CA1284649C - Boronic acid adducts of rhenium and radioactive isotopes of rheniumdioxime complexes - Google Patents
Boronic acid adducts of rhenium and radioactive isotopes of rheniumdioxime complexesInfo
- Publication number
- CA1284649C CA1284649C CA000578324A CA578324A CA1284649C CA 1284649 C CA1284649 C CA 1284649C CA 000578324 A CA000578324 A CA 000578324A CA 578324 A CA578324 A CA 578324A CA 1284649 C CA1284649 C CA 1284649C
- Authority
- CA
- Canada
- Prior art keywords
- boronic acid
- alkyl
- accordance
- acid adduct
- dioxime
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 229910052702 rhenium Inorganic materials 0.000 title claims abstract description 17
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 title claims abstract description 16
- 230000002285 radioactive effect Effects 0.000 title claims abstract description 7
- 150000001642 boronic acid derivatives Chemical class 0.000 title abstract description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 23
- 150000001875 compounds Chemical class 0.000 claims abstract description 21
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 17
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 17
- 125000003118 aryl group Chemical group 0.000 claims abstract description 14
- 239000001257 hydrogen Substances 0.000 claims abstract description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 11
- 150000001450 anions Chemical group 0.000 claims abstract description 10
- 150000003839 salts Chemical class 0.000 claims abstract description 10
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 8
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 7
- 150000001638 boron Chemical class 0.000 claims abstract description 7
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 5
- 150000002367 halogens Chemical group 0.000 claims abstract description 5
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 4
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims abstract description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 4
- 125000004181 carboxyalkyl group Chemical group 0.000 claims abstract description 4
- 125000000392 cycloalkenyl group Chemical group 0.000 claims abstract description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 4
- 239000001301 oxygen Substances 0.000 claims abstract description 4
- 125000005082 alkoxyalkenyl group Chemical group 0.000 claims abstract description 3
- 125000005019 carboxyalkenyl group Chemical group 0.000 claims abstract description 3
- 125000000262 haloalkenyl group Chemical group 0.000 claims abstract description 3
- 125000005020 hydroxyalkenyl group Chemical group 0.000 claims abstract description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims abstract description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract 6
- CUNNCKOPAWXYDX-KQQUZDAGSA-N (NE)-N-[(2E)-2-hydroxyiminocyclohexylidene]hydroxylamine Chemical group O\N=C1/CCCC/C/1=N\O CUNNCKOPAWXYDX-KQQUZDAGSA-N 0.000 claims description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 16
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 claims description 14
- RKLSGKOUKYOIRM-UHFFFAOYSA-N butylboron Chemical compound [B]CCCC RKLSGKOUKYOIRM-UHFFFAOYSA-N 0.000 claims description 7
- JGUQDUKBUKFFRO-CIIODKQPSA-N dimethylglyoxime Chemical group O/N=C(/C)\C(\C)=N\O JGUQDUKBUKFFRO-CIIODKQPSA-N 0.000 claims description 6
- PLFLRQISROSEIJ-UHFFFAOYSA-N methylborane Chemical compound CB PLFLRQISROSEIJ-UHFFFAOYSA-N 0.000 claims description 3
- LJHFIVQEAFAURQ-ZPUQHVIOSA-N (NE)-N-[(2E)-2-hydroxyiminoethylidene]hydroxylamine Chemical compound O\N=C\C=N\O LJHFIVQEAFAURQ-ZPUQHVIOSA-N 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- XPPWLXNXHSNMKC-UHFFFAOYSA-N phenylboron Chemical compound [B]C1=CC=CC=C1 XPPWLXNXHSNMKC-UHFFFAOYSA-N 0.000 claims description 2
- RBOZTFPIXJBLPK-DSOJMZEYSA-N (NZ)-N-[(2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethylidene]hydroxylamine Chemical group O\N=C(\C(=N/O)\C1=CC=CO1)/C1=CC=CO1 RBOZTFPIXJBLPK-DSOJMZEYSA-N 0.000 claims 2
- 150000001805 chlorine compounds Chemical group 0.000 claims 2
- LJHFIVQEAFAURQ-UHFFFAOYSA-N glyoxime Chemical group ON=CC=NO LJHFIVQEAFAURQ-UHFFFAOYSA-N 0.000 claims 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical group [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims 1
- OYVWGNWQQULBOK-UHFFFAOYSA-N N-(2-hydroxyimino-3-methylcyclopentylidene)hydroxylamine Chemical group CC1CCC(=NO)C1=NO OYVWGNWQQULBOK-UHFFFAOYSA-N 0.000 claims 1
- ZTBIQJONGXVDJZ-UHFFFAOYSA-N N-(2-hydroxyiminocyclopentylidene)hydroxylamine Chemical group ON=C1CCCC1=NO ZTBIQJONGXVDJZ-UHFFFAOYSA-N 0.000 claims 1
- 238000002372 labelling Methods 0.000 abstract description 3
- 238000001959 radiotherapy Methods 0.000 abstract description 3
- 239000003795 chemical substances by application Substances 0.000 abstract description 2
- 239000000243 solution Substances 0.000 description 29
- 239000007787 solid Substances 0.000 description 27
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- 238000003756 stirring Methods 0.000 description 10
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- QPKFVRWIISEVCW-UHFFFAOYSA-N 1-butane boronic acid Chemical compound CCCCB(O)O QPKFVRWIISEVCW-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- -1 amino, hydroxy Chemical group 0.000 description 5
- 239000003638 chemical reducing agent Substances 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 4
- 229910008066 SnC12 Inorganic materials 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000008139 complexing agent Substances 0.000 description 4
- 230000001143 conditioned effect Effects 0.000 description 4
- 150000002431 hydrogen Chemical group 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 238000002390 rotary evaporation Methods 0.000 description 4
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 3
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 206010028980 Neoplasm Diseases 0.000 description 3
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229960001484 edetic acid Drugs 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- KTMKRRPZPWUYKK-UHFFFAOYSA-N methylboronic acid Chemical compound CB(O)O KTMKRRPZPWUYKK-UHFFFAOYSA-N 0.000 description 3
- 229960003330 pentetic acid Drugs 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000001119 stannous chloride Substances 0.000 description 3
- 235000011150 stannous chloride Nutrition 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229910019599 ReO2 Inorganic materials 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000004327 boric acid Substances 0.000 description 2
- 201000011510 cancer Diseases 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 230000000536 complexating effect Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 1
- GEZAUFNYMZVOFV-UHFFFAOYSA-J 2-[(2-oxo-1,3,2$l^{5},4$l^{2}-dioxaphosphastannetan-2-yl)oxy]-1,3,2$l^{5},4$l^{2}-dioxaphosphastannetane 2-oxide Chemical compound [Sn+2].[Sn+2].[O-]P([O-])(=O)OP([O-])([O-])=O GEZAUFNYMZVOFV-UHFFFAOYSA-J 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical group [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920000858 Cyclodextrin Polymers 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 101150024701 PPH3 gene Proteins 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 125000005620 boronic acid group Chemical group 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000000875 corresponding effect Effects 0.000 description 1
- 239000000287 crude extract Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 229940011871 estrogen Drugs 0.000 description 1
- 239000000262 estrogen Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001810 isothiocyanato group Chemical group *N=C=S 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 230000003439 radiotherapeutic effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 150000003282 rhenium compounds Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- ANOBYBYXJXCGBS-UHFFFAOYSA-L stannous fluoride Chemical compound F[Sn]F ANOBYBYXJXCGBS-UHFFFAOYSA-L 0.000 description 1
- 229960002799 stannous fluoride Drugs 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 230000008685 targeting Effects 0.000 description 1
- 125000000858 thiocyanato group Chemical group *SC#N 0.000 description 1
- IUTCEZPPWBHGIX-UHFFFAOYSA-N tin(2+) Chemical compound [Sn+2] IUTCEZPPWBHGIX-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F13/00—Compounds containing elements of Groups 7 or 17 of the Periodic Table
- C07F13/005—Compounds without a metal-carbon linkage
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/107,209 US4871836A (en) | 1987-10-13 | 1987-10-13 | Boronic acid adducts of rhenium and radioactive isotopes of rhenium dioxime complexes |
| US107,209 | 1987-10-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1284649C true CA1284649C (en) | 1991-06-04 |
Family
ID=22315440
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000578324A Expired - Lifetime CA1284649C (en) | 1987-10-13 | 1988-09-23 | Boronic acid adducts of rhenium and radioactive isotopes of rheniumdioxime complexes |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4871836A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0311891B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPH01132594A (cg-RX-API-DMAC7.html) |
| AT (1) | ATE80888T1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU616207B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1284649C (cg-RX-API-DMAC7.html) |
| DE (1) | DE3874852T2 (cg-RX-API-DMAC7.html) |
| DK (1) | DK568788A (cg-RX-API-DMAC7.html) |
| ES (1) | ES2035205T3 (cg-RX-API-DMAC7.html) |
| GR (1) | GR3006633T3 (cg-RX-API-DMAC7.html) |
| NZ (1) | NZ226255A (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA887113B (cg-RX-API-DMAC7.html) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5118797A (en) * | 1989-08-28 | 1992-06-02 | E. R. Squibb & Sons, Inc. | Rhenium tris dioxime complexes |
| US5069900A (en) * | 1989-08-28 | 1991-12-03 | E. R. Squibb & Sons, Inc. | Boronic acid adducts of technetium-99m dioxime-imine complexes |
| CA2034042C (en) | 1990-01-18 | 1999-08-17 | Adrian D. Nunn | Boronic acid adducts of rhenium dioxime and technetium-99m dioxime complexes containing a biochemically active group |
| US5183653A (en) * | 1990-04-13 | 1993-02-02 | E. R. Squibb & Sons, Inc. | Boronic acid adducts of metal dioxime complexes useful in labelling proteins and other amine-containing compounds |
| US5808091A (en) * | 1991-10-29 | 1998-09-15 | Bracco International B.V. | Rhenium and technetium complexes containing a hypoxia localizing moiety |
| US5300280A (en) * | 1992-02-14 | 1994-04-05 | Mallinckrodt Medical, Inc. | Stabilized radiopharmaceutical kits |
| US5508020A (en) * | 1992-06-05 | 1996-04-16 | Diatech, Inc. | Technetium-99M labeled peptides for imaging |
| US5608110A (en) * | 1993-06-15 | 1997-03-04 | Bracco International B.V. | Heteroatom-bearing ligands and metal complexes thereof |
| ATE164833T1 (de) | 1994-01-12 | 1998-04-15 | Bracco Int Bv | Liganden und deren metallkomplexe |
| IT1289660B1 (it) * | 1996-10-03 | 1998-10-16 | Sorin Biomedica Diagnost Spa | Procedimento per la riduzione di composti ossigenati del renio o del tecnezio |
| US6056941A (en) * | 1999-07-28 | 2000-05-02 | Bracco Research Usa | Kit for the preparation of technetium TC 99m teboroxime myocardial perfusion agent |
| US7026415B2 (en) * | 2004-02-17 | 2006-04-11 | Equistar Chemicals, Lp | Clathrochelates as olefin polymerization catalyst components |
| WO2008059489A2 (en) | 2006-11-13 | 2008-05-22 | Spectrum Dynamics Llc | Radioimaging applications of and novel formulations of teboroxime |
| JP4843417B2 (ja) * | 2006-08-31 | 2011-12-21 | Juki株式会社 | ボトルホルダ |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4387087A (en) * | 1980-04-18 | 1983-06-07 | Research Corporation | Cationic lipophilic complexes of 99m Tc and their use for myocardial and hepatobiliary imaging |
| US4434151A (en) * | 1982-11-08 | 1984-02-28 | Medi-Physics, Inc. | Bifunctional chelating agents |
| US4615876A (en) * | 1983-04-25 | 1986-10-07 | Curators Of The University Of Missouri | Macrocyclic complexes of technetium-99m for use as diagnostic radionuclides |
| US4647445A (en) * | 1984-03-28 | 1987-03-03 | Massachusetts Institute Of Technology | Radiolabelled lipoproteins and method for making same |
| US4652440A (en) * | 1984-05-03 | 1987-03-24 | Paik Chang H | Method of stably radiolabeling antibodies with technetium and rhenium |
| CA1260827A (en) * | 1984-08-31 | 1989-09-26 | Richard C. Siegel | Antibody-metal ion complexes |
| US4659839A (en) * | 1984-10-10 | 1987-04-21 | Mallinckrodt, Inc. | Coupling agents for radiolabeled antibody fragments |
| US4707544A (en) * | 1984-11-28 | 1987-11-17 | President And Fellows Of Harvard College | Metal-isonitrile adducts for preparing radionuclide complexes for labelling and imaging agents |
| US4705849A (en) * | 1985-04-15 | 1987-11-10 | E. R. Squibb & Sons, Inc. | Boronic acid adducts of technetium-99m dioxime complexes |
| US4680338A (en) * | 1985-10-17 | 1987-07-14 | Immunomedics, Inc. | Bifunctional linker |
| US4714605A (en) * | 1986-10-14 | 1987-12-22 | E. R. Squibb & Sons, Inc. | Technetium-99m labeled dioxime complexes |
-
1987
- 1987-10-13 US US07/107,209 patent/US4871836A/en not_active Expired - Lifetime
-
1988
- 1988-09-20 NZ NZ226255A patent/NZ226255A/en unknown
- 1988-09-22 ZA ZA887113A patent/ZA887113B/xx unknown
- 1988-09-23 CA CA000578324A patent/CA1284649C/en not_active Expired - Lifetime
- 1988-09-28 AU AU22889/88A patent/AU616207B2/en not_active Ceased
- 1988-10-06 DE DE8888116515T patent/DE3874852T2/de not_active Expired - Fee Related
- 1988-10-06 AT AT88116515T patent/ATE80888T1/de active
- 1988-10-06 ES ES198888116515T patent/ES2035205T3/es not_active Expired - Lifetime
- 1988-10-06 EP EP88116515A patent/EP0311891B1/en not_active Expired - Lifetime
- 1988-10-12 DK DK568788A patent/DK568788A/da not_active Application Discontinuation
- 1988-10-13 JP JP63260351A patent/JPH01132594A/ja active Pending
-
1992
- 1992-12-22 GR GR920403079T patent/GR3006633T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES2035205T3 (es) | 1993-04-16 |
| EP0311891B1 (en) | 1992-09-23 |
| DE3874852T2 (de) | 1993-04-15 |
| NZ226255A (en) | 1990-09-26 |
| DK568788D0 (da) | 1988-10-12 |
| DK568788A (da) | 1989-04-14 |
| GR3006633T3 (cg-RX-API-DMAC7.html) | 1993-06-30 |
| US4871836A (en) | 1989-10-03 |
| ZA887113B (en) | 1989-05-30 |
| AU616207B2 (en) | 1991-10-24 |
| DE3874852D1 (de) | 1992-10-29 |
| JPH01132594A (ja) | 1989-05-25 |
| EP0311891A1 (en) | 1989-04-19 |
| AU2288988A (en) | 1989-04-13 |
| ATE80888T1 (de) | 1992-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1284649C (en) | Boronic acid adducts of rhenium and radioactive isotopes of rheniumdioxime complexes | |
| US5387409A (en) | Boronic acid adducts of rhenium dioxime and technetium-99m dioxime complexes containing a biochemically active group | |
| JP4357597B2 (ja) | fac型金属トリカルボニル化合物の調製方法および生物活性基質の標識化におけるその使用 | |
| Wang et al. | Reactivity of 2-pyridine–aldehyde and 2-acetyl–pyridine coordinated to [Re (CO) 3]+ with alcohols and amines: metal mediated Schiff base formation and dimerization | |
| CA2022575A1 (en) | Rhenium tris dioxime complexes | |
| US5183653A (en) | Boronic acid adducts of metal dioxime complexes useful in labelling proteins and other amine-containing compounds | |
| RU2026300C1 (ru) | Способ получения комплексов переходных металлов | |
| US4705849A (en) | Boronic acid adducts of technetium-99m dioxime complexes | |
| Linder et al. | Neutral, seven-coordinate dioxime complexes of technetium (III): synthesis and characterization | |
| EP0426759A1 (en) | NEW Tc-99m COMPLEXES. | |
| IL148971A (en) | Carbon monoxide source for preparation of transition-metal-carbonyl-complexes | |
| Maresca et al. | Cationic complexes of the ‘3+ 1’oxorhenium–thiolate family | |
| HU209459B (en) | New process for preparing of metal-complex with fuctionalized isothiocyanato-group | |
| FI85859C (fi) | Foerfarande foer framstaellning av radionuklidkomplex av metall/isonitriladdukter. | |
| US5589576A (en) | Cores for technetium radiopharmaceuticals | |
| Francesconi et al. | Synthesis, characterization and solid state structure of a neutral gallium (III) amino thiolate complex: a potential radiopharmaceutical for PET imaging | |
| Moura et al. | Rhenium (v) oxocomplexes with novel pyrazolyl-based N 4-and N 3 S-donor chelators | |
| US5069900A (en) | Boronic acid adducts of technetium-99m dioxime-imine complexes | |
| US6515112B2 (en) | Cores for technetium radiopharmaceuticals | |
| Le Gal et al. | Synthesis and structural characterization of new oxorhenium and oxotechnetium complexes with XN 2 S-tetradentate semi-rigid ligands (X= O, S, N) | |
| Mohr et al. | Solid-state phosphorus-31 NMR and structural studies on copper (I) complexes of tetradentate-N2P2 ligands | |
| CN101775038A (zh) | 一种标记环芬尼类衍生物及其参照化合物和中间体、及制备方法和应用 | |
| WO2023183813A2 (en) | Boron-capped clathrochelate and macrocyclic ligands and metal complexes thereof | |
| Mutalib et al. | Synthesis and Characterization of Bis (β-diketonato) nitridotechnetium (V) Complexes | |
| NZ247699A (en) | Boronic acid derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed | ||
| MKLA | Lapsed |
Effective date: 19951204 |