CA1336712C - 1,5-benzothiazepine derivatives, their preparation and their use in the treatment of cardiovascular disorders - Google Patents
1,5-benzothiazepine derivatives, their preparation and their use in the treatment of cardiovascular disordersInfo
- Publication number
- CA1336712C CA1336712C CA000606525A CA606525A CA1336712C CA 1336712 C CA1336712 C CA 1336712C CA 000606525 A CA000606525 A CA 000606525A CA 606525 A CA606525 A CA 606525A CA 1336712 C CA1336712 C CA 1336712C
- Authority
- CA
- Canada
- Prior art keywords
- group
- methoxyphenyl
- dihydro
- multiplet
- singlet
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 208000024172 Cardiovascular disease Diseases 0.000 title claims abstract description 13
- 238000011282 treatment Methods 0.000 title claims abstract description 11
- 238000002360 preparation method Methods 0.000 title description 48
- KJFRSZASZNLCDF-UHFFFAOYSA-N 1,5-benzothiazepine Chemical class S1C=CC=NC2=CC=CC=C12 KJFRSZASZNLCDF-UHFFFAOYSA-N 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 268
- -1 aliphatic acyl Chemical group 0.000 claims abstract description 98
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 46
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 22
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 18
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 18
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims abstract description 16
- 125000003118 aryl group Chemical group 0.000 claims abstract description 14
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 14
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 14
- 239000001301 oxygen Substances 0.000 claims abstract description 14
- 239000011593 sulfur Chemical group 0.000 claims abstract description 12
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 10
- 238000011321 prophylaxis Methods 0.000 claims abstract description 8
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims abstract description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 5
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims abstract description 5
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims abstract description 5
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 claims abstract description 3
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims abstract 3
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims abstract 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 92
- 125000001424 substituent group Chemical group 0.000 claims description 48
- 150000003839 salts Chemical class 0.000 claims description 39
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 30
- 125000005843 halogen group Chemical group 0.000 claims description 25
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 24
- 125000001931 aliphatic group Chemical group 0.000 claims description 23
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 20
- 229910052757 nitrogen Inorganic materials 0.000 claims description 15
- 229910052801 chlorine Inorganic materials 0.000 claims description 13
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 12
- 125000001589 carboacyl group Chemical group 0.000 claims description 11
- 125000006413 ring segment Chemical group 0.000 claims description 11
- 229940127291 Calcium channel antagonist Drugs 0.000 claims description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 10
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 9
- 239000000480 calcium channel blocker Substances 0.000 claims description 9
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 9
- 125000002541 furyl group Chemical group 0.000 claims description 9
- 125000000623 heterocyclic group Chemical group 0.000 claims description 9
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 9
- 125000000335 thiazolyl group Chemical group 0.000 claims description 9
- 125000001544 thienyl group Chemical group 0.000 claims description 9
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 8
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 8
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 8
- 125000002971 oxazolyl group Chemical group 0.000 claims description 8
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 claims description 8
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 8
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 7
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 7
- 125000004434 sulfur atom Chemical group 0.000 claims description 7
- 125000005425 toluyl group Chemical group 0.000 claims description 7
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 6
- 125000002837 carbocyclic group Chemical group 0.000 claims description 5
- 125000001153 fluoro group Chemical group F* 0.000 claims description 5
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 4
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 3
- 125000006828 (C2-C7) alkoxycarbonyl group Chemical group 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- LASGCVYJHFWCNY-UHFFFAOYSA-N 5-[2-(dimethylamino)ethyl]-2-(3-fluoro-4-methoxyphenyl)-8-(4-fluorophenoxy)-3-hydroxy-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=C(F)C(OC)=CC=C1C1C(O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=CC(F)=CC=3)C=C2S1 LASGCVYJHFWCNY-UHFFFAOYSA-N 0.000 claims description 2
- CQOPGCPCUXWXOO-UHFFFAOYSA-N 5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-8-phenoxy-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1C1C(O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=CC=CC=3)C=C2S1 CQOPGCPCUXWXOO-UHFFFAOYSA-N 0.000 claims description 2
- LQGLQMNSRJCINC-UHFFFAOYSA-N 5-[2-(dimethylamino)ethyl]-8-(4-fluorophenoxy)-3-hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1C1C(O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=CC(F)=CC=3)C=C2S1 LQGLQMNSRJCINC-UHFFFAOYSA-N 0.000 claims description 2
- MPVNROGDPWHZAW-UHFFFAOYSA-N 8-benzyl-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1C1C(O)C(=O)N(CCN(C)C)C2=CC=C(CC=3C=CC=CC=3)C=C2S1 MPVNROGDPWHZAW-UHFFFAOYSA-N 0.000 claims description 2
- GNXJOZMQXFLIHJ-UHFFFAOYSA-N [5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-8-phenoxy-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical compound C1=CC(OC)=CC=C1C1C(OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=CC=CC=3)C=C2S1 GNXJOZMQXFLIHJ-UHFFFAOYSA-N 0.000 claims description 2
- YJKDPWBELCGVNH-UHFFFAOYSA-N [8-benzyl-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical compound C1=CC(OC)=CC=C1C1C(OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(CC=3C=CC=CC=3)C=C2S1 YJKDPWBELCGVNH-UHFFFAOYSA-N 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 11
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 3
- BEHIFOPJQGVGDB-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yl)-5-[2-(dimethylamino)ethyl]-3-hydroxy-8-phenoxy-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=C2SC(C=3C=C4OCOC4=CC=3)C(O)C(=O)N(CCN(C)C)C2=CC=C1OC1=CC=CC=C1 BEHIFOPJQGVGDB-UHFFFAOYSA-N 0.000 claims 1
- PPCNBPATDPLLHF-UHFFFAOYSA-N 5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-8-(thiophen-2-ylmethyl)-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1C1C(O)C(=O)N(CCN(C)C)C2=CC=C(CC=3SC=CC=3)C=C2S1 PPCNBPATDPLLHF-UHFFFAOYSA-N 0.000 claims 1
- MUCXVRQHMHPNLZ-UHFFFAOYSA-N 5-[2-(dimethylamino)ethyl]-8-[(4-fluorophenyl)methyl]-3-hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1C1C(O)C(=O)N(CCN(C)C)C2=CC=C(CC=3C=CC(F)=CC=3)C=C2S1 MUCXVRQHMHPNLZ-UHFFFAOYSA-N 0.000 claims 1
- FOHDORFCRSWVLG-UHFFFAOYSA-N 8-benzyl-5-[2-(dimethylamino)ethyl]-2-(3-fluoro-4-methoxyphenyl)-3-hydroxy-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=C(F)C(OC)=CC=C1C1C(O)C(=O)N(CCN(C)C)C2=CC=C(CC=3C=CC=CC=3)C=C2S1 FOHDORFCRSWVLG-UHFFFAOYSA-N 0.000 claims 1
- INTPWHAGJLAVDT-UHFFFAOYSA-N [5-[2-(dimethylamino)ethyl]-2-(3-fluoro-4-methoxyphenyl)-8-(4-fluorophenoxy)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical compound C1=C(F)C(OC)=CC=C1C1C(OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=CC(F)=CC=3)C=C2S1 INTPWHAGJLAVDT-UHFFFAOYSA-N 0.000 claims 1
- GKBNJRFNEDLOAM-UHFFFAOYSA-N [5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-8-(thiophen-2-ylmethyl)-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical compound C1=CC(OC)=CC=C1C1C(OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(CC=3SC=CC=3)C=C2S1 GKBNJRFNEDLOAM-UHFFFAOYSA-N 0.000 claims 1
- HGRBLDVCIKCMBT-UHFFFAOYSA-N [5-[2-(dimethylamino)ethyl]-8-(furan-2-ylmethyl)-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical compound C1=CC(OC)=CC=C1C1C(OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(CC=3OC=CC=3)C=C2S1 HGRBLDVCIKCMBT-UHFFFAOYSA-N 0.000 claims 1
- IKSGPHDDMPUOKP-UHFFFAOYSA-N [8-benzyl-5-[2-(dimethylamino)ethyl]-2-(3-fluoro-4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical compound C1=C(F)C(OC)=CC=C1C1C(OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(CC=3C=CC=CC=3)C=C2S1 IKSGPHDDMPUOKP-UHFFFAOYSA-N 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 abstract description 11
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 6
- 239000001257 hydrogen Substances 0.000 abstract description 6
- 230000008061 calcium-channel-blocking effect Effects 0.000 abstract description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 3
- 125000002947 alkylene group Chemical group 0.000 abstract description 2
- 150000002367 halogens Chemical class 0.000 abstract description 2
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 abstract 2
- 150000002431 hydrogen Chemical class 0.000 abstract 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 abstract 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 162
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 129
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 111
- 238000000034 method Methods 0.000 description 107
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 90
- 238000006243 chemical reaction Methods 0.000 description 76
- 239000000203 mixture Substances 0.000 description 76
- 230000008018 melting Effects 0.000 description 68
- 238000002844 melting Methods 0.000 description 68
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 63
- 230000003287 optical effect Effects 0.000 description 52
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 49
- 239000000243 solution Substances 0.000 description 48
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 46
- 239000013078 crystal Substances 0.000 description 44
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 39
- 239000000460 chlorine Substances 0.000 description 35
- 238000001704 evaporation Methods 0.000 description 35
- 239000002904 solvent Substances 0.000 description 34
- 230000002829 reductive effect Effects 0.000 description 33
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 32
- 230000008020 evaporation Effects 0.000 description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 29
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 28
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 27
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 24
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 20
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 20
- 239000007864 aqueous solution Substances 0.000 description 20
- 239000007787 solid Substances 0.000 description 20
- 239000000047 product Substances 0.000 description 19
- 229960004166 diltiazem Drugs 0.000 description 18
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 18
- 239000000843 powder Substances 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 18
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- 238000000746 purification Methods 0.000 description 16
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 15
- 238000001914 filtration Methods 0.000 description 15
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 15
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 13
- 235000020357 syrup Nutrition 0.000 description 13
- 239000006188 syrup Substances 0.000 description 13
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- 239000011780 sodium chloride Substances 0.000 description 12
- 238000004440 column chromatography Methods 0.000 description 11
- 239000003480 eluent Substances 0.000 description 11
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 description 10
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 10
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 10
- HSUGRBWQSSZJOP-RTWAWAEBSA-N diltiazem Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=CC=C2S1 HSUGRBWQSSZJOP-RTWAWAEBSA-N 0.000 description 10
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 10
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 9
- 229910000027 potassium carbonate Inorganic materials 0.000 description 9
- 235000011181 potassium carbonates Nutrition 0.000 description 9
- 235000011118 potassium hydroxide Nutrition 0.000 description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 8
- 238000004587 chromatography analysis Methods 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- MLKAYDMCGMDUJN-UHFFFAOYSA-N 2-amino-5-phenoxybenzenethiol Chemical compound C1=C(S)C(N)=CC=C1OC1=CC=CC=C1 MLKAYDMCGMDUJN-UHFFFAOYSA-N 0.000 description 7
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 7
- 238000007796 conventional method Methods 0.000 description 7
- 229910052731 fluorine Inorganic materials 0.000 description 7
- 150000008282 halocarbons Chemical class 0.000 description 7
- 229930195733 hydrocarbon Natural products 0.000 description 7
- 150000002430 hydrocarbons Chemical class 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 230000036772 blood pressure Effects 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 150000002170 ethers Chemical class 0.000 description 6
- 239000011737 fluorine Substances 0.000 description 6
- 125000005842 heteroatom Chemical group 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 231100000989 no adverse effect Toxicity 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- 238000010898 silica gel chromatography Methods 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 238000011699 spontaneously hypertensive rat Methods 0.000 description 6
- ILGPYWNOPXKGHP-UHFFFAOYSA-N 2-amino-5-(4-fluorophenoxy)benzenethiol Chemical compound C1=C(S)C(N)=CC=C1OC1=CC=C(F)C=C1 ILGPYWNOPXKGHP-UHFFFAOYSA-N 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 238000000862 absorption spectrum Methods 0.000 description 5
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 5
- 229910001424 calcium ion Inorganic materials 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 229940079593 drug Drugs 0.000 description 5
- 239000003814 drug Substances 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 5
- 238000012746 preparative thin layer chromatography Methods 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 239000008096 xylene Substances 0.000 description 5
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 239000004593 Epoxy Substances 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 235000008504 concentrate Nutrition 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 230000008602 contraction Effects 0.000 description 4
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 4
- 125000001624 naphthyl group Chemical group 0.000 description 4
- 150000007530 organic bases Chemical class 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- IWMJWTWSJUAIDL-RTWAWAEBSA-N (2s,3s)-2-(3-fluoro-4-methoxyphenyl)-3-hydroxy-8-phenoxy-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound C1=C(F)C(OC)=CC=C1[C@H]1[C@@H](O)C(=O)NC2=CC=C(OC=3C=CC=CC=3)C=C2S1 IWMJWTWSJUAIDL-RTWAWAEBSA-N 0.000 description 3
- KOHHAYZOZFKLSR-RTWAWAEBSA-N (2s,3s)-3-(2-amino-5-phenoxyphenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid Chemical compound C1=CC(OC)=CC=C1[C@@H]([C@@H](O)C(O)=O)SC1=CC(OC=2C=CC=CC=2)=CC=C1N KOHHAYZOZFKLSR-RTWAWAEBSA-N 0.000 description 3
- SZKCGMAGGRTZCD-RTWAWAEBSA-N (2s,3s)-3-(2-amino-5-phenoxyphenyl)sulfanyl-3-(3-fluoro-4-methoxyphenyl)-2-hydroxypropanoic acid Chemical compound C1=C(F)C(OC)=CC=C1[C@@H]([C@@H](O)C(O)=O)SC1=CC(OC=2C=CC=CC=2)=CC=C1N SZKCGMAGGRTZCD-RTWAWAEBSA-N 0.000 description 3
- ZSBOORQWKFXRFV-RTWAWAEBSA-N (2s,3s)-3-[2-amino-5-(4-fluorophenoxy)phenyl]sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid Chemical compound C1=CC(OC)=CC=C1[C@@H]([C@@H](O)C(O)=O)SC1=CC(OC=2C=CC(F)=CC=2)=CC=C1N ZSBOORQWKFXRFV-RTWAWAEBSA-N 0.000 description 3
- BPLVEGDVMUWPJT-RTWAWAEBSA-N (2s,3s)-3-[2-amino-5-(4-fluorophenoxy)phenyl]sulfanyl-3-(3-fluoro-4-methoxyphenyl)-2-hydroxypropanoic acid Chemical compound C1=C(F)C(OC)=CC=C1[C@@H]([C@@H](O)C(O)=O)SC1=CC(OC=2C=CC(F)=CC=2)=CC=C1N BPLVEGDVMUWPJT-RTWAWAEBSA-N 0.000 description 3
- ZHEXTBULFNTLSA-RPBOFIJWSA-N (2s,3s)-5-[2-(dimethylamino)ethyl]-2-(3-fluoro-4-methoxyphenyl)-3-hydroxy-8-phenoxy-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=C(F)C(OC)=CC=C1[C@H]1[C@@H](O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=CC=CC=3)C=C2S1 ZHEXTBULFNTLSA-RPBOFIJWSA-N 0.000 description 3
- LASGCVYJHFWCNY-RPBOFIJWSA-N (2s,3s)-5-[2-(dimethylamino)ethyl]-2-(3-fluoro-4-methoxyphenyl)-8-(4-fluorophenoxy)-3-hydroxy-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=C(F)C(OC)=CC=C1[C@H]1[C@@H](O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=CC(F)=CC=3)C=C2S1 LASGCVYJHFWCNY-RPBOFIJWSA-N 0.000 description 3
- SSFPGQTZBRUFOU-RTWAWAEBSA-N (2s,3s)-8-(4-fluorophenoxy)-3-hydroxy-2-(4-methoxyphenyl)-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)NC2=CC=C(OC=3C=CC(F)=CC=3)C=C2S1 SSFPGQTZBRUFOU-RTWAWAEBSA-N 0.000 description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 description 3
- 125000004414 alkyl thio group Chemical group 0.000 description 3
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000012024 dehydrating agents Substances 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000001530 fumaric acid Substances 0.000 description 3
- 125000001188 haloalkyl group Chemical group 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 238000011084 recovery Methods 0.000 description 3
- 238000006798 ring closing metathesis reaction Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000011975 tartaric acid Substances 0.000 description 3
- 235000002906 tartaric acid Nutrition 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- 239000012485 toluene extract Substances 0.000 description 3
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical group C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 description 2
- KDRKRKBNCASKMX-YADHBBJMSA-N (2S,3S)-3-[2-amino-5-(1,3-benzodioxol-5-yloxy)phenyl]sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid Chemical compound NC1=C(C=C(C=C1)OC1=CC2=C(C=C1)OCO2)S[C@H]([C@H](C(=O)O)O)C2=CC=C(C=C2)OC KDRKRKBNCASKMX-YADHBBJMSA-N 0.000 description 2
- ROGHJYNMRVKLIS-YADHBBJMSA-N (2s,3s)-3-(2-amino-5-benzylphenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid Chemical compound C1=CC(OC)=CC=C1[C@@H]([C@@H](O)C(O)=O)SC1=CC(CC=2C=CC=CC=2)=CC=C1N ROGHJYNMRVKLIS-YADHBBJMSA-N 0.000 description 2
- OCTUOIYWBWFQDW-UXHICEINSA-N (2s,3s)-3-[2-amino-5-(thiophen-2-ylmethyl)phenyl]sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid Chemical compound C1=CC(OC)=CC=C1[C@@H]([C@@H](O)C(O)=O)SC1=CC(CC=2SC=CC=2)=CC=C1N OCTUOIYWBWFQDW-UXHICEINSA-N 0.000 description 2
- JFWOOXXGRSLVMV-YADHBBJMSA-N (2s,3s)-3-[2-amino-5-[(4-fluorophenyl)methyl]phenyl]sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid Chemical compound C1=CC(OC)=CC=C1[C@@H]([C@@H](O)C(O)=O)SC1=CC(CC=2C=CC(F)=CC=2)=CC=C1N JFWOOXXGRSLVMV-YADHBBJMSA-N 0.000 description 2
- MKEJXNOYHILRPB-RTWAWAEBSA-N (2s,3s)-3-hydroxy-2-(4-methoxyphenyl)-8-phenoxy-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)NC2=CC=C(OC=3C=CC=CC=3)C=C2S1 MKEJXNOYHILRPB-RTWAWAEBSA-N 0.000 description 2
- CEHGPCUMWPTVLD-YADHBBJMSA-N (2s,3s)-3-hydroxy-8-(4-methoxyphenoxy)-2-(4-methoxyphenyl)-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1OC1=CC=C(NC(=O)[C@H](O)[C@@H](S2)C=3C=CC(OC)=CC=3)C2=C1 CEHGPCUMWPTVLD-YADHBBJMSA-N 0.000 description 2
- PPCNBPATDPLLHF-RPWUZVMVSA-N (2s,3s)-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-8-(thiophen-2-ylmethyl)-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)N(CCN(C)C)C2=CC=C(CC=3SC=CC=3)C=C2S1 PPCNBPATDPLLHF-RPWUZVMVSA-N 0.000 description 2
- IHGCVLLVXXARRH-RPBOFIJWSA-N (2s,3s)-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-8-[(5-methylthiophen-2-yl)methyl]-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)N(CCN(C)C)C2=CC=C(CC=3SC(C)=CC=3)C=C2S1 IHGCVLLVXXARRH-RPBOFIJWSA-N 0.000 description 2
- CQOPGCPCUXWXOO-RPBOFIJWSA-N (2s,3s)-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-8-phenoxy-2,3-dihydro-1,5-benzothiazepin-4-one Chemical class C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=CC=CC=3)C=C2S1 CQOPGCPCUXWXOO-RPBOFIJWSA-N 0.000 description 2
- ZDXKZNNEBOCAFS-RPBOFIJWSA-N (2s,3s)-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-8-phenylsulfanyl-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)N(CCN(C)C)C2=CC=C(SC=3C=CC=CC=3)C=C2S1 ZDXKZNNEBOCAFS-RPBOFIJWSA-N 0.000 description 2
- LQGLQMNSRJCINC-RPBOFIJWSA-N (2s,3s)-5-[2-(dimethylamino)ethyl]-8-(4-fluorophenoxy)-3-hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one Chemical class C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=CC(F)=CC=3)C=C2S1 LQGLQMNSRJCINC-RPBOFIJWSA-N 0.000 description 2
- MUCXVRQHMHPNLZ-FTJBHMTQSA-N (2s,3s)-5-[2-(dimethylamino)ethyl]-8-[(4-fluorophenyl)methyl]-3-hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)N(CCN(C)C)C2=CC=C(CC=3C=CC(F)=CC=3)C=C2S1 MUCXVRQHMHPNLZ-FTJBHMTQSA-N 0.000 description 2
- ULUBRKPQADRBAJ-YADHBBJMSA-N (2s,3s)-8-(1,3-benzodioxol-5-yloxy)-3-hydroxy-2-(4-methoxyphenyl)-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)NC2=CC=C(OC=3C=C4OCOC4=CC=3)C=C2S1 ULUBRKPQADRBAJ-YADHBBJMSA-N 0.000 description 2
- VWKPOAHLJMCBJA-FTJBHMTQSA-N (2s,3s)-8-(1,3-benzodioxol-5-yloxy)-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=C4OCOC4=CC=3)C=C2S1 VWKPOAHLJMCBJA-FTJBHMTQSA-N 0.000 description 2
- WWUHQWDJMSOXPQ-YADHBBJMSA-N (2s,3s)-8-benzyl-3-hydroxy-2-(4-methoxyphenyl)-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)NC2=CC=C(CC=3C=CC=CC=3)C=C2S1 WWUHQWDJMSOXPQ-YADHBBJMSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- 125000004521 1,3,4-thiadiazol-2-yl group Chemical group S1C(=NN=C1)* 0.000 description 2
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 2
- SGTNSNPWRIOYBX-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile Chemical compound C1=C(OC)C(OC)=CC=C1CCN(C)CCCC(C#N)(C(C)C)C1=CC=C(OC)C(OC)=C1 SGTNSNPWRIOYBX-UHFFFAOYSA-N 0.000 description 2
- FPHCJNFTPYNCBS-UHFFFAOYSA-N 2-amino-5-(1,3-benzodioxol-5-yloxy)benzenethiol Chemical compound C1=C(S)C(N)=CC=C1OC1=CC=C(OCO2)C2=C1 FPHCJNFTPYNCBS-UHFFFAOYSA-N 0.000 description 2
- ZHJSAPSHDIOSQA-UHFFFAOYSA-N 2-amino-5-(3-methylphenoxy)benzenethiol Chemical compound CC1=CC=CC(OC=2C=C(S)C(N)=CC=2)=C1 ZHJSAPSHDIOSQA-UHFFFAOYSA-N 0.000 description 2
- QLJYHBXPWITUDK-UHFFFAOYSA-N 2-amino-5-(4-chlorophenoxy)benzenethiol Chemical compound C1=C(S)C(N)=CC=C1OC1=CC=C(Cl)C=C1 QLJYHBXPWITUDK-UHFFFAOYSA-N 0.000 description 2
- XOXLXSYSXFEGFU-UHFFFAOYSA-N 2-amino-5-(4-methoxyphenoxy)benzenethiol Chemical compound C1=CC(OC)=CC=C1OC1=CC=C(N)C(S)=C1 XOXLXSYSXFEGFU-UHFFFAOYSA-N 0.000 description 2
- MFONZAUKGVWKGP-UHFFFAOYSA-N 2-amino-5-[(4-fluorophenyl)methyl]benzenethiol Chemical compound C1=C(S)C(N)=CC=C1CC1=CC=C(F)C=C1 MFONZAUKGVWKGP-UHFFFAOYSA-N 0.000 description 2
- GZPOWMYSTLJDGN-UHFFFAOYSA-N 2-amino-5-[(5-methylthiophen-2-yl)methyl]benzenethiol Chemical compound S1C(C)=CC=C1CC1=CC=C(N)C(S)=C1 GZPOWMYSTLJDGN-UHFFFAOYSA-N 0.000 description 2
- KUSVSCKLZKJLLQ-UHFFFAOYSA-N 2-amino-5-benzylbenzenethiol Chemical compound C1=C(S)C(N)=CC=C1CC1=CC=CC=C1 KUSVSCKLZKJLLQ-UHFFFAOYSA-N 0.000 description 2
- VBYKXWQBWVEMIP-UHFFFAOYSA-N 2-amino-5-phenylsulfanylbenzenethiol Chemical compound C1=C(S)C(N)=CC=C1SC1=CC=CC=C1 VBYKXWQBWVEMIP-UHFFFAOYSA-N 0.000 description 2
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- 125000001216 2-naphthoyl group Chemical group C1=C(C=CC2=CC=CC=C12)C(=O)* 0.000 description 2
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 2
- KOHHAYZOZFKLSR-UHFFFAOYSA-N 3-(2-amino-5-phenoxyphenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid Chemical compound C1=CC(OC)=CC=C1C(C(O)C(O)=O)SC1=CC(OC=2C=CC=CC=2)=CC=C1N KOHHAYZOZFKLSR-UHFFFAOYSA-N 0.000 description 2
- GMFLVBZIBTVCMB-UHFFFAOYSA-N 3-(2-amino-5-phenoxyphenyl)sulfanyl-3-(1,3-benzodioxol-5-yl)-2-hydroxypropanoic acid Chemical compound C1=C(SC(C(O)C(O)=O)C=2C=C3OCOC3=CC=2)C(N)=CC=C1OC1=CC=CC=C1 GMFLVBZIBTVCMB-UHFFFAOYSA-N 0.000 description 2
- JQJWFYDOEJUCPE-UHFFFAOYSA-N 3-(2-amino-5-phenoxyphenyl)sulfanyl-3-(3-chloro-4-methoxyphenyl)-2-hydroxypropanoic acid Chemical compound C1=C(Cl)C(OC)=CC=C1C(C(O)C(O)=O)SC1=CC(OC=2C=CC=CC=2)=CC=C1N JQJWFYDOEJUCPE-UHFFFAOYSA-N 0.000 description 2
- SZKCGMAGGRTZCD-UHFFFAOYSA-N 3-(2-amino-5-phenoxyphenyl)sulfanyl-3-(3-fluoro-4-methoxyphenyl)-2-hydroxypropanoic acid Chemical compound C1=C(F)C(OC)=CC=C1C(C(O)C(O)=O)SC1=CC(OC=2C=CC=CC=2)=CC=C1N SZKCGMAGGRTZCD-UHFFFAOYSA-N 0.000 description 2
- RGTXBVSWTJHMRK-UHFFFAOYSA-N 3-[2-amino-5-(3-methylphenoxy)phenyl]sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid Chemical compound C1=CC(OC)=CC=C1C(C(O)C(O)=O)SC1=CC(OC=2C=C(C)C=CC=2)=CC=C1N RGTXBVSWTJHMRK-UHFFFAOYSA-N 0.000 description 2
- QJVCOYMYGPGXIO-UHFFFAOYSA-N 3-[2-amino-5-(4-chlorophenoxy)phenyl]sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid Chemical compound C1=CC(OC)=CC=C1C(C(O)C(O)=O)SC1=CC(OC=2C=CC(Cl)=CC=2)=CC=C1N QJVCOYMYGPGXIO-UHFFFAOYSA-N 0.000 description 2
- JUIJATVAEXBDOT-UHFFFAOYSA-N 3-[2-amino-5-(4-methoxyphenoxy)phenyl]sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid Chemical compound C1=CC(OC)=CC=C1OC1=CC=C(N)C(SC(C(O)C(O)=O)C=2C=CC(OC)=CC=2)=C1 JUIJATVAEXBDOT-UHFFFAOYSA-N 0.000 description 2
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 2
- MINCZQZTEVQYOT-UHFFFAOYSA-N 6-(1,3-benzodioxol-5-yloxy)-1,3-benzothiazol-2-amine Chemical compound C1=C2OCOC2=CC(OC2=CC=C3N=C(SC3=C2)N)=C1 MINCZQZTEVQYOT-UHFFFAOYSA-N 0.000 description 2
- WGQXXUYJQBLKBO-UHFFFAOYSA-N 6-(3-methylphenoxy)-1,3-benzothiazol-2-amine Chemical compound CC1=CC=CC(OC=2C=C3SC(N)=NC3=CC=2)=C1 WGQXXUYJQBLKBO-UHFFFAOYSA-N 0.000 description 2
- TWRDYQHTRDNJQR-UHFFFAOYSA-N 6-(4-chlorophenoxy)-1,3-benzothiazol-2-amine Chemical compound C1=C2SC(N)=NC2=CC=C1OC1=CC=C(Cl)C=C1 TWRDYQHTRDNJQR-UHFFFAOYSA-N 0.000 description 2
- SLJJWWCIBRDPIU-UHFFFAOYSA-N 6-(4-fluorophenoxy)-1,3-benzothiazol-2-amine Chemical compound C1=C2SC(N)=NC2=CC=C1OC1=CC=C(F)C=C1 SLJJWWCIBRDPIU-UHFFFAOYSA-N 0.000 description 2
- VNVRWGSDVJRGAG-UHFFFAOYSA-N 6-(4-methoxyphenoxy)-1,3-benzothiazol-2-amine Chemical compound C1=CC(OC)=CC=C1OC1=CC=C(N=C(N)S2)C2=C1 VNVRWGSDVJRGAG-UHFFFAOYSA-N 0.000 description 2
- MZMZKWLNLOXGQK-UHFFFAOYSA-N 6-(thiophen-2-ylmethyl)-1,3-benzothiazol-2-amine Chemical compound C1=C2SC(N)=NC2=CC=C1CC1=CC=CS1 MZMZKWLNLOXGQK-UHFFFAOYSA-N 0.000 description 2
- JAWWVJZYKNLCDP-UHFFFAOYSA-N 6-[(5-methylthiophen-2-yl)methyl]-1,3-benzothiazol-2-amine Chemical compound S1C(C)=CC=C1CC1=CC=C(N=C(N)S2)C2=C1 JAWWVJZYKNLCDP-UHFFFAOYSA-N 0.000 description 2
- KWQXAJXQSPOIJH-UHFFFAOYSA-N 6-benzyl-1,3-benzothiazol-2-amine Chemical compound C1=C2SC(N)=NC2=CC=C1CC1=CC=CC=C1 KWQXAJXQSPOIJH-UHFFFAOYSA-N 0.000 description 2
- AGCIBKULIKCGAH-UHFFFAOYSA-N 6-phenoxy-1,3-benzothiazol-2-amine Chemical compound C1=C2SC(N)=NC2=CC=C1OC1=CC=CC=C1 AGCIBKULIKCGAH-UHFFFAOYSA-N 0.000 description 2
- IMSPVXQBEFVUQW-UHFFFAOYSA-N 6-phenylsulfanyl-1,3-benzothiazol-2-amine Chemical compound C1=C2SC(N)=NC2=CC=C1SC1=CC=CC=C1 IMSPVXQBEFVUQW-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 206010002383 Angina Pectoris Diseases 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- DAXSWONXHIRAKR-RTWAWAEBSA-N ClC1=CC=C(OC2=CC3=C(NC([C@@H]([C@@H](S3)C3=CC=C(C=C3)OC)O)=O)C=C2)C=C1 Chemical compound ClC1=CC=C(OC2=CC3=C(NC([C@@H]([C@@H](S3)C3=CC=C(C=C3)OC)O)=O)C=C2)C=C1 DAXSWONXHIRAKR-RTWAWAEBSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- 208000001953 Hypotension Diseases 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- ZBBHBTPTTSWHBA-UHFFFAOYSA-N Nicardipine Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCCN(C)CC=2C=CC=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 ZBBHBTPTTSWHBA-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 241000244155 Taenia Species 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 2
- 150000008046 alkali metal hydrides Chemical class 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- 150000007657 benzothiazepines Chemical class 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000006255 cyclopropyl carbonyl group Chemical group [H]C1([H])C([H])([H])C1([H])C(*)=O 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 229940113088 dimethylacetamide Drugs 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- PBJKOXZDDSNIEM-UHFFFAOYSA-N ethyl 3-(2-amino-5-phenoxyphenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoate Chemical compound C=1C=C(OC)C=CC=1C(C(O)C(=O)OCC)SC(C(=CC=1)N)=CC=1OC1=CC=CC=C1 PBJKOXZDDSNIEM-UHFFFAOYSA-N 0.000 description 2
- FJIPRJYPGJFTNP-UHFFFAOYSA-N ethyl 3-(2-amino-5-phenoxyphenyl)sulfanyl-3-(3-chloro-4-methoxyphenyl)-2-hydroxypropanoate Chemical compound C=1C=C(OC)C(Cl)=CC=1C(C(O)C(=O)OCC)SC(C(=CC=1)N)=CC=1OC1=CC=CC=C1 FJIPRJYPGJFTNP-UHFFFAOYSA-N 0.000 description 2
- RIWMUPFMBHQYTP-UHFFFAOYSA-N ethyl 3-(2-amino-5-phenoxyphenyl)sulfanyl-3-(3-fluoro-4-methoxyphenyl)-2-hydroxypropanoate Chemical compound C=1C=C(OC)C(F)=CC=1C(C(O)C(=O)OCC)SC(C(=CC=1)N)=CC=1OC1=CC=CC=C1 RIWMUPFMBHQYTP-UHFFFAOYSA-N 0.000 description 2
- KEGMQRFFKHJCIH-UHFFFAOYSA-N ethyl 3-[2-amino-5-(4-fluorophenoxy)phenyl]sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoate Chemical compound C=1C=C(OC)C=CC=1C(C(O)C(=O)OCC)SC(C(=CC=1)N)=CC=1OC1=CC=C(F)C=C1 KEGMQRFFKHJCIH-UHFFFAOYSA-N 0.000 description 2
- OUCJRHVTKZFOHE-UHFFFAOYSA-N ethyl 3-[2-amino-5-(4-fluorophenoxy)phenyl]sulfanyl-3-(3-fluoro-4-methoxyphenyl)-2-hydroxypropanoate Chemical compound C=1C=C(OC)C(F)=CC=1C(C(O)C(=O)OCC)SC(C(=CC=1)N)=CC=1OC1=CC=C(F)C=C1 OUCJRHVTKZFOHE-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 229960000326 flunarizine Drugs 0.000 description 2
- SMANXXCATUTDDT-QPJJXVBHSA-N flunarizine Chemical compound C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)N1CCN(C\C=C\C=2C=CC=CC=2)CC1 SMANXXCATUTDDT-QPJJXVBHSA-N 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 230000036543 hypotension Effects 0.000 description 2
- 230000004941 influx Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 238000010253 intravenous injection Methods 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- HMAPTYVOCWBHQA-UHFFFAOYSA-N methyl 3-(2-amino-5-phenylsulfanylphenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoate Chemical compound C=1C=C(OC)C=CC=1C(C(O)C(=O)OC)SC(C(=CC=1)N)=CC=1SC1=CC=CC=C1 HMAPTYVOCWBHQA-UHFFFAOYSA-N 0.000 description 2
- SAVGKOGGNZVHIV-UHFFFAOYSA-N methyl 3-[2-amino-5-(3-methylphenoxy)phenyl]sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoate Chemical compound C=1C=C(OC)C=CC=1C(C(O)C(=O)OC)SC(C(=CC=1)N)=CC=1OC1=CC=CC(C)=C1 SAVGKOGGNZVHIV-UHFFFAOYSA-N 0.000 description 2
- TWXOMUMJJFLIMS-UHFFFAOYSA-N methyl 3-[2-amino-5-(4-chlorophenoxy)phenyl]sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoate Chemical compound C=1C=C(OC)C=CC=1C(C(O)C(=O)OC)SC(C(=CC=1)N)=CC=1OC1=CC=C(Cl)C=C1 TWXOMUMJJFLIMS-UHFFFAOYSA-N 0.000 description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 229960001783 nicardipine Drugs 0.000 description 2
- 229960001597 nifedipine Drugs 0.000 description 2
- HYIMSNHJOBLJNT-UHFFFAOYSA-N nifedipine Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1[N+]([O-])=O HYIMSNHJOBLJNT-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 210000004789 organ system Anatomy 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 229960001722 verapamil Drugs 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- BEHIFOPJQGVGDB-RPBOFIJWSA-N (2s,3s)-2-(1,3-benzodioxol-5-yl)-5-[2-(dimethylamino)ethyl]-3-hydroxy-8-phenoxy-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound O=C([C@H](O)[C@@H](SC1=C2)C=3C=C4OCOC4=CC=3)N(CCN(C)C)C1=CC=C2OC1=CC=CC=C1 BEHIFOPJQGVGDB-RPBOFIJWSA-N 0.000 description 1
- IGYJSQQTSFHAQO-RPBOFIJWSA-N (2s,3s)-2-(3-chloro-4-methoxyphenyl)-5-[2-(dimethylamino)ethyl]-3-hydroxy-8-phenoxy-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=C(Cl)C(OC)=CC=C1[C@H]1[C@@H](O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=CC=CC=3)C=C2S1 IGYJSQQTSFHAQO-RPBOFIJWSA-N 0.000 description 1
- SVHJKZGETXFGTJ-RTWAWAEBSA-N (2s,3s)-2-(3-fluoro-4-methoxyphenyl)-8-(4-fluorophenoxy)-3-hydroxy-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound C1=C(F)C(OC)=CC=C1[C@H]1[C@@H](O)C(=O)NC2=CC=C(OC=3C=CC(F)=CC=3)C=C2S1 SVHJKZGETXFGTJ-RTWAWAEBSA-N 0.000 description 1
- MVGRDYRIQLEIDX-YADHBBJMSA-N (2s,3s)-3-hydroxy-2-(4-methoxyphenyl)-8-(3-methylphenoxy)-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)NC2=CC=C(OC=3C=C(C)C=CC=3)C=C2S1 MVGRDYRIQLEIDX-YADHBBJMSA-N 0.000 description 1
- ORJUFNTXCQOQDP-RTWAWAEBSA-N (2s,3s)-3-hydroxy-2-(4-methoxyphenyl)-8-phenylsulfanyl-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)NC2=CC=C(SC=3C=CC=CC=3)C=C2S1 ORJUFNTXCQOQDP-RTWAWAEBSA-N 0.000 description 1
- GIVVUGGBFDXANS-SXOMAYOGSA-N (2s,3s)-5-[2-(diethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-8-phenoxy-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound O=C([C@H](O)[C@@H](SC1=C2)C=3C=CC(OC)=CC=3)N(CCN(CC)CC)C1=CC=C2OC1=CC=CC=C1 GIVVUGGBFDXANS-SXOMAYOGSA-N 0.000 description 1
- FOHDORFCRSWVLG-FTJBHMTQSA-N (2s,3s)-8-benzyl-5-[2-(dimethylamino)ethyl]-2-(3-fluoro-4-methoxyphenyl)-3-hydroxy-2,3-dihydro-1,5-benzothiazepin-4-one Chemical class C1=C(F)C(OC)=CC=C1[C@H]1[C@@H](O)C(=O)N(CCN(C)C)C2=CC=C(CC=3C=CC=CC=3)C=C2S1 FOHDORFCRSWVLG-FTJBHMTQSA-N 0.000 description 1
- MPVNROGDPWHZAW-FTJBHMTQSA-N (2s,3s)-8-benzyl-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one Chemical class C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)N(CCN(C)C)C2=CC=C(CC=3C=CC=CC=3)C=C2S1 MPVNROGDPWHZAW-FTJBHMTQSA-N 0.000 description 1
- FHGWEHGZBUBQKL-UHFFFAOYSA-N 1,2-benzothiazepine Chemical compound S1N=CC=CC2=CC=CC=C12 FHGWEHGZBUBQKL-UHFFFAOYSA-N 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 description 1
- OPCMVVKRCLOEDQ-UHFFFAOYSA-N 1-(4-chlorophenyl)-2-(methylamino)pentan-1-one Chemical compound ClC1=CC=C(C=C1)C(C(CCC)NC)=O OPCMVVKRCLOEDQ-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- DVVGIUUJYPYENY-UHFFFAOYSA-N 1-methylpyridin-2-one Chemical compound CN1C=CC=CC1=O DVVGIUUJYPYENY-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- JDRPDUXQDCDWHT-UHFFFAOYSA-N 2-(4-methoxyphenyl)-5h-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1C1=CC(=O)NC2=CC=CC=C2S1 JDRPDUXQDCDWHT-UHFFFAOYSA-N 0.000 description 1
- WSINGHRMIDCJKX-UHFFFAOYSA-N 2-amino-3-methyl-5-thiophen-2-ylbenzenethiol Chemical compound SC1=C(N)C(C)=CC(C=2SC=CC=2)=C1 WSINGHRMIDCJKX-UHFFFAOYSA-N 0.000 description 1
- SMFDHCSUIWRVDE-UHFFFAOYSA-N 2-amino-5-(thiophen-2-ylmethyl)benzenethiol Chemical compound C1=C(S)C(N)=CC=C1CC1=CC=CS1 SMFDHCSUIWRVDE-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- RAGSWDIQBBZLLL-UHFFFAOYSA-N 2-chloroethyl(diethyl)azanium;chloride Chemical compound Cl.CCN(CC)CCCl RAGSWDIQBBZLLL-UHFFFAOYSA-N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- XHJCYCAFIPBKFE-UHFFFAOYSA-N 3-(2-amino-5-phenylsulfanylphenyl)sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoic acid Chemical compound C1=CC(OC)=CC=C1C(C(O)C(O)=O)SC1=CC(SC=2C=CC=CC=2)=CC=C1N XHJCYCAFIPBKFE-UHFFFAOYSA-N 0.000 description 1
- BPLVEGDVMUWPJT-UHFFFAOYSA-N 3-[2-amino-5-(4-fluorophenoxy)phenyl]sulfanyl-3-(3-fluoro-4-methoxyphenyl)-2-hydroxypropanoic acid Chemical compound C1=C(F)C(OC)=CC=C1C(C(O)C(O)=O)SC1=CC(OC=2C=CC(F)=CC=2)=CC=C1N BPLVEGDVMUWPJT-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- SOQCZBSZZLWDGU-UHFFFAOYSA-N 3-fluoro-4-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1F SOQCZBSZZLWDGU-UHFFFAOYSA-N 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- QPOCERUJLCNHEI-UHFFFAOYSA-N 4-(1,3-benzodioxol-5-yloxy)aniline Chemical compound C1=CC(N)=CC=C1OC1=CC=C(OCO2)C2=C1 QPOCERUJLCNHEI-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- GYVLOVTVJKXIGZ-UHFFFAOYSA-N 4-(3-methylphenoxy)aniline Chemical compound CC1=CC=CC(OC=2C=CC(N)=CC=2)=C1 GYVLOVTVJKXIGZ-UHFFFAOYSA-N 0.000 description 1
- YTISFYMPVILQRL-UHFFFAOYSA-N 4-(4-chlorophenoxy)aniline Chemical compound C1=CC(N)=CC=C1OC1=CC=C(Cl)C=C1 YTISFYMPVILQRL-UHFFFAOYSA-N 0.000 description 1
- SMWBBLSINLFYAB-UHFFFAOYSA-N 4-(4-fluorophenoxy)aniline Chemical compound C1=CC(N)=CC=C1OC1=CC=C(F)C=C1 SMWBBLSINLFYAB-UHFFFAOYSA-N 0.000 description 1
- VTYZDTAGEMAJMM-UHFFFAOYSA-N 4-(4-methoxyphenoxy)aniline Chemical compound C1=CC(OC)=CC=C1OC1=CC=C(N)C=C1 VTYZDTAGEMAJMM-UHFFFAOYSA-N 0.000 description 1
- PRONHUYSFVLOKG-UHFFFAOYSA-N 4-[(4-fluorophenyl)methyl]aniline Chemical compound C1=CC(N)=CC=C1CC1=CC=C(F)C=C1 PRONHUYSFVLOKG-UHFFFAOYSA-N 0.000 description 1
- RGNXUKKOKJEVEK-UHFFFAOYSA-N 4-[(5-methylthiophen-2-yl)methyl]aniline Chemical compound S1C(C)=CC=C1CC1=CC=C(N)C=C1 RGNXUKKOKJEVEK-UHFFFAOYSA-N 0.000 description 1
- WDTRNCFZFQIWLM-UHFFFAOYSA-N 4-benzylaniline Chemical compound C1=CC(N)=CC=C1CC1=CC=CC=C1 WDTRNCFZFQIWLM-UHFFFAOYSA-N 0.000 description 1
- WOYZXEVUWXQVNV-UHFFFAOYSA-N 4-phenoxyaniline Chemical compound C1=CC(N)=CC=C1OC1=CC=CC=C1 WOYZXEVUWXQVNV-UHFFFAOYSA-N 0.000 description 1
- TZQVSGOOKNNDFU-UHFFFAOYSA-N 4-phenylsulfanylaniline Chemical compound C1=CC(N)=CC=C1SC1=CC=CC=C1 TZQVSGOOKNNDFU-UHFFFAOYSA-N 0.000 description 1
- BVABFIZTUSTDDW-UHFFFAOYSA-N 5h-1,2-benzothiazepin-4-one Chemical compound S1N=CC(=O)CC2=CC=CC=C21 BVABFIZTUSTDDW-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- MBKWGKGZDORAMG-UHFFFAOYSA-N 6-[(4-fluorophenyl)methyl]-1,3-benzothiazol-2-amine Chemical compound C1=C2SC(N)=NC2=CC=C1CC1=CC=C(F)C=C1 MBKWGKGZDORAMG-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- BDJGLLHMHSLIIY-SXOMAYOGSA-N C(C)(=O)O[C@@H]1[C@@H](SC2=C(N(C1=O)CCN(C)C)C=CC(=C2)OC1=CC=CC=C1)C1=CC(=C(C=C1)OC)Cl Chemical compound C(C)(=O)O[C@@H]1[C@@H](SC2=C(N(C1=O)CCN(C)C)C=CC(=C2)OC1=CC=CC=C1)C1=CC(=C(C=C1)OC)Cl BDJGLLHMHSLIIY-SXOMAYOGSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 108090000312 Calcium Channels Proteins 0.000 description 1
- 102000003922 Calcium Channels Human genes 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- 206010059109 Cerebral vasoconstriction Diseases 0.000 description 1
- QYNABIZGZPIZPK-RPBOFIJWSA-N ClC1=CC=C(OC2=CC3=C(N(C([C@@H]([C@@H](S3)C3=CC=C(C=C3)OC)O)=O)CCN(C)C)C=C2)C=C1 Chemical compound ClC1=CC=C(OC2=CC3=C(N(C([C@@H]([C@@H](S3)C3=CC=C(C=C3)OC)O)=O)CCN(C)C)C=C2)C=C1 QYNABIZGZPIZPK-RPBOFIJWSA-N 0.000 description 1
- STBWKGNEFDKJDS-RTWAWAEBSA-N ClC=1C=C(C=CC=1OC)[C@@H]1SC2=C(NC([C@@H]1O)=O)C=CC(=C2)OC1=CC=CC=C1 Chemical compound ClC=1C=C(C=CC=1OC)[C@@H]1SC2=C(NC([C@@H]1O)=O)C=CC(=C2)OC1=CC=CC=C1 STBWKGNEFDKJDS-RTWAWAEBSA-N 0.000 description 1
- 208000007530 Essential hypertension Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- VFPCZSBNLUCBPC-RTWAWAEBSA-N O[C@@H]1[C@@H](SC2=C(NC1=O)C=CC(=C2)OC2=CC=CC=C2)C2=CC1=C(C=C2)OCO1 Chemical compound O[C@@H]1[C@@H](SC2=C(NC1=O)C=CC(=C2)OC2=CC=CC=C2)C2=CC1=C(C=C2)OCO1 VFPCZSBNLUCBPC-RTWAWAEBSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical group CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- NGYVKCPDZOVKRA-WDYNHAJCSA-N [(2s,3s)-5-[2-(diethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-8-phenoxy-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical compound O=C([C@H](OC(C)=O)[C@@H](SC1=C2)C=3C=CC(OC)=CC=3)N(CCN(CC)CC)C1=CC=C2OC1=CC=CC=C1 NGYVKCPDZOVKRA-WDYNHAJCSA-N 0.000 description 1
- OEXIAGDCRNXQJM-SXOMAYOGSA-N [(2s,3s)-5-[2-(dimethylamino)ethyl]-2-(3-fluoro-4-methoxyphenyl)-4-oxo-8-phenoxy-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical compound C1=C(F)C(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=CC=CC=3)C=C2S1 OEXIAGDCRNXQJM-SXOMAYOGSA-N 0.000 description 1
- INTPWHAGJLAVDT-SXOMAYOGSA-N [(2s,3s)-5-[2-(dimethylamino)ethyl]-2-(3-fluoro-4-methoxyphenyl)-8-(4-fluorophenoxy)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical compound C1=C(F)C(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=CC(F)=CC=3)C=C2S1 INTPWHAGJLAVDT-SXOMAYOGSA-N 0.000 description 1
- GKBNJRFNEDLOAM-FTJBHMTQSA-N [(2s,3s)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-8-(thiophen-2-ylmethyl)-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(CC=3SC=CC=3)C=C2S1 GKBNJRFNEDLOAM-FTJBHMTQSA-N 0.000 description 1
- GNXJOZMQXFLIHJ-SXOMAYOGSA-N [(2s,3s)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-8-phenoxy-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=CC=CC=3)C=C2S1 GNXJOZMQXFLIHJ-SXOMAYOGSA-N 0.000 description 1
- ZXFHAJCDCUXOHD-SXOMAYOGSA-N [(2s,3s)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-8-phenylsulfanyl-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(SC=3C=CC=CC=3)C=C2S1 ZXFHAJCDCUXOHD-SXOMAYOGSA-N 0.000 description 1
- HTCOUPVVVJANGD-SXOMAYOGSA-N [(2s,3s)-5-[2-(dimethylamino)ethyl]-8-(4-fluorophenoxy)-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical class C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=CC(F)=CC=3)C=C2S1 HTCOUPVVVJANGD-SXOMAYOGSA-N 0.000 description 1
- HGRBLDVCIKCMBT-FTJBHMTQSA-N [(2s,3s)-5-[2-(dimethylamino)ethyl]-8-(furan-2-ylmethyl)-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical class C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(CC=3OC=CC=3)C=C2S1 HGRBLDVCIKCMBT-FTJBHMTQSA-N 0.000 description 1
- QKLDODAOCYNWMJ-IZLXSDGUSA-N [(2s,3s)-5-[2-(dimethylamino)ethyl]-8-[(4-fluorophenyl)methyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical class C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(CC=3C=CC(F)=CC=3)C=C2S1 QKLDODAOCYNWMJ-IZLXSDGUSA-N 0.000 description 1
- RCNLJCWRLWKGPX-IZLXSDGUSA-N [(2s,3s)-8-(1,3-benzodioxol-5-yloxy)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(OC=3C=C4OCOC4=CC=3)C=C2S1 RCNLJCWRLWKGPX-IZLXSDGUSA-N 0.000 description 1
- IKSGPHDDMPUOKP-IZLXSDGUSA-N [(2s,3s)-8-benzyl-5-[2-(dimethylamino)ethyl]-2-(3-fluoro-4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical class C1=C(F)C(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(CC=3C=CC=CC=3)C=C2S1 IKSGPHDDMPUOKP-IZLXSDGUSA-N 0.000 description 1
- YJKDPWBELCGVNH-IZLXSDGUSA-N [(2s,3s)-8-benzyl-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate Chemical class C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(CC=3C=CC=CC=3)C=C2S1 YJKDPWBELCGVNH-IZLXSDGUSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 210000000702 aorta abdominal Anatomy 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 206010003119 arrhythmia Diseases 0.000 description 1
- 230000006793 arrhythmia Effects 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 229940085242 benzothiazepine derivative selective calcium channel blockers with direct cardiac effects Drugs 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- GYKFWCDBQAFCLJ-UHFFFAOYSA-N clentiazem Chemical compound C1=CC(OC)=CC=C1C1C(OC(C)=O)C(=O)N(CCN(C)C)C2=CC=C(Cl)C=C2S1 GYKFWCDBQAFCLJ-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 150000003983 crown ethers Chemical class 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000006637 cyclobutyl carbonyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000006639 cyclohexyl carbonyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000006638 cyclopentyl carbonyl group Chemical group 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- ZWWWLCMDTZFSOO-UHFFFAOYSA-N diethoxyphosphorylformonitrile Chemical compound CCOP(=O)(C#N)OCC ZWWWLCMDTZFSOO-UHFFFAOYSA-N 0.000 description 1
- 229940085304 dihydropyridine derivative selective calcium channel blockers with mainly vascular effects Drugs 0.000 description 1
- 125000004925 dihydropyridyl group Chemical class N1(CC=CC=C1)* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 208000037765 diseases and disorders Diseases 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- PUSKHXMZPOMNTQ-UHFFFAOYSA-N ethyl 2,1,3-benzoselenadiazole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2N=[Se]=NC2=C1 PUSKHXMZPOMNTQ-UHFFFAOYSA-N 0.000 description 1
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 1
- KURWVLUZMVETIO-UHFFFAOYSA-N ethyl 3-(2-amino-5-phenoxyphenyl)sulfanyl-3-(1,3-benzodioxol-5-yl)-2-hydroxypropanoate Chemical compound C=1C=C2OCOC2=CC=1C(C(O)C(=O)OCC)SC(C(=CC=1)N)=CC=1OC1=CC=CC=C1 KURWVLUZMVETIO-UHFFFAOYSA-N 0.000 description 1
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 210000001105 femoral artery Anatomy 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000010575 fractional recrystallization Methods 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 238000003304 gavage Methods 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000001077 hypotensive effect Effects 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 208000001286 intracranial vasospasm Diseases 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 208000023589 ischemic disease Diseases 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- SIAPCJWMELPYOE-UHFFFAOYSA-N lithium hydride Chemical compound [LiH] SIAPCJWMELPYOE-UHFFFAOYSA-N 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- GPKUICFDWYEPTK-UHFFFAOYSA-N methoxycyclohexatriene Chemical group COC1=CC=C=C[CH]1 GPKUICFDWYEPTK-UHFFFAOYSA-N 0.000 description 1
- KSYWADVJOHOIOM-UHFFFAOYSA-N methyl 3-[2-amino-5-(4-methoxyphenoxy)phenyl]sulfanyl-2-hydroxy-3-(4-methoxyphenyl)propanoate Chemical compound C=1C=C(OC)C=CC=1C(C(O)C(=O)OC)SC(C(=CC=1)N)=CC=1OC1=CC=C(OC)C=C1 KSYWADVJOHOIOM-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 230000002107 myocardial effect Effects 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- WMECTFPJZGMPSH-UHFFFAOYSA-N n-methyl-4-thiophen-2-ylaniline Chemical compound C1=CC(NC)=CC=C1C1=CC=CS1 WMECTFPJZGMPSH-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 238000003385 ring cleavage reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 230000009897 systematic effect Effects 0.000 description 1
- 125000001443 terpenyl group Chemical group 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 210000004509 vascular smooth muscle cell Anatomy 0.000 description 1
- 230000024883 vasodilation Effects 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/55—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having seven-membered rings, e.g. azelastine, pentylenetetrazole
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D281/00—Heterocyclic compounds containing rings of more than six members having one nitrogen atom and one sulfur atom as the only ring hetero atoms
- C07D281/02—Seven-membered rings
- C07D281/04—Seven-membered rings having the hetero atoms in positions 1 and 4
- C07D281/08—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D281/10—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems condensed with one six-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP18509788 | 1988-07-25 | ||
| JP63-185097 | 1988-07-25 | ||
| JP63-267540 | 1988-10-24 | ||
| JP26754088 | 1988-10-24 | ||
| JP4102489 | 1989-02-21 | ||
| JP1-41024 | 1989-02-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1336712C true CA1336712C (en) | 1995-08-15 |
Family
ID=27290681
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000606525A Expired - Fee Related CA1336712C (en) | 1988-07-25 | 1989-07-25 | 1,5-benzothiazepine derivatives, their preparation and their use in the treatment of cardiovascular disorders |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US5002942A (en:Method) |
| EP (1) | EP0353032B1 (en:Method) |
| KR (1) | KR940003291B1 (en:Method) |
| CA (1) | CA1336712C (en:Method) |
| DE (1) | DE68900867D1 (en:Method) |
| ES (1) | ES2034642T3 (en:Method) |
| GR (1) | GR3004725T3 (en:Method) |
| IE (1) | IE62994B1 (en:Method) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1255545B (it) * | 1992-10-23 | 1995-11-09 | Procedimento per la preparazione di diltiazem | |
| ES2118292T3 (es) * | 1994-09-16 | 1998-09-16 | Orion Corp Fermion | Metodo para la preparacion de 3-hidroxi-5-(2-dimetilamino)-etil)-2,3-dihidro-4-(metoxifenil)-1,5-benzotiazepin-4(5h)-ona y uso del producto para elaborar compuestos farmaceuticamente activos. |
| FI97725C (fi) * | 1995-02-17 | 1997-02-10 | Orion Yhtymae Oy | Menetelmä diltiatseemin valmistamiseksi |
| US5709897A (en) * | 1995-09-12 | 1998-01-20 | Pearlstein; Leonard | Absorbent packaging for food products |
| JP4875561B2 (ja) * | 2007-07-20 | 2012-02-15 | 株式会社クボタ | 作業車のサスペンション構造 |
| CA2734780C (en) * | 2008-08-22 | 2016-07-05 | Milestone Pharmaceuticals Inc. | Short acting benzothiazepine calcium channel blockers and uses thereof |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0022317B1 (en) * | 1979-06-12 | 1983-09-21 | Fujisawa Pharmaceutical Co., Ltd. | 2-oxo-benzothiazoline, benzoxazoline or indoline derivatives, their preparation, and pharmaceutical compositions comprising such derivatives |
| JPS55167282A (en) * | 1979-06-12 | 1980-12-26 | Fujisawa Pharmaceut Co Ltd | Piperazine derivative or its salt and its preparation |
| US4567175A (en) * | 1983-06-03 | 1986-01-28 | Tanabe Seiyaku Co., Ltd. | 8-Chloro-1,5-benzothiazepine derivatives |
| US4590188A (en) * | 1984-02-18 | 1986-05-20 | Tanabe Seiyaku Co., Ltd. | 1,5-benzothiazepine derivatives and their pharmaceutical use |
| US4594342A (en) * | 1984-04-10 | 1986-06-10 | Tanabe Seiyaku Co., Ltd. | 1,5-benzothiazepine derivative |
-
1989
- 1989-07-21 US US07/384,261 patent/US5002942A/en not_active Expired - Fee Related
- 1989-07-25 CA CA000606525A patent/CA1336712C/en not_active Expired - Fee Related
- 1989-07-25 IE IE240989A patent/IE62994B1/en not_active IP Right Cessation
- 1989-07-25 KR KR1019890010523A patent/KR940003291B1/ko not_active Expired - Fee Related
- 1989-07-25 ES ES198989307564T patent/ES2034642T3/es not_active Expired - Lifetime
- 1989-07-25 DE DE8989307564T patent/DE68900867D1/de not_active Expired - Fee Related
- 1989-07-25 EP EP89307564A patent/EP0353032B1/en not_active Expired - Lifetime
-
1992
- 1992-05-26 GR GR920401074T patent/GR3004725T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GR3004725T3 (en:Method) | 1993-04-28 |
| EP0353032B1 (en) | 1992-02-26 |
| KR910002821A (ko) | 1991-02-26 |
| DE68900867D1 (de) | 1992-04-02 |
| US5002942A (en) | 1991-03-26 |
| IE892409L (en) | 1990-01-25 |
| EP0353032A1 (en) | 1990-01-31 |
| KR940003291B1 (ko) | 1994-04-20 |
| IE62994B1 (en) | 1995-03-08 |
| ES2034642T3 (es) | 1993-04-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0683774B1 (en) | Hypolipidaemic compounds | |
| US6906058B2 (en) | 1,5-Benzothiazepines and their use as hypolipidaemics | |
| RU2383536C2 (ru) | Производное триазола | |
| US5229388A (en) | 3-[4-(1-substituted-4-piperazinyl)butyl]-4-thiazolidinone and related compounds | |
| NO173544B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive 2-tiometyl-substituerte 1,4-dihydropyridiner | |
| BG62048B1 (bg) | Хиполипидемични 1,4-бензотиазепин-1,1-диоксиди | |
| AU2001237556A1 (en) | 1,5-benzothiazepines and their use as hypolipidaemics | |
| CA2082500A1 (en) | Alkoxy-substituted dihydrobenzopyran-2-carboxylic acids and derivatives thereof | |
| CA2013163A1 (en) | Benzopyran derivatives and processes for preparation thereof | |
| EP0243018B1 (en) | Thiolactam-n-acetic acid derivatives, their production and use | |
| EP0434394B1 (en) | Compounds for treating inflammatory bowel disease | |
| US4652561A (en) | Naphtho[1,2-b]-1,4-thiazepinones | |
| CA1336712C (en) | 1,5-benzothiazepine derivatives, their preparation and their use in the treatment of cardiovascular disorders | |
| Harris et al. | Acyl-CoA: cholesterol O-acyl transferase (ACAT) inhibitors. 1. 2-(Alkylthio)-4, 5-diphenyl-1H-imidazoles as potent inhibitors of ACAT | |
| US4665068A (en) | Novel 9-chloro-1,5-benzothiazepine derivatives and their pharmaceutical use | |
| US4145541A (en) | 3,3-Dichloro-2-azetidinone derivatives having basic substituents | |
| KR900005680B1 (ko) | 1,5-벤조티아제핀 유도체의 제조방법 | |
| US4521430A (en) | 1,5-Benzothiazepin-4-one, their pharmaceutical compositoins, and methods of use | |
| DE69221634T2 (de) | 5-Piperazinylalkyl)-1,5-Benzothiazepinone verwendbar als Calciumantagonisten | |
| EP0302379B1 (en) | Naphthothiazepine derivatives and a process for preparing the same | |
| JP2954962B2 (ja) | 8位置換1,5―ベンゾチアゼピン誘導体 | |
| US4640930A (en) | Naphtho(1,8-bc)-1,5-thiazocinones | |
| KR910002879B1 (ko) | 1,5-벤조티아제핀 유도체의 제조방법 | |
| EP0189080A2 (en) | (1,2,4-Oxadiazol-3-YL)-arylmethanones, a process for their preparation and their use as medicaments |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed |