CA1256235A - Moldable fire retardent aromatic polycarbonates - Google Patents
Moldable fire retardent aromatic polycarbonatesInfo
- Publication number
- CA1256235A CA1256235A CA000478677A CA478677A CA1256235A CA 1256235 A CA1256235 A CA 1256235A CA 000478677 A CA000478677 A CA 000478677A CA 478677 A CA478677 A CA 478677A CA 1256235 A CA1256235 A CA 1256235A
- Authority
- CA
- Canada
- Prior art keywords
- compounds
- molding composition
- hydroxyphenyl
- bis
- imide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000003118 aryl group Chemical group 0.000 title claims description 5
- 229920000515 polycarbonate Polymers 0.000 title description 18
- 239000004417 polycarbonate Substances 0.000 title description 18
- 239000000203 mixture Substances 0.000 claims abstract description 33
- -1 imide compound Chemical class 0.000 claims abstract description 29
- 229920005668 polycarbonate resin Polymers 0.000 claims abstract description 15
- 239000004431 polycarbonate resin Substances 0.000 claims abstract description 15
- 238000000465 moulding Methods 0.000 claims abstract description 11
- 238000012360 testing method Methods 0.000 claims abstract description 6
- 238000009757 thermoplastic moulding Methods 0.000 claims abstract 4
- 238000002360 preparation method Methods 0.000 abstract description 14
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 abstract description 4
- 239000003063 flame retardant Substances 0.000 abstract description 4
- 125000002490 anilino group Chemical class [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 150000003021 phthalic acid derivatives Chemical class 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 description 27
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- 239000000460 chlorine Substances 0.000 description 15
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 13
- 229910052801 chlorine Inorganic materials 0.000 description 12
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 11
- 229910052794 bromium Inorganic materials 0.000 description 10
- 150000002367 halogens Chemical group 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 7
- 150000003949 imides Chemical class 0.000 description 7
- 229920001169 thermoplastic Polymers 0.000 description 7
- 239000004416 thermosoftening plastic Substances 0.000 description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- LGRFSURHDFAFJT-UHFFFAOYSA-N phthalic anhydride Chemical compound C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 6
- 239000003340 retarding agent Substances 0.000 description 6
- 150000008065 acid anhydrides Chemical class 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 229920005989 resin Polymers 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000013065 commercial product Substances 0.000 description 4
- 229910001610 cryolite Inorganic materials 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- QHWKHLYUUZGSCW-UHFFFAOYSA-N Tetrabromophthalic anhydride Chemical compound BrC1=C(Br)C(Br)=C2C(=O)OC(=O)C2=C1Br QHWKHLYUUZGSCW-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 150000001448 anilines Chemical class 0.000 description 3
- 125000001246 bromo group Chemical group Br* 0.000 description 3
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000005543 phthalimide group Chemical class 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 3
- 239000004810 polytetrafluoroethylene Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- GVPODVKBTHCGFU-UHFFFAOYSA-N 2,4,6-tribromoaniline Chemical compound NC1=C(Br)C=C(Br)C=C1Br GVPODVKBTHCGFU-UHFFFAOYSA-N 0.000 description 2
- UIAFKZKHHVMJGS-UHFFFAOYSA-N 2,4-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1O UIAFKZKHHVMJGS-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000004809 Teflon Substances 0.000 description 2
- 229920006362 Teflon® Polymers 0.000 description 2
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 2
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 2
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- AUHHYELHRWCWEZ-UHFFFAOYSA-N tetrachlorophthalic anhydride Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)OC(=O)C2=C1Cl AUHHYELHRWCWEZ-UHFFFAOYSA-N 0.000 description 2
- HJIAMFHSAAEUKR-UHFFFAOYSA-N (2-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC=CC=C1C(=O)C1=CC=CC=C1 HJIAMFHSAAEUKR-UHFFFAOYSA-N 0.000 description 1
- GUMCAKKKNKYFEB-UHFFFAOYSA-N 2,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C=C1Cl GUMCAKKKNKYFEB-UHFFFAOYSA-N 0.000 description 1
- MAQOZOILPAMFSW-UHFFFAOYSA-N 2,6-bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CC=2C(=C(CC=3C(=CC=C(C)C=3)O)C=C(C)C=2)O)=C1 MAQOZOILPAMFSW-UHFFFAOYSA-N 0.000 description 1
- VXHYVVAUHMGCEX-UHFFFAOYSA-N 2-(2-hydroxyphenoxy)phenol Chemical class OC1=CC=CC=C1OC1=CC=CC=C1O VXHYVVAUHMGCEX-UHFFFAOYSA-N 0.000 description 1
- XSVZEASGNTZBRQ-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfinylphenol Chemical class OC1=CC=CC=C1S(=O)C1=CC=CC=C1O XSVZEASGNTZBRQ-UHFFFAOYSA-N 0.000 description 1
- QUWAJPZDCZDTJS-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfonylphenol Chemical class OC1=CC=CC=C1S(=O)(=O)C1=CC=CC=C1O QUWAJPZDCZDTJS-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical compound C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- CJIXPPFHQMBRLQ-UHFFFAOYSA-N 4,5,6,7-tetrabromo-2-(2,6-diethylphenyl)isoindole-1,3-dione Chemical compound CCC1=CC=CC(CC)=C1N1C(=O)C(C(Br)=C(Br)C(Br)=C2Br)=C2C1=O CJIXPPFHQMBRLQ-UHFFFAOYSA-N 0.000 description 1
- DYIZJUDNMOIZQO-UHFFFAOYSA-N 4,5,6,7-tetrabromo-2-[2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)ethyl]isoindole-1,3-dione Chemical compound O=C1C(C(=C(Br)C(Br)=C2Br)Br)=C2C(=O)N1CCN1C(=O)C2=C(Br)C(Br)=C(Br)C(Br)=C2C1=O DYIZJUDNMOIZQO-UHFFFAOYSA-N 0.000 description 1
- RMERDSANZTVURS-UHFFFAOYSA-N 4,5,6,7-tetrachloro-2-(2,6-diethylphenyl)isoindole-1,3-dione Chemical compound CCC1=CC=CC(CC)=C1N1C(=O)C(C(Cl)=C(Cl)C(Cl)=C2Cl)=C2C1=O RMERDSANZTVURS-UHFFFAOYSA-N 0.000 description 1
- OHCSZUQRNNNMRG-UHFFFAOYSA-N 4,5,6,7-tetrachloro-2-methylisoindole-1,3-dione Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C2=C1C(=O)N(C)C2=O OHCSZUQRNNNMRG-UHFFFAOYSA-N 0.000 description 1
- LPUUYZVKCMCHLO-UHFFFAOYSA-N 4,5,6,7-tetrachloroisoindole-1,3-dione Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)NC(=O)C2=C1Cl LPUUYZVKCMCHLO-UHFFFAOYSA-N 0.000 description 1
- XJGTVJRTDRARGO-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)propan-2-yl]benzene-1,3-diol Chemical compound C=1C=C(O)C=C(O)C=1C(C)(C)C1=CC=C(O)C=C1 XJGTVJRTDRARGO-UHFFFAOYSA-N 0.000 description 1
- XXOBZOBRMJZVDG-UHFFFAOYSA-N 4-[3,4-bis(4-hydroxyphenyl)phenyl]phenol Chemical compound C1=CC(O)=CC=C1C(C=C1C=2C=CC(O)=CC=2)=CC=C1C1=CC=C(O)C=C1 XXOBZOBRMJZVDG-UHFFFAOYSA-N 0.000 description 1
- KUYWTIAWENANED-UHFFFAOYSA-N 4-[4,6-bis(4-hydroxyphenyl)-2,4,6-trimethylheptan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(C)CC(C)(C=1C=CC(O)=CC=1)CC(C)(C)C1=CC=C(O)C=C1 KUYWTIAWENANED-UHFFFAOYSA-N 0.000 description 1
- LIDWAYDGZUAJEG-UHFFFAOYSA-N 4-[bis(4-hydroxyphenyl)-phenylmethyl]phenol Chemical compound C1=CC(O)=CC=C1C(C=1C=CC(O)=CC=1)(C=1C=CC(O)=CC=1)C1=CC=CC=C1 LIDWAYDGZUAJEG-UHFFFAOYSA-N 0.000 description 1
- BOCLKUCIZOXUEY-UHFFFAOYSA-N 4-[tris(4-hydroxyphenyl)methyl]phenol Chemical compound C1=CC(O)=CC=C1C(C=1C=CC(O)=CC=1)(C=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 BOCLKUCIZOXUEY-UHFFFAOYSA-N 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- JPYHHZQJCSQRJY-UHFFFAOYSA-N Phloroglucinol Natural products CCC=CCC=CCC=CCC=CCCCCC(=O)C1=C(O)C=C(O)C=C1O JPYHHZQJCSQRJY-UHFFFAOYSA-N 0.000 description 1
- 229920001074 Tenite Polymers 0.000 description 1
- 102100029290 Transthyretin Human genes 0.000 description 1
- 108050000089 Transthyretin Proteins 0.000 description 1
- 239000012963 UV stabilizer Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M acrylate group Chemical group C(C=C)(=O)[O-] NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000001118 alkylidene group Chemical group 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 229940114055 beta-resorcylic acid Drugs 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- QZXCCPZJCKEPSA-UHFFFAOYSA-N chlorfenac Chemical compound OC(=O)CC1=C(Cl)C=CC(Cl)=C1Cl QZXCCPZJCKEPSA-UHFFFAOYSA-N 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- 150000004045 organic chlorine compounds Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- JGTNAGYHADQMCM-UHFFFAOYSA-N perfluorobutanesulfonic acid Chemical compound OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F JGTNAGYHADQMCM-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 description 1
- 229960001553 phloroglucinol Drugs 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001707 polybutylene terephthalate Polymers 0.000 description 1
- 239000002952 polymeric resin Substances 0.000 description 1
- LVTHXRLARFLXNR-UHFFFAOYSA-M potassium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate Chemical compound [K+].[O-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F LVTHXRLARFLXNR-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- 239000003017 thermal stabilizer Substances 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- STCOOQWBFONSKY-UHFFFAOYSA-N tributyl phosphate Chemical compound CCCCOP(=O)(OCCCC)OCCCC STCOOQWBFONSKY-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3412—Heterocyclic compounds having nitrogen in the ring having one nitrogen atom in the ring
- C08K5/3415—Five-membered rings
- C08K5/3417—Five-membered rings condensed with carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/672,511 US4673699A (en) | 1984-11-19 | 1984-11-19 | Flame retardant molding compositions |
| US672,511 | 1991-03-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1256235A true CA1256235A (en) | 1989-06-20 |
Family
ID=24698858
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000478677A Expired CA1256235A (en) | 1984-11-19 | 1985-04-09 | Moldable fire retardent aromatic polycarbonates |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4673699A (Direct) |
| EP (1) | EP0183107B1 (Direct) |
| JP (1) | JPS61126167A (Direct) |
| CA (1) | CA1256235A (Direct) |
| DE (1) | DE3569120D1 (Direct) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4873277A (en) * | 1986-10-31 | 1989-10-10 | General Electric Company | Aromatic carbonate resin exhibiting improved impact properties |
| DE4119329A1 (de) * | 1991-06-12 | 1992-12-17 | Bayer Ag | Verwendung von kernbromierten phthalsaeurederivaten zur stabilisierung von thermoplastischen polycarbonaten gegen die einwirkung von gammastrahlen |
| HUP0700433A2 (en) * | 2007-06-21 | 2009-03-30 | Avidin Kutato | Compounds influencing development or functioning of cellular vesicular systems particularly lipid droplets, pharmaceutical compositions containing these compounds and use them for treatment of illnesses |
| HUP0700432A2 (en) * | 2007-06-21 | 2009-03-30 | Avicor Kft | Compounds for detecting of lipid droplets, compositions for detecting of lipid droplets and method for visualization of cells or cell components |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3357942A (en) * | 1965-04-05 | 1967-12-12 | Eastman Kodak Co | Fire-retardant polycarbonates |
| US3873567A (en) * | 1968-09-05 | 1975-03-25 | Universal Oil Prod Co | N-substituted polybromoaromatic ortho-dicarboximides |
| US4374220A (en) * | 1968-09-18 | 1983-02-15 | Raychem Corporation | Imide flame retardants and compositions containing them |
| US4581396A (en) * | 1968-09-18 | 1986-04-08 | Raychem Corporation | Flame retardants and compositions containing them |
| GB1273071A (en) * | 1969-03-21 | 1972-05-03 | Hooker Chemical Corp | Fire retardant additive systems |
| AT297333B (de) * | 1969-06-13 | 1972-03-27 | Bayer Ag | Verfahren zur Herstellung von Polycarbonaten mit verminderter Brennbarkeit |
| US3632544A (en) * | 1970-05-07 | 1972-01-04 | Borg Warner | Self-extinguishing polymeric compositions |
| US3836490A (en) * | 1970-10-08 | 1974-09-17 | Bayer Ag | Flameproof polycarbonates containing an alkali metal salt soluble in the polycarbonate melt |
| US3828003A (en) * | 1970-10-26 | 1974-08-06 | Nippon Oils & Fats Co Ltd | Flame resistant polymer compositions |
| US3784509A (en) * | 1971-09-24 | 1974-01-08 | Cities Service Co | Fire retardant compositions |
| DE2265415C2 (de) * | 1971-09-24 | 1985-05-02 | Ethyl Corp., Richmond, Va. | Bis-5,6-dibromonorbornan-2,3-dicarboximide und deren Verwendung |
| DE2149311A1 (de) * | 1971-10-02 | 1973-04-05 | Bayer Ag | Flammwidrige polycarbonate |
| CA986522A (en) * | 1971-10-04 | 1976-03-30 | Ciba-Geigy Ag | Pyromellitic diimides of 3,5-dialkyl-4-hydroxyphenylsubstituted amines |
| US3821162A (en) * | 1971-10-04 | 1974-06-28 | Ciba Geigy Corp | Benzophenone-3,4,3,4-tetracarboxylic acid diimides of 3,5-dialkyl-4- hydroxyphenyl substituted amines |
| US3883476A (en) * | 1971-10-04 | 1975-05-13 | Ciba Geigy Corp | Pyromellitic diimides of 3,5-dialkyl-4-hydroxyphenylsubstituted amines |
| US3734926A (en) * | 1971-10-04 | 1973-05-22 | Ciba Geigy Corp | Benzophenone-3,4,3{40 ,4-tetracarboxylic acid diimides of 3,5-dialkyl-4-hydroxyphenylsubstituted amines |
| BE790385A (fr) * | 1971-11-01 | 1973-02-15 | Gen Electric | Perfectionnements aux compositions thermoplastiques a inflammation retardee, et aux procedes pour leur |
| US4056504A (en) * | 1974-08-16 | 1977-11-01 | Bayer Aktiengesellschaft | Polycarbonate molding compositions |
| US4208489A (en) * | 1977-01-29 | 1980-06-17 | Bayer Aktiengesellschaft | Polycarbonate molding compositions with improved flame-repellency |
| US4115333A (en) * | 1977-03-18 | 1978-09-19 | General Electric Company | Warp-resistant reinforced thermoplastic compositions comprising polyester resins and zinc stearate |
| DE2937877A1 (de) * | 1978-09-29 | 1980-04-17 | Mobay Chemical Corp | Flammwidrigesolycarbonat |
| US4339383A (en) * | 1979-07-11 | 1982-07-13 | Ciba-Geigy Corporation | Imide containing stabilizers for chlorinated thermoplastics |
| US4366276A (en) * | 1980-06-25 | 1982-12-28 | Bayer Aktiengesellschaft | Flame-resistant moulding materials based on thermoplastic aromatic polyesters and polyesters carbonates, a process for their production and their use in the production of moulded bodies |
| DE3203905A1 (de) * | 1982-02-05 | 1983-08-11 | Bayer Ag, 5090 Leverkusen | Polycarbonat-formmassen mit verbesserter flammwidrigkeit |
| CA1249095A (en) * | 1982-08-25 | 1989-01-17 | Giovanni Dozzi | Self-extinguishing polycarbonate composition |
| US4506047A (en) * | 1983-06-06 | 1985-03-19 | Mobay Chemical Corporation | Polycarbonate compositions having improved rigidity |
| DE3334822A1 (de) * | 1983-09-26 | 1985-04-04 | Bayer Ag, 5090 Leverkusen | Neue flammschutzmittel, ihre herstellung und ihre verwendung zur flammfestausruestung von polycarbonaten |
-
1984
- 1984-11-19 US US06/672,511 patent/US4673699A/en not_active Expired - Fee Related
-
1985
- 1985-04-09 CA CA000478677A patent/CA1256235A/en not_active Expired
- 1985-11-08 EP EP85114234A patent/EP0183107B1/en not_active Expired
- 1985-11-08 DE DE8585114234T patent/DE3569120D1/de not_active Expired
- 1985-11-18 JP JP60256826A patent/JPS61126167A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0423660B2 (Direct) | 1992-04-22 |
| DE3569120D1 (en) | 1989-05-03 |
| EP0183107A1 (en) | 1986-06-04 |
| US4673699A (en) | 1987-06-16 |
| JPS61126167A (ja) | 1986-06-13 |
| EP0183107B1 (en) | 1989-03-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100420881B1 (ko) | 저휘발성방향족포스페이트에스테르화합물을함유하는카보네이트중합체수지 | |
| EP0384110B1 (en) | Gamma radiation resistant polycarbonate composition | |
| US4873271A (en) | Gamma radiation rsistant polycarbonate compositions | |
| CA1193082A (en) | Stabilizer compositions, their use for stabilizing thermoplastic polycarbonates and stabilized thermoplastic polycarbonates | |
| US4477637A (en) | Flame retardant alkylated polycarbonate compositions | |
| CA1335221C (en) | Polycarbonate compositions resistant to gamma radiation | |
| EP0375942A2 (en) | Flame retardant carbonate polymer blends | |
| US4578409A (en) | Flame retarding silanes | |
| US4410662A (en) | Polycarbonate having an improved impact performance | |
| CA1256235A (en) | Moldable fire retardent aromatic polycarbonates | |
| EP0717071B1 (en) | Thermally stable, gamma radiation-resistant blend of polycarbonate with polyester | |
| EP0343606B1 (en) | An engineering plastic composition and an article made of the same | |
| EP1313806B1 (en) | A transparent composition containing polycarbonate and a copolymer of methylmethacrylate | |
| CA1089589A (en) | Stabilized polycarbonate compositions | |
| CA1237844A (en) | Polycarbonate compositions having improved rigidity | |
| CA1248113A (en) | Flame retarding agents for polycarbonates | |
| US5124377A (en) | Flame retardant polycarbonate composition having improved impact strength | |
| US4415692A (en) | Stabilized thermoplastic moulding compositions | |
| CA2080331A1 (en) | Polycarbonate compositions resistant to gamma radiation | |
| KR102716326B1 (ko) | 디올 화합물, 폴리카보네이트 및 이의 제조방법 | |
| US4594375A (en) | Bis-(imide-sulfonate) flameproofing agents, their preparation and their use for flameproofing in polycarbonate | |
| US5414046A (en) | Flame retardant polymer compositions comprising thermally stable resins | |
| KR101134015B1 (ko) | 투명성, 난연성 및 내스크래치성이 우수한 폴리카보네이트 수지 조성물 | |
| JPH01266159A (ja) | 帯電防止性熱可塑性樹脂組成物 | |
| US4280952A (en) | Flame retardant polystyrene plastic compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |