CA2142077A1 - Stabilized modifier and impact modified thermoplastics - Google Patents
Stabilized modifier and impact modified thermoplasticsInfo
- Publication number
- CA2142077A1 CA2142077A1 CA002142077A CA2142077A CA2142077A1 CA 2142077 A1 CA2142077 A1 CA 2142077A1 CA 002142077 A CA002142077 A CA 002142077A CA 2142077 A CA2142077 A CA 2142077A CA 2142077 A1 CA2142077 A1 CA 2142077A1
- Authority
- CA
- Canada
- Prior art keywords
- poly
- component
- graft copolymer
- styrene
- core shell
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 229920001169 thermoplastic Polymers 0.000 title claims abstract description 87
- 239000004416 thermosoftening plastic Substances 0.000 title claims abstract description 86
- 239000003607 modifier Substances 0.000 title description 16
- 239000000203 mixture Substances 0.000 claims abstract description 116
- 239000011258 core-shell material Substances 0.000 claims abstract description 57
- 229920000578 graft copolymer Polymers 0.000 claims abstract description 54
- 239000006174 pH buffer Substances 0.000 claims abstract description 35
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 claims abstract description 32
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims abstract description 30
- 238000009472 formulation Methods 0.000 claims abstract description 23
- 239000005062 Polybutadiene Substances 0.000 claims abstract description 20
- 229920002857 polybutadiene Polymers 0.000 claims abstract description 20
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims abstract description 17
- 229920009204 Methacrylate-butadiene-styrene Polymers 0.000 claims description 127
- -1 poly(alkylene terephthalates Chemical class 0.000 claims description 72
- 239000003381 stabilizer Substances 0.000 claims description 51
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 48
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 30
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 30
- 229920001577 copolymer Chemical class 0.000 claims description 23
- 229920000642 polymer Polymers 0.000 claims description 23
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 claims description 22
- 239000001488 sodium phosphate Substances 0.000 claims description 21
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 claims description 21
- 229910000406 trisodium phosphate Inorganic materials 0.000 claims description 21
- 235000019801 trisodium phosphate Nutrition 0.000 claims description 21
- 239000011347 resin Substances 0.000 claims description 17
- 229920005989 resin Polymers 0.000 claims description 17
- 239000000654 additive Substances 0.000 claims description 15
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 15
- 150000002989 phenols Chemical class 0.000 claims description 13
- 239000003795 chemical substances by application Substances 0.000 claims description 11
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 10
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 claims description 9
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 claims description 9
- 229920000728 polyester Polymers 0.000 claims description 8
- 229920002223 polystyrene Polymers 0.000 claims description 8
- 239000000314 lubricant Substances 0.000 claims description 7
- 239000004417 polycarbonate Substances 0.000 claims description 7
- 229920000515 polycarbonate Polymers 0.000 claims description 7
- UYQYTUYNNYZATF-UHFFFAOYSA-N 6-methyl-4,6-bis(octylsulfanylmethyl)cyclohexa-1,3-dien-1-ol Chemical group CCCCCCCCSCC1=CC=C(O)C(C)(CSCCCCCCCC)C1 UYQYTUYNNYZATF-UHFFFAOYSA-N 0.000 claims description 5
- 239000004952 Polyamide Substances 0.000 claims description 5
- 239000004611 light stabiliser Substances 0.000 claims description 5
- 229920002647 polyamide Polymers 0.000 claims description 5
- 239000004642 Polyimide Substances 0.000 claims description 4
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 4
- 239000002667 nucleating agent Substances 0.000 claims description 4
- 229920002492 poly(sulfone) Polymers 0.000 claims description 4
- 229920001721 polyimide Polymers 0.000 claims description 4
- 229920002635 polyurethane Polymers 0.000 claims description 4
- 239000004814 polyurethane Substances 0.000 claims description 4
- DTCREUSDXLDLRK-UHFFFAOYSA-N C(CCCCCCC)C(C(=S)O)C.C(CCCCCCC)C(C(=S)O)C.C(CCCCCCC)C(C(=S)O)C.C(O)C(CC)(CO)CO Chemical compound C(CCCCCCC)C(C(=S)O)C.C(CCCCCCC)C(C(=S)O)C.C(CCCCCCC)C(C(=S)O)C.C(O)C(CC)(CO)CO DTCREUSDXLDLRK-UHFFFAOYSA-N 0.000 claims description 3
- 239000006057 Non-nutritive feed additive Substances 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 239000002216 antistatic agent Substances 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 230000003287 optical effect Effects 0.000 claims description 3
- 239000000049 pigment Substances 0.000 claims description 3
- 239000004014 plasticizer Substances 0.000 claims description 3
- 229920001748 polybutylene Polymers 0.000 claims description 3
- 239000003340 retarding agent Substances 0.000 claims description 3
- 125000000101 thioether group Chemical group 0.000 claims description 3
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 claims description 2
- ACYXOHNDKRVKLH-UHFFFAOYSA-N 5-phenylpenta-2,4-dienenitrile prop-2-enoic acid Chemical compound OC(=O)C=C.N#CC=CC=CC1=CC=CC=C1 ACYXOHNDKRVKLH-UHFFFAOYSA-N 0.000 claims description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 2
- 239000004696 Poly ether ether ketone Substances 0.000 claims description 2
- 239000004698 Polyethylene Substances 0.000 claims description 2
- 239000002174 Styrene-butadiene Substances 0.000 claims description 2
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 claims description 2
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 claims description 2
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 claims description 2
- 229920006020 amorphous polyamide Polymers 0.000 claims description 2
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 claims description 2
- 239000013078 crystal Substances 0.000 claims description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 claims description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims description 2
- ZUAIFACQGGPSKV-UHFFFAOYSA-N o-[3-(2-methyldecanethioyloxy)-2,2-bis(2-methyldecanethioyloxymethyl)propyl] 2-methyldecanethioate Chemical compound CCCCCCCCC(C)C(=S)OCC(COC(=S)C(C)CCCCCCCC)(COC(=S)C(C)CCCCCCCC)COC(=S)C(C)CCCCCCCC ZUAIFACQGGPSKV-UHFFFAOYSA-N 0.000 claims description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 2
- 229920006287 phenoxy resin Polymers 0.000 claims description 2
- 239000013034 phenoxy resin Substances 0.000 claims description 2
- 229920001643 poly(ether ketone) Polymers 0.000 claims description 2
- 229920001652 poly(etherketoneketone) Polymers 0.000 claims description 2
- 229920001230 polyarylate Polymers 0.000 claims description 2
- 229920001707 polybutylene terephthalate Polymers 0.000 claims description 2
- 229920006393 polyether sulfone Polymers 0.000 claims description 2
- 229920002530 polyetherether ketone Polymers 0.000 claims description 2
- 229920000573 polyethylene Polymers 0.000 claims description 2
- 229920001470 polyketone Polymers 0.000 claims description 2
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 claims description 2
- 239000011145 styrene acrylonitrile resin Substances 0.000 claims description 2
- 239000011115 styrene butadiene Substances 0.000 claims description 2
- 229920003048 styrene butadiene rubber Polymers 0.000 claims description 2
- 150000003440 styrenes Chemical class 0.000 claims description 2
- 229920000193 polymethacrylate Polymers 0.000 claims 4
- 239000004793 Polystyrene Substances 0.000 claims 2
- 239000000975 dye Substances 0.000 claims 1
- RIQKBVXSTHYTNU-UHFFFAOYSA-N o-octyl propanethioate Chemical compound CCCCCCCCOC(=S)CC RIQKBVXSTHYTNU-UHFFFAOYSA-N 0.000 claims 1
- 229920000139 polyethylene terephthalate Polymers 0.000 claims 1
- 239000005020 polyethylene terephthalate Substances 0.000 claims 1
- 229920002725 thermoplastic elastomer Polymers 0.000 claims 1
- 229920006324 polyoxymethylene Polymers 0.000 abstract description 46
- 230000032683 aging Effects 0.000 abstract description 22
- 230000006641 stabilisation Effects 0.000 abstract description 10
- 238000011105 stabilization Methods 0.000 abstract description 10
- 229930182556 Polyacetal Natural products 0.000 abstract description 8
- 230000003679 aging effect Effects 0.000 abstract description 7
- 229930040373 Paraformaldehyde Natural products 0.000 description 29
- 230000000052 comparative effect Effects 0.000 description 27
- 229920005213 HOSTAFORM® C 9021 Polymers 0.000 description 22
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 15
- 239000000839 emulsion Substances 0.000 description 15
- 239000000155 melt Substances 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 12
- 229920001971 elastomer Polymers 0.000 description 11
- 238000000034 method Methods 0.000 description 11
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 229920000126 latex Polymers 0.000 description 8
- 238000002156 mixing Methods 0.000 description 8
- 239000001993 wax Substances 0.000 description 8
- BGYHLZZASRKEJE-UHFFFAOYSA-N [3-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]-2,2-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxymethyl]propyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)OCC(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 BGYHLZZASRKEJE-UHFFFAOYSA-N 0.000 description 7
- 239000004816 latex Substances 0.000 description 7
- 239000008188 pellet Substances 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 239000005060 rubber Substances 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- GHKOFFNLGXMVNJ-UHFFFAOYSA-N Didodecyl thiobispropanoate Chemical compound CCCCCCCCCCCCOC(=O)CCSCCC(=O)OCCCCCCCCCCCC GHKOFFNLGXMVNJ-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- 229920005027 Ultraform® Polymers 0.000 description 6
- 239000000470 constituent Substances 0.000 description 6
- 239000000945 filler Substances 0.000 description 6
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 6
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 6
- 150000003568 thioethers Chemical class 0.000 description 6
- 230000004580 weight loss Effects 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 5
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 5
- 239000007983 Tris buffer Substances 0.000 description 5
- 230000008859 change Effects 0.000 description 5
- 238000000113 differential scanning calorimetry Methods 0.000 description 5
- 229940117927 ethylene oxide Drugs 0.000 description 5
- 229920001519 homopolymer Polymers 0.000 description 5
- SSDSCDGVMJFTEQ-UHFFFAOYSA-N octadecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 SSDSCDGVMJFTEQ-UHFFFAOYSA-N 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- MGTZNGICWXYDPR-ZJWHSJSFSA-N 3-[[(2r)-2-[[(2s)-2-(azepane-1-carbonylamino)-4-methylpentanoyl]amino]-3-(1h-indol-3-yl)propanoyl]amino]butanoic acid Chemical compound N([C@@H](CC(C)C)C(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C(=O)NC(C)CC(O)=O)C(=O)N1CCCCCC1 MGTZNGICWXYDPR-ZJWHSJSFSA-N 0.000 description 4
- PRWJPWSKLXYEPD-UHFFFAOYSA-N 4-[4,4-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butan-2-yl]-2-tert-butyl-5-methylphenol Chemical compound C=1C(C(C)(C)C)=C(O)C=C(C)C=1C(C)CC(C=1C(=CC(O)=C(C=1)C(C)(C)C)C)C1=CC(C(C)(C)C)=C(O)C=C1C PRWJPWSKLXYEPD-UHFFFAOYSA-N 0.000 description 4
- JKIJEFPNVSHHEI-UHFFFAOYSA-N Phenol, 2,4-bis(1,1-dimethylethyl)-, phosphite (3:1) Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC=C1OP(OC=1C(=CC(=CC=1)C(C)(C)C)C(C)(C)C)OC1=CC=C(C(C)(C)C)C=C1C(C)(C)C JKIJEFPNVSHHEI-UHFFFAOYSA-N 0.000 description 4
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 4
- 150000004292 cyclic ethers Chemical class 0.000 description 4
- 239000000806 elastomer Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000011159 matrix material Substances 0.000 description 4
- 125000005704 oxymethylene group Chemical group [H]C([H])([*:2])O[*:1] 0.000 description 4
- 238000001694 spray drying Methods 0.000 description 4
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 3
- HHMAHORWXWSISL-UHFFFAOYSA-N 1,2-bis(ethenoxy)ethane;3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoic acid Chemical compound C=COCCOC=C.CC1=CC(CCC(O)=O)=CC(C(C)(C)C)=C1O.CC1=CC(CCC(O)=O)=CC(C(C)(C)C)=C1O HHMAHORWXWSISL-UHFFFAOYSA-N 0.000 description 3
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 3
- ZVVFVKJZNVSANF-UHFFFAOYSA-N 6-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]hexyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)OCCCCCCOC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 ZVVFVKJZNVSANF-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 3
- 239000003508 Dilauryl thiodipropionate Substances 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 239000003963 antioxidant agent Substances 0.000 description 3
- 239000007853 buffer solution Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000005345 coagulation Methods 0.000 description 3
- 230000015271 coagulation Effects 0.000 description 3
- 238000010276 construction Methods 0.000 description 3
- 239000008367 deionised water Substances 0.000 description 3
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical class NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 3
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 3
- 235000019304 dilauryl thiodipropionate Nutrition 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 3
- 239000004926 polymethyl methacrylate Substances 0.000 description 3
- XWGJFPHUCFXLBL-UHFFFAOYSA-M rongalite Chemical compound [Na+].OCS([O-])=O XWGJFPHUCFXLBL-UHFFFAOYSA-M 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- 229920001897 terpolymer Polymers 0.000 description 3
- WGKLOLBTFWFKOD-UHFFFAOYSA-N tris(2-nonylphenyl) phosphite Chemical compound CCCCCCCCCC1=CC=CC=C1OP(OC=1C(=CC=CC=1)CCCCCCCCC)OC1=CC=CC=C1CCCCCCCCC WGKLOLBTFWFKOD-UHFFFAOYSA-N 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- HPILSDOMLLYBQF-UHFFFAOYSA-N 2-[1-(oxiran-2-ylmethoxy)butoxymethyl]oxirane Chemical class C1OC1COC(CCC)OCC1CO1 HPILSDOMLLYBQF-UHFFFAOYSA-N 0.000 description 2
- QSRJVOOOWGXUDY-UHFFFAOYSA-N 2-[2-[2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]ethoxy]ethoxy]ethyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate Chemical compound CC(C)(C)C1=C(O)C(C)=CC(CCC(=O)OCCOCCOCCOC(=O)CCC=2C=C(C(O)=C(C)C=2)C(C)(C)C)=C1 QSRJVOOOWGXUDY-UHFFFAOYSA-N 0.000 description 2
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 2
- 229920004943 Delrin® Polymers 0.000 description 2
- OKOBUGCCXMIKDM-UHFFFAOYSA-N Irganox 1098 Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)NCCCCCCNC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 OKOBUGCCXMIKDM-UHFFFAOYSA-N 0.000 description 2
- 229920000877 Melamine resin Polymers 0.000 description 2
- 239000004721 Polyphenylene oxide Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000002318 adhesion promoter Substances 0.000 description 2
- 125000001931 aliphatic group Chemical class 0.000 description 2
- 150000001412 amines Chemical group 0.000 description 2
- 150000001565 benzotriazoles Chemical class 0.000 description 2
- 230000001588 bifunctional effect Effects 0.000 description 2
- LKAVYBZHOYOUSX-UHFFFAOYSA-N buta-1,3-diene;2-methylprop-2-enoic acid;styrene Chemical compound C=CC=C.CC(=C)C(O)=O.C=CC1=CC=CC=C1 LKAVYBZHOYOUSX-UHFFFAOYSA-N 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 230000001112 coagulating effect Effects 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 238000006266 etherification reaction Methods 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000007974 melamines Chemical class 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920000570 polyether Polymers 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 2
- 150000003918 triazines Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- ZXHDVRATSGZISC-UHFFFAOYSA-N 1,2-bis(ethenoxy)ethane Chemical compound C=COCCOC=C ZXHDVRATSGZISC-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- 229940035437 1,3-propanediol Drugs 0.000 description 1
- GXURZKWLMYOCDX-UHFFFAOYSA-N 2,2-bis(hydroxymethyl)propane-1,3-diol;dihydroxyphosphanyl dihydrogen phosphite Chemical compound OP(O)OP(O)O.OCC(CO)(CO)CO GXURZKWLMYOCDX-UHFFFAOYSA-N 0.000 description 1
- DXEHRPYIAJFYJW-UHFFFAOYSA-N 2,4-dimethylcyclobutane-1,3-diol Chemical compound CC1C(O)C(C)C1O DXEHRPYIAJFYJW-UHFFFAOYSA-N 0.000 description 1
- WIYLFSVLMOHTCU-UHFFFAOYSA-N 2-methyl-3,4-bis(octylsulfanylmethyl)phenol Chemical compound CCCCCCCCSCC1=CC=C(O)C(C)=C1CSCCCCCCCC WIYLFSVLMOHTCU-UHFFFAOYSA-N 0.000 description 1
- AIBRSVLEQRWAEG-UHFFFAOYSA-N 3,9-bis(2,4-ditert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC=C1OP1OCC2(COP(OC=3C(=CC(=CC=3)C(C)(C)C)C(C)(C)C)OC2)CO1 AIBRSVLEQRWAEG-UHFFFAOYSA-N 0.000 description 1
- XOJWAAUYNWGQAU-UHFFFAOYSA-N 4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCCOC(=O)C(C)=C XOJWAAUYNWGQAU-UHFFFAOYSA-N 0.000 description 1
- UFFRSDWQMJYQNE-UHFFFAOYSA-N 6-azaniumylhexylazanium;hexanedioate Chemical compound [NH3+]CCCCCC[NH3+].[O-]C(=O)CCCCC([O-])=O UFFRSDWQMJYQNE-UHFFFAOYSA-N 0.000 description 1
- 239000004135 Bone phosphate Substances 0.000 description 1
- BCZXFFBUYPCTSJ-UHFFFAOYSA-L Calcium propionate Chemical compound [Ca+2].CCC([O-])=O.CCC([O-])=O BCZXFFBUYPCTSJ-UHFFFAOYSA-L 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920000049 Carbon (fiber) Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- ZRALSGWEFCBTJO-UHFFFAOYSA-N anhydrous guanidine Natural products NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 230000000386 athletic effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- 229930188620 butyrolactone Natural products 0.000 description 1
- FNAQSUUGMSOBHW-UHFFFAOYSA-H calcium citrate Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O.[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O FNAQSUUGMSOBHW-UHFFFAOYSA-H 0.000 description 1
- 239000001354 calcium citrate Substances 0.000 description 1
- MKJXYGKVIBWPFZ-UHFFFAOYSA-L calcium lactate Chemical compound [Ca+2].CC(O)C([O-])=O.CC(O)C([O-])=O MKJXYGKVIBWPFZ-UHFFFAOYSA-L 0.000 description 1
- 239000001527 calcium lactate Substances 0.000 description 1
- 229960002401 calcium lactate Drugs 0.000 description 1
- 235000011086 calcium lactate Nutrition 0.000 description 1
- 239000004330 calcium propionate Substances 0.000 description 1
- 235000010331 calcium propionate Nutrition 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000004917 carbon fiber Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229920006039 crystalline polyamide Polymers 0.000 description 1
- STENYDAIMALDKF-UHFFFAOYSA-N cyclobutane-1,3-diol Chemical compound OC1CC(O)C1 STENYDAIMALDKF-UHFFFAOYSA-N 0.000 description 1
- YWJUZWOHLHBWQY-UHFFFAOYSA-N decanedioic acid;hexane-1,6-diamine Chemical compound NCCCCCCN.OC(=O)CCCCCCCCC(O)=O YWJUZWOHLHBWQY-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000012765 fibrous filler Substances 0.000 description 1
- 229920002313 fluoropolymer Polymers 0.000 description 1
- 239000004811 fluoropolymer Substances 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012770 industrial material Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 238000002074 melt spinning Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- CWQXQMHSOZUFJS-UHFFFAOYSA-N molybdenum disulfide Chemical compound S=[Mo]=S CWQXQMHSOZUFJS-UHFFFAOYSA-N 0.000 description 1
- TXSUIVPRHHQNTM-UHFFFAOYSA-N n'-(3-methylanilino)-n-phenyliminobenzenecarboximidamide Chemical compound CC1=CC=CC(NN=C(N=NC=2C=CC=CC=2)C=2C=CC=CC=2)=C1 TXSUIVPRHHQNTM-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- 150000002830 nitrogen compounds Chemical class 0.000 description 1
- 125000006353 oxyethylene group Chemical group 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 229920002587 poly(1,3-butadiene) polymer Polymers 0.000 description 1
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 229940096992 potassium oleate Drugs 0.000 description 1
- MLICVSDCCDDWMD-KVVVOXFISA-M potassium;(z)-octadec-9-enoate Chemical compound [K+].CCCCCCCC\C=C/CCCCCCCC([O-])=O MLICVSDCCDDWMD-KVVVOXFISA-M 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000012779 reinforcing material Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- LVEOKSIILWWVEO-UHFFFAOYSA-N tetradecyl 3-(3-oxo-3-tetradecoxypropyl)sulfanylpropanoate Chemical compound CCCCCCCCCCCCCCOC(=O)CCSCCC(=O)OCCCCCCCCCCCCCC LVEOKSIILWWVEO-UHFFFAOYSA-N 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 238000009757 thermoplastic moulding Methods 0.000 description 1
- 235000013337 tricalcium citrate Nutrition 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L51/00—Compositions of graft polymers in which the grafted component is obtained by reactions only involving carbon-to-carbon unsaturated bonds; Compositions of derivatives of such polymers
- C08L51/04—Compositions of graft polymers in which the grafted component is obtained by reactions only involving carbon-to-carbon unsaturated bonds; Compositions of derivatives of such polymers grafted on to rubbers
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L101/00—Compositions of unspecified macromolecular compounds
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S525/00—Synthetic resins or natural rubbers -- part of the class 520 series
- Y10S525/902—Core-shell
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/196742 | 1994-02-15 | ||
| US08/196,742 US5451624A (en) | 1994-02-15 | 1994-02-15 | Stabilized modifier and impact modified thermoplastics |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2142077A1 true CA2142077A1 (en) | 1995-08-16 |
Family
ID=22726658
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002142077A Abandoned CA2142077A1 (en) | 1994-02-15 | 1995-02-08 | Stabilized modifier and impact modified thermoplastics |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US5451624A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0668318A1 (cg-RX-API-DMAC10.html) |
| JP (1) | JPH07286087A (cg-RX-API-DMAC10.html) |
| KR (1) | KR950032470A (cg-RX-API-DMAC10.html) |
| BR (1) | BR9500637A (cg-RX-API-DMAC10.html) |
| CA (1) | CA2142077A1 (cg-RX-API-DMAC10.html) |
| TW (1) | TW302385B (cg-RX-API-DMAC10.html) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5869154A (en) * | 1996-03-21 | 1999-02-09 | Fort James Corporation | Resin composition having special colors and decoration added thereto |
| JPH09282950A (ja) * | 1996-04-12 | 1997-10-31 | Polyplastics Co | 防蟻ケーブル |
| JP3505037B2 (ja) * | 1996-05-23 | 2004-03-08 | パイオニア株式会社 | スピーカ |
| DE19630118A1 (de) * | 1996-07-25 | 1998-01-29 | Basf Ag | Flächige Wandelemente |
| EP0924259B1 (en) * | 1996-09-19 | 2005-11-16 | Asahi Kasei Chemicals Corporation | Polycarbonate resin compositions |
| BR9713804A (pt) * | 1996-12-31 | 2000-01-25 | Dow Chemical Co | Estruturas laminadas para recipientes de combustìvel, métodos para produzì-los e recipiente produzido |
| DE19713895A1 (de) * | 1997-04-03 | 1998-10-08 | Basf Ag | Transparente, schlagzähmodifizierte thermoplastische Formmassen |
| US6545089B1 (en) * | 1997-09-04 | 2003-04-08 | General Electric Company | Impact modified carbonnate polymer composition having improved resistance to degradation and improved thermal stability |
| DE69943227D1 (de) | 1998-09-09 | 2011-04-07 | Rohm & Haas | Ein Verfahren zur Herstellung einer Kernschalen-schlagmodifizierten Emulsion |
| US6524673B1 (en) * | 1999-05-13 | 2003-02-25 | Jpmorgan Chase Bank | High performance thermoplastic hose and method for manufacturing such hose from a thermoplastic vulcanizate |
| WO2002062890A1 (en) * | 2001-02-06 | 2002-08-15 | Cyro Industries | Polymethylmethacrylate compositions of enhanced optics and low temperature impact strength |
| US7008700B1 (en) | 2001-03-05 | 2006-03-07 | 3-Form | Architectural laminate panel with embedded compressible objects and methods for making the same |
| US7691470B2 (en) | 2001-03-05 | 2010-04-06 | 3Form | Laminate structure with polycarbonate sheets |
| US7303810B2 (en) | 2001-03-05 | 2007-12-04 | 3Form, Inc. | Fire-resistant architectural resin materials |
| JP4879407B2 (ja) * | 2001-06-11 | 2012-02-22 | 株式会社カネカ | 押出成形用樹脂組成物 |
| KR20030000778A (ko) * | 2001-06-27 | 2003-01-06 | 주식회사 삼양사 | 고충격 열가소성 수지 조성물 |
| US7799855B2 (en) * | 2001-11-12 | 2010-09-21 | Sabic Innovative Plastics Ip B.V. | Flame retardant thermoplastic polycarbonate compositions, use and method thereof |
| JP2004176906A (ja) * | 2002-09-30 | 2004-06-24 | Tokai Rubber Ind Ltd | 燃料系ホース |
| US20100036016A1 (en) * | 2003-09-10 | 2010-02-11 | Alex Wegmann | Stabilization of methylmethacrylate-butadiene-styrene graft copolymers against thermal oxidation |
| WO2005023886A1 (en) * | 2003-09-10 | 2005-03-17 | Ciba Specialty Chemicals Holding Inc. | Stabilization of methylmethacrylate-butadiene-styrene graft copolymers against thermal oxidation |
| DE10361190A1 (de) * | 2003-12-24 | 2005-07-28 | Ticona Gmbh | Verbundkörper, Verfahren zu dessen Herstellung und dessen Verwendung |
| US7223804B2 (en) * | 2003-12-30 | 2007-05-29 | General Electric Company | Polycarbonate composition |
| US7199171B2 (en) * | 2004-01-05 | 2007-04-03 | Kaneka Corporation | (Meth)acrylic resin composition |
| US20060030647A1 (en) * | 2004-08-05 | 2006-02-09 | Thomas Ebeling | Flame retardant thermoplastic polycarbonate compositions, use, and method of manufacture thereof |
| US20060046017A1 (en) | 2004-09-01 | 2006-03-02 | 3Form | Architectural glass panels with embedded objects and methods for making the same |
| JP5275341B2 (ja) | 2007-05-08 | 2013-08-28 | ハンター・ダグラス・インダストリーズ・スウィツァーランド・ゲーエムベーハー | テクスチャーを適用した多変量着色システム |
| KR101304168B1 (ko) * | 2010-11-08 | 2013-09-04 | (주)엘지하우시스 | 열성형 시에 고광택을 유지할 수 있는 abs 수지 조성물 및 이를 이용한 abs 시트 |
| FR2969159B1 (fr) | 2010-12-15 | 2013-01-11 | Arkema France | Composition thermoplastique modifiee choc ayant une sensibilite hydrolytique pour obtenir une fluidite elevee tout en maintenant une resistance aux chocs elevee |
| US8669314B2 (en) | 2012-02-03 | 2014-03-11 | Sabic Innovative Plastics Ip B.V. | Hydrolytic stability in polycarbonate compositions |
| USD691289S1 (en) | 2012-09-05 | 2013-10-08 | 3Form, Inc. | Panel with cut and aligned thatch interlayer |
| US9260603B2 (en) | 2013-03-15 | 2016-02-16 | Sabic Global Technologies B.V. | Polymer compositions, method of manufacture, and articles formed therefrom |
| US9260604B2 (en) * | 2013-03-15 | 2016-02-16 | Sabic Global Technologies B.V. | Polycarbonate compositions comprising elastomer-modified graft copolymer prepared by emulsion polymerization |
| GB2562466B (en) * | 2017-05-04 | 2022-01-05 | Si Group Switzerland Chaa Gmbh | Composition |
| EP3810678A1 (en) * | 2018-06-21 | 2021-04-28 | Solvay Specialty Polymers USA, LLC. | Poly(ether ketone ketone) (pekk) polymer and composites |
| KR102279651B1 (ko) * | 2018-11-15 | 2021-07-19 | 주식회사 엘지화학 | 코어-쉘 공중합체, 이의 제조방법 및 이를 포함하는 열가소성 수지 조성물 |
| GB201907363D0 (en) * | 2019-05-24 | 2019-07-10 | Si Group Switzerland Chaa Gmbh | Stabilising composition |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3027352A (en) * | 1958-02-28 | 1962-03-27 | Celanese Corp | Copolymers |
| BE586592A (cg-RX-API-DMAC10.html) * | 1959-01-16 | |||
| GB1145279A (en) * | 1965-12-30 | 1969-03-12 | Geigy Uk Ltd | Treatment processes |
| US3479319A (en) * | 1967-09-19 | 1969-11-18 | Firestone Tire & Rubber Co | Polyethylene terephthalate stabilized with sodium pyrophosphate |
| DE2408487A1 (de) * | 1974-02-22 | 1975-09-18 | Basf Ag | Thermoplastische formmassen hoher schlagfestigkeit |
| DE2951045C2 (de) * | 1979-12-19 | 1983-12-22 | Röhm GmbH, 6100 Darmstadt | Herstellung von schlagzähen Harzen |
| US4419471A (en) * | 1981-09-04 | 1983-12-06 | Gaf Corporation | Core-shell polymers |
| US4424307A (en) * | 1982-03-26 | 1984-01-03 | Celanese Corporation | Oxymethylene polymer modified with 1,2-polybutadiene exhibiting enhanced tensile impact properties |
| US5047471A (en) * | 1984-03-28 | 1991-09-10 | Hoechst Aktiengesellschaft | Toughened polyoxymethylene and shaped articles produced therefrom |
| DE3441547A1 (de) * | 1984-11-14 | 1986-05-15 | Basf Ag, 6700 Ludwigshafen | Schlagzaehe polyoxymethylenformmassen sowie ein verfahren zu deren herstellung |
| US4965301A (en) * | 1984-12-03 | 1990-10-23 | Phillips Petroleum Company | Stabilization of polyolefins |
| EP0224442B1 (de) * | 1985-11-13 | 1990-05-16 | Ciba-Geigy Ag | Substituierte Phenole als Stabilisatoren |
| US4801646A (en) * | 1987-01-16 | 1989-01-31 | The Dow Chemical Company | Low gloss weather and impact resistant resins |
| US4877821A (en) * | 1987-02-26 | 1989-10-31 | The Dow Chemical Company | Stabilizer concentrate |
| JPH01245044A (ja) * | 1988-03-28 | 1989-09-29 | Mitsubishi Rayon Co Ltd | 耐熱着色性、耐熱劣化性に優れた熱可塑性樹脂用衝撃改質剤及びそれを用いた熱可塑性樹脂組成物 |
| US5183858A (en) * | 1989-03-31 | 1993-02-02 | Takeda Chemical Industries, Ltd. | Core-shell polymer, production and use thereof |
| US5164434A (en) * | 1990-11-30 | 1992-11-17 | Rohm And Haas Company | Thermal stabilizers |
| US5268430A (en) * | 1991-09-16 | 1993-12-07 | General Electric Company | Methacrylate-butadiene-styrene graft polymer and its PVC blends having low yellowness, good clarity, and improved impact strength |
| US5186993A (en) * | 1991-10-11 | 1993-02-16 | Rohm And Haas Company | Polymer blends |
-
1994
- 1994-02-15 US US08/196,742 patent/US5451624A/en not_active Expired - Lifetime
-
1995
- 1995-02-03 EP EP95300703A patent/EP0668318A1/en not_active Withdrawn
- 1995-02-08 CA CA002142077A patent/CA2142077A1/en not_active Abandoned
- 1995-02-14 KR KR1019950002710A patent/KR950032470A/ko not_active Ceased
- 1995-02-14 BR BR9500637A patent/BR9500637A/pt not_active Application Discontinuation
- 1995-02-15 JP JP7050640A patent/JPH07286087A/ja not_active Withdrawn
- 1995-03-08 TW TW084102177A patent/TW302385B/zh not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPH07286087A (ja) | 1995-10-31 |
| US5451624A (en) | 1995-09-19 |
| BR9500637A (pt) | 1995-10-31 |
| EP0668318A1 (en) | 1995-08-23 |
| TW302385B (cg-RX-API-DMAC10.html) | 1997-04-11 |
| KR950032470A (ko) | 1995-12-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5451624A (en) | Stabilized modifier and impact modified thermoplastics | |
| US5919849A (en) | Impact modified polyacetal compositions | |
| US5039741A (en) | Toughened polyoxymethylene and shaped articles produced therefrom | |
| EP0170960B1 (en) | Thermoplastic resin composition containing wood flour | |
| AU750166B2 (en) | An impact modified carbonate polymer composition having improved resistance to degradation and improved thermal stability | |
| KR101524333B1 (ko) | 플라스틱 스트랩핑용 중합체 조성물 | |
| US5280066A (en) | Polyester-polyolefin blends containing a functionalized elastomer | |
| US5244946A (en) | Styrenic copolymer/polyacetal/thermoplastic polyurethane or elastomeric copolyester blend compositions | |
| EP0463368B1 (en) | Flame retardant blends of polycarbonate, ABS and a polyalkylmethacrylate having increased weld line strength | |
| CA1218779A (en) | Composition | |
| US5795935A (en) | Thermoplastic composition of polyester, polyamide and glycidyl-modified polyolefin | |
| US5306770A (en) | Thermoplastic resin compositions and process for producing the same | |
| US5047471A (en) | Toughened polyoxymethylene and shaped articles produced therefrom | |
| US5159003A (en) | Polyester-compatible alloys of polycarbonate | |
| US5250606A (en) | Polymer blend compositions containing a styrenic copolymer, an acetal polymer and a thermoplastic polyester or polycarbonate resin ingredient | |
| EP0406010A1 (en) | Polyester resin composition | |
| US5266633A (en) | Toughened polyoxymethylene and shaped articles produced therefrom | |
| WO1994024210A1 (en) | Low gloss polymer blend compositions | |
| JPH04213351A (ja) | 重合体ブレンド組成物 | |
| KR19980055579A (ko) | 열가소성 수지조성물 | |
| US5196461A (en) | Styrenic copolymer/polyacetal blend compositions | |
| JP3167236B2 (ja) | ポリアセタール樹脂組成物 | |
| US5070144A (en) | Reactive compatibilization of polyacetal and polypropylene blends | |
| KR19980027070A (ko) | 내충격성이 우수한 열가소성 수지조성물 | |
| EP0427268A2 (en) | Thermoplastic compositions based on vinyl-aromatic copolymers and polyamide resins |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |