CA2250698A1 - Para-substituted phenylpropanoic acid derivatives as integrin antagonists - Google Patents
Para-substituted phenylpropanoic acid derivatives as integrin antagonists Download PDFInfo
- Publication number
- CA2250698A1 CA2250698A1 CA002250698A CA2250698A CA2250698A1 CA 2250698 A1 CA2250698 A1 CA 2250698A1 CA 002250698 A CA002250698 A CA 002250698A CA 2250698 A CA2250698 A CA 2250698A CA 2250698 A1 CA2250698 A1 CA 2250698A1
- Authority
- CA
- Canada
- Prior art keywords
- amino
- carbonyl
- phenyl
- aminoiminomethyl
- phenylalanine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 108010044426 integrins Proteins 0.000 title claims abstract description 27
- 102000006495 integrins Human genes 0.000 title claims abstract description 27
- YPGCWEMNNLXISK-UHFFFAOYSA-N hydratropic acid Chemical class OC(=O)C(C)C1=CC=CC=C1 YPGCWEMNNLXISK-UHFFFAOYSA-N 0.000 title description 13
- 239000005557 antagonist Substances 0.000 title description 11
- 150000001875 compounds Chemical class 0.000 claims abstract description 384
- 150000003839 salts Chemical class 0.000 claims abstract description 17
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 352
- -1 N-substituted pyrrolidinyl,piperidinyl Chemical group 0.000 claims description 238
- 125000003118 aryl group Chemical group 0.000 claims description 156
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 144
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 135
- 125000000217 alkyl group Chemical group 0.000 claims description 131
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 81
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 71
- 229960005190 phenylalanine Drugs 0.000 claims description 52
- 125000001188 haloalkyl group Chemical group 0.000 claims description 49
- 125000003545 alkoxy group Chemical group 0.000 claims description 47
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 45
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 claims description 43
- 125000001424 substituent group Chemical group 0.000 claims description 43
- 125000002911 monocyclic heterocycle group Chemical group 0.000 claims description 42
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 38
- 229910052736 halogen Inorganic materials 0.000 claims description 35
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 claims description 33
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 33
- 150000002367 halogens Chemical class 0.000 claims description 33
- 229910052739 hydrogen Inorganic materials 0.000 claims description 32
- 125000004414 alkyl thio group Chemical group 0.000 claims description 31
- 125000003342 alkenyl group Chemical group 0.000 claims description 28
- 239000002253 acid Substances 0.000 claims description 27
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 27
- 125000000304 alkynyl group Chemical group 0.000 claims description 27
- 125000004104 aryloxy group Chemical group 0.000 claims description 25
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 23
- 206010028980 Neoplasm Diseases 0.000 claims description 22
- 229910052717 sulfur Inorganic materials 0.000 claims description 21
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 20
- 229940124530 sulfonamide Drugs 0.000 claims description 20
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 19
- 229910052760 oxygen Inorganic materials 0.000 claims description 19
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 19
- 150000003456 sulfonamides Chemical class 0.000 claims description 19
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 18
- 150000004702 methyl esters Chemical class 0.000 claims description 18
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 16
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen(.) Chemical compound [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 16
- 125000003282 alkyl amino group Chemical group 0.000 claims description 15
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 15
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 15
- 125000005843 halogen group Chemical group 0.000 claims description 14
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 14
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 12
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 claims description 11
- 125000004442 acylamino group Chemical group 0.000 claims description 11
- 125000003368 amide group Chemical group 0.000 claims description 11
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 11
- 125000005842 heteroatom Chemical group 0.000 claims description 11
- 125000000623 heterocyclic group Chemical group 0.000 claims description 11
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 9
- 230000033115 angiogenesis Effects 0.000 claims description 9
- 150000001602 bicycloalkyls Chemical group 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- 125000004995 haloalkylthio group Chemical class 0.000 claims description 9
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 claims description 9
- 125000002950 monocyclic group Chemical group 0.000 claims description 9
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 9
- 239000011593 sulfur Substances 0.000 claims description 9
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- 206010027476 Metastases Diseases 0.000 claims description 8
- 208000001132 Osteoporosis Diseases 0.000 claims description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
- CJGXMNONHNZEQQ-JTQLQIEISA-N ethyl (2s)-2-amino-3-phenylpropanoate Chemical compound CCOC(=O)[C@@H](N)CC1=CC=CC=C1 CJGXMNONHNZEQQ-JTQLQIEISA-N 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 7
- 230000009401 metastasis Effects 0.000 claims description 7
- 208000037803 restenosis Diseases 0.000 claims description 7
- 230000015590 smooth muscle cell migration Effects 0.000 claims description 7
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 claims description 7
- 230000004614 tumor growth Effects 0.000 claims description 7
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000002619 bicyclic group Chemical group 0.000 claims description 6
- 125000004494 ethyl ester group Chemical group 0.000 claims description 6
- 208000008750 humoral hypercalcemia of malignancy Diseases 0.000 claims description 6
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 claims description 6
- 241000124008 Mammalia Species 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 5
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 5
- 229910001873 dinitrogen Inorganic materials 0.000 claims description 5
- 239000003937 drug carrier Substances 0.000 claims description 5
- 230000001404 mediated effect Effects 0.000 claims description 5
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 claims description 5
- QGJDFKHLVHUSAJ-UHFFFAOYSA-N 2-[4-[2-[3-(hydrazinylmethylideneamino)anilino]-2-oxoethyl]phenoxy]acetic acid Chemical compound NNC=NC1=CC=CC(NC(=O)CC=2C=CC(OCC(O)=O)=CC=2)=C1 QGJDFKHLVHUSAJ-UHFFFAOYSA-N 0.000 claims description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 4
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 claims description 4
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 4
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 4
- 125000004441 haloalkylsulfonyl group Chemical group 0.000 claims description 4
- 150000003431 steroids Chemical class 0.000 claims description 4
- 235000000346 sugar Nutrition 0.000 claims description 4
- 150000008163 sugars Chemical class 0.000 claims description 4
- BDFMVIGZRRIXCL-QHCPKHFHSA-N (2s)-2-(benzenesulfonamido)-3-[4-[[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzoyl]amino]phenyl]propanoic acid Chemical compound C([C@@H](C(=O)O)NS(=O)(=O)C=1C=CC=CC=1)C(C=C1)=CC=C1NC(=O)C(C=1)=CC=CC=1NC1=NCCCN1 BDFMVIGZRRIXCL-QHCPKHFHSA-N 0.000 claims description 3
- AOJHWPMWHARSCU-NRFANRHFSA-N (2s)-2-(benzenesulfonamido)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid Chemical compound NNC=NC1=CC=CC(C(=O)NC=2C=CC(C[C@H](NS(=O)(=O)C=3C=CC=CC=3)C(O)=O)=CC=2)=C1 AOJHWPMWHARSCU-NRFANRHFSA-N 0.000 claims description 3
- SHIVUZBHDSTXNM-IBGZPJMESA-N (2s)-2-(butylsulfonylamino)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](NS(=O)(=O)CCCC)C(O)=O)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 SHIVUZBHDSTXNM-IBGZPJMESA-N 0.000 claims description 3
- JGDJRFBOGGQOGF-KRWDZBQOSA-N (2s)-2-(ethoxycarbonylamino)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)OCC)C(O)=O)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 JGDJRFBOGGQOGF-KRWDZBQOSA-N 0.000 claims description 3
- KTJCFMAEFZIIRZ-KRWDZBQOSA-N (2s)-2-acetamido-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)C)C(O)=O)=CC=C1NC(=O)C1=CC=CC(NC=NN)=C1 KTJCFMAEFZIIRZ-KRWDZBQOSA-N 0.000 claims description 3
- SLYHQGMHAQXNGT-HNNXBMFYSA-N (2s)-2-amino-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid Chemical compound NNC=NC1=CC=CC(C(=O)NC=2C=CC(C[C@H](N)C(O)=O)=CC=2)=C1 SLYHQGMHAQXNGT-HNNXBMFYSA-N 0.000 claims description 3
- QPZOEIQRDYCGMD-FQEVSTJZSA-N (2s)-3-[2-methoxy-4-[[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzoyl]amino]phenyl]-2-(propan-2-yloxycarbonylamino)propanoic acid Chemical compound C1=C(C[C@H](NC(=O)OC(C)C)C(O)=O)C(OC)=CC(NC(=O)C=2C=C(NC=3NCCCN=3)C=CC=2)=C1 QPZOEIQRDYCGMD-FQEVSTJZSA-N 0.000 claims description 3
- BRERTKAHKRPWBX-SFHVURJKSA-N (2s)-3-[3-chloro-4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(propan-2-yloxycarbonylamino)propanoic acid Chemical compound ClC1=CC(C[C@H](NC(=O)OC(C)C)C(O)=O)=CC=C1NC(=O)C1=CC=CC(NC=NN)=C1 BRERTKAHKRPWBX-SFHVURJKSA-N 0.000 claims description 3
- RBYQPKHTSHEEQK-IBGZPJMESA-N (2s)-3-[4-[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]-2-(3-methylbutanoylamino)propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)CC(C)C)C(O)=O)=CC=C1NC(=O)C1=CC(N=CNN)=CC(C(F)(F)F)=C1 RBYQPKHTSHEEQK-IBGZPJMESA-N 0.000 claims description 3
- XFNSENZQCHMFHQ-INIZCTEOSA-N (2s)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(methanesulfonamido)propanoic acid Chemical compound C1=CC(C[C@H](NS(=O)(=O)C)C(O)=O)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 XFNSENZQCHMFHQ-INIZCTEOSA-N 0.000 claims description 3
- UCALCLSMHHIHRW-INIZCTEOSA-N (2s)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(methoxycarbonylamino)propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)OC)C(O)=O)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 UCALCLSMHHIHRW-INIZCTEOSA-N 0.000 claims description 3
- LMAYIJYGWKNYGE-IBGZPJMESA-N (2s)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(morpholine-4-carbonylamino)propanoic acid Chemical compound NNC=NC1=CC=CC(C(=O)NC=2C=CC(C[C@H](NC(=O)N3CCOCC3)C(O)=O)=CC=2)=C1 LMAYIJYGWKNYGE-IBGZPJMESA-N 0.000 claims description 3
- XBUAUKZFDMEDRL-NRFANRHFSA-N (2s)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(phenoxycarbonylamino)propanoic acid Chemical compound NNC=NC1=CC=CC(C(=O)NC=2C=CC(C[C@H](NC(=O)OC=3C=CC=CC=3)C(O)=O)=CC=2)=C1 XBUAUKZFDMEDRL-NRFANRHFSA-N 0.000 claims description 3
- BPWOWOXWUCSAKA-QHCPKHFHSA-N (2s)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid Chemical compound CC1=CC(C)=CC(C)=C1S(=O)(=O)N[C@H](C(O)=O)CC(C=C1)=CC=C1NC(=O)C1=CC=CC(NC=NN)=C1 BPWOWOXWUCSAKA-QHCPKHFHSA-N 0.000 claims description 3
- DLZQCTFMYQKZRA-KRWDZBQOSA-N (2s)-3-[4-[[3-[(5-amino-1,2,4-oxadiazol-3-yl)amino]benzoyl]amino]phenyl]-2-(propan-2-yloxycarbonylamino)propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)OC(C)C)C(O)=O)=CC=C1NC(=O)C1=CC=CC(NC=2N=C(N)ON=2)=C1 DLZQCTFMYQKZRA-KRWDZBQOSA-N 0.000 claims description 3
- UNOORXNLEMQEPL-UHFFFAOYSA-N 2-(2-carboxyethyl)-5-[[3-(hydrazinylmethylideneamino)benzoyl]amino]benzoic acid Chemical compound NNC=NC1=CC=CC(C(=O)NC=2C=C(C(CCC(O)=O)=CC=2)C(O)=O)=C1 UNOORXNLEMQEPL-UHFFFAOYSA-N 0.000 claims description 3
- YFSSRHIMVAXZMH-UHFFFAOYSA-N 2-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]butanedioic acid Chemical compound NNC=NC1=CC=CC(C(=O)NC=2C=CC(=CC=2)C(CC(O)=O)C(O)=O)=C1 YFSSRHIMVAXZMH-UHFFFAOYSA-N 0.000 claims description 3
- VALGDIUSHXSBMA-UHFFFAOYSA-N 2-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]sulfanylacetic acid Chemical compound NNC=NC1=CC=CC(C(=O)NC=2C=CC(SCC(O)=O)=CC=2)=C1 VALGDIUSHXSBMA-UHFFFAOYSA-N 0.000 claims description 3
- LOYHYBIVXDMARE-UHFFFAOYSA-N 3-[4-[(3-methanehydrazonoylbenzoyl)amino]phenyl]propanoic acid Chemical compound NN=CC1=CC=CC(C(=O)NC=2C=CC(CCC(O)=O)=CC=2)=C1 LOYHYBIVXDMARE-UHFFFAOYSA-N 0.000 claims description 3
- OMSLLPXFSXEYMG-UHFFFAOYSA-N 3-[4-[[(3-methanehydrazonoylbenzoyl)amino]methyl]phenyl]propanoic acid Chemical compound NN=CC1=CC=CC(C(=O)NCC=2C=CC(CCC(O)=O)=CC=2)=C1 OMSLLPXFSXEYMG-UHFFFAOYSA-N 0.000 claims description 3
- OYDUIDMZDZUPGH-UHFFFAOYSA-N 3-[4-[[3-(benzylcarbamoylamino)benzoyl]amino]phenyl]propanoic acid Chemical compound C1=CC(CCC(=O)O)=CC=C1NC(=O)C1=CC=CC(NC(=O)NCC=2C=CC=CC=2)=C1 OYDUIDMZDZUPGH-UHFFFAOYSA-N 0.000 claims description 3
- HYVQLWARYNMRQD-UHFFFAOYSA-N 3-[4-[[3-(carbamoylamino)benzoyl]amino]phenyl]propanoic acid Chemical compound NC(=O)NC1=CC=CC(C(=O)NC=2C=CC(CCC(O)=O)=CC=2)=C1 HYVQLWARYNMRQD-UHFFFAOYSA-N 0.000 claims description 3
- HTFKXBIALJKCQN-UHFFFAOYSA-N 3-[4-[[[3-(hydrazinylmethylideneamino)benzoyl]amino]methyl]phenyl]propanoic acid Chemical compound NNC=NC1=CC=CC(C(=O)NCC=2C=CC(CCC(O)=O)=CC=2)=C1 HTFKXBIALJKCQN-UHFFFAOYSA-N 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 3
- UTHJTUPUEHRHAK-IBGZPJMESA-N ethyl (2s)-2-(ethoxycarbonylamino)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoate Chemical compound C1=CC(C[C@H](NC(=O)OCC)C(=O)OCC)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 UTHJTUPUEHRHAK-IBGZPJMESA-N 0.000 claims description 3
- FYMGGULCMNZLSM-UHFFFAOYSA-N ethyl 3-[4-[[(3-methanehydrazonoylbenzoyl)amino]methyl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCC)=CC=C1CNC(=O)C1=CC=CC(C=NN)=C1 FYMGGULCMNZLSM-UHFFFAOYSA-N 0.000 claims description 3
- FVYPQUPVQDBRPJ-UHFFFAOYSA-N ethyl 3-[4-[[3-(carbamoylamino)benzoyl]amino]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCC)=CC=C1NC(=O)C1=CC=CC(NC(N)=O)=C1 FVYPQUPVQDBRPJ-UHFFFAOYSA-N 0.000 claims description 3
- KKWYGXHIOVCJJL-UHFFFAOYSA-N ethyl 3-[4-[[3-(n'-hydroxycarbamimidoyl)benzoyl]amino]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCC)=CC=C1NC(=O)C1=CC=CC(C(N)=NO)=C1 KKWYGXHIOVCJJL-UHFFFAOYSA-N 0.000 claims description 3
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 3
- 125000002757 morpholinyl group Chemical group 0.000 claims description 3
- AZTXMOGSUZNPFT-IBGZPJMESA-N (2s)-2-(3,3-dimethylbutanoylamino)-3-[4-[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)CC(C)(C)C)C(O)=O)=CC=C1NC(=O)C1=CC(N=CNN)=CC(C(F)(F)F)=C1 AZTXMOGSUZNPFT-IBGZPJMESA-N 0.000 claims description 2
- SOBVPCJQFKAPNT-NRFANRHFSA-N (2s)-2-(3-methylbutanoylamino)-3-[4-[[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)CC(C)C)C(O)=O)=CC=C1NC(=O)C1=CC(NC=2NCCCN=2)=CC(C(F)(F)F)=C1 SOBVPCJQFKAPNT-NRFANRHFSA-N 0.000 claims description 2
- ZVLVYKCGPSZKTH-SFHVURJKSA-N (2s)-3-[4-[[3-(hydrazinylmethylidenecarbamoyl)benzoyl]amino]phenyl]-2-(propan-2-yloxycarbonylamino)propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)OC(C)C)C(O)=O)=CC=C1NC(=O)C1=CC=CC(C(=O)N=CNN)=C1 ZVLVYKCGPSZKTH-SFHVURJKSA-N 0.000 claims description 2
- GPNNVIVBATZBGX-UHFFFAOYSA-N 2-(2-carboxyethyl)-5-[[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzoyl]amino]benzoic acid Chemical compound C1=C(C(O)=O)C(CCC(=O)O)=CC=C1NC(=O)C1=CC=CC(NC=2NCCCN=2)=C1 GPNNVIVBATZBGX-UHFFFAOYSA-N 0.000 claims description 2
- NEYPGRLOEFCTSV-UHFFFAOYSA-N 2-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]sulfonylacetic acid Chemical compound NNC=NC1=CC=CC(C(=O)NC=2C=CC(=CC=2)S(=O)(=O)CC(O)=O)=C1 NEYPGRLOEFCTSV-UHFFFAOYSA-N 0.000 claims description 2
- OEMWSKPPUDCMPD-QHCPKHFHSA-N ethyl (2s)-2-benzamido-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoate Chemical compound C([C@@H](C(=O)OCC)NC(=O)C=1C=CC=CC=1)C(C=C1)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 OEMWSKPPUDCMPD-QHCPKHFHSA-N 0.000 claims description 2
- VGOSMFQHNFHFRA-SFHVURJKSA-N ethyl (2s)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(methanesulfonamido)propanoate Chemical compound C1=CC(C[C@@H](C(=O)OCC)NS(C)(=O)=O)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 VGOSMFQHNFHFRA-SFHVURJKSA-N 0.000 claims description 2
- XIWFCAYBCFQJJT-FQEVSTJZSA-N ethyl (2s)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate Chemical compound C1=CC(C[C@@H](C(=O)OCC)NC(=O)OC(C)(C)C)=CC=C1NC(=O)C1=CC=CC(NC=NN)=C1 XIWFCAYBCFQJJT-FQEVSTJZSA-N 0.000 claims description 2
- 229960003424 phenylacetic acid Drugs 0.000 claims description 2
- QHSSKTAHDJTGGJ-UHFFFAOYSA-N tert-butyl 3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]-3-hydroxyphenyl]propanoate Chemical compound OC1=CC(CCC(=O)OC(C)(C)C)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 QHSSKTAHDJTGGJ-UHFFFAOYSA-N 0.000 claims description 2
- PNHCPGXDFDVBSF-SFHVURJKSA-N (2s)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)OC(C)(C)C)C(O)=O)=CC=C1NC(=O)C1=CC=CC(NC=NN)=C1 PNHCPGXDFDVBSF-SFHVURJKSA-N 0.000 claims 6
- JOAFADWNCSAUPV-QHCPKHFHSA-N (2s)-2-(butylsulfonylamino)-3-[4-[[3-(3,4,5,6-tetrahydro-2h-azepin-7-ylamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](NS(=O)(=O)CCCC)C(O)=O)=CC=C1NC(=O)C1=CC(NC=2CCCCCN=2)=CC(C(F)(F)F)=C1 JOAFADWNCSAUPV-QHCPKHFHSA-N 0.000 claims 4
- BGOYLHDSWOZUFI-QHCPKHFHSA-N (2s)-2-(2-methylpropoxycarbonylamino)-3-[4-[[3-(3,4,5,6-tetrahydro-2h-azepin-7-ylamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)OCC(C)C)C(O)=O)=CC=C1NC(=O)C1=CC(NC=2CCCCCN=2)=CC(C(F)(F)F)=C1 BGOYLHDSWOZUFI-QHCPKHFHSA-N 0.000 claims 3
- DHURYRPQAWBJLB-IBGZPJMESA-N (2s)-2-(butylsulfonylamino)-3-[4-[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](NS(=O)(=O)CCCC)C(O)=O)=CC=C1NC(=O)C1=CC(N=CNN)=CC(C(F)(F)F)=C1 DHURYRPQAWBJLB-IBGZPJMESA-N 0.000 claims 3
- KRRQTWUJZJLGSG-IBGZPJMESA-N (2s)-3-[4-[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]-2-(2-methylpropoxycarbonylamino)propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)OCC(C)C)C(O)=O)=CC=C1NC(=O)C1=CC(N=CNN)=CC(C(F)(F)F)=C1 KRRQTWUJZJLGSG-IBGZPJMESA-N 0.000 claims 3
- HYEZGGXSGXCKPJ-IBGZPJMESA-N (2s)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(2-methylpropoxycarbonylamino)propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)OCC(C)C)C(O)=O)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 HYEZGGXSGXCKPJ-IBGZPJMESA-N 0.000 claims 3
- HPHWFFAHBLPFEK-UHFFFAOYSA-N 3-[4-[[3-(hydrazinylmethylideneamino)phenyl]sulfonylamino]phenyl]propanoic acid Chemical compound NNC=NC1=CC=CC(S(=O)(=O)NC=2C=CC(CCC(O)=O)=CC=2)=C1 HPHWFFAHBLPFEK-UHFFFAOYSA-N 0.000 claims 3
- OAUSFRZOFHYTDG-QHCPKHFHSA-N (2S)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(2-phenylethenylsulfonylamino)propanoic acid Chemical compound NN=CNC=1C=C(C=CC1)C(=O)NC1=CC=C(C[C@H](NS(=O)(=O)C=CC2=CC=CC=C2)C(=O)O)C=C1 OAUSFRZOFHYTDG-QHCPKHFHSA-N 0.000 claims 2
- QPLWLOWSRGOOEW-QHCPKHFHSA-N (2s)-2-(butylsulfonylamino)-3-[4-[[3-(3,4,5,6-tetrahydro-2h-azepin-7-ylamino)benzoyl]amino]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](NS(=O)(=O)CCCC)C(O)=O)=CC=C1NC(=O)C1=CC=CC(NC=2CCCCCN=2)=C1 QPLWLOWSRGOOEW-QHCPKHFHSA-N 0.000 claims 2
- PYBCHFHQIXOAJI-FQEVSTJZSA-N (2s)-2-(butylsulfonylamino)-3-[4-[[3-(hydrazinylmethylideneamino)phenyl]methoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](NS(=O)(=O)CCCC)C(O)=O)=CC=C1OCC1=CC=CC(N=CNN)=C1 PYBCHFHQIXOAJI-FQEVSTJZSA-N 0.000 claims 2
- CHFUVQXAGAHLCK-SFHVURJKSA-N (2s)-2-(tert-butylcarbamoylamino)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)NC(C)(C)C)C(O)=O)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 CHFUVQXAGAHLCK-SFHVURJKSA-N 0.000 claims 2
- UTVUPRALEHQTEG-KRWDZBQOSA-N (2s)-2-acetamido-3-[4-[[3-(hydrazinylmethylideneamino)phenyl]carbamoylamino]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)C)C(O)=O)=CC=C1NC(=O)NC1=CC=CC(N=CNN)=C1 UTVUPRALEHQTEG-KRWDZBQOSA-N 0.000 claims 2
- CPXOGTPDBTUNRM-NRFANRHFSA-N (2s)-2-benzamido-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid Chemical compound NNC=NC1=CC=CC(C(=O)NC=2C=CC(C[C@H](NC(=O)C=3C=CC=CC=3)C(O)=O)=CC=2)=C1 CPXOGTPDBTUNRM-NRFANRHFSA-N 0.000 claims 2
- HYQPPGGTDCSHER-SFHVURJKSA-N (2s)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]-2-methoxyphenyl]-2-(propan-2-yloxycarbonylamino)propanoic acid Chemical compound C1=C(C[C@H](NC(=O)OC(C)C)C(O)=O)C(OC)=CC(NC(=O)C=2C=C(C=CC=2)N=CNN)=C1 HYQPPGGTDCSHER-SFHVURJKSA-N 0.000 claims 2
- WPTYOYNGOXCRMT-SFHVURJKSA-N (2s)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]-2-methoxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound C1=C(C[C@H](NC(=O)OC(C)(C)C)C(O)=O)C(OC)=CC(NC(=O)C=2C=C(NC=NN)C=CC=2)=C1 WPTYOYNGOXCRMT-SFHVURJKSA-N 0.000 claims 2
- GSIWPMFXJDJDON-SFHVURJKSA-N (2s)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(propan-2-yloxycarbonylamino)propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)OC(C)C)C(O)=O)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 GSIWPMFXJDJDON-SFHVURJKSA-N 0.000 claims 2
- HAVKADYFCFXNIM-SFHVURJKSA-N (2s)-3-[4-[[3-[(5-oxo-1,4-dihydroimidazol-2-yl)amino]benzoyl]amino]phenyl]-2-(propan-2-yloxycarbonylamino)propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)OC(C)C)C(O)=O)=CC=C1NC(=O)C1=CC=CC(NC=2NCC(=O)N=2)=C1 HAVKADYFCFXNIM-SFHVURJKSA-N 0.000 claims 2
- DECMUWLJMZMHGV-UHFFFAOYSA-N 2-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]-2-methoxyphenoxy]acetic acid Chemical compound C1=C(OCC(O)=O)C(OC)=CC(NC(=O)C=2C=C(C=CC=2)N=CNN)=C1 DECMUWLJMZMHGV-UHFFFAOYSA-N 0.000 claims 2
- NWAXONRVNDSNGG-UHFFFAOYSA-N 3-[2-(dimethylamino)-4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid Chemical compound C1=C(CCC(O)=O)C(N(C)C)=CC(NC(=O)C=2C=C(C=CC=2)N=CNN)=C1 NWAXONRVNDSNGG-UHFFFAOYSA-N 0.000 claims 2
- JTOSMCOFPADVGU-UHFFFAOYSA-N 3-[2-methoxy-4-[[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzoyl]amino]phenyl]propanoic acid Chemical compound C1=C(CCC(O)=O)C(OC)=CC(NC(=O)C=2C=C(NC=3NCCCN=3)C=CC=2)=C1 JTOSMCOFPADVGU-UHFFFAOYSA-N 0.000 claims 2
- NQSKERYCJLUHQA-UHFFFAOYSA-N 3-[2-tert-butyl-4-[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]ethyl]phenyl]propanoic acid Chemical compound C1=C(CCC(O)=O)C(C(C)(C)C)=CC(CCNC(=O)C=2C=C(C=CC=2)N=CNN)=C1 NQSKERYCJLUHQA-UHFFFAOYSA-N 0.000 claims 2
- WHVNOCXIIATORN-UHFFFAOYSA-N 3-[3-[[[3-(carbamoylamino)benzoyl]amino]methyl]phenyl]propanoic acid Chemical compound NC(=O)NC1=CC=CC(C(=O)NCC=2C=C(CCC(O)=O)C=CC=2)=C1 WHVNOCXIIATORN-UHFFFAOYSA-N 0.000 claims 2
- KZVLFDIZWUSTRX-UHFFFAOYSA-N 3-[4-[[2-[3-(hydrazinylmethylideneamino)phenyl]-2-oxoethyl]amino]phenyl]propanoic acid Chemical compound NNC=NC1=CC=CC(C(=O)CNC=2C=CC(CCC(O)=O)=CC=2)=C1 KZVLFDIZWUSTRX-UHFFFAOYSA-N 0.000 claims 2
- USNUTJBKWWWSSX-UHFFFAOYSA-N 3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid Chemical compound NNC=NC1=CC=CC(C(=O)NC=2C=CC(CCC(O)=O)=CC=2)=C1 USNUTJBKWWWSSX-UHFFFAOYSA-N 0.000 claims 2
- YXJXRVJNCWQQCZ-UHFFFAOYSA-N 4-(carboxymethylamino)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-4-oxobutanoic acid Chemical compound NN=CNC1=CC=CC(C(=O)NC=2C=CC(=CC=2)C(CC(O)=O)C(=O)NCC(O)=O)=C1 YXJXRVJNCWQQCZ-UHFFFAOYSA-N 0.000 claims 2
- DKUZQHNXZBBEBY-NRFANRHFSA-N ethyl (2s)-2-(butylsulfonylamino)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoate Chemical compound C1=CC(C[C@H](NS(=O)(=O)CCCC)C(=O)OCC)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 DKUZQHNXZBBEBY-NRFANRHFSA-N 0.000 claims 2
- AQVJCNCAFJIAMR-UHFFFAOYSA-N ethyl 3-[3-[(3-methanehydrazonoylbenzoyl)amino]phenyl]propanoate Chemical compound CCOC(=O)CCC1=CC=CC(NC(=O)C=2C=C(C=NN)C=CC=2)=C1 AQVJCNCAFJIAMR-UHFFFAOYSA-N 0.000 claims 2
- FMTVMETWZSHBRP-UHFFFAOYSA-N ethyl 3-[3-[[(3-methanehydrazonoylbenzoyl)amino]methyl]phenyl]propanoate Chemical compound CCOC(=O)CCC1=CC=CC(CNC(=O)C=2C=C(C=NN)C=CC=2)=C1 FMTVMETWZSHBRP-UHFFFAOYSA-N 0.000 claims 2
- DPDPIRDYLJQHKF-UHFFFAOYSA-N ethyl 3-[4-[[2-[3-(hydrazinylmethylideneamino)phenyl]-2-oxoethyl]amino]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCC)=CC=C1NCC(=O)C1=CC=CC(N=CNN)=C1 DPDPIRDYLJQHKF-UHFFFAOYSA-N 0.000 claims 2
- WPMBWFOQSNZUGF-UHFFFAOYSA-N ethyl 3-[4-[[3-(benzylcarbamoylamino)benzoyl]amino]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCC)=CC=C1NC(=O)C1=CC=CC(NC(=O)NCC=2C=CC=CC=2)=C1 WPMBWFOQSNZUGF-UHFFFAOYSA-N 0.000 claims 2
- ADNCFKDXOJPZQB-IBGZPJMESA-N (2s)-2-(3,3-dimethylbutanoylamino)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)CC(C)(C)C)C(O)=O)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 ADNCFKDXOJPZQB-IBGZPJMESA-N 0.000 claims 1
- WZFNLEITZAVOEE-UHFFFAOYSA-N 2-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenoxy]propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 WZFNLEITZAVOEE-UHFFFAOYSA-N 0.000 claims 1
- LYAQXSSQCYBHQI-UHFFFAOYSA-N 3-[4-[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]ethyl]phenyl]propanoic acid Chemical compound NNC=NC1=CC=CC(C(=O)NCCC=2C=CC(CCC(O)=O)=CC=2)=C1 LYAQXSSQCYBHQI-UHFFFAOYSA-N 0.000 claims 1
- ZYAJDTNUSABQBZ-UHFFFAOYSA-N 3-[4-[[2-[4-(hydrazinylmethylideneamino)phenyl]acetyl]amino]phenyl]propanoic acid Chemical compound C1=CC(N=CNN)=CC=C1CC(=O)NC1=CC=C(CCC(O)=O)C=C1 ZYAJDTNUSABQBZ-UHFFFAOYSA-N 0.000 claims 1
- AARFVOIDVCDXLK-UHFFFAOYSA-N 3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]-3-hydroxyphenyl]propanoic acid Chemical compound NNC=NC1=CC=CC(C(=O)NC=2C(=CC(CCC(O)=O)=CC=2)O)=C1 AARFVOIDVCDXLK-UHFFFAOYSA-N 0.000 claims 1
- YSYJWGOPLFDFNI-UHFFFAOYSA-N NN=CNC=1C=C(C=CC1)C(=O)NC1=CC=C(C=C1)S(=O)(=O)CC(=O)OCC Chemical compound NN=CNC=1C=C(C=CC1)C(=O)NC1=CC=C(C=C1)S(=O)(=O)CC(=O)OCC YSYJWGOPLFDFNI-UHFFFAOYSA-N 0.000 claims 1
- LAFHZVDIYYHQBF-QHCPKHFHSA-N ethyl (2s)-2-(benzenesulfonamido)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoate Chemical compound C([C@@H](C(=O)OCC)NS(=O)(=O)C=1C=CC=CC=1)C(C=C1)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 LAFHZVDIYYHQBF-QHCPKHFHSA-N 0.000 claims 1
- YQJINDVRPMYQRX-FQEVSTJZSA-N ethyl (2s)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(propan-2-yloxycarbonylamino)propanoate Chemical compound C1=CC(C[C@@H](C(=O)OCC)NC(=O)OC(C)C)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 YQJINDVRPMYQRX-FQEVSTJZSA-N 0.000 claims 1
- IDKNNPKOQSOWAS-UHFFFAOYSA-N ethyl 3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCC)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 IDKNNPKOQSOWAS-UHFFFAOYSA-N 0.000 claims 1
- 238000000034 method Methods 0.000 abstract description 96
- 230000002401 inhibitory effect Effects 0.000 abstract description 15
- 230000003042 antagnostic effect Effects 0.000 abstract description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 204
- 229910001868 water Inorganic materials 0.000 description 175
- 239000000047 product Substances 0.000 description 162
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 139
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 138
- 238000005481 NMR spectroscopy Methods 0.000 description 126
- 239000007787 solid Substances 0.000 description 126
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 124
- 239000000243 solution Substances 0.000 description 120
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 114
- 238000006243 chemical reaction Methods 0.000 description 113
- 239000000203 mixture Substances 0.000 description 101
- 238000004458 analytical method Methods 0.000 description 100
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 96
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 89
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 85
- 235000019439 ethyl acetate Nutrition 0.000 description 81
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 77
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 73
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 72
- 230000015572 biosynthetic process Effects 0.000 description 72
- 238000003786 synthesis reaction Methods 0.000 description 71
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Natural products CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 67
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 60
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 58
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 56
- 239000011541 reaction mixture Substances 0.000 description 56
- 230000002829 reductive effect Effects 0.000 description 53
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 50
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 48
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 48
- 150000003254 radicals Chemical class 0.000 description 47
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 45
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 44
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 43
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 39
- 239000002904 solvent Substances 0.000 description 33
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 30
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 28
- 239000000741 silica gel Substances 0.000 description 28
- 229910002027 silica gel Inorganic materials 0.000 description 28
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 26
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 25
- 238000004128 high performance liquid chromatography Methods 0.000 description 25
- 235000008729 phenylalanine Nutrition 0.000 description 25
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 24
- 239000003921 oil Substances 0.000 description 23
- 235000019198 oils Nutrition 0.000 description 23
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 22
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 22
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 21
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 20
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 20
- 239000012267 brine Substances 0.000 description 20
- 239000002244 precipitate Substances 0.000 description 20
- 238000002360 preparation method Methods 0.000 description 20
- 238000004007 reversed phase HPLC Methods 0.000 description 20
- 238000010992 reflux Methods 0.000 description 19
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 18
- 238000005160 1H NMR spectroscopy Methods 0.000 description 18
- 238000000746 purification Methods 0.000 description 18
- 239000012043 crude product Substances 0.000 description 17
- 238000003818 flash chromatography Methods 0.000 description 17
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 16
- 239000012044 organic layer Substances 0.000 description 16
- 239000012071 phase Substances 0.000 description 16
- 238000003756 stirring Methods 0.000 description 16
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 15
- 229910052786 argon Inorganic materials 0.000 description 15
- 229940073584 methylene chloride Drugs 0.000 description 15
- 235000002639 sodium chloride Nutrition 0.000 description 15
- 229910052938 sodium sulfate Inorganic materials 0.000 description 15
- 235000011152 sodium sulphate Nutrition 0.000 description 15
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 14
- 239000007832 Na2SO4 Substances 0.000 description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- 235000019441 ethanol Nutrition 0.000 description 14
- 235000019341 magnesium sulphate Nutrition 0.000 description 14
- 230000002441 reversible effect Effects 0.000 description 14
- 239000003656 tris buffered saline Substances 0.000 description 14
- 238000003556 assay Methods 0.000 description 13
- WEDIIKBPDQQQJU-UHFFFAOYSA-N butane-1-sulfonyl chloride Chemical compound CCCCS(Cl)(=O)=O WEDIIKBPDQQQJU-UHFFFAOYSA-N 0.000 description 13
- 239000003054 catalyst Substances 0.000 description 13
- 238000001914 filtration Methods 0.000 description 13
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 12
- 239000012346 acetyl chloride Substances 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 12
- 229910000027 potassium carbonate Inorganic materials 0.000 description 12
- XXMFJKNOJSDQBM-UHFFFAOYSA-N 2,2,2-trifluoroacetic acid;hydrate Chemical compound [OH3+].[O-]C(=O)C(F)(F)F XXMFJKNOJSDQBM-UHFFFAOYSA-N 0.000 description 11
- 125000004429 atom Chemical group 0.000 description 11
- 239000012458 free base Substances 0.000 description 11
- 230000005764 inhibitory process Effects 0.000 description 11
- 229910000104 sodium hydride Inorganic materials 0.000 description 11
- BCWMPJBMQCJLKX-UHFFFAOYSA-N 3-(diaminomethylideneamino)benzoic acid;hydrochloride Chemical compound Cl.NC(=N)NC1=CC=CC(C(O)=O)=C1 BCWMPJBMQCJLKX-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 239000010410 layer Substances 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- 102000005962 receptors Human genes 0.000 description 10
- 108020003175 receptors Proteins 0.000 description 10
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 108010031318 Vitronectin Proteins 0.000 description 9
- 102100035140 Vitronectin Human genes 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 210000004027 cell Anatomy 0.000 description 9
- 239000000543 intermediate Substances 0.000 description 9
- 229910052763 palladium Inorganic materials 0.000 description 9
- 229920006395 saturated elastomer Polymers 0.000 description 9
- ISULZYQDGYXDFW-UHFFFAOYSA-N 3-methylbutanoyl chloride Chemical compound CC(C)CC(Cl)=O ISULZYQDGYXDFW-UHFFFAOYSA-N 0.000 description 8
- NXTNASSYJUXJDV-UHFFFAOYSA-N 3-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=CC(C(Cl)=O)=C1 NXTNASSYJUXJDV-UHFFFAOYSA-N 0.000 description 8
- 238000000668 atmospheric pressure chemical ionisation mass spectrometry Methods 0.000 description 8
- 239000007789 gas Substances 0.000 description 8
- 125000001072 heteroaryl group Chemical group 0.000 description 8
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 8
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 7
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 7
- IYMAXBFPHPZYIK-BQBZGAKWSA-N Arg-Gly-Asp Chemical compound NC(N)=NCCC[C@H](N)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(O)=O IYMAXBFPHPZYIK-BQBZGAKWSA-N 0.000 description 7
- 125000002947 alkylene group Chemical group 0.000 description 7
- 239000003153 chemical reaction reagent Substances 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- 239000003446 ligand Substances 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 6
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 241000282414 Homo sapiens Species 0.000 description 6
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- 229910017974 NH40H Inorganic materials 0.000 description 6
- 238000010168 coupling process Methods 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 238000004108 freeze drying Methods 0.000 description 6
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 6
- 239000002480 mineral oil Substances 0.000 description 6
- 235000010446 mineral oil Nutrition 0.000 description 6
- 235000011181 potassium carbonates Nutrition 0.000 description 6
- 230000009467 reduction Effects 0.000 description 6
- 238000003828 vacuum filtration Methods 0.000 description 6
- 239000003039 volatile agent Substances 0.000 description 6
- WBNTUGPRADFXAL-UHFFFAOYSA-N 1H-pyrazole-5-carboximidamide Chemical compound NC(=N)C=1C=CNN=1 WBNTUGPRADFXAL-UHFFFAOYSA-N 0.000 description 5
- 208000006386 Bone Resorption Diseases 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- 101000803709 Homo sapiens Vitronectin Proteins 0.000 description 5
- 230000009286 beneficial effect Effects 0.000 description 5
- 230000024279 bone resorption Effects 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 238000004440 column chromatography Methods 0.000 description 5
- 230000008878 coupling Effects 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 230000009826 neoplastic cell growth Effects 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 235000015320 potassium carbonate Nutrition 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 5
- AJHPGXZOIAYYDW-UHFFFAOYSA-N 3-(2-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)CC1=CC=CC=C1C#N AJHPGXZOIAYYDW-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- 239000004215 Carbon black (E152) Substances 0.000 description 4
- 102000000844 Cell Surface Receptors Human genes 0.000 description 4
- 108010001857 Cell Surface Receptors Proteins 0.000 description 4
- 206010012689 Diabetic retinopathy Diseases 0.000 description 4
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- 208000010191 Osteitis Deformans Diseases 0.000 description 4
- 208000027868 Paget disease Diseases 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 4
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 4
- 239000002671 adjuvant Substances 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- 235000011114 ammonium hydroxide Nutrition 0.000 description 4
- 230000001745 anti-biotin effect Effects 0.000 description 4
- 206010003246 arthritis Diseases 0.000 description 4
- 210000000988 bone and bone Anatomy 0.000 description 4
- 239000012230 colorless oil Substances 0.000 description 4
- 239000013058 crude material Substances 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 238000010828 elution Methods 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 208000027202 mammary Paget disease Diseases 0.000 description 4
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 4
- 230000001575 pathological effect Effects 0.000 description 4
- 208000028169 periodontal disease Diseases 0.000 description 4
- 239000008177 pharmaceutical agent Substances 0.000 description 4
- 230000002265 prevention Effects 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 4
- 206010039073 rheumatoid arthritis Diseases 0.000 description 4
- 235000011150 stannous chloride Nutrition 0.000 description 4
- 239000012258 stirred mixture Substances 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- 230000001225 therapeutic effect Effects 0.000 description 4
- GZNAASVAJNXPPW-UHFFFAOYSA-M tin(4+) chloride dihydrate Chemical compound O.O.[Cl-].[Sn+4] GZNAASVAJNXPPW-UHFFFAOYSA-M 0.000 description 4
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 4
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Substances O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 4
- 230000005747 tumor angiogenesis Effects 0.000 description 4
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 3
- NTKADLOYTKVXQN-UHFFFAOYSA-N 1-bromo-2-methoxy-4-nitrobenzene Chemical compound COC1=CC([N+]([O-])=O)=CC=C1Br NTKADLOYTKVXQN-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 108090000371 Esterases Proteins 0.000 description 3
- 108010012088 Fibrinogen Receptors Proteins 0.000 description 3
- 102100022337 Integrin alpha-V Human genes 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 201000004681 Psoriasis Diseases 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 208000017442 Retinal disease Diseases 0.000 description 3
- 206010038923 Retinopathy Diseases 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 3
- 125000004471 alkyl aminosulfonyl group Chemical group 0.000 description 3
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 description 3
- ZRALSGWEFCBTJO-UHFFFAOYSA-N anhydrous guanidine Natural products NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 3
- 230000008485 antagonism Effects 0.000 description 3
- 239000003443 antiviral agent Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 108010072041 arginyl-glycyl-aspartic acid Proteins 0.000 description 3
- 239000000872 buffer Substances 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 230000021164 cell adhesion Effects 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 150000001851 cinnamic acid derivatives Chemical class 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 238000000921 elemental analysis Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 210000002997 osteoclast Anatomy 0.000 description 3
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 3
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical class OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 3
- 210000002381 plasma Anatomy 0.000 description 3
- 230000003389 potentiating effect Effects 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 3
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- 125000005034 trifluormethylthio group Chemical group FC(S*)(F)F 0.000 description 3
- 150000003667 tyrosine derivatives Chemical class 0.000 description 3
- YMXHPSHLTSZXKH-RVBZMBCESA-N (2,5-dioxopyrrolidin-1-yl) 5-[(3as,4s,6ar)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate Chemical compound C([C@H]1[C@H]2NC(=O)N[C@H]2CS1)CCCC(=O)ON1C(=O)CCC1=O YMXHPSHLTSZXKH-RVBZMBCESA-N 0.000 description 2
- ZYMCBJWUWHHVRX-UHFFFAOYSA-N (4-nitrophenyl)-phenylmethanone Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)C1=CC=CC=C1 ZYMCBJWUWHHVRX-UHFFFAOYSA-N 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 2
- CSEWAUGPAQPMDC-UHFFFAOYSA-N 2-(4-aminophenyl)acetic acid Chemical compound NC1=CC=C(CC(O)=O)C=C1 CSEWAUGPAQPMDC-UHFFFAOYSA-N 0.000 description 2
- MGOLNIXAPIAKFM-UHFFFAOYSA-N 2-isocyanato-2-methylpropane Chemical compound CC(C)(C)N=C=O MGOLNIXAPIAKFM-UHFFFAOYSA-N 0.000 description 2
- BUTKIHRNYUEGKB-UHFFFAOYSA-N 3,3-dimethylbutanoyl chloride Chemical group CC(C)(C)CC(Cl)=O BUTKIHRNYUEGKB-UHFFFAOYSA-N 0.000 description 2
- WBTHOSZMTIPJLR-UHFFFAOYSA-N 3-amino-5-(trifluoromethyl)benzoic acid Chemical compound NC1=CC(C(O)=O)=CC(C(F)(F)F)=C1 WBTHOSZMTIPJLR-UHFFFAOYSA-N 0.000 description 2
- ODCLHXGXGFBBTA-UHFFFAOYSA-N 3-nitro-5-(trifluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC(C(F)(F)F)=C1 ODCLHXGXGFBBTA-UHFFFAOYSA-N 0.000 description 2
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 2
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical class OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- 241000283707 Capra Species 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- 108010037362 Extracellular Matrix Proteins Proteins 0.000 description 2
- 102000010834 Extracellular Matrix Proteins Human genes 0.000 description 2
- 108010001336 Horseradish Peroxidase Proteins 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- 206010029113 Neovascularisation Diseases 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- 238000002835 absorbance Methods 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 102000019997 adhesion receptor Human genes 0.000 description 2
- 108010013985 adhesion receptor Proteins 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229960004050 aminobenzoic acid Drugs 0.000 description 2
- 150000005415 aminobenzoic acids Chemical class 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 239000004599 antimicrobial Substances 0.000 description 2
- 230000006907 apoptotic process Effects 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 239000012131 assay buffer Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N biotin Natural products N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 description 2
- IULFXBLVJIPESI-UHFFFAOYSA-N bis(methylsulfanyl)methylidenecyanamide Chemical compound CSC(SC)=NC#N IULFXBLVJIPESI-UHFFFAOYSA-N 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004204 blood vessel Anatomy 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 2
- NNTOJPXOCKCMKR-UHFFFAOYSA-N boron;pyridine Chemical compound [B].C1=CC=NC=C1 NNTOJPXOCKCMKR-UHFFFAOYSA-N 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 230000004709 cell invasion Effects 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000007979 citrate buffer Substances 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- 238000001212 derivatisation Methods 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000012039 electrophile Substances 0.000 description 2
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 2
- 230000001747 exhibiting effect Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 210000002744 extracellular matrix Anatomy 0.000 description 2
- 239000004023 fresh frozen plasma Substances 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 229940106780 human fibrinogen Drugs 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 2
- 206010020718 hyperplasia Diseases 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 210000004185 liver Anatomy 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 201000001441 melanoma Diseases 0.000 description 2
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- BTHMRXRBXYHLRA-FVGYRXGTSA-N methyl (2s)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride Chemical compound Cl.COC(=O)[C@@H](N)CC1=CC=C([N+]([O-])=O)C=C1 BTHMRXRBXYHLRA-FVGYRXGTSA-N 0.000 description 2
- VZDNXXPBYLGWOS-UHFFFAOYSA-N methyl 3-aminobenzoate Chemical compound COC(=O)C1=CC=CC(N)=C1 VZDNXXPBYLGWOS-UHFFFAOYSA-N 0.000 description 2
- CWKLZLBVOJRSOM-UHFFFAOYSA-N methyl pyruvate Chemical compound COC(=O)C(C)=O CWKLZLBVOJRSOM-UHFFFAOYSA-N 0.000 description 2
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000013641 positive control Substances 0.000 description 2
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000013207 serial dilution Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 239000007790 solid phase Substances 0.000 description 2
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 2
- 239000011550 stock solution Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 2
- 229930192474 thiophene Natural products 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- 125000004950 trifluoroalkyl group Chemical group 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 210000004881 tumor cell Anatomy 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- TXTWXQXDMWILOF-UHFFFAOYSA-N (2-ethoxy-2-oxoethyl)azanium;chloride Chemical compound [Cl-].CCOC(=O)C[NH3+] TXTWXQXDMWILOF-UHFFFAOYSA-N 0.000 description 1
- ZRGWRWGKRQBTSZ-SFHVURJKSA-N (2S)-2-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]-N-(2-phenylethenylsulfonyl)anilino]propanoic acid Chemical compound NN=CNC=1C=C(C=CC1)C(=O)NC1=CC=C(C=C1)N([C@@H](C)C(=O)O)S(=O)(=O)C=CC1=CC=CC=C1 ZRGWRWGKRQBTSZ-SFHVURJKSA-N 0.000 description 1
- PNHCPGXDFDVBSF-GOSISDBHSA-N (2r)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound C1=CC(C[C@@H](NC(=O)OC(C)(C)C)C(O)=O)=CC=C1NC(=O)C1=CC=CC(NC=NN)=C1 PNHCPGXDFDVBSF-GOSISDBHSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- VCEATEUKXBPHOE-FQEVSTJZSA-N (2s)-2-(3,3-dimethylbutanoylamino)-3-[4-[[3-(hydrazinylmethylideneamino)phenyl]methoxy]phenyl]propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)CC(C)(C)C)C(O)=O)=CC=C1OCC1=CC=CC(N=CNN)=C1 VCEATEUKXBPHOE-FQEVSTJZSA-N 0.000 description 1
- PHURMYZSMQJQNN-AWEZNQCLSA-N (2s)-3-(4-hydroxyphenyl)-2-(2-phenylhydrazinyl)propanoic acid Chemical class C([C@@H](C(=O)O)NNC=1C=CC=CC=1)C1=CC=C(O)C=C1 PHURMYZSMQJQNN-AWEZNQCLSA-N 0.000 description 1
- GIANIJCPTPUNBA-QMMMGPOBSA-N (2s)-3-(4-hydroxyphenyl)-2-nitramidopropanoic acid Chemical class [O-][N+](=O)N[C@H](C(=O)O)CC1=CC=C(O)C=C1 GIANIJCPTPUNBA-QMMMGPOBSA-N 0.000 description 1
- YBADLXQNJCMBKR-UHFFFAOYSA-N (4-nitrophenyl)acetic acid Chemical compound OC(=O)CC1=CC=C([N+]([O-])=O)C=C1 YBADLXQNJCMBKR-UHFFFAOYSA-N 0.000 description 1
- FUFUQQWIXMPZFU-VIFPVBQESA-N (s)-methyl 2-amino-3-(4-nitrophenyl)propanoate Chemical compound COC(=O)[C@@H](N)CC1=CC=C([N+]([O-])=O)C=C1 FUFUQQWIXMPZFU-VIFPVBQESA-N 0.000 description 1
- FTNJQNQLEGKTGD-UHFFFAOYSA-N 1,3-benzodioxole Chemical compound C1=CC=C2OCOC2=C1 FTNJQNQLEGKTGD-UHFFFAOYSA-N 0.000 description 1
- WORJRXHJTUTINR-UHFFFAOYSA-N 1,4-dioxane;hydron;chloride Chemical compound Cl.C1COCCO1 WORJRXHJTUTINR-UHFFFAOYSA-N 0.000 description 1
- LNWXALCHPJANMJ-UHFFFAOYSA-N 1-(bromomethyl)-3-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC(CBr)=C1 LNWXALCHPJANMJ-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 1
- GFFGYTMCNVMFAJ-UHFFFAOYSA-N 1-isocyanato-3-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC(N=C=O)=C1 GFFGYTMCNVMFAJ-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- RBZRMBCLZMEYEH-UHFFFAOYSA-N 1h-pyrazol-1-ium-1-carboximidamide;chloride Chemical compound Cl.NC(=N)N1C=CC=N1 RBZRMBCLZMEYEH-UHFFFAOYSA-N 0.000 description 1
- PVJZBZSCGJAWNG-UHFFFAOYSA-N 2,4,6-trimethylbenzenesulfonyl chloride Chemical compound CC1=CC(C)=C(S(Cl)(=O)=O)C(C)=C1 PVJZBZSCGJAWNG-UHFFFAOYSA-N 0.000 description 1
- XUSKZLBLGHBCLD-UHFFFAOYSA-N 2-(3-aminophenyl)acetic acid Chemical compound NC1=CC=CC(CC(O)=O)=C1 XUSKZLBLGHBCLD-UHFFFAOYSA-N 0.000 description 1
- HRABHOUJTSDXGT-UHFFFAOYSA-N 2-(4-anilinophenyl)butanedioic acid Chemical compound C1=CC(C(C(O)=O)CC(=O)O)=CC=C1NC1=CC=CC=C1 HRABHOUJTSDXGT-UHFFFAOYSA-N 0.000 description 1
- MFHFWRBXPQDZSA-UHFFFAOYSA-N 2-(4-bromophenyl)acetonitrile Chemical compound BrC1=CC=C(CC#N)C=C1 MFHFWRBXPQDZSA-UHFFFAOYSA-N 0.000 description 1
- IZLVFLOBTPURLP-UHFFFAOYSA-N 2-Methoxy-4-nitrophenol Chemical compound COC1=CC([N+]([O-])=O)=CC=C1O IZLVFLOBTPURLP-UHFFFAOYSA-N 0.000 description 1
- WCOCCXZFEJGHTC-UHFFFAOYSA-N 2-[4-(bromomethyl)phenyl]acetic acid Chemical compound OC(=O)CC1=CC=C(CBr)C=C1 WCOCCXZFEJGHTC-UHFFFAOYSA-N 0.000 description 1
- XTLWTCFZJHMIJH-UHFFFAOYSA-N 2-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenoxy]acetic acid Chemical compound NNC=NC1=CC=CC(C(=O)NC=2C=CC(OCC(O)=O)=CC=2)=C1 XTLWTCFZJHMIJH-UHFFFAOYSA-N 0.000 description 1
- HFDARIHSWRVCAI-UHFFFAOYSA-N 2-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]sulfanylbutanoic acid Chemical compound C1=CC(SC(CC)C(O)=O)=CC=C1NC(=O)C1=CC=CC(N=CNN)=C1 HFDARIHSWRVCAI-UHFFFAOYSA-N 0.000 description 1
- OLZDHJRNUIXKLU-UHFFFAOYSA-N 2-amino-3-(4-nitrophenyl)propanoic acid;hydrate Chemical compound O.[O-]C(=O)C([NH3+])CC1=CC=C([N+]([O-])=O)C=C1 OLZDHJRNUIXKLU-UHFFFAOYSA-N 0.000 description 1
- IHTLKLSRRSWIGD-DAFODLJHSA-N 2-chloro-5-nitrocinnamic acid Chemical compound OC(=O)\C=C\C1=CC([N+]([O-])=O)=CC=C1Cl IHTLKLSRRSWIGD-DAFODLJHSA-N 0.000 description 1
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 description 1
- PFDJIMKTGBPMEC-UHFFFAOYSA-N 2-methylpropylcarbamic acid Chemical compound CC(C)CNC(O)=O PFDJIMKTGBPMEC-UHFFFAOYSA-N 0.000 description 1
- QDJXYVMXOAOTAV-UHFFFAOYSA-N 2-nitro-2-phenylpropanoic acid Chemical class OC(=O)C(C)([N+]([O-])=O)C1=CC=CC=C1 QDJXYVMXOAOTAV-UHFFFAOYSA-N 0.000 description 1
- SLAMLWHELXOEJZ-UHFFFAOYSA-N 2-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1[N+]([O-])=O SLAMLWHELXOEJZ-UHFFFAOYSA-N 0.000 description 1
- MOTOSAGBNXXRRE-UHFFFAOYSA-N 2-phenylsulfanylacetic acid Chemical class OC(=O)CSC1=CC=CC=C1 MOTOSAGBNXXRRE-UHFFFAOYSA-N 0.000 description 1
- UGWULZWUXSCWPX-UHFFFAOYSA-N 2-sulfanylideneimidazolidin-4-one Chemical compound O=C1CNC(=S)N1 UGWULZWUXSCWPX-UHFFFAOYSA-N 0.000 description 1
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
- WNHPMKYMPWMAIT-UHFFFAOYSA-N 3,4,5,6-tetrahydro-2h-azepine Chemical compound C1CCC=NCC1 WNHPMKYMPWMAIT-UHFFFAOYSA-N 0.000 description 1
- AGYXIUAGBLMBGV-UHFFFAOYSA-N 3,5-dimethylpyrazole-1-carboximidamide;nitric acid Chemical compound O[N+]([O-])=O.CC=1C=C(C)N(C(N)=N)N=1 AGYXIUAGBLMBGV-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- JRQJYVACDJEUDZ-UHFFFAOYSA-N 3-(carbamothioylamino)benzoic acid Chemical compound NC(=S)NC1=CC=CC(C(O)=O)=C1 JRQJYVACDJEUDZ-UHFFFAOYSA-N 0.000 description 1
- PXSNYSNPCWKFBY-UHFFFAOYSA-N 3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoic acid Chemical compound NC(=N)NC1=CC(C(O)=O)=CC(C(F)(F)F)=C1 PXSNYSNPCWKFBY-UHFFFAOYSA-N 0.000 description 1
- STUCMBRFCQKITK-UHFFFAOYSA-N 3-(diaminomethylideneamino)benzoic acid Chemical compound NC(N)=NC1=CC=CC(C(O)=O)=C1 STUCMBRFCQKITK-UHFFFAOYSA-N 0.000 description 1
- XTHSOFAXOBUVFQ-UHFFFAOYSA-N 3-[2-(2-carboxyethyl)-4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid Chemical compound NNC=NC1=CC=CC(C(=O)NC=2C=C(CCC(O)=O)C(CCC(O)=O)=CC=2)=C1 XTHSOFAXOBUVFQ-UHFFFAOYSA-N 0.000 description 1
- MRTIAKPIJHVVHN-UHFFFAOYSA-N 3-[4-[bis(2-chloroethyl)aminomethyl]phenyl]propanoic acid;hydrochloride Chemical compound Cl.OC(=O)CCC1=CC=C(CN(CCCl)CCCl)C=C1 MRTIAKPIJHVVHN-UHFFFAOYSA-N 0.000 description 1
- DMGFVJVLVZOSOE-UHFFFAOYSA-N 3-amino-4-chlorobenzoic acid Chemical compound NC1=CC(C(O)=O)=CC=C1Cl DMGFVJVLVZOSOE-UHFFFAOYSA-N 0.000 description 1
- PTTMMENRLMBXGK-UHFFFAOYSA-N 3-aminobenzoic acid;hydron;chloride Chemical compound Cl.NC1=CC=CC(C(O)=O)=C1 PTTMMENRLMBXGK-UHFFFAOYSA-N 0.000 description 1
- GYLKKXHEIIFTJH-UHFFFAOYSA-N 3-cyanobenzoic acid Chemical compound OC(=O)C1=CC=CC(C#N)=C1 GYLKKXHEIIFTJH-UHFFFAOYSA-N 0.000 description 1
- AUBBVPIQUDFRQI-UHFFFAOYSA-N 3-hydroxy-4-nitrobenzaldehyde Chemical compound OC1=CC(C=O)=CC=C1[N+]([O-])=O AUBBVPIQUDFRQI-UHFFFAOYSA-N 0.000 description 1
- LYEOTKIPRXRKPM-UHFFFAOYSA-N 3-nitro-2,3-diphenylprop-2-enoic acid Chemical class C=1C=CC=CC=1C(C(=O)O)=C([N+]([O-])=O)C1=CC=CC=C1 LYEOTKIPRXRKPM-UHFFFAOYSA-N 0.000 description 1
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 description 1
- MWWNNNAOGWPTQY-UHFFFAOYSA-N 3-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=CC(S(Cl)(=O)=O)=C1 MWWNNNAOGWPTQY-UHFFFAOYSA-N 0.000 description 1
- AFPHTEQTJZKQAQ-UHFFFAOYSA-N 3-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC([N+]([O-])=O)=C1 AFPHTEQTJZKQAQ-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- WCDSVWRUXWCYFN-UHFFFAOYSA-N 4-aminobenzenethiol Chemical compound NC1=CC=C(S)C=C1 WCDSVWRUXWCYFN-UHFFFAOYSA-N 0.000 description 1
- WXOHKMNWMKZMND-UHFFFAOYSA-N 4-aminohydrocinnamic acid Chemical compound NC1=CC=C(CCC(O)=O)C=C1 WXOHKMNWMKZMND-UHFFFAOYSA-N 0.000 description 1
- QEMWWFHROBPSSM-UHFFFAOYSA-N 4-benzhydrylpiperazin-1-amine Chemical compound C1CN(N)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 QEMWWFHROBPSSM-UHFFFAOYSA-N 0.000 description 1
- WZWIQYMTQZCSKI-UHFFFAOYSA-N 4-cyanobenzaldehyde Chemical compound O=CC1=CC=C(C#N)C=C1 WZWIQYMTQZCSKI-UHFFFAOYSA-N 0.000 description 1
- YQYGPGKTNQNXMH-UHFFFAOYSA-N 4-nitroacetophenone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)C=C1 YQYGPGKTNQNXMH-UHFFFAOYSA-N 0.000 description 1
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 1
- GTVVZTAFGPQSPC-UHFFFAOYSA-N 4-nitrophenylalanine Chemical compound OC(=O)C(N)CC1=CC=C([N+]([O-])=O)C=C1 GTVVZTAFGPQSPC-UHFFFAOYSA-N 0.000 description 1
- VQHITFFJBFOMBG-UHFFFAOYSA-N 6-(4-methylpiperazin-1-yl)-11h-benzo[b][1,4]benzodiazepine Chemical compound C1CN(C)CCN1C1=NC2=CC=CC=C2NC2=CC=CC=C12 VQHITFFJBFOMBG-UHFFFAOYSA-N 0.000 description 1
- XBQADBXCNQPHHY-LLVKDONJSA-N 61280-75-9 Chemical compound CC(C)(C)OC(=O)N[C@@H](C(O)=O)CC1=CC=C([N+]([O-])=O)C=C1 XBQADBXCNQPHHY-LLVKDONJSA-N 0.000 description 1
- DNXIQMQGKSQHPC-UHFFFAOYSA-N 7-methoxy-3,4,5,6-tetrahydro-2h-azepine Chemical compound COC1=NCCCCC1 DNXIQMQGKSQHPC-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 1
- 125000006847 BOC protecting group Chemical group 0.000 description 1
- KYNSBQPICQTCGU-UHFFFAOYSA-N Benzopyrane Chemical compound C1=CC=C2C=CCOC2=C1 KYNSBQPICQTCGU-UHFFFAOYSA-N 0.000 description 1
- 208000010392 Bone Fractures Diseases 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- XITYSLDHRKNLEN-UHFFFAOYSA-N Cl.NC1=NCCCCC1C=1C=C(C(=O)O)C=C(C1)C(F)(F)F Chemical compound Cl.NC1=NCCCCC1C=1C=C(C(=O)O)C=C(C1)C(F)(F)F XITYSLDHRKNLEN-UHFFFAOYSA-N 0.000 description 1
- JLKKAPCBGZXUKA-UHFFFAOYSA-N Cl.NC1=NCCCCC1C=1C=C(C(=O)O)C=CC1 Chemical compound Cl.NC1=NCCCCC1C=1C=C(C(=O)O)C=CC1 JLKKAPCBGZXUKA-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- PDQAZBWRQCGBEV-UHFFFAOYSA-N Ethylenethiourea Chemical compound S=C1NCCN1 PDQAZBWRQCGBEV-UHFFFAOYSA-N 0.000 description 1
- 102000008946 Fibrinogen Human genes 0.000 description 1
- 108010049003 Fibrinogen Proteins 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- YEWGIGCYIAMFMA-UHFFFAOYSA-N LSM-2007 Chemical compound C1C2=CC=CC=C2CCN(C)CCC2=C1NC1=CC=CC=C21 YEWGIGCYIAMFMA-UHFFFAOYSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 102000012750 Membrane Glycoproteins Human genes 0.000 description 1
- 108010090054 Membrane Glycoproteins Proteins 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- ZRKWMRDKSOPRRS-UHFFFAOYSA-N N-Methyl-N-nitrosourea Chemical compound O=NN(C)C(N)=O ZRKWMRDKSOPRRS-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- QIAFMBKCNZACKA-UHFFFAOYSA-N N-benzoylglycine Chemical compound OC(=O)CNC(=O)C1=CC=CC=C1 QIAFMBKCNZACKA-UHFFFAOYSA-N 0.000 description 1
- LYNSZQCICBUUTC-UHFFFAOYSA-N NN=CNC=1C=C(C=CC1)C(=O)NC1=CC=C(OCC(=O)OCC)C=C1 Chemical compound NN=CNC=1C=C(C=CC1)C(=O)NC1=CC=C(OCC(=O)OCC)C=C1 LYNSZQCICBUUTC-UHFFFAOYSA-N 0.000 description 1
- 241001024099 Olla Species 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 108010035030 Platelet Membrane Glycoprotein IIb Proteins 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910008066 SnC12 Inorganic materials 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- ZWZUFQPXYVYAFO-UHFFFAOYSA-N Tert-butyl (triphenylphosphoranylidene)acetate Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=CC(=O)OC(C)(C)C)C1=CC=CC=C1 ZWZUFQPXYVYAFO-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- 108010048673 Vitronectin Receptors Proteins 0.000 description 1
- RAFKCLFWELPONH-UHFFFAOYSA-N acetonitrile;dichloromethane Chemical compound CC#N.ClCCl RAFKCLFWELPONH-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 238000001042 affinity chromatography Methods 0.000 description 1
- 235000004279 alanine Nutrition 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000005360 alkyl sulfoxide group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 1
- 230000002491 angiogenic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 229940121357 antivirals Drugs 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 150000001502 aryl halides Chemical class 0.000 description 1
- 125000005362 aryl sulfone group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 125000005361 aryl sulfoxide group Chemical group 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 1
- 150000001556 benzimidazoles Chemical class 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000008827 biological function Effects 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- PFYXSUNOLOJMDX-UHFFFAOYSA-N bis(2,5-dioxopyrrolidin-1-yl) carbonate Chemical compound O=C1CCC(=O)N1OC(=O)ON1C(=O)CCC1=O PFYXSUNOLOJMDX-UHFFFAOYSA-N 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 108010009896 bone resorption factor Proteins 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 238000000160 carbon, hydrogen and nitrogen elemental analysis Methods 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 210000000805 cytoplasm Anatomy 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 125000006003 dichloroethyl group Chemical group 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- SLIKWVTWIGHFJE-UHFFFAOYSA-N diphenoxymethylidenecyanamide Chemical compound C=1C=CC=CC=1OC(=NC#N)OC1=CC=CC=C1 SLIKWVTWIGHFJE-UHFFFAOYSA-N 0.000 description 1
- JZBWUTVDIDNCMW-UHFFFAOYSA-L dipotassium;oxido sulfate Chemical compound [K+].[K+].[O-]OS([O-])(=O)=O JZBWUTVDIDNCMW-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- XKAUHHTXJNCNME-UHFFFAOYSA-N ditert-butyl 2-sulfanylideneimidazolidine-1,3-dicarboxylate Chemical compound CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)C1=S XKAUHHTXJNCNME-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000012202 endocytosis Effects 0.000 description 1
- 210000002889 endothelial cell Anatomy 0.000 description 1
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 1
- ZRSDQBKGDNPFLT-UHFFFAOYSA-N ethanol;oxolane Chemical compound CCO.C1CCOC1 ZRSDQBKGDNPFLT-UHFFFAOYSA-N 0.000 description 1
- VQNGANSRVZMYKT-UHFFFAOYSA-N ethoxyhydrazine Chemical compound CCONN VQNGANSRVZMYKT-UHFFFAOYSA-N 0.000 description 1
- GYUCVQSNZFRDRL-UHFFFAOYSA-N ethyl 2-diethoxyphosphorylbutanoate Chemical compound CCOC(=O)C(CC)P(=O)(OCC)OCC GYUCVQSNZFRDRL-UHFFFAOYSA-N 0.000 description 1
- NNEJKXHIHCAEBS-UHFFFAOYSA-N ethyl 3-[4-[(3-methanehydrazonoylbenzoyl)amino]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCC)=CC=C1NC(=O)C1=CC=CC(C=NN)=C1 NNEJKXHIHCAEBS-UHFFFAOYSA-N 0.000 description 1
- HORAROOHHPIWPC-UHFFFAOYSA-N ethyl 3-[4-[[(3-cyanobenzoyl)amino]methyl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCC)=CC=C1CNC(=O)C1=CC=CC(C#N)=C1 HORAROOHHPIWPC-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- SAXHIDRUJXPDOD-UHFFFAOYSA-N ethyl hydroxy(phenyl)acetate Chemical compound CCOC(=O)C(O)C1=CC=CC=C1 SAXHIDRUJXPDOD-UHFFFAOYSA-N 0.000 description 1
- JXMLAPZRDDWRRV-UHFFFAOYSA-N ethyl n-(ethoxycarbonylamino)carbamate Chemical compound CCOC(=O)NNC(=O)OCC JXMLAPZRDDWRRV-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000010265 fast atom bombardment Methods 0.000 description 1
- 238000004992 fast atom bombardment mass spectroscopy Methods 0.000 description 1
- 229940012952 fibrinogen Drugs 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000005816 fluoropropyl group Chemical group [H]C([H])(F)C([H])([H])C([H])([H])* 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 125000000267 glycino group Chemical group [H]N([*])C([H])([H])C(=O)O[H] 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 229960000789 guanidine hydrochloride Drugs 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- PJJJBBJSCAKJQF-UHFFFAOYSA-N guanidinium chloride Chemical compound [Cl-].NC(N)=[NH2+] PJJJBBJSCAKJQF-UHFFFAOYSA-N 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 230000009545 invasion Effects 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- YDNLNVZZTACNJX-UHFFFAOYSA-N isocyanatomethylbenzene Chemical compound O=C=NCC1=CC=CC=C1 YDNLNVZZTACNJX-UHFFFAOYSA-N 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000033001 locomotion Effects 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-L malate(2-) Chemical compound [O-]C(=O)C(O)CC([O-])=O BJEPYKJPYRNKOW-UHFFFAOYSA-L 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 229960002523 mercuric chloride Drugs 0.000 description 1
- BQPIGGFYSBELGY-UHFFFAOYSA-N mercury(2+) Chemical compound [Hg+2] BQPIGGFYSBELGY-UHFFFAOYSA-N 0.000 description 1
- 230000001394 metastastic effect Effects 0.000 description 1
- 206010061289 metastatic neoplasm Diseases 0.000 description 1
- FBBDOOHMGLLEGJ-UHFFFAOYSA-N methane;hydrochloride Chemical compound C.Cl FBBDOOHMGLLEGJ-UHFFFAOYSA-N 0.000 description 1
- VWHHEDIHZWZRTF-VIFPVBQESA-N methyl (2s)-2-amino-3-(4-aminophenyl)propanoate Chemical compound COC(=O)[C@@H](N)CC1=CC=C(N)C=C1 VWHHEDIHZWZRTF-VIFPVBQESA-N 0.000 description 1
- XGDZEDRBLVIUMX-UHFFFAOYSA-N methyl 2-(4-hydroxyphenyl)acetate Chemical compound COC(=O)CC1=CC=C(O)C=C1 XGDZEDRBLVIUMX-UHFFFAOYSA-N 0.000 description 1
- VSEYYEKRZNRECT-UHFFFAOYSA-N methyl 2-bromo-5-nitrobenzoate Chemical compound COC(=O)C1=CC([N+]([O-])=O)=CC=C1Br VSEYYEKRZNRECT-UHFFFAOYSA-N 0.000 description 1
- LPEKGGXMPWTOCB-UHFFFAOYSA-N methyl 2-hydroxypropionate Chemical compound COC(=O)C(C)O LPEKGGXMPWTOCB-UHFFFAOYSA-N 0.000 description 1
- FQPUKDJQCHGSAO-UHFFFAOYSA-N methyl 3-(2-chloro-5-nitrophenyl)prop-2-enoate Chemical compound COC(=O)C=CC1=CC([N+]([O-])=O)=CC=C1Cl FQPUKDJQCHGSAO-UHFFFAOYSA-N 0.000 description 1
- YOZSQEKCLUHEFW-UHFFFAOYSA-N methyl 3-[[(cyanoamino)-methylsulfanylmethylidene]amino]benzoate Chemical compound COC(=O)C1=CC=CC(NC(SC)=NC#N)=C1 YOZSQEKCLUHEFW-UHFFFAOYSA-N 0.000 description 1
- PBJXXCDAZXTPAA-UHFFFAOYSA-N methyl 3-[[amino-(cyanoamino)methylidene]amino]benzoate Chemical compound COC(=O)C1=CC=CC(NC(N)=NC#N)=C1 PBJXXCDAZXTPAA-UHFFFAOYSA-N 0.000 description 1
- LOCJPOYKBUUVKU-UHFFFAOYSA-N methyl 3-amino-4-chlorobenzoate Chemical compound COC(=O)C1=CC=C(Cl)C(N)=C1 LOCJPOYKBUUVKU-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000003278 mimic effect Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XBXCNNQPRYLIDE-UHFFFAOYSA-M n-tert-butylcarbamate Chemical compound CC(C)(C)NC([O-])=O XBXCNNQPRYLIDE-UHFFFAOYSA-M 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 230000001599 osteoclastic effect Effects 0.000 description 1
- 150000002917 oxazolidines Chemical class 0.000 description 1
- LVSJDHGRKAEGLX-UHFFFAOYSA-N oxolane;2,2,2-trifluoroacetic acid Chemical compound C1CCOC1.OC(=O)C(F)(F)F LVSJDHGRKAEGLX-UHFFFAOYSA-N 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- VIGODTIMSIHKSD-UHFFFAOYSA-N phenyl 3-phenylpropanoate Chemical compound C=1C=CC=CC=1OC(=O)CCC1=CC=CC=C1 VIGODTIMSIHKSD-UHFFFAOYSA-N 0.000 description 1
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical class O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 description 1
- 150000003007 phosphonic acid derivatives Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 210000002826 placenta Anatomy 0.000 description 1
- 230000010118 platelet activation Effects 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 229940116357 potassium thiocyanate Drugs 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- OVPLZYJGTGDFNB-UHFFFAOYSA-N propan-2-yl carbamate Chemical compound CC(C)OC(N)=O OVPLZYJGTGDFNB-UHFFFAOYSA-N 0.000 description 1
- IVRIRQXJSNCSPQ-UHFFFAOYSA-N propan-2-yl carbonochloridate Chemical compound CC(C)OC(Cl)=O IVRIRQXJSNCSPQ-UHFFFAOYSA-N 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- CEEVRMDYKKNRAW-UHFFFAOYSA-N pyrazine-2-carboximidamide Chemical compound NC(=N)C1=CN=CC=N1 CEEVRMDYKKNRAW-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical class 0.000 description 1
- 150000004728 pyruvic acid derivatives Chemical class 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- UQDJGEHQDNVPGU-UHFFFAOYSA-N serine phosphoethanolamine Chemical compound [NH3+]CCOP([O-])(=O)OCC([NH3+])C([O-])=O UQDJGEHQDNVPGU-UHFFFAOYSA-N 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 210000000329 smooth muscle myocyte Anatomy 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 235000011008 sodium phosphates Nutrition 0.000 description 1
- 230000009295 sperm incapacitation Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000012289 standard assay Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229940086735 succinate Drugs 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 238000007910 systemic administration Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 150000003548 thiazolidines Chemical class 0.000 description 1
- 125000002769 thiazolinyl group Chemical group 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- ZMCBYSBVJIMENC-UHFFFAOYSA-N tricaine Chemical compound CCOC(=O)C1=CC=CC(N)=C1 ZMCBYSBVJIMENC-UHFFFAOYSA-N 0.000 description 1
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 1
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 241000701161 unidentified adenovirus Species 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
- C07D271/07—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/13—Amines
- A61K31/155—Amidines (), e.g. guanidine (H2N—C(=NH)—NH2), isourea (N=C(OH)—NH2), isothiourea (—N=C(SH)—NH2)
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/08—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/08—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease
- A61P19/10—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease for osteoporosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/14—Vasoprotectives; Antihaemorrhoidals; Drugs for varicose therapy; Capillary stabilisers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/42—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/18—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of guanidine groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/20—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylguanidines
- C07C279/22—Y being a hydrogen or a carbon atom, e.g. benzoylguanidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/20—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylguanidines
- C07C279/24—Y being a hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/28—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of guanidine groups bound to cyano groups, e.g. cyanoguanidines, dicyandiamides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/02—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C311/03—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atoms of the sulfonamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C311/06—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atoms of the sulfonamide groups bound to hydrogen atoms or to acyclic carbon atoms to acyclic carbon atoms of hydrocarbon radicals substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/12—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing rings
- C07C311/13—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing rings the carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/16—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom
- C07C311/19—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom to an acyclic carbon atom of a hydrocarbon radical substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/64—X and Y being nitrogen atoms, e.g. N-sulfonylguanidine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/44—Sulfones; Sulfoxides having sulfone or sulfoxide groups and carboxyl groups bound to the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/51—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/52—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/02—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D223/06—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D223/12—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/44—Nitrogen atoms not forming part of a nitro radical
- C07D233/50—Nitrogen atoms not forming part of a nitro radical with carbocyclic radicals directly attached to said nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/88—Nitrogen atoms, e.g. allantoin
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/06—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D239/08—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms directly attached in position 2
- C07D239/12—Nitrogen atoms not forming part of a nitro radical
- C07D239/14—Nitrogen atoms not forming part of a nitro radical with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached to said nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D249/14—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/215—Radicals derived from nitrogen analogues of carbonic acid
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Medicinal Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Physical Education & Sports Medicine (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Rheumatology (AREA)
- Epidemiology (AREA)
- Vascular Medicine (AREA)
- Ophthalmology & Optometry (AREA)
- Cardiology (AREA)
- Heart & Thoracic Surgery (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- Peptides Or Proteins (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US1428896P | 1996-03-29 | 1996-03-29 | |
| US60/014,288 | 1996-03-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2250698A1 true CA2250698A1 (en) | 1997-10-09 |
Family
ID=21764580
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002250698A Abandoned CA2250698A1 (en) | 1996-03-29 | 1997-03-26 | Para-substituted phenylpropanoic acid derivatives as integrin antagonists |
Country Status (12)
| Country | Link |
|---|---|
| US (2) | US5952381A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0891325B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP2000515493A (cg-RX-API-DMAC7.html) |
| AT (1) | ATE212978T1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU2536097A (cg-RX-API-DMAC7.html) |
| CA (1) | CA2250698A1 (cg-RX-API-DMAC7.html) |
| DE (1) | DE69710319T2 (cg-RX-API-DMAC7.html) |
| DK (1) | DK0891325T3 (cg-RX-API-DMAC7.html) |
| ES (1) | ES2172780T3 (cg-RX-API-DMAC7.html) |
| HK (1) | HK1044527A1 (cg-RX-API-DMAC7.html) |
| PT (1) | PT891325E (cg-RX-API-DMAC7.html) |
| WO (1) | WO1997036859A1 (cg-RX-API-DMAC7.html) |
Families Citing this family (81)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE203234T1 (de) * | 1995-08-30 | 2001-08-15 | Searle & Co | Meta-guanidine, harnstoff, thioharnstoff oder azacyklische aminobenzoesäure-derivate als integrin antagonisten |
| AU5596298A (en) * | 1996-12-09 | 1998-07-03 | Cor Therapeutics, Inc. | Integrin antagonists |
| US6245809B1 (en) | 1996-12-09 | 2001-06-12 | Cor Therapeutics Inc. | Integrin antagonists |
| AU8063098A (en) * | 1997-06-10 | 1998-12-30 | Eli Lilly And Company | Combinatorial process for preparing substituted phenylalanine libraries |
| AU739511B2 (en) * | 1997-08-22 | 2001-10-11 | F. Hoffmann-La Roche Ag | N-aroylphenylalanine derivatives |
| US6229011B1 (en) | 1997-08-22 | 2001-05-08 | Hoffman-La Roche Inc. | N-aroylphenylalanine derivative VCAM-1 inhibitors |
| EP1403247A1 (en) * | 1997-08-22 | 2004-03-31 | F.Hoffmann-La Roche Ag | N-Alkanoylphenylalanine derivatives |
| US6455550B1 (en) | 1997-08-22 | 2002-09-24 | Hoffmann-La Roche Inc. | N-alkanoylphenylalanine derivatives |
| US6740682B2 (en) | 1997-08-29 | 2004-05-25 | Tularik Limited | Meta-benzamidine derivatives as serine protease inhibitors |
| DE69830410T2 (de) * | 1997-08-29 | 2006-01-26 | Tularik Ltd. | Meta-benzamidinderivate als serinprotease-inhibitoren |
| DE69835688T2 (de) | 1997-10-31 | 2007-10-04 | Aventis Pharma Ltd., West Malling | Substituierte anilide |
| NZ505363A (en) * | 1997-12-23 | 2005-02-25 | Aventis Pharma Ltd | Compounds containing substituted {2-[3-methoxy-4-(3-o-tolylureido)phenyl]acetylamino}- groups and pharmaceuticals thereof; useful as inhibitors of alpha4beta1 mediated cell division |
| US6329372B1 (en) | 1998-01-27 | 2001-12-11 | Celltech Therapeutics Limited | Phenylalanine derivatives |
| WO1999043642A1 (en) * | 1998-02-26 | 1999-09-02 | Celltech Therapeutics Limited | Phenylalanine derivatives as inhibitors of alpha4 integrins |
| GB9805655D0 (en) | 1998-03-16 | 1998-05-13 | Celltech Therapeutics Ltd | Chemical compounds |
| US6521626B1 (en) | 1998-03-24 | 2003-02-18 | Celltech R&D Limited | Thiocarboxamide derivatives |
| CN1140511C (zh) | 1998-04-09 | 2004-03-03 | 明治制果株式会社 | 作为整合素αvβ3拮抗剂的氨基哌啶衍生物 |
| GB9811159D0 (en) | 1998-05-22 | 1998-07-22 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9811969D0 (en) | 1998-06-03 | 1998-07-29 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9812088D0 (en) | 1998-06-05 | 1998-08-05 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9814414D0 (en) | 1998-07-03 | 1998-09-02 | Celltech Therapeutics Ltd | Chemical compounds |
| US6352977B1 (en) | 1998-07-13 | 2002-03-05 | Aventis Pharma Limited | Substituted β-alanines |
| GB9821061D0 (en) | 1998-09-28 | 1998-11-18 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9821222D0 (en) | 1998-09-30 | 1998-11-25 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9825652D0 (en) | 1998-11-23 | 1999-01-13 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9826174D0 (en) * | 1998-11-30 | 1999-01-20 | Celltech Therapeutics Ltd | Chemical compounds |
| US6677360B2 (en) | 1998-12-16 | 2004-01-13 | Bayer Aktiengesellschaft | Biphenyl and biphenyl-analogous compounds as integrin antagonists |
| CZ20012185A3 (cs) * | 1998-12-16 | 2001-10-17 | Bayer Aktiengesellschaft | Nové bifenylové sloučeniny a sloučeniny analogické bifenylovým sloučeninám, způsob jejich přípravy, farmaceutické prostředky a pouľití těchto sloučenin a prostředků jako antagonistů integrinu |
| IL143870A0 (en) | 1998-12-23 | 2002-04-21 | Searle & Co | Method of using a cyclooxygenase-2 inhibitor and one or more antineoplastic agents as a combination therapy in the treatment of neoplasia |
| US6833373B1 (en) | 1998-12-23 | 2004-12-21 | G.D. Searle & Co. | Method of using an integrin antagonist and one or more antineoplastic agents as a combination therapy in the treatment of neoplasia |
| US6858598B1 (en) | 1998-12-23 | 2005-02-22 | G. D. Searle & Co. | Method of using a matrix metalloproteinase inhibitor and one or more antineoplastic agents as a combination therapy in the treatment of neoplasia |
| US6291503B1 (en) | 1999-01-15 | 2001-09-18 | Bayer Aktiengesellschaft | β-phenylalanine derivatives as integrin antagonists |
| US6344484B1 (en) * | 1999-02-12 | 2002-02-05 | 3-Dimensional Pharmaceuticals, Inc. | Tyrosine alkoxyguanidines as integrin inhibitors |
| IL144636A0 (en) | 1999-02-18 | 2002-05-23 | Hoffmann La Roche | Thioamide derivatives |
| PL349463A1 (en) * | 1999-02-18 | 2002-07-29 | Hoffmann La Roche | Phenylalaninol derivatives |
| FR2792314B1 (fr) * | 1999-04-15 | 2001-06-01 | Adir | Nouveaux composes aminotriazoles, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| US6518283B1 (en) | 1999-05-28 | 2003-02-11 | Celltech R&D Limited | Squaric acid derivatives |
| EP1209152A4 (en) | 1999-08-05 | 2003-03-12 | Meiji Seika Kaisha | OMEGA-AMINO-ALPHA-HYDROXY-CARBONIC ACID DERIVATIVES WITH AN INTEGRIN ALPHA V BETA ANTAGONISM |
| CA2352957A1 (en) | 1999-09-29 | 2001-04-05 | Ortho-Mcneil Pharmaceutical, Inc. | Isonipecotamides for the treatment of integrin-mediated disorders |
| US6534513B1 (en) | 1999-09-29 | 2003-03-18 | Celltech R&D Limited | Phenylalkanoic acid derivatives |
| AU7961200A (en) * | 1999-10-29 | 2001-05-14 | Kaken Pharmaceutical Co., Ltd. | Urea derivative, process for producing the same, and medicine containing the urea derivative |
| WO2001044186A1 (en) * | 1999-12-16 | 2001-06-21 | Sumitomo Pharmaceuticals Company, Limited | Substituted guanidine derivatives |
| US6455539B2 (en) | 1999-12-23 | 2002-09-24 | Celltech R&D Limited | Squaric acid derivates |
| CA2398186A1 (en) * | 2000-01-25 | 2001-08-02 | Mitsuhiro Abe | Therapeutic agent for reperfusion injury comprising integrin .alpha.v.beta.3 antagonists |
| WO2001056607A1 (en) * | 2000-02-03 | 2001-08-09 | Eisai Co., Ltd. | Integrin expression inhibitors |
| ATE375330T1 (de) * | 2000-04-17 | 2007-10-15 | Ucb Pharma Sa | Enamin-derivate als zell-adhäsionsmoleküle |
| GB0011817D0 (en) | 2000-05-16 | 2000-07-05 | Pharmacia & Upjohn Spa | Antagonists of integrin receptors |
| US6545013B2 (en) | 2000-05-30 | 2003-04-08 | Celltech R&D Limited | 2,7-naphthyridine derivatives |
| US6403608B1 (en) | 2000-05-30 | 2002-06-11 | Celltech R&D, Ltd. | 3-Substituted isoquinolin-1-yl derivatives |
| DE10032256C2 (de) * | 2000-07-03 | 2003-06-05 | Infineon Technologies Ag | Chip-ID-Register-Anordnung |
| WO2002004426A1 (en) | 2000-07-07 | 2002-01-17 | Celltech R & D Limited | Squaric acid derivatives containing a bicyclic heteroaromatic ring as integrin antagonists |
| US7015216B2 (en) * | 2000-07-21 | 2006-03-21 | Elan Pharmaceuticals, Inc. | Heteroaryl-β-alanine derivatives as alpha 4 integrin inhibitors |
| EP1318803A1 (en) * | 2000-08-02 | 2003-06-18 | SmithKline Beecham Corporation | Fatty acid synthase inhibitors |
| AU2001275724A1 (en) | 2000-08-02 | 2002-02-13 | Celltech R&D Limited | 3-substituted isoquinolin-1-yl derivatives |
| US7163681B2 (en) | 2000-08-07 | 2007-01-16 | Centocor, Inc. | Anti-integrin antibodies, compositions, methods and uses |
| US7288390B2 (en) | 2000-08-07 | 2007-10-30 | Centocor, Inc. | Anti-dual integrin antibodies, compositions, methods and uses |
| US6486174B2 (en) | 2000-08-07 | 2002-11-26 | 3-Dimensional Pharmaceuticals, Inc. | Tetrahydroisoquinoline-3-carboxylic acid alkoxyguanidines as integrin antagonists |
| WO2002014272A1 (en) * | 2000-08-09 | 2002-02-21 | Kaken Pharmaceutical Co., Ltd. | (thio)urea derivatives, process for their production and medicines containing the derivatives |
| DZ3415A1 (fr) | 2000-08-31 | 2002-03-07 | Chiron Corp | Guanidinobenzamides comme mc4-r agonistes. |
| US6855722B2 (en) * | 2001-01-29 | 2005-02-15 | Dimensional Pharmaceuticals, Inc. | Substituted indoles and their use as integrin antagonists |
| ITTO20010110A1 (it) | 2001-02-08 | 2002-08-08 | Rotta Research Lab | Nuovi derivati benzamidinici dotati di attivita' anti-infiammatoria ed immunosoppressiva. |
| DK1385823T3 (da) | 2001-04-09 | 2007-03-26 | Novartis Vaccines & Diagnostic | Guanidinoforbindelser som melanocortin-4-receptor- (MC4-R) -agonister |
| DE60208186T2 (de) | 2001-04-09 | 2006-08-24 | Ortho-Mcneil Pharmaceutical Research Inc. | Chinazolin- und chinazolinähnliche verbindungen zur behandlung von integrin-vermittelten erkrankungen |
| US6872730B2 (en) | 2001-04-27 | 2005-03-29 | 3-Dimensional Pharmaceuticals, Inc. | Substituted benzofurans and benzothiophenes, methods of making and methods of use as integrin antagonists |
| JP4750360B2 (ja) | 2001-10-22 | 2011-08-17 | ザ スクリプス リサーチ インスティチュート | 抗体ターゲッティング化合物 |
| US20030195187A1 (en) * | 2002-02-04 | 2003-10-16 | Chiron Corporation | Guanidino compounds |
| US20050124652A1 (en) * | 2002-02-04 | 2005-06-09 | Rustum Boyce | Guanidino compounds |
| US20030207814A1 (en) * | 2002-02-04 | 2003-11-06 | Chiron Corporation | Novel guanidinyl derivatives |
| US20030229025A1 (en) * | 2002-02-25 | 2003-12-11 | Chiron Corporation | Intranasal administration of MC4-R agonists |
| AU2003245325A1 (en) * | 2002-05-23 | 2003-12-12 | Chiron Corporation | Substituted quinazolinone compounds |
| CA2523015A1 (en) * | 2003-05-23 | 2004-12-29 | Chiron Corporation | Guanidino-substituted quinazolinone compounds as mc4-r agonists |
| CA2528438A1 (en) * | 2003-06-03 | 2005-01-06 | Novartis Ag | P-38 inhibitors |
| MXPA06005736A (es) * | 2003-11-19 | 2006-12-14 | Chiron Corp | Compuestos de quinazolinona con bioacumulacion reducida. |
| WO2007048127A2 (en) * | 2005-10-20 | 2007-04-26 | The Scripps Research Institute | Fc labeling for immunostaining and immunotargeting |
| WO2007147763A1 (en) | 2006-06-20 | 2007-12-27 | F. Hoffmann-La Roche Ag | Arylsulfonyl naphthalene derivatives and uses thereof |
| JP2012517447A (ja) | 2009-02-10 | 2012-08-02 | ザ スクリプス リサーチ インスティチュート | 化学的にプログラムされたワクチン接種法 |
| US20140010783A1 (en) * | 2012-07-06 | 2014-01-09 | Hoffmann-La Roche Inc. | Antiviral compounds |
| US8716226B2 (en) | 2012-07-18 | 2014-05-06 | Saint Louis University | 3,5 phenyl-substituted beta amino acid derivatives as integrin antagonists |
| JP6215324B2 (ja) | 2012-07-18 | 2017-10-18 | セントルイス ユニバーシティ | インテグリンアンタゴニストとしてのβアミノ酸誘導体 |
| JP2019500355A (ja) | 2015-12-30 | 2019-01-10 | セントルイス ユニバーシティ | 汎インテグリンアンタゴニストとしてのメタ−アザ環式アミノ安息香酸誘導体 |
| CN107652210B (zh) * | 2017-09-30 | 2021-01-01 | 瑞阳(上海)新药研发有限公司 | 一种胍类化合物或其药学上可接受的盐、其制备方法和应用 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI890918A7 (fi) * | 1988-03-11 | 1989-09-12 | Eisai Co Ltd | Polypeptider. |
| US5039805A (en) * | 1988-12-08 | 1991-08-13 | Hoffmann-La Roche Inc. | Novel benzoic and phenylacetic acid derivatives |
| NZ239846A (en) * | 1990-09-27 | 1994-11-25 | Merck & Co Inc | Sulphonamide derivatives and pharmaceutical compositions thereof |
| IL99537A (en) * | 1990-09-27 | 1995-11-27 | Merck & Co Inc | Fibrinogen receptor antagonists and pharmaceutical compositions containing them |
| WO1992008464A1 (en) * | 1990-11-15 | 1992-05-29 | Tanabe Seiyaku Co. Ltd. | Substituted urea and related cell adhesion modulation compounds |
| WO1993008823A1 (en) * | 1991-11-06 | 1993-05-13 | Tanabe Seiyaku Co., Ltd. | Guanidinyl and related cell adhesion modulation compounds |
| JPH07503944A (ja) * | 1991-11-22 | 1995-04-27 | イエダ リサーチ アンド デベロツプメント カンパニー リミテツド | Arg−gly−asp配列の非ペプチド代替物およびそれらからなる医薬組成物 |
| ES2186720T3 (es) * | 1994-05-27 | 2003-05-16 | Merck & Co Inc | Composiciones para inhibir la reabsorcion osea mediada por osteoclastos. |
-
1997
- 1997-03-26 DK DK97916852T patent/DK0891325T3/da active
- 1997-03-26 CA CA002250698A patent/CA2250698A1/en not_active Abandoned
- 1997-03-26 EP EP97916852A patent/EP0891325B1/en not_active Expired - Lifetime
- 1997-03-26 AT AT97916852T patent/ATE212978T1/de not_active IP Right Cessation
- 1997-03-26 AU AU25360/97A patent/AU2536097A/en not_active Abandoned
- 1997-03-26 PT PT97916852T patent/PT891325E/pt unknown
- 1997-03-26 ES ES97916852T patent/ES2172780T3/es not_active Expired - Lifetime
- 1997-03-26 WO PCT/US1997/004460 patent/WO1997036859A1/en not_active Ceased
- 1997-03-26 DE DE69710319T patent/DE69710319T2/de not_active Expired - Fee Related
- 1997-03-26 JP JP09535308A patent/JP2000515493A/ja not_active Ceased
- 1997-03-27 US US08/826,244 patent/US5952381A/en not_active Expired - Fee Related
-
1999
- 1999-04-08 US US09/288,742 patent/US6251944B1/en not_active Expired - Fee Related
-
2002
- 2002-05-28 HK HK02103989.5A patent/HK1044527A1/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PT891325E (pt) | 2002-07-31 |
| US6251944B1 (en) | 2001-06-26 |
| ES2172780T3 (es) | 2002-10-01 |
| DK0891325T3 (da) | 2002-05-21 |
| DE69710319T2 (de) | 2002-08-14 |
| HK1044527A1 (en) | 2002-10-25 |
| JP2000515493A (ja) | 2000-11-21 |
| US5952381A (en) | 1999-09-14 |
| EP0891325B1 (en) | 2002-02-06 |
| DE69710319D1 (de) | 2002-03-21 |
| WO1997036859A1 (en) | 1997-10-09 |
| AU2536097A (en) | 1997-10-22 |
| EP0891325A1 (en) | 1999-01-20 |
| ATE212978T1 (de) | 2002-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US6251944B1 (en) | Para-substituted phenylene derivatives | |
| US6677308B1 (en) | Meta-substituted phenylene sulphonamide derivatives | |
| EP0889877B1 (en) | META-SUBSTITUTED PHENYLENE DERIVATIVES AND THEIR USE AS ALPHAvBETA3 INTEGRIN ANTAGONISTS OR INHIBITORS | |
| EP0894084B1 (en) | Cinnamic acid derivatives and their use as integrin antagonists | |
| EP0889875B1 (en) | Cyclopropyl alkanoic acid derivatives | |
| US6831199B1 (en) | Pyrimidine compounds and derivatives thereof | |
| IE64407B1 (en) | Novel benzoic acid and phenylacetic acid derivatives a process for their manufacture and use as medicaments | |
| AU3294799A (en) | Meta-azacyclic amino benzoic acid compounds and derivatives thereof being integrin antagonists | |
| US6013651A (en) | Meta-azacyclic amino benzoic acid compounds and derivatives thereof | |
| EP1157985A1 (en) | Para- substituted phenylene derivatives and their use as integrin antagonists |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Discontinued | ||
| FZDE | Discontinued |
Effective date: 20080731 |