam-core golf balls |
| US6802785B2 (en) | 2002-08-09 | 2004-10-12 | Acushnet Company | Golf balls including a layer with reinforced fibers and methods for forming such golf balls |
| US7037965B2 (en) * | 2002-08-27 | 2006-05-02 | Acushnet Company | Golf balls comprising glass ionomers, ormocers, or other hybrid organic/inorganic compositions |
| US7238122B2 (en) | 2002-08-27 | 2007-07-03 | Acushnet Company | Ormocer composites for golf ball components |
| US6793592B2 (en) * | 2002-08-27 | 2004-09-21 | Acushnet Company | Golf balls comprising glass ionomers, or other hybrid organic/inorganic compositions |
| US6852043B2 (en) * | 2002-12-12 | 2005-02-08 | Acushnet Company | Golf ball |
| US6916254B2 (en) | 2003-01-02 | 2005-07-12 | Acushnet Company | Golf ball with small inner core |
| US7354357B2 (en) * | 2004-02-06 | 2008-04-08 | Acushnet Company | Multi-layer core golf ball |
| US7468006B2 (en) * | 2004-03-10 | 2008-12-23 | Acushnet Company | Golf balls having two or more core layers formed from HNP compositions |
| US7207903B2 (en) * | 2004-03-10 | 2007-04-24 | Acushnet Company | Golf balls having a low modulus HNP layer and a high modulus HNP layer |
| US7211008B2 (en) | 2004-03-10 | 2007-05-01 | Acushnet Company | Golf balls having a low modulus HNP layer and a high modulus HNP layer |
| US7517289B2 (en) * | 2004-03-10 | 2009-04-14 | Acushnet Company | Golf balls having two or more core layers formed from HNP compositions |
| US8152653B2 (en) | 2004-05-07 | 2012-04-10 | Acushnet Company | Thick inner cover multi-layer golf ball |
| US7004856B2 (en) * | 2004-05-07 | 2006-02-28 | Acushnet Company | Thick inner cover multi-layer golf ball |
| US20080153629A1 (en) * | 2004-05-07 | 2008-06-26 | Sullivan Michael J | Thick Outer Cover Layer Golf Ball |
| US7244194B2 (en) | 2004-05-07 | 2007-07-17 | Acushnet Company | Thick inner cover multi-layer golf ball |
| US7125348B2 (en) * | 2004-05-14 | 2006-10-24 | Acushnet Company | Thick-covered, soft core golf ball |
| US7377863B2 (en) * | 2005-01-03 | 2008-05-27 | Acushnet Company | Multi-layer golf ball having improved inter-layer adhesion via induction heating |
| US7819761B2 (en) | 2005-01-26 | 2010-10-26 | Taylor Made Golf Company, Inc. | Golf ball having cross-core hardness differential and method for making it |
| US7261647B2 (en) * | 2005-02-18 | 2007-08-28 | Acushnet Company | Nano-particulate compositions for decreasing the water vapor transmission rate of golf ball layers |
| US20060270790A1 (en) * | 2005-05-26 | 2006-11-30 | Brian Comeau | Carbon-nanotube-reinforced composites for golf ball layers |
| US20070161434A1 (en) * | 2005-06-03 | 2007-07-12 | Dufaux Douglas | Golf ball |
| US7766767B2 (en) * | 2005-12-15 | 2010-08-03 | Acushnet Company | Golf balls having a low modulus HNP layer and a high modulus HNP layer |
| US7731607B2 (en) * | 2005-12-15 | 2010-06-08 | Acushnet Company | Golf balls having at least two core layers formed from HNP compositions |
| US9427630B2 (en) | 2005-12-15 | 2016-08-30 | Acushnet Company | Golf balls having at least two core layers formed from HNP compositions |
| US7654916B2 (en) * | 2005-12-15 | 2010-02-02 | Acushnet Company | Golf balls having a low modulus HNP layer and a high modulus HNP layer |
| US10119008B2 (en) | 2005-12-15 | 2018-11-06 | Acushnet Company | Golf balls incorporating HNP ionomers based on highly diverse mixtures of organic acids |
| US7963862B2 (en) * | 2005-12-15 | 2011-06-21 | Acushnet Company | Golf balls having at least two core layers formed from HNP compositions |
| US10188912B2 (en) | 2005-12-15 | 2019-01-29 | Acushnet Company | Golf ball |
| US8030411B2 (en) | 2005-12-21 | 2011-10-04 | Taylor Made Golf Company, Inc. | Polymer compositions comprising peptizers, sports equipment comprising such compositions, and method for their manufacture |
| US20070213143A1 (en) * | 2006-03-07 | 2007-09-13 | Chinn Jeffrey D | Exterior coatings for golf balls |
| US20080057332A1 (en) * | 2006-06-26 | 2008-03-06 | Nanodynamics, Inc. | Methods for making hollow metal spheres |
| US7476339B2 (en) | 2006-08-18 | 2009-01-13 | Saint-Gobain Ceramics & Plastics, Inc. | Highly filled thermoplastic composites |
| US8414424B2 (en) * | 2006-12-12 | 2013-04-09 | Acushnet Company | Anti-counterfeiting system using compound additives |
| US10549157B2 (en) | 2007-03-30 | 2020-02-04 | Acushnet Company | Buoyant, high coefficient of restitution (CoR) golf ball having a reduced flight distance yet the perceived flight trajectory of regular distance high CoR golf balls |
| US7654917B2 (en) * | 2007-03-30 | 2010-02-02 | Acushnet Company | Golf balls having a low modulus HNP layer and a high modulus HNP layer |
| US7935004B2 (en) | 2007-03-30 | 2011-05-03 | Acushnet Company | Golf balls having a low modulus HNP layer and a high modulus HNP layer |
| CN101275209A (zh) * | 2007-03-30 | 2008-10-01 | 清华大学 | 热界面材料及其制备方法 |
| US7833112B2 (en) * | 2007-03-30 | 2010-11-16 | Acushnet Company | Golf balls having a low modulus HNP layer and a high modulus HNP layer |
| US11684824B2 (en) | 2007-03-30 | 2023-06-27 | Acushnet Company | Buoyant high coefficient of restitution (CoR) golf ball incorporating aerodynamics targeting flight trajectory |
| TWI417404B (zh) * | 2007-04-10 | 2013-12-01 | Hon Hai Prec Ind Co Ltd | 熱介面材料及其製備方法 |
| US7775908B2 (en) * | 2007-04-23 | 2010-08-17 | Acushnet Company | Golf balls having two core layers formed from HNP compositions |
| US7731606B2 (en) * | 2007-04-23 | 2010-06-08 | Acushnet Company | Golf balls having two core layers formed from HNP compositions |
| US7871342B2 (en) | 2007-04-23 | 2011-01-18 | Acushnet Company | Golf balls having two or more core layers formed from HNP compositions |
| US8211976B2 (en) | 2007-12-21 | 2012-07-03 | Taylor Made Golf Company, Inc. | Sports equipment compositions comprising a polyurethane, polyurea or prepolymer thereof and a polyfunctional modifier |
| US8096899B2 (en) | 2007-12-28 | 2012-01-17 | Taylor Made Golf Company, Inc. | Golf ball comprising isocyanate-modified composition |
| US8262511B2 (en) * | 2008-01-10 | 2012-09-11 | Acushnet Company | Multi-layer core golf ball |
| US10427008B2 (en) | 2008-01-10 | 2019-10-01 | Acushnet Company | Multi-layer core golf ball incorporating intermediate composite layer comprised of functionalized nanostructures |
| US8469836B2 (en) | 2008-01-10 | 2013-06-25 | Acushnet Company | Multi-layer core golf ball |
| US8123631B2 (en) * | 2008-01-10 | 2012-02-28 | Acushnet Company | Multi-layer core golf ball |
| US8562460B2 (en) | 2008-01-10 | 2013-10-22 | Acushnet Company | Multi-layer golf ball |
| US8236880B2 (en) | 2008-04-23 | 2012-08-07 | Taylor Made Golf Company, Inc. | Compositions comprising an amino triazine and ionomer or ionomer precursor |
| US20100160082A1 (en) * | 2008-12-19 | 2010-06-24 | Murali Rajagopalan | Golf Balls having a Casing Layer Formed from a Single High Acid Based Ionomer with an Ultra High Melt Flow Index Maleic Anhydride Terpolymer |
| US8197360B2 (en) * | 2009-04-29 | 2012-06-12 | Acushnet Company | Multi-layered golf balls containing polyethylene powder |
| US8575278B2 (en) | 2009-12-31 | 2013-11-05 | Taylor Made Golf Company, Inc. | Ionomer compositions for golf balls |
| US8629228B2 (en) | 2009-12-31 | 2014-01-14 | Taylor Made Golf Company, Inc. | Ionomer compositions for golf balls |
| US8674023B2 (en) | 2009-12-31 | 2014-03-18 | Taylor Made Golf Company, Inc. | Ionomer compositions for golf balls |
| US20130072323A1 (en) * | 2011-09-21 | 2013-03-21 | Nike, Inc. | Method Of Golf Ball Compression Molding |
| US8568837B2 (en) * | 2012-03-30 | 2013-10-29 | Nike, Inc. | Method of making golf ball with thermal sprayed layer |
| US9415269B2 (en) | 2012-03-30 | 2016-08-16 | Nike, Inc. | Golf ball with deposited layer |
| US20130274032A1 (en) * | 2012-04-12 | 2013-10-17 | Bridgestone Sports Co., Ltd. | Golf ball |
| US9220946B2 (en) | 2012-09-07 | 2015-12-29 | Acushnet Company | Golf balls having non-uniform core structures with metal-containing centers |
| US9878213B2 (en) * | 2012-09-07 | 2018-01-30 | Acushnet Company | Golf balls having dual-layered cores with metal-containing centers and thermoplastic outer cores |
| US10143893B2 (en) | 2012-09-07 | 2018-12-04 | Acushnet Company | Golf balls having core structures with iron-containing centers |
| US9095746B2 (en) * | 2012-09-07 | 2015-08-04 | Acushnet Company | Golf balls having dual-layered cores with metal-containing centers and thermoset outer cores |
| US9248350B2 (en) | 2013-12-10 | 2016-02-02 | Acushnet Company | Multi-layered golf balls having foam center with selective weight distribution |
| US10010765B2 (en) | 2014-04-02 | 2018-07-03 | Acushnet Company | Golf balls having a center with surrounding foam outer core layer |
| KR101608614B1 (ko) | 2015-01-16 | 2016-04-12 | 서울대학교산학협력단 | 가공경화능 제어 비정질 합금 기지 복합재의 제조방법 및 그에 따라 제조된 복합재료 |
| US9433826B1 (en) | 2015-03-27 | 2016-09-06 | Acushnet Company | Golf ball incorporating metallic film and method of making |
| US20170047145A1 (en) * | 2015-03-30 | 2017-02-16 | Little Device Corporation | Conductive ball |
| US9643063B2 (en) * | 2015-08-06 | 2017-05-09 | Acushnet Company | Golf balls incorporating at least one thermoset and/or thermoplastic layer/coating/film via reactive spray |
| CN205127319U (zh) * | 2015-09-24 | 2016-04-06 | 钟正明 | 一种高弹性环保球结构 |
| GB2594228B (en) * | 2019-11-20 | 2023-12-27 | Jemmtec Ltd | Mould for the manufacture of ceramic packing members |
| US20220162443A1 (en) * | 2020-11-25 | 2022-05-26 | Launch Technologies Co., Ltd. | Thermoplastic polyurethane composition, golf ball, and method for making golf ball |
| US12496497B2 (en) | 2023-11-15 | 2025-12-16 | Acushnet Company | Golf ball including metal foam layer |
Family Cites Families (106)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US707263A (en) * | 1900-09-11 | 1902-08-19 | Frank A Seiberling | Golf-ball. |
| US697816A (en) * | 1901-09-27 | 1902-04-15 | Cleland Davis | Golf-ball. |
| US696887A (en) * | 1901-11-23 | 1902-04-01 | Kempshall Mfg Co | Golf-ball. |
| US696890A (en) * | 1902-01-04 | 1902-04-01 | Kempshall Mfg Co | Golf-ball. |
| US696891A (en) * | 1902-01-04 | 1902-04-01 | Kempshall Mfg Co | Golf-ball. |
| US696895A (en) * | 1902-02-24 | 1902-04-01 | Kempshall Mfg Co | Golf-ball. |
| US700656A (en) * | 1902-03-19 | 1902-05-20 | Kempshall Mfg Co | Shell-blank for playing-balls. |
| US697925A (en) * | 1902-03-24 | 1902-04-15 | Kempshall Mfg Co | Billiard-ball. |
| US699089A (en) * | 1902-03-25 | 1902-04-29 | Kempshall Mfg Co | Playing-ball. |
| US700658A (en) * | 1902-03-25 | 1902-05-20 | Kempshall Mfg Co | Playing-ball. |
| US700660A (en) * | 1902-04-11 | 1902-05-20 | Kempshall Mfg Co | Golf-ball. |
| US704748A (en) * | 1902-04-23 | 1902-07-15 | Eleazer Kempshall | Playing-ball. |
| US704838A (en) * | 1902-05-03 | 1902-07-15 | Eleazer Kempshall | Playing-ball. |
| US701741A (en) * | 1902-05-05 | 1902-06-03 | Kempshall Mfg Co | Golf-ball. |
| US705359A (en) * | 1902-05-09 | 1902-07-22 | Eleazer Kempshall | Playing-ball. |
| US711177A (en) * | 1902-06-12 | 1902-10-14 | Kempshall Mfg Co | Playing-ball. |
| US712413A (en) * | 1902-06-14 | 1902-10-28 | Kempshall Mfg Co | Golf-ball. |
| US711227A (en) * | 1902-06-14 | 1902-10-14 | Kempshall Mfg Co | Playing-ball. |
| US739753A (en) * | 1902-06-14 | 1903-09-22 | Eleazer Kempshall | Playing-ball. |
| US705249A (en) * | 1902-06-14 | 1902-07-22 | Eleazar Kempshall | Playing-ball. |
| US713772A (en) * | 1902-08-07 | 1902-11-18 | Eleazer Kempshall | Playing-ball. |
| US711474A (en) * | 1902-08-07 | 1902-10-21 | Henry S Chapman | Playing-ball. |
| US727200A (en) * | 1902-10-01 | 1903-05-05 | Kempshall Mfg Co | Playing-ball. |
| US719499A (en) * | 1902-10-13 | 1903-02-03 | Kenyon V Painter | Ball. |
| US740403A (en) * | 1902-11-17 | 1903-10-06 | Howard Dorrance Day | Ball. |
| US720852A (en) * | 1903-01-06 | 1903-02-17 | Holdrege Company | Golf-ball. |
| US906644A (en) | 1908-05-07 | 1908-12-15 | John B Mears | Tobacco-receptacle. |
| US985741A (en) * | 1909-08-18 | 1911-02-28 | Francis H Richards | Play-ball. |
| US1182604A (en) * | 1911-03-28 | 1916-05-09 | Frank L O Wadsworth | Golf-ball. |
| US1182605A (en) * | 1911-03-28 | 1916-05-09 | Frank L O Wadsworth | Golf-ball. |
| US1255388A (en) * | 1916-12-14 | 1918-02-05 | Revere Rubber Co | Golf-ball. |
| US1270008A (en) * | 1917-01-10 | 1918-06-18 | Revere Rubber Co | Method of making resilient balls and apparatus therefor. |
| US1339992A (en) * | 1917-07-30 | 1920-05-11 | Charles C Wais | Ball and method of making the same |
| US1586514A (en) * | 1921-01-13 | 1926-06-01 | Arnott Robert Fleming | Balanced ball |
| US1568514A (en) * | 1923-12-22 | 1926-01-05 | Thomas A Lewis | Playing ball |
| US1591117A (en) * | 1925-02-11 | 1926-07-06 | George G Floyd | Golf ball |
| US2055326A (en) * | 1931-06-08 | 1936-09-22 | Leonard A Young | Golf ball |
| US2258333A (en) * | 1937-09-08 | 1941-10-07 | Miller Ellis | Manufacture of golf balls and the like |
| US2258331A (en) * | 1937-09-08 | 1941-10-07 | Miller Ellis | Manufacture of golf balls and the like |
| US2258332A (en) * | 1937-09-08 | 1941-10-07 | Miller Ellis | Manufacture of golf balls and the like |
| US2364955A (en) * | 1943-04-01 | 1944-12-12 | William H Diddel | Golf ball |
| US2786684A (en) * | 1953-12-22 | 1957-03-26 | Louis F Muccino | Golf balls |
| US3031194A (en) * | 1959-04-13 | 1962-04-24 | Perfection Finishing Corp | Golf ball structure |
| US3218075A (en) * | 1962-05-10 | 1965-11-16 | Shakespeare Co | Golf ball |
| SE339751B (enExample) * | 1966-07-22 | 1971-10-18 | Dunlop Co Ltd | |
| US3572722A (en) * | 1966-07-22 | 1971-03-30 | Dunlop Co Ltd | Play balls |
| US3534965A (en) * | 1966-07-22 | 1970-10-20 | Dunlop Co Ltd | Play balls |
| JPS4810618B1 (enExample) * | 1969-03-10 | 1973-04-05 | ||
| US3940145A (en) * | 1970-11-16 | 1976-02-24 | Gentiluomo Joseph A | Golf ball |
| US3908993A (en) * | 1971-05-12 | 1975-09-30 | Joseph A Gentiluomo | Centerless thick-walled game ball |
| US4085937A (en) * | 1975-09-26 | 1978-04-25 | Hugh J. Mclaughlin & Son, Inc. | Composition for a floater golf ball and the floater golf ball made therefrom |
| US4123061A (en) * | 1976-05-20 | 1978-10-31 | Acushnet Company | Ball and process and composition of matter for production thereof |
| US4431193A (en) * | 1981-08-25 | 1984-02-14 | Questor Corporation | Golf ball and method of making same |
| JPS58118775A (ja) * | 1982-01-06 | 1983-07-14 | 早川ゴム株式会社 | ゴルフボ−ル |
| US4473229A (en) * | 1982-04-02 | 1984-09-25 | Kloppenburg Jerry K | Golf ball utilizing graphite materials |
| US4679795A (en) * | 1983-08-01 | 1987-07-14 | Spalding & Evenflo Companies, Inc. | Optical brighteners in golf ball covers |
| US4839116A (en) * | 1984-03-12 | 1989-06-13 | Macgregor Golf Company | Method of molding a foamed core short distance golf ball |
| US4836552A (en) * | 1984-03-12 | 1989-06-06 | Macgregor Golf Company | Short distance golf ball |
| JPS62137075A (ja) * | 1984-10-30 | 1987-06-19 | 住友ゴム工業株式会社 | マルチピ−スソリツドゴルフボ−ル |
| US4674751A (en) * | 1984-12-10 | 1987-06-23 | Spalding & Evenflo Companies, Inc. | Golf ball having improved playability properties |
| US4653758A (en) * | 1985-08-22 | 1987-03-31 | Karsten Solheim | Golf ball |
| US4688801A (en) * | 1985-09-23 | 1987-08-25 | Pony Ind Inc | Production of homogeneous molded golf balls |
| JPH078301B2 (ja) * | 1986-05-23 | 1995-02-01 | ブリヂストンスポーツ株式会社 | ソリツドゴルフボ−ル |
| US4805914A (en) * | 1986-09-04 | 1989-02-21 | Toland J William | Golf ball and method of making the same |
| US4848770A (en) * | 1986-10-20 | 1989-07-18 | Wilson Sporting Goods Co. | Three-piece solid golf ball |
| GB2206889B (en) * | 1987-06-11 | 1991-03-20 | Asics Corp | Rubber composition and golf ball comprising it |
| US4844471A (en) * | 1987-12-24 | 1989-07-04 | Spalding & Evenflo Companies, Inc. | Golf ball core composition including dialkyl tin difatty acid |
| US4884814A (en) * | 1988-01-15 | 1989-12-05 | Spalding & Evenflo Companies, Inc. | Golf ball |
| US5159676A (en) * | 1988-12-05 | 1992-10-27 | Micron Technology, Inc. | Semi-smart DRAM controller IC to provide a pseudo-cache mode of operation using standard page mode draws |
| US4995613A (en) * | 1988-12-15 | 1991-02-26 | Spin-Alizer Corporation | Process for manufacturing practice golf ball |
| US4886275A (en) * | 1988-12-15 | 1989-12-12 | Walker Grant W | Golf ball |
| JP3124533B2 (ja) * | 1989-02-06 | 2001-01-15 | 住友ゴム工業株式会社 | ゴルフボール |
| JP2674627B2 (ja) * | 1989-03-01 | 1997-11-12 | 住友ゴム工業株式会社 | ラージサイズのスリーピースソリッドゴルフボール |
| US5480155A (en) * | 1989-03-10 | 1996-01-02 | Lisco, Inc. | Golf ball |
| US5830087A (en) * | 1995-06-26 | 1998-11-03 | Lisco, Inc. | Multi-layer golf ball |
| US5150906A (en) * | 1989-03-10 | 1992-09-29 | Lisco, Inc. | Multi-piece golf balls and methods of manufacture |
| GB2230531B (en) * | 1989-03-15 | 1992-06-17 | Bridgestone Corp | Three-piece solid golf ball |
| US5020803A (en) * | 1989-03-20 | 1991-06-04 | Acushnet Company | Golf ball and method of making same |
| US4911451A (en) * | 1989-03-29 | 1990-03-27 | Sullivan Michael J | Golf ball cover of neutralized poly(ethylene-acrylic acid) copolymer |
| JP2725374B2 (ja) * | 1989-05-24 | 1998-03-11 | ブリヂストンスポーツ株式会社 | 糸捲きゴルフボール |
| US4943055A (en) * | 1989-07-24 | 1990-07-24 | Deryl Corley | Weighted warmup ball |
| US5098105A (en) | 1989-12-13 | 1992-03-24 | Lisco, Inc. | Golf ball compositions |
| US4986545A (en) * | 1989-12-13 | 1991-01-22 | Spalding Sports Worldwide | Golf ball compositions |
| US5187013A (en) * | 1989-12-13 | 1993-02-16 | Lisco, Inc. | Golf ball compositions |
| DE3942612C2 (de) * | 1989-12-25 | 2003-05-08 | Rieter Ingolstadt Spinnerei | Offenend-Spinnvorrichtung |
| JPH0435674A (ja) * | 1990-06-01 | 1992-02-06 | Bridgestone Corp | 糸巻きゴルフボールの製造方法 |
| KR920006255B1 (ko) * | 1990-06-01 | 1992-08-01 | 일야실업 주식회사 | 세겹으로 이루어진 골프공 |
| US5018740A (en) * | 1990-06-13 | 1991-05-28 | Spalding & Evenflo Companies, Inc. | Golf ball core |
| US5120791A (en) * | 1990-07-27 | 1992-06-09 | Lisco, Inc. | Golf ball cover compositions |
| JP2915108B2 (ja) * | 1990-08-10 | 1999-07-05 | 住友ゴム工業株式会社 | ゴルフボール |
| FR2666018A1 (fr) * | 1990-08-22 | 1992-02-28 | Salomon Sa | Balle de golf. |
| US5873796A (en) * | 1990-12-10 | 1999-02-23 | Acushnet Company | Multi-layer golf ball comprising a cover of ionomer blends |
| US5104126A (en) * | 1991-07-08 | 1992-04-14 | Gentiluomo Joseph A | Golf ball |
| US5439227A (en) * | 1992-08-31 | 1995-08-08 | Bridgestone Sports Co., Ltd. | Multi-piece solid golf ball |
| US5273286A (en) * | 1992-11-06 | 1993-12-28 | Sun Donald J C | Multiple concentric section golf ball |
| US5452898A (en) * | 1993-03-12 | 1995-09-26 | Bridgestone Sports Co., Ltd. | Golf ball |
| JP3057624B2 (ja) * | 1993-04-27 | 2000-07-04 | 住友ゴム工業株式会社 | 糸巻きゴルフボール |
| US6142887A (en) * | 1996-09-16 | 2000-11-07 | Spalding Sports Worldwide, Inc. | Golf ball comprising a metal, ceramic, or composite mantle or inner layer |
| JP3349557B2 (ja) * | 1993-08-13 | 2002-11-25 | 住友ゴム工業株式会社 | 糸巻きゴルフボール |
| JP3257890B2 (ja) * | 1993-12-29 | 2002-02-18 | 住友ゴム工業株式会社 | ゴルフボール |
| US5824746A (en) * | 1995-01-24 | 1998-10-20 | Acushnet Company | Golf balls incorporating foamed metallocene catalyzed polymer |
| US5759676A (en) * | 1995-06-07 | 1998-06-02 | Acushnet Company | Multilayer golf ball |
| US5813923A (en) * | 1995-06-07 | 1998-09-29 | Acushnet Company | Golf ball |
| US5688191A (en) * | 1995-06-07 | 1997-11-18 | Acushnet Company | Multilayer golf ball |
| US5645497A (en) * | 1995-10-03 | 1997-07-08 | Lisco, Inc. | Golf ball |
| US5683312A (en) * | 1996-03-11 | 1997-11-04 | Acushnet Company | Fluid or liquid filled non-wound golf ball |
-
1998
- 1998-02-20 US US09/027,482 patent/US6142887A/en not_active Expired - Lifetime
- 1998-03-27 WO PCT/US1998/006180 patent/WO1999036130A1/en not_active Ceased
- 1998-03-27 CA CA002283787A patent/CA2283787A1/en not_active Abandoned
- 1998-03-27 JP JP52943999A patent/JP4169799B2/ja not_active Expired - Fee Related
- 1998-03-27 GB GB9922130A patent/GB2337939B/en not_active Expired - Fee Related
- 1998-03-27 AU AU67854/98A patent/AU738596B2/en not_active Ceased
-
2000
- 2000-09-14 US US09/662,379 patent/US6612939B1/en not_active Expired - Lifetime
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US11673027B2 (en) | 2020-07-07 | 2023-06-13 | Acushnet Company | Golf ball incorporating functionalized inorganic aluminosilicate ceramic microspheres in at least one core layer |
| US11918861B2 (en) | 2020-07-07 | 2024-03-05 | Acushnet Company | Golf ball incorporating functionalized inorganic aluminosilicate ceramic microspheres in at least one core layer |
Also Published As
| Publication number | Publication date |
|---|---|
| JP4169799B2 (ja) | 2008-10-22 |
| JP2002514962A (ja) | 2002-05-21 |
| GB9922130D0 (en) | 1999-11-17 |
| US6142887A (en) | 2000-11-07 |
| US6612939B1 (en) | 2003-09-02 |
| GB2337939B (en) | 2001-08-29 |
| AU6785498A (en) | 1999-08-02 |
| GB2337939A (en) | 1999-12-08 |
| WO1999036130A1 (en) | 1999-07-22 |
| AU738596B2 (en) | 2001-09-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US6142887A (en) | Golf ball comprising a metal, ceramic, or composite mantle or inner layer | |
| US6244977B1 (en) | Golf ball comprising a metal mantle with a cellular or liquid core | |
| AU758028B2 (en) | Low spin golf ball comprising a mantle with a cellular or liquid core | |
| AU739037B2 (en) | Golf ball comprising a metal mantle having a hollow interior | |
| AU761048B2 (en) | Low spin golf ball comprising a mantle having a hollow interior | |
| US20020022537A1 (en) | Low spin golf ball comprising a metal, ceramic, or composite mantle or inner layer | |
| AU761494B2 (en) | Golf ball comprising a metal, ceramic, or composite mantle or inner layer | |
| AU757103B2 (en) | Low spin golf ball comprising a metal, ceramic, or composite mantle or inner layer | |
| GB2360221A (en) | Golf ball comprising a metal, ceramic, or composite mantle or inner layer | |
| GB2357039A (en) | Golf ball and method of making same | |
| GB2357043A (en) | Golf ball comprising a metal mantle having a hollow interior | |
| JP2002102387A (ja) | マルチコンポーネントゴルフボールの内層における充填材としての架橋フォームまたはコア | |
| GB2385799A (en) | Low spin golf ball comprising a mantle layer including at least one metal |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Dead |