CA1238340A - Isomerization of diacyloxybutenes - Google Patents
Isomerization of diacyloxybutenesInfo
- Publication number
- CA1238340A CA1238340A CA000459387A CA459387A CA1238340A CA 1238340 A CA1238340 A CA 1238340A CA 000459387 A CA000459387 A CA 000459387A CA 459387 A CA459387 A CA 459387A CA 1238340 A CA1238340 A CA 1238340A
- Authority
- CA
- Canada
- Prior art keywords
- catalyst
- zeolite
- ene
- diacyloxybut
- hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000006317 isomerization reaction Methods 0.000 title description 5
- 239000003054 catalyst Substances 0.000 claims abstract description 40
- 239000010457 zeolite Substances 0.000 claims abstract description 39
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims abstract description 36
- 229910021536 Zeolite Inorganic materials 0.000 claims abstract description 24
- 238000000034 method Methods 0.000 claims abstract description 16
- 239000001257 hydrogen Substances 0.000 claims abstract description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 9
- 239000012071 phase Substances 0.000 claims abstract description 9
- 239000007789 gas Substances 0.000 claims abstract description 8
- 239000007791 liquid phase Substances 0.000 claims abstract description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 4
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 3
- 229910000323 aluminium silicate Inorganic materials 0.000 claims description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 23
- 238000006243 chemical reaction Methods 0.000 description 12
- 239000000377 silicon dioxide Substances 0.000 description 10
- 235000012239 silicon dioxide Nutrition 0.000 description 10
- 229910052681 coesite Inorganic materials 0.000 description 8
- 229910052906 cristobalite Inorganic materials 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 229910052682 stishovite Inorganic materials 0.000 description 8
- 229910052905 tridymite Inorganic materials 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 5
- 238000000465 moulding Methods 0.000 description 5
- MWWXARALRVYLAE-UHFFFAOYSA-N 2-acetyloxybut-3-enyl acetate Chemical compound CC(=O)OCC(C=C)OC(C)=O MWWXARALRVYLAE-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 4
- -1 hydrogen halides Chemical class 0.000 description 4
- 229910052742 iron Inorganic materials 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 4
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 241000282326 Felis catus Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- VZUAUHWZIKOMFC-ONEGZZNKSA-N [(e)-4-acetyloxybut-2-enyl] acetate Chemical compound CC(=O)OC\C=C\COC(C)=O VZUAUHWZIKOMFC-ONEGZZNKSA-N 0.000 description 3
- VIRPYONDKXQHHU-HWKANZROSA-N [(e)-4-acetyloxybut-3-enyl] acetate Chemical compound CC(=O)OCC\C=C\OC(C)=O VIRPYONDKXQHHU-HWKANZROSA-N 0.000 description 3
- 150000001342 alkaline earth metals Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 229910052733 gallium Inorganic materials 0.000 description 3
- 239000002638 heterogeneous catalyst Substances 0.000 description 3
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-QDNHWIQGSA-N 1,6-dideuteriohexane Chemical compound [2H]CCCCCC[2H] VLKZOEOYAKHREP-QDNHWIQGSA-N 0.000 description 2
- VZUAUHWZIKOMFC-UHFFFAOYSA-N 4-acetyloxybut-2-enyl acetate Chemical compound CC(=O)OCC=CCOC(C)=O VZUAUHWZIKOMFC-UHFFFAOYSA-N 0.000 description 2
- 229910002016 Aerosil® 200 Inorganic materials 0.000 description 2
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- 229920000305 Nylon 6,10 Polymers 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910001593 boehmite Inorganic materials 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 239000000306 component Substances 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- FAHBNUUHRFUEAI-UHFFFAOYSA-M hydroxidooxidoaluminium Chemical compound O[Al]=O FAHBNUUHRFUEAI-UHFFFAOYSA-M 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- VUQLRYUBEINYDQ-UHFFFAOYSA-N (2-acetyloxy-3-methylbut-3-enyl) acetate Chemical compound CC(=O)OC(C(=C)C)COC(C)=O VUQLRYUBEINYDQ-UHFFFAOYSA-N 0.000 description 1
- LJPNEMAMFITRSO-UHFFFAOYSA-N (4-acetyloxy-3-methylbut-2-enyl) acetate Chemical compound CC(=O)OCC=C(C)COC(C)=O LJPNEMAMFITRSO-UHFFFAOYSA-N 0.000 description 1
- ATUOYWHBWRKTHZ-QDNHWIQGSA-N 1,3-dideuteriopropane Chemical compound [2H]CCC[2H] ATUOYWHBWRKTHZ-QDNHWIQGSA-N 0.000 description 1
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 1
- YWFKFOYLQXMASD-UHFFFAOYSA-N 2-formyloxybut-3-enyl formate Chemical compound O=COC(C=C)COC=O YWFKFOYLQXMASD-UHFFFAOYSA-N 0.000 description 1
- HRLBERNMJJQWGK-UHFFFAOYSA-N 4-formyloxybut-2-enyl formate Chemical compound O=COCC=CCOC=O HRLBERNMJJQWGK-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 241000518994 Conta Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 240000000543 Pentas lanceolata Species 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 229940037003 alum Drugs 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 229910021502 aluminium hydroxide Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910000329 aluminium sulfate Inorganic materials 0.000 description 1
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 230000001174 ascending effect Effects 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 150000001639 boron compounds Chemical class 0.000 description 1
- 238000001354 calcination Methods 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000000571 coke Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- DQUIAMCJEJUUJC-UHFFFAOYSA-N dibismuth;dioxido(oxo)silane Chemical compound [Bi+3].[Bi+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O.[O-][Si]([O-])=O DQUIAMCJEJUUJC-UHFFFAOYSA-N 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229910001679 gibbsite Inorganic materials 0.000 description 1
- 239000002815 homogeneous catalyst Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 1
- 238000001027 hydrothermal synthesis Methods 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 150000002910 rare earth metals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 229960000342 retinol acetate Drugs 0.000 description 1
- QGNJRVVDBSJHIZ-QHLGVNSISA-N retinyl acetate Chemical compound CC(=O)OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C QGNJRVVDBSJHIZ-QHLGVNSISA-N 0.000 description 1
- 235000019173 retinyl acetate Nutrition 0.000 description 1
- 239000011770 retinyl acetate Substances 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 150000003377 silicon compounds Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910001388 sodium aluminate Inorganic materials 0.000 description 1
- PCNRQYHSJVEIGH-ASTDGNLGSA-M sodium;5-benzo[e]benzotriazol-2-yl-2-[(e)-2-phenylethenyl]benzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC(N2N=C3C4=CC=CC=C4C=CC3=N2)=CC=C1\C=C\C1=CC=CC=C1 PCNRQYHSJVEIGH-ASTDGNLGSA-M 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003505 terpenes Chemical class 0.000 description 1
- 235000007586 terpenes Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- IAQRGUVFOMOMEM-ONEGZZNKSA-N trans-but-2-ene Chemical compound C\C=C\C IAQRGUVFOMOMEM-ONEGZZNKSA-N 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 229960001124 trientine Drugs 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP3326668.9 | 1983-07-23 | ||
| DE19833326668 DE3326668A1 (de) | 1983-07-23 | 1983-07-23 | Verfahren zur isomerisierung von diacyloxy-butenen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1238340A true CA1238340A (en) | 1988-06-21 |
Family
ID=6204794
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000459387A Expired CA1238340A (en) | 1983-07-23 | 1984-07-20 | Isomerization of diacyloxybutenes |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4806679A (enExample) |
| EP (1) | EP0132737B1 (enExample) |
| JP (1) | JPS6069056A (enExample) |
| CA (1) | CA1238340A (enExample) |
| DE (2) | DE3326668A1 (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10117065A1 (de) * | 2001-04-05 | 2002-10-10 | Basf Ag | Verfahren zur Herstellung von C5-Acetat |
| US8414910B2 (en) | 2006-11-20 | 2013-04-09 | Lutonix, Inc. | Drug releasing coatings for medical devices |
| US20090054717A1 (en) * | 2007-08-21 | 2009-02-26 | The Nippon Synthetic Chemical Industry Co., Ltd. | Method of Producing 3,4-Diacyloxy-1-Butene |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5218172B1 (enExample) * | 1970-07-08 | 1977-05-20 | ||
| JPS5218688B2 (enExample) * | 1974-03-22 | 1977-05-24 | ||
| DE2454768C2 (de) * | 1974-11-19 | 1983-04-28 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Isomerisierung von Butendioldiacetaten |
| DE2736695A1 (de) * | 1977-08-16 | 1979-03-01 | Basf Ag | Verfahren zur isomerisierung von butendioldiacetaten |
| US4182901A (en) * | 1977-10-13 | 1980-01-08 | Phillips Petroleum Company | Diacyloxybutene isomerization with selenium dioxide |
| NL8003396A (nl) * | 1979-06-13 | 1980-12-16 | Japan Synthetic Rubber Co Ltd | Werkwijze voor het isomeriseren van diacetoxybutenen. |
| US4468475A (en) * | 1983-07-11 | 1984-08-28 | Mobil Oil Corporation | Hydrothermal activation of acid zeolites with alumina |
-
1983
- 1983-07-23 DE DE19833326668 patent/DE3326668A1/de not_active Withdrawn
-
1984
- 1984-07-14 DE DE8484108310T patent/DE3468408D1/de not_active Expired
- 1984-07-14 EP EP84108310A patent/EP0132737B1/de not_active Expired
- 1984-07-20 CA CA000459387A patent/CA1238340A/en not_active Expired
- 1984-07-23 US US06/633,279 patent/US4806679A/en not_active Expired - Fee Related
- 1984-07-23 JP JP59151453A patent/JPS6069056A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE3326668A1 (de) | 1985-01-31 |
| EP0132737A2 (de) | 1985-02-13 |
| US4806679A (en) | 1989-02-21 |
| DE3468408D1 (en) | 1988-02-11 |
| JPH0417173B2 (enExample) | 1992-03-25 |
| EP0132737A3 (en) | 1985-11-13 |
| JPS6069056A (ja) | 1985-04-19 |
| EP0132737B1 (de) | 1988-01-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4927979A (en) | Process for the preparation of p-ethylphenol | |
| CA1218677A (en) | Preparation of amines | |
| EP0333078B1 (en) | Method for one-step synthesis of methyl t-butyl ether | |
| US4777322A (en) | Obtaining but-2-enes from C4 -hydrocarbon mixtures which contain but-1-ene and may or may not contain but-2-enes | |
| US4804758A (en) | Preparation of 1,4-diazabicyclo[2.2.2]octanes | |
| US3328467A (en) | Condensation of alkylene oxides | |
| US4788326A (en) | Preparation of 4-pentenoates | |
| US4933487A (en) | Preparation of 4-pentenates | |
| CA1238340A (en) | Isomerization of diacyloxybutenes | |
| CA1230618A (en) | Preparation of dienes by dehydration of aldehydes | |
| US4904812A (en) | Preparation of unsaturated nitriles | |
| JPS61200943A (ja) | ゼオライト触媒によるエステル交換反応 | |
| US4743702A (en) | Preparation of aliphatic dinitriles | |
| US4943667A (en) | Preparation of phenylethanols | |
| JP2582759B2 (ja) | 新規なフェニルアセトアルデヒド | |
| US4904806A (en) | Preparation of tetrahydrofurans from butane-1,4-diols | |
| JPS62167749A (ja) | ニトリルの製法 | |
| US4694107A (en) | Preparation of ketones by isomerization of aldehydes | |
| CA2049908A1 (en) | Process for the preparation of acylbenzenes | |
| US4967013A (en) | Preparation of hydroxybenzaldehydes | |
| US4914241A (en) | Preparation of diamines | |
| US4952742A (en) | Preparation of polyunsaturated hydrocarbons | |
| US4960954A (en) | Preparation of enol ethers | |
| US5002639A (en) | Separation of ortho-, meta- and para-tolunitrile from ternary mixtures of the isomers | |
| US5773660A (en) | Preparation of amines from olefins over hexagonal faujasites |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |