CA1256890A - Unsaturated silylethers of arylpinacols as free- radical initiators - Google Patents
Unsaturated silylethers of arylpinacols as free- radical initiatorsInfo
- Publication number
- CA1256890A CA1256890A CA000491260A CA491260A CA1256890A CA 1256890 A CA1256890 A CA 1256890A CA 000491260 A CA000491260 A CA 000491260A CA 491260 A CA491260 A CA 491260A CA 1256890 A CA1256890 A CA 1256890A
- Authority
- CA
- Canada
- Prior art keywords
- radicals
- free
- hydrocarbon radicals
- aryl
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003999 initiator Substances 0.000 title claims abstract description 14
- 150000003254 radicals Chemical class 0.000 title claims description 22
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 title abstract 2
- -1 aryl ketone Chemical class 0.000 claims abstract description 18
- 239000004215 Carbon black (E152) Substances 0.000 claims description 11
- 229930195733 hydrocarbon Natural products 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 5
- 229930195735 unsaturated hydrocarbon Natural products 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229940126214 compound 3 Drugs 0.000 claims 1
- 229940125898 compound 5 Drugs 0.000 claims 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 abstract description 6
- 229910052710 silicon Inorganic materials 0.000 abstract description 6
- 239000011777 magnesium Substances 0.000 abstract description 5
- 229910052749 magnesium Inorganic materials 0.000 abstract description 3
- 238000000034 method Methods 0.000 abstract description 3
- 239000003638 chemical reducing agent Substances 0.000 abstract description 2
- 229910052751 metal Inorganic materials 0.000 abstract description 2
- 239000002184 metal Substances 0.000 abstract description 2
- 239000010703 silicon Substances 0.000 abstract description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 15
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 6
- 239000000178 monomer Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 4
- 238000000921 elemental analysis Methods 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 159000000003 magnesium salts Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- MFEWNFVBWPABCX-UHFFFAOYSA-N 1,1,2,2-tetraphenylethane-1,2-diol Chemical compound C=1C=CC=CC=1C(C(O)(C=1C=CC=CC=1)C=1C=CC=CC=1)(O)C1=CC=CC=C1 MFEWNFVBWPABCX-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 101100219404 Mus musculus Calcrl gene Proteins 0.000 description 2
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- XSDCTSITJJJDPY-UHFFFAOYSA-N chloro-ethenyl-dimethylsilane Chemical compound C[Si](C)(Cl)C=C XSDCTSITJJJDPY-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 235000001055 magnesium Nutrition 0.000 description 2
- 229940091250 magnesium supplement Drugs 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 125000005023 xylyl group Chemical group 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZCHZRIBKBZLMAJ-UHFFFAOYSA-N 2,3-dimethyl-1-silylbutane-2,3-diol Chemical group [SiH3]CC(O)(C)C(C)(C)O ZCHZRIBKBZLMAJ-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 102100038916 Caspase-5 Human genes 0.000 description 1
- 101100112336 Homo sapiens CASP5 gene Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 101100273286 Mus musculus Casp4 gene Proteins 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- YLJJAVFOBDSYAN-UHFFFAOYSA-N dichloro-ethenyl-methylsilane Chemical compound C[Si](Cl)(Cl)C=C YLJJAVFOBDSYAN-UHFFFAOYSA-N 0.000 description 1
- KUGFVFZVBCBQNO-UHFFFAOYSA-N dichloro-methyl-oct-7-enylsilane Chemical compound C[Si](Cl)(Cl)CCCCCCC=C KUGFVFZVBCBQNO-UHFFFAOYSA-N 0.000 description 1
- BUMGIEFFCMBQDG-UHFFFAOYSA-N dichlorosilicon Chemical compound Cl[Si]Cl BUMGIEFFCMBQDG-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- YLQWCDOCJODRMT-UHFFFAOYSA-N fluoren-9-one Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C2=C1 YLQWCDOCJODRMT-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 229910052990 silicon hydride Inorganic materials 0.000 description 1
- 229920005573 silicon-containing polymer Polymers 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000001149 thermolysis Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/18—Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages
- C07F7/1804—Compounds having Si-O-C linkages
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Polymerization Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/667,931 US4535174A (en) | 1984-11-02 | 1984-11-02 | Free-radical initiators and method for making |
| US667,931 | 1984-11-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1256890A true CA1256890A (en) | 1989-07-04 |
Family
ID=24680263
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000491260A Expired CA1256890A (en) | 1984-11-02 | 1985-09-20 | Unsaturated silylethers of arylpinacols as free- radical initiators |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4535174A (en:Method) |
| JP (1) | JPH07644B2 (en:Method) |
| CA (1) | CA1256890A (en:Method) |
| DE (1) | DE3538327A1 (en:Method) |
| FR (1) | FR2572729B1 (en:Method) |
| GB (1) | GB2166444B (en:Method) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4677169A (en) * | 1984-11-02 | 1987-06-30 | General Electric Company | Silicone-organic block polymers and method for making |
| US4675426A (en) * | 1986-06-11 | 1987-06-23 | General Electric Company | Free-radical, initiators, curable compositions, and methods |
| IT1216719B (it) * | 1988-01-28 | 1990-03-08 | Milano | Composizioni termodegradabili abase di omo o copolimeri cristallini del propilene eprocedimento per effettuare la degradazione selettiva di tali omo e copolimeri. |
| US5189191A (en) * | 1989-11-27 | 1993-02-23 | General Electric Company | Free-radical generating aromatic diols, polycarbonates containing thermal labile groups and their conversion to polycarbonate block copolymers |
| JPH0692419B2 (ja) * | 1991-07-16 | 1994-11-16 | 信越化学工業株式会社 | シルエチレンオキサイドの製造方法 |
| MXPA97008152A (es) | 1997-10-23 | 2003-12-11 | Ct De Investigacion En Quimica | Metodo para la preparacion de nanocompositos compuestos de elastomeros dienicos y termoplasticos. |
| WO2012177823A2 (en) * | 2011-06-22 | 2012-12-27 | Elantas Pdg, Inc. | Benzopinacol metalloester polymerization initiator |
| WO2022048951A1 (en) * | 2020-09-04 | 2022-03-10 | Basf Coatings Gmbh | Copolymer derived from substituted benzopinacol and use of the same as polymerization initiator |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1044080B (de) * | 1955-08-17 | 1958-11-20 | Ici Ltd | Verfahren zur Herstellung von (Tetramethylaethylendioxy)-dimethylsilan |
| FR1161094A (fr) * | 1955-08-17 | 1958-08-20 | Ici Ltd | Nouveau silane industriel et sa fabrication |
| US3256308A (en) * | 1962-03-05 | 1966-06-14 | Dow Chemical Co | 2-methyl-1, 3-dioxa-2-sila-cyclohept-5-ene |
| US3337598A (en) * | 1962-03-05 | 1967-08-22 | Dow Chemical Co | 2-methyl-2-phenyl-1, 3-dioxa-2-silacyclohept-5-ene |
| US3433819A (en) * | 1966-09-22 | 1969-03-18 | Du Pont | Hexasubstituted-2-sila-1,3-dioxolanes |
| US3839383A (en) * | 1967-09-08 | 1974-10-01 | Dynamit Nobel Ag | Hydrolysis-resistant unsaturated organic compounds containing hindered alkoxy or aryloxy groups |
| FR2094611A5 (en:Method) * | 1970-06-26 | 1972-02-04 | Aquitaine Petrole | |
| DE2113296A1 (de) * | 1971-03-19 | 1972-09-21 | Bayer Ag | Neue ringfoermige Hydroxylgruppenhaltige Siliciumverbindungen |
| US3931355A (en) * | 1971-12-24 | 1976-01-06 | Bayer Aktiengesellschaft | Radical-initiated polymerization reactions and mixture |
| DE2164482C3 (de) * | 1971-12-24 | 1980-07-31 | Bayer Ag, 5090 Leverkusen | Initiatoren für radikalisch auszulösende Polymerisationsreaktionen |
| NL168232C (nl) * | 1976-07-17 | 1982-03-16 | Bayer Ag | Werkwijze voor het bereiden van hardbare harsmengsels, werkwijze voor het bereiden van daarvoor als initiator geschikte silylethers, alsmede uit deze harsmengsels vervaardigde gevormde voortbrengselen. |
| GB2088398A (en) * | 1980-12-03 | 1982-06-09 | Shell Int Research | 1,2-Bis(trialkylsiloxymethyl)- cyclopropanes and a Method for Preparing 1,2-Bis(trialkylsiloxy- methyl)cyclopropanes |
| DE3151444A1 (de) * | 1981-12-24 | 1983-07-07 | Bayer Ag, 5090 Leverkusen | Neue silylether, verfahren zu ihrer herstellung und ihre verwendung als polymerisationsinitiatoren |
| DE3151442A1 (de) * | 1981-12-24 | 1983-07-07 | Bayer Ag, 5090 Leverkusen | Einbrennlackbindemittel auf basis von polyestern und verfahren zu ihrer herstellung |
-
1984
- 1984-11-02 US US06/667,931 patent/US4535174A/en not_active Expired - Lifetime
-
1985
- 1985-06-05 GB GB08514146A patent/GB2166444B/en not_active Expired
- 1985-09-20 CA CA000491260A patent/CA1256890A/en not_active Expired
- 1985-10-28 DE DE19853538327 patent/DE3538327A1/de active Granted
- 1985-10-29 FR FR858516018A patent/FR2572729B1/fr not_active Expired
- 1985-11-01 JP JP60244269A patent/JPH07644B2/ja not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| GB8514146D0 (en) | 1985-07-10 |
| DE3538327C2 (en:Method) | 1991-10-31 |
| JPH07644B2 (ja) | 1995-01-11 |
| FR2572729A1 (fr) | 1986-05-09 |
| US4535174A (en) | 1985-08-13 |
| DE3538327A1 (de) | 1986-05-15 |
| GB2166444A (en) | 1986-05-08 |
| FR2572729B1 (fr) | 1989-03-31 |
| GB2166444B (en) | 1988-07-27 |
| JPS61120806A (ja) | 1986-06-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3410886A (en) | Si-h to c=c or c=c addition in the presence of a nitrile-platinum (ii) halide complex | |
| US2930809A (en) | Aminoalkylsilicon compounds and process for producing same | |
| EP0176086B1 (en) | Organocyclosiloxane | |
| CA1273348A (en) | Free-radical initiators, curable compositions and methods | |
| US5892084A (en) | Aminoorganofunctionalsiloxanes | |
| US4033991A (en) | Method for preparing organosilanes containing silicon-bonded oxime groups | |
| US4535174A (en) | Free-radical initiators and method for making | |
| DE2020842A1 (de) | Imidosubstituierte Organosilanverbindungen und Verfahren zu ihrer Herstellung | |
| US4131609A (en) | Silicon-phthalocyanine-siloxy monomers | |
| US4294975A (en) | Hydroalkenyloxysilanes | |
| US5874514A (en) | Siloxane unsaturated hydrocarbon based polymers | |
| CA1321598C (en) | Cyclic silethynyl polymers and a method for making them | |
| US3530092A (en) | Process for preparing organosiliconnitrogen compounds | |
| US4126630A (en) | Process for preparing oxime containing silicon compounds | |
| CA1153001A (en) | Hydantoinylsilanes and method for preparing same | |
| US5281736A (en) | Method for the preparation of 1-aza-2-silacyclopentane compounds | |
| US4297499A (en) | Novel disubstituted dichlorosilane and method for producing same | |
| US3642855A (en) | Silyl-containing dithiocarbamates with functional groups on sulfuralkyl ester side chain | |
| EP0392509B1 (en) | 3-(2-Oxo-1-pyrrolidinyl)-propyl-silanes and method for preparing the silane compounds | |
| US5403945A (en) | Cyclotrisiloxane and process for producing the same | |
| US2985680A (en) | Nitro and nitrito derivatives of organosilicon compounds | |
| US5049688A (en) | Allyl cyclosilalactams | |
| Trommer et al. | Generation and investigation of various (alkylamino) phenylsilyllithium species–behaviour in coupling reactions with chlorosilanes | |
| US6087521A (en) | Silicon compounds containing silamethylene bonds and method for their preparation | |
| US5233068A (en) | Organic silicon compounds and method for making |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |