CA1276942C - Process for producing n-acyl-acyloxy aromatic amines - Google Patents
Process for producing n-acyl-acyloxy aromatic aminesInfo
- Publication number
- CA1276942C CA1276942C CA000503471A CA503471A CA1276942C CA 1276942 C CA1276942 C CA 1276942C CA 000503471 A CA000503471 A CA 000503471A CA 503471 A CA503471 A CA 503471A CA 1276942 C CA1276942 C CA 1276942C
- Authority
- CA
- Canada
- Prior art keywords
- aromatic
- acyl
- acid
- hydroxy
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000000034 method Methods 0.000 title claims abstract description 20
- TXFPEBPIARQUIG-UHFFFAOYSA-N 4'-hydroxyacetophenone Chemical compound CC(=O)C1=CC=C(O)C=C1 TXFPEBPIARQUIG-UHFFFAOYSA-N 0.000 claims abstract description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims abstract description 20
- -1 hydroxy aromatic ketones Chemical class 0.000 claims abstract description 15
- UJAOSPFULOFZRR-UHFFFAOYSA-N (4-acetamidophenyl) acetate Chemical compound CC(=O)NC1=CC=C(OC(C)=O)C=C1 UJAOSPFULOFZRR-UHFFFAOYSA-N 0.000 claims abstract description 13
- 229940073735 4-hydroxy acetophenone Drugs 0.000 claims abstract description 11
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229940049953 phenylacetate Drugs 0.000 claims abstract description 7
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 claims abstract description 7
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims abstract description 6
- 150000002989 phenols Chemical class 0.000 claims abstract 4
- 239000003795 chemical substances by application Substances 0.000 claims abstract 3
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 claims description 21
- 239000003054 catalyst Substances 0.000 claims description 17
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 15
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 8
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical group CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 6
- 238000005618 Fries rearrangement reaction Methods 0.000 claims description 4
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 claims description 4
- 235000006408 oxalic acid Nutrition 0.000 claims description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical group F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 claims description 3
- 238000005727 Friedel-Crafts reaction Methods 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 229910000040 hydrogen fluoride Inorganic materials 0.000 claims description 3
- 150000002443 hydroxylamines Chemical class 0.000 claims description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 230000003197 catalytic effect Effects 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 150000002576 ketones Chemical class 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- JXEHBRQVIPIGRN-UHFFFAOYSA-N 2-hydroxyimino-2-phenylethanol Chemical compound OCC(=NO)C1=CC=CC=C1 JXEHBRQVIPIGRN-UHFFFAOYSA-N 0.000 claims 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 claims 1
- 150000008064 anhydrides Chemical class 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 150000004982 aromatic amines Chemical class 0.000 abstract description 3
- HBGGXOJOCNVPFY-UHFFFAOYSA-N diisononyl phthalate Chemical compound CC(C)CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC(C)C HBGGXOJOCNVPFY-UHFFFAOYSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 description 19
- 208000029618 autoimmune pulmonary alveolar proteinosis Diseases 0.000 description 7
- 238000006640 acetylation reaction Methods 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 5
- 230000021736 acetylation Effects 0.000 description 5
- 235000011007 phosphoric acid Nutrition 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 4
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- 239000012345 acetylating agent Substances 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 230000008707 rearrangement Effects 0.000 description 4
- 101150034533 ATIC gene Proteins 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- ODKSFYDXXFIFQN-UHFFFAOYSA-N Arginine Chemical compound OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 3
- 238000006237 Beckmann rearrangement reaction Methods 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- GHPYJLCQYMAXGG-WCCKRBBISA-N (2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid hydrochloride Chemical compound Cl.N[C@@H](CSCCB(O)O)C(O)=O GHPYJLCQYMAXGG-WCCKRBBISA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 101000620880 Homo sapiens Tartrate-resistant acid phosphatase type 5 Proteins 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 101000730535 Morganella morganii Major phosphate-irrepressible acid phosphatase Proteins 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 102100022919 Tartrate-resistant acid phosphatase type 5 Human genes 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 229960001413 acetanilide Drugs 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 101100355584 Mus musculus Rad51 gene Proteins 0.000 description 1
- 101100412856 Mus musculus Rhod gene Proteins 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- 229920000557 Nafion® Polymers 0.000 description 1
- 101100109871 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) aro-8 gene Proteins 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- UCTLHLZWKJIXJI-LXIBVNSESA-N [(3s,8r,9s,10r,13s,14s)-17-chloro-16-formyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1h-cyclopenta[a]phenanthren-3-yl] acetate Chemical compound C([C@@H]12)C[C@]3(C)C(Cl)=C(C=O)C[C@H]3[C@@H]1CC=C1[C@]2(C)CC[C@H](OC(=O)C)C1 UCTLHLZWKJIXJI-LXIBVNSESA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229940037003 alum Drugs 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- JJCFRYNCJDLXIK-UHFFFAOYSA-N cyproheptadine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JJCFRYNCJDLXIK-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 150000002085 enols Chemical class 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- ATADHKWKHYVBTJ-UHFFFAOYSA-N hydron;4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;chloride Chemical compound Cl.CNCC(O)C1=CC=C(O)C(O)=C1 ATADHKWKHYVBTJ-UHFFFAOYSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940099990 ogen Drugs 0.000 description 1
- HVFSJXUIRWUHRG-UHFFFAOYSA-N oic acid Natural products C1CC2C3CC=C4CC(OC5C(C(O)C(O)C(CO)O5)O)CC(O)C4(C)C3CCC2(C)C1C(C)C(O)CC(C)=C(C)C(=O)OC1OC(COC(C)=O)C(O)C(O)C1OC(C(C1O)O)OC(COC(C)=O)C1OC1OC(CO)C(O)C(O)C1O HVFSJXUIRWUHRG-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/16—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/710,787 US4665216A (en) | 1985-03-12 | 1985-03-12 | Process for producing n-acyl-acyloxy aromatic amines |
| US710,787 | 1985-03-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1276942C true CA1276942C (en) | 1990-11-27 |
Family
ID=24855532
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000503471A Expired - Fee Related CA1276942C (en) | 1985-03-12 | 1986-03-06 | Process for producing n-acyl-acyloxy aromatic amines |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4665216A (enExample) |
| EP (1) | EP0194849B1 (enExample) |
| JP (1) | JPS61218564A (enExample) |
| AT (1) | ATE57178T1 (enExample) |
| CA (1) | CA1276942C (enExample) |
| DE (1) | DE3674606D1 (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1313678C (en) * | 1988-01-28 | 1993-02-16 | Hoechst Celanese Corporation | Process for producing an aqueous 4-hydroxyacetophenone (4-hap) which is stable at room temperature |
| US5155273A (en) * | 1988-07-12 | 1992-10-13 | Hoechst Celanese Corporation | Production of acetaminophen |
| US5214194A (en) * | 1991-09-24 | 1993-05-25 | Eastman Kodak Company | Coupler intermediates and their formation |
| JP4615881B2 (ja) * | 2004-03-15 | 2011-01-19 | イハラケミカル工業株式会社 | アニリン化合物の製造方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2650933A (en) * | 1952-03-08 | 1953-09-01 | Paper Chemistry Inst | Higher alkyl 4-hydroxy-3-ethoxybenzoate and process for making same |
| US2833825A (en) * | 1954-03-22 | 1958-05-06 | California Research Corp | Preparation of acylphenols |
| DE2616986A1 (de) * | 1976-04-17 | 1977-10-27 | Bayer Ag | Verfahren zur herstellung von hydroxyketonen |
| US4507248A (en) * | 1982-11-01 | 1985-03-26 | Allied Corporation | Preparation from hydroxylammonium sulfate of oximes and hydroxamic acids via alcoholic hydroxylamine solution |
| AU4195185A (en) * | 1984-06-04 | 1985-12-12 | Celanese Corporation | Producing n-acyl-hydroxy and n-acyl acyloxy aromatic amines |
| US4568763A (en) * | 1984-07-03 | 1986-02-04 | Celanese Corporation | Process for producing N-acyl-acyloxy aromatic amines |
| US4560789A (en) * | 1984-07-03 | 1985-12-24 | Celanese Corporation | Process for producing 4-acetoxyacetanilide |
-
1985
- 1985-03-12 US US06/710,787 patent/US4665216A/en not_active Expired - Fee Related
-
1986
- 1986-03-06 CA CA000503471A patent/CA1276942C/en not_active Expired - Fee Related
- 1986-03-10 JP JP61050719A patent/JPS61218564A/ja active Granted
- 1986-03-11 AT AT86301726T patent/ATE57178T1/de active
- 1986-03-11 EP EP86301726A patent/EP0194849B1/en not_active Expired - Lifetime
- 1986-03-11 DE DE8686301726T patent/DE3674606D1/de not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| EP0194849A2 (en) | 1986-09-17 |
| ATE57178T1 (de) | 1990-10-15 |
| JPH0564943B2 (enExample) | 1993-09-16 |
| EP0194849A3 (en) | 1988-01-13 |
| US4665216A (en) | 1987-05-12 |
| EP0194849B1 (en) | 1990-10-03 |
| JPS61218564A (ja) | 1986-09-29 |
| DE3674606D1 (de) | 1990-11-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4524217A (en) | Process for producing N-acyl-hydroxy aromatic amines | |
| US6632955B1 (en) | Optically active nitro alcohol derivatives, optically active amino alcohol derivatives, and process for preparing the same | |
| EP0048037A1 (en) | Optically active 1-alkyl-3-(4-substituted-phenyl)-propylamines | |
| US5212206A (en) | Ion exchange modified with mercapto amines | |
| CA1276942C (en) | Process for producing n-acyl-acyloxy aromatic amines | |
| US4931594A (en) | Method for making aromatic bisphenols | |
| US4568763A (en) | Process for producing N-acyl-acyloxy aromatic amines | |
| FI78455C (fi) | Nytt foerfarande foer framstaellning av d-2-(6-metoxi-2-naftyl)-propionsyra. | |
| US4560789A (en) | Process for producing 4-acetoxyacetanilide | |
| CZ296096B6 (cs) | Zpusob prípravy N,N´-bis[2,3-dihydroxypropyl]-5-[(hydroxyacetyl)methylamino]-2,4,6-trijod-1,3-benzendikarboxylamidu | |
| EP0168908B1 (en) | Process for producing n-acyl-acyloxy aromatic amines | |
| WO1998003460A1 (en) | Process for the preparation of alkyl carboxylates | |
| CN100366604C (zh) | 载有给电子基团的酚类化合物官能化方法 | |
| CN118005485A (zh) | 一种碳同位素标记苯甲醇的制备方法 | |
| JPS60226843A (ja) | エステルの製造方法 | |
| US4415751A (en) | Process for preparing phenylalkanoic acids | |
| US20030109745A1 (en) | Method for producing carboxylic acid benzyl esters | |
| US4578250A (en) | Method for the recovery of palladium | |
| WO2002072516A1 (en) | Method for producing bisphenol a | |
| DE4213870C2 (de) | Bisphenol-Synthese an modifizierten Ionenaustauscherharzen unter Verwendung speziell gereinigter Carbonylverbindungen | |
| CA1039306A (en) | Preparation of optically active allethrolone via allethronyl acid phthalate | |
| US5684186A (en) | Process for production of phenyllactic acid derivative | |
| US4778922A (en) | Process for producing N,O-diacetyl-6-amino-2-naphthol | |
| KR900004399B1 (ko) | N-아실-p-아미노페놀 및 4-아실옥시-N-아실 아닐리드의 제조방법 | |
| IE850679L (en) | Producing n-acyl-hydroxy and n-acyl-acyloxy aromatic amines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed |