CA1232178A - Detergent compositions - Google Patents
Detergent compositionsInfo
- Publication number
- CA1232178A CA1232178A CA000475004A CA475004A CA1232178A CA 1232178 A CA1232178 A CA 1232178A CA 000475004 A CA000475004 A CA 000475004A CA 475004 A CA475004 A CA 475004A CA 1232178 A CA1232178 A CA 1232178A
- Authority
- CA
- Canada
- Prior art keywords
- weight
- surfactant
- detergent composition
- water
- gel
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 118
- 239000003599 detergent Substances 0.000 title claims abstract description 47
- 239000004094 surface-active agent Substances 0.000 claims abstract description 112
- -1 alkylbenzene sulphonate Chemical class 0.000 claims abstract description 84
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 72
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims abstract description 71
- 239000004202 carbamide Substances 0.000 claims abstract description 71
- 239000000654 additive Substances 0.000 claims abstract description 56
- 230000000996 additive effect Effects 0.000 claims abstract description 50
- 239000000463 material Substances 0.000 claims abstract description 28
- 239000007787 solid Substances 0.000 claims abstract description 19
- 125000000129 anionic group Chemical group 0.000 claims abstract description 13
- 239000003945 anionic surfactant Substances 0.000 claims abstract description 10
- 239000003093 cationic surfactant Substances 0.000 claims abstract description 7
- 230000002209 hydrophobic effect Effects 0.000 claims abstract description 5
- 239000002736 nonionic surfactant Substances 0.000 claims description 21
- 125000001931 aliphatic group Chemical group 0.000 claims description 12
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 12
- 239000000194 fatty acid Substances 0.000 claims description 12
- 229930195729 fatty acid Natural products 0.000 claims description 12
- 239000004327 boric acid Substances 0.000 claims description 11
- 150000004665 fatty acids Chemical class 0.000 claims description 11
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 10
- 239000004615 ingredient Substances 0.000 claims description 10
- 239000004973 liquid crystal related substance Substances 0.000 claims description 10
- 239000000344 soap Substances 0.000 claims description 8
- 150000003839 salts Chemical group 0.000 claims description 7
- 229910019142 PO4 Inorganic materials 0.000 claims description 4
- 230000003139 buffering effect Effects 0.000 claims description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 3
- 239000010452 phosphate Substances 0.000 claims description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 11
- 229910021653 sulphate ion Inorganic materials 0.000 claims 2
- 150000001408 amides Chemical class 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- KVCGISUBCHHTDD-UHFFFAOYSA-M sodium;4-methylbenzenesulfonate Chemical compound [Na+].CC1=CC=C(S([O-])(=O)=O)C=C1 KVCGISUBCHHTDD-UHFFFAOYSA-M 0.000 claims 1
- 239000000499 gel Substances 0.000 abstract description 83
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical compound OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 abstract description 15
- 239000002304 perfume Substances 0.000 abstract description 9
- 238000004851 dishwashing Methods 0.000 abstract description 6
- 238000004040 coloring Methods 0.000 abstract 1
- 235000013877 carbamide Nutrition 0.000 description 68
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 47
- 229920000180 alkyd Polymers 0.000 description 34
- 238000000034 method Methods 0.000 description 30
- 159000000000 sodium salts Chemical class 0.000 description 28
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 25
- 229910052708 sodium Inorganic materials 0.000 description 20
- 239000011734 sodium Substances 0.000 description 20
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical class OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 18
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 18
- 239000000243 solution Substances 0.000 description 18
- 150000002430 hydrocarbons Chemical group 0.000 description 15
- 238000002360 preparation method Methods 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 12
- 239000003792 electrolyte Substances 0.000 description 12
- 229960004418 trolamine Drugs 0.000 description 11
- 150000004996 alkyl benzenes Chemical class 0.000 description 10
- 230000000694 effects Effects 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- 235000010265 sodium sulphite Nutrition 0.000 description 9
- 238000006386 neutralization reaction Methods 0.000 description 8
- 238000010587 phase diagram Methods 0.000 description 8
- 238000005406 washing Methods 0.000 description 8
- 235000013162 Cocos nucifera Nutrition 0.000 description 7
- 244000060011 Cocos nucifera Species 0.000 description 7
- 235000019832 sodium triphosphate Nutrition 0.000 description 7
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 238000005187 foaming Methods 0.000 description 6
- 229920001983 poloxamer Polymers 0.000 description 6
- 235000011121 sodium hydroxide Nutrition 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 239000004744 fabric Substances 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 5
- 239000000872 buffer Substances 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 4
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000002091 cationic group Chemical group 0.000 description 3
- 238000004140 cleaning Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000010586 diagram Methods 0.000 description 3
- ROSDSFDQCJNGOL-UHFFFAOYSA-O dimethylaminium Chemical class C[NH2+]C ROSDSFDQCJNGOL-UHFFFAOYSA-O 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 230000007704 transition Effects 0.000 description 3
- SVTBMSDMJJWYQN-UHFFFAOYSA-N 2-methylpentane-2,4-diol Chemical compound CC(O)CC(C)(C)O SVTBMSDMJJWYQN-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- KBPLFHHGFOOTCA-UHFFFAOYSA-N caprylic alcohol Natural products CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 2
- 230000003750 conditioning effect Effects 0.000 description 2
- 239000004064 cosurfactant Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000007046 ethoxylation reaction Methods 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 239000000395 magnesium oxide Substances 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- 159000000003 magnesium salts Chemical group 0.000 description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 description 2
- 235000019982 sodium hexametaphosphate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 2
- XIWRCSVXKPGGAJ-UHFFFAOYSA-N 1-(5-tert-butyl-2-phenylpyrazol-3-yl)-3-(4-chlorophenyl)urea Chemical compound C=1C=CC=CC=1N1N=C(C(C)(C)C)C=C1NC(=O)NC1=CC=C(Cl)C=C1 XIWRCSVXKPGGAJ-UHFFFAOYSA-N 0.000 description 1
- GJMPSRSMBJLKKB-UHFFFAOYSA-N 3-methylphenylacetic acid Chemical compound CC1=CC=CC(CC(O)=O)=C1 GJMPSRSMBJLKKB-UHFFFAOYSA-N 0.000 description 1
- 229910021532 Calcite Inorganic materials 0.000 description 1
- 229920000298 Cellophane Polymers 0.000 description 1
- 240000002989 Euphorbia neriifolia Species 0.000 description 1
- 241000257303 Hymenoptera Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229920005479 Lucite® Polymers 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- 240000007930 Oxalis acetosella Species 0.000 description 1
- 235000008098 Oxalis acetosella Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000018936 Vitellaria paradoxa Nutrition 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 239000003082 abrasive agent Substances 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 238000005273 aeration Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000005619 boric acid group Chemical group 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- UQMRAFJOBWOFNS-UHFFFAOYSA-N butyl 2-(2,4-dichlorophenoxy)acetate Chemical compound CCCCOC(=O)COC1=CC=C(Cl)C=C1Cl UQMRAFJOBWOFNS-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- WOWHHFRSBJGXCM-UHFFFAOYSA-M cetyltrimethylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+](C)(C)C WOWHHFRSBJGXCM-UHFFFAOYSA-M 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 239000008162 cooking oil Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000002979 fabric softener Substances 0.000 description 1
- 229940051250 hexylene glycol Drugs 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N n-Octanol Natural products CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical class OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N protonated dimethyl amine Natural products CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- 239000013014 purified material Substances 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- WYPBVHPKMJYUEO-NBTZWHCOSA-M sodium;(9z,12z)-octadeca-9,12-dienoate Chemical compound [Na+].CCCCC\C=C/C\C=C/CCCCCCCC([O-])=O WYPBVHPKMJYUEO-NBTZWHCOSA-M 0.000 description 1
- YJWSBMQTQRNKPO-UHFFFAOYSA-M sodium;dodecyl sulfite Chemical compound [Na+].CCCCCCCCCCCCOS([O-])=O YJWSBMQTQRNKPO-UHFFFAOYSA-M 0.000 description 1
- 239000008234 soft water Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000007785 strong electrolyte Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 230000002277 temperature effect Effects 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 229940117957 triethanolamine hydrochloride Drugs 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000004520 water soluble gel Substances 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D9/00—Compositions of detergents based essentially on soap
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0008—Detergent materials or soaps characterised by their shape or physical properties aqueous liquid non soap compositions
- C11D17/0026—Structured liquid compositions, e.g. liquid crystalline phases or network containing non-Newtonian phase
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0008—Detergent materials or soaps characterised by their shape or physical properties aqueous liquid non soap compositions
- C11D17/003—Colloidal solutions, e.g. gels; Thixotropic solutions or pastes
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Crystallography & Structural Chemistry (AREA)
- Dispersion Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB848405266A GB8405266D0 (en) | 1984-02-29 | 1984-02-29 | Detergent compositions |
| GB8405266 | 1984-02-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1232178A true CA1232178A (en) | 1988-02-02 |
Family
ID=10557347
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000475004A Expired CA1232178A (en) | 1984-02-29 | 1985-02-22 | Detergent compositions |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4615819A (enFirst) |
| EP (1) | EP0153857B2 (enFirst) |
| JP (1) | JPS60210700A (enFirst) |
| KR (1) | KR900000898B1 (enFirst) |
| AR (1) | AR240958A1 (enFirst) |
| AT (1) | ATE37392T1 (enFirst) |
| AU (1) | AU559957B2 (enFirst) |
| BR (1) | BR8500872A (enFirst) |
| CA (1) | CA1232178A (enFirst) |
| DE (1) | DE3565120D1 (enFirst) |
| ES (1) | ES8706802A1 (enFirst) |
| GB (1) | GB8405266D0 (enFirst) |
| GR (1) | GR850510B (enFirst) |
| HK (1) | HK24588A (enFirst) |
| IN (2) | IN162412B (enFirst) |
| KE (1) | KE3787A (enFirst) |
| NO (1) | NO850794L (enFirst) |
| PH (1) | PH20387A (enFirst) |
| PT (1) | PT80028B (enFirst) |
| SG (1) | SG102887G (enFirst) |
| TR (1) | TR22431A (enFirst) |
| ZA (1) | ZA851533B (enFirst) |
| ZW (1) | ZW2585A1 (enFirst) |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8504862D0 (en) * | 1985-02-26 | 1985-03-27 | Unilever Plc | Liquid detergent composition |
| CA1276852C (en) * | 1985-06-21 | 1990-11-27 | Francis John Leng | Liquid detergent composition |
| GB8515721D0 (en) * | 1985-06-21 | 1985-07-24 | Unilever Plc | Detergent compositions |
| US4692275A (en) * | 1986-04-23 | 1987-09-08 | Lever Brothers Company | Detergent compositions containing an alkylbenzene sulfonate and alcohol ethoxysulfate surfactant system |
| EP0243927A3 (en) * | 1986-05-01 | 1988-08-17 | Kao Corporation | Liquid detergent composition |
| EP0306493A4 (en) * | 1986-05-14 | 1990-11-28 | Donnelly, Dawn, Elizabeth | Detergent composition |
| JPH0745394B2 (ja) * | 1987-01-28 | 1995-05-17 | 花王株式会社 | 保湿用皮膚化粧料 |
| US5230823A (en) * | 1989-05-22 | 1993-07-27 | The Procter & Gamble Company | Light-duty liquid or gel dishwashing detergent composition containing an alkyl ethoxy carboxylate surfactant |
| MA22118A1 (fr) * | 1990-04-10 | 1991-12-31 | Huntsman Internat Llc Etat De | Composition detergente liquide versable a concentration elevee en tensioactifs |
| GB9021217D0 (en) * | 1990-09-28 | 1990-11-14 | Procter & Gamble | Liquid detergent compositions |
| US5378409A (en) * | 1990-11-16 | 1995-01-03 | The Procter & Gamble Co. | Light duty dishwashing detergent composition containing an alkyl ethoxy carboxylate surfactant and ions |
| CA2055048C (en) * | 1990-11-16 | 1996-05-14 | Kofi Ofosu-Asante | Alkaline light-duty dishwashing detergent composition containing an alkyl ethoxy carboxylate surfactant, magnesium ions, chelator and buffer |
| US5154853A (en) * | 1991-02-19 | 1992-10-13 | University Of South Florida | Unimolecular micelles and method of making the same |
| ES2151483T3 (es) * | 1992-03-17 | 2001-01-01 | Procter & Gamble | Composiciones diluibles y metodo para la limpieza de superficies duras. |
| US5269974A (en) * | 1992-09-01 | 1993-12-14 | The Procter & Gamble Company | Liquid or gel dishwashing detergent composition containing alkyl amphocarboxylic acid and magnesium or calcium ions |
| US5320783A (en) * | 1992-11-04 | 1994-06-14 | The Procter & Gamble Company | Detergent gels containing ethoxylated alkyl sulfate surfactants in hexagonal liquid crystal form |
| WO1994010273A1 (en) * | 1992-11-04 | 1994-05-11 | The Procter & Gamble Company | Detergent gels |
| EP0598335A3 (en) * | 1992-11-13 | 1996-01-10 | Albright & Wilson | New cleaning compositions. |
| WO1994014947A1 (en) * | 1992-12-28 | 1994-07-07 | The Procter & Gamble Company | Clear detergent gels |
| CA2157673C (en) * | 1993-03-30 | 2004-06-15 | James A. Mcdonell | Multi-surface cleaning compositions and method of use |
| PE4995A1 (es) * | 1993-06-30 | 1995-03-01 | Procter & Gamble | Gel detergente que contiene alquilsulfatos etoxilados y sulfonatos secundarios |
| DE69411758T2 (de) * | 1993-12-30 | 1998-11-12 | Ecolab Inc | Verfahren zur herstellung stark alkalischer fester reinigungsmittelzusammensetzungen |
| AU682244B2 (en) * | 1993-12-30 | 1997-09-25 | Ecolab Inc. | Method of making urea-based solid cleaning compositions |
| AU1516795A (en) * | 1993-12-30 | 1995-07-17 | Ecolab Inc. | Method of making non-caustic solid cleaning compositions |
| US6489278B1 (en) * | 1993-12-30 | 2002-12-03 | Ecolab Inc. | Combination of a nonionic silicone surfactant and a nonionic surfactant in a solid block detergent |
| US5547661A (en) * | 1994-02-22 | 1996-08-20 | Helene Curtis, Inc. | Antiperspirant deodorant compositions |
| CA2147674C (en) * | 1994-05-16 | 1999-03-30 | David Robert Zint | Shaped semi-solid or solid dishwashing detergent |
| AU689624B2 (en) * | 1994-07-21 | 1998-04-02 | Minnesota Mining And Manufacturing Company | Concentrated cleaner compositions capable of viscosity increase upon dilution |
| US6673765B1 (en) | 1995-05-15 | 2004-01-06 | Ecolab Inc. | Method of making non-caustic solid cleaning compositions |
| US5792385A (en) * | 1995-05-25 | 1998-08-11 | The Clorox Company | Liquid peracid precursor colloidal dispersions: liquid crystals |
| US5719118A (en) * | 1995-10-30 | 1998-02-17 | Tomah Products, Inc. | Detergent compositions having polyalkoxylated amine foam stabilizers and method for cleaning including stabilized detergent foam |
| US6221822B1 (en) | 1995-10-30 | 2001-04-24 | Tomah Products, Inc. | Detergent compositions having polyalkoxylated amine foam stabilizers |
| US5703028A (en) * | 1996-06-14 | 1997-12-30 | Colgate-Palmolive Co | Liquid crystal detergent compositions based on anionic sulfonate-ether sulfate mixtures |
| EP0907712B2 (en) | 1996-06-28 | 2005-01-26 | The Procter & Gamble Company | Nonaqueous liquid detergent compositions containing bleach precursors |
| US6369021B1 (en) | 1999-05-07 | 2002-04-09 | Ecolab Inc. | Detergent composition and method for removing soil |
| GB2355015A (en) * | 1999-08-02 | 2001-04-11 | Procter & Gamble | Structured liquid detergents with selected perfume fragrance materials |
| FR2810542B1 (fr) * | 2000-06-23 | 2004-02-27 | Oreal | Creme cosmetique moussante |
| FR2829693B1 (fr) * | 2001-09-20 | 2004-02-27 | Oreal | Creme cosmetique moussante |
| US6849589B2 (en) | 2001-10-10 | 2005-02-01 | 3M Innovative Properties Company | Cleaning composition |
| KR100779296B1 (ko) * | 2001-12-12 | 2007-11-27 | 애경산업(주) | 지방족 탄화수소 오일을 함유하는 수중유 마이크로에멀젼타입 세정제 조성물 |
| CN100393862C (zh) * | 2002-04-18 | 2008-06-11 | 狮王株式会社 | 液晶面板用水性液态清洗剂组成物 |
| FR2850976B1 (fr) * | 2003-02-11 | 2005-04-15 | Centre Nat Rech Scient | Cristaux liquides gonfles |
| FR2850977B1 (fr) * | 2003-02-11 | 2005-04-15 | Centre Nat Rech Scient | Milieu reactionnel constitue par un cristal liquide gonfle |
| DE102004056554A1 (de) * | 2004-11-23 | 2006-05-24 | Buck-Chemie Gmbh | Haftendes Sanitärreinigungs- und Beduftungsmittel |
| EP2134825A4 (en) * | 2007-03-13 | 2011-10-19 | Elementis Specialties Inc | BIODEGRADABLE CLEANING COMPOSITIONS |
| JP5489452B2 (ja) * | 2008-12-16 | 2014-05-14 | ライオン株式会社 | 液晶パネル用洗浄剤組成物および液晶パネルの洗浄方法 |
| US8252122B2 (en) | 2009-03-17 | 2012-08-28 | Bbt Bergedorfer Biotechnik Gmbh | Use of an agent that contains carbamide and/or at least a derivative thereof as a cleaning agent |
| EP2770044A1 (en) | 2013-02-20 | 2014-08-27 | Unilever PLC | Lamellar gel with amine oxide |
| EP4450606A3 (en) * | 2015-06-22 | 2025-01-15 | The Procter & Gamble Company | Processes for making liquid detergent compositions comprising a liquid crystalline phase |
| KR20180059650A (ko) * | 2016-11-25 | 2018-06-05 | 삼성전자주식회사 | 세정 조성물, 세정 장치, 및 그를 이용한 반도체 소자의 제조 방법 |
Family Cites Families (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3175977A (en) * | 1965-03-30 | Liquid eetekgent compositions | ||
| BE480713A (enFirst) * | 1947-02-26 | |||
| US2978416A (en) * | 1955-07-14 | 1961-04-04 | Allied Chem | Concentrated aqueous detergent composition |
| FR1236665A (fr) * | 1959-06-12 | 1960-07-22 | Crème détergente | |
| US3174935A (en) * | 1961-06-20 | 1965-03-23 | Monsanto Co | Alkylbenzene sulfonate slurry |
| CH467620A (de) * | 1963-05-03 | 1969-01-31 | Ciba Geigy | Verwendung von Salzen quaternärer, saurer Ammoniumverbindungen als gelartige Verdickungsmittel |
| US3440171A (en) * | 1964-06-29 | 1969-04-22 | Union Carbide Corp | Surface active compositions |
| DE1617744A1 (de) * | 1964-07-24 | 1970-09-10 | Peter Strong & Co Inc | Reinigungsmittel fuer Zahnprothesen |
| US3463736A (en) * | 1966-03-04 | 1969-08-26 | Atlantic Richfield Co | Aqueous slurries of triethanolamine salts of linear alkylbenzene sulfonic acids |
| FR2136913B1 (enFirst) * | 1971-05-07 | 1973-05-11 | Colgate Palmolive Co | |
| JPS506322B1 (enFirst) * | 1971-06-09 | 1975-03-13 | ||
| GB1370377A (en) * | 1971-11-15 | 1974-10-16 | Procter & Gamble Ltd | Composition and method for cleaning hard surfaces |
| ZA732200B (en) * | 1972-05-04 | 1974-11-27 | Colgate Palmolive Co | Softener dispersion |
| BE794274A (fr) * | 1973-01-22 | 1973-05-16 | Colgate Palmolive Co | Fabrication de dentifrice exempt de gaz |
| JPS5154855A (ja) * | 1974-11-08 | 1976-05-14 | Nippon Steel Corp | Renzokuchuzochuhennotategirihoho |
| AU509049B2 (en) * | 1975-08-11 | 1980-04-17 | Colgate-Palmolive Company, The | Laundry detergent in gel form |
| US4257908A (en) * | 1975-08-11 | 1981-03-24 | Colgate Palmolive Company | Laundry detergent in gel form |
| US4328131A (en) * | 1976-12-02 | 1982-05-04 | Colgate-Palmolive Company | Elastic detergent bar of improved elevated temperature stability |
| FR2398797B1 (fr) * | 1977-07-26 | 1981-02-06 | Albright & Wilson | Compositions tensioactives aqueuses concentrees |
| CH642104A5 (de) * | 1979-06-27 | 1984-03-30 | Sandoz Ag | Reinigungsmittel in pastenform. |
| JPS6029758B2 (ja) * | 1979-09-04 | 1985-07-12 | ライオン株式会社 | ゼリ−状洗浄剤組成物 |
| JPS56141400A (en) * | 1980-04-07 | 1981-11-05 | Kao Corp | Liquid detergent composition |
| JPS57162799A (en) * | 1981-03-31 | 1982-10-06 | Fumakilla Ltd | Water-soluble fragrant detergent gel composition |
| JPS58138800A (ja) * | 1982-02-11 | 1983-08-17 | 保科 俊英 | ゼリ−状洗剤及びその製造方法 |
| DE3240403A1 (de) * | 1982-11-02 | 1984-05-03 | Henkel KGaA, 4000 Düsseldorf | Verwendung von niedermolekularen organischen verbindungen als viskositaetsregler fuer hochviskose technische tensid-konzentrate |
| JPS59122600A (ja) * | 1982-12-28 | 1984-07-16 | 保科 俊英 | ゼリ−状洗剤およびその製造方法 |
-
1984
- 1984-02-29 GB GB848405266A patent/GB8405266D0/en active Pending
- 1984-10-03 TR TR6605/84A patent/TR22431A/xx unknown
-
1985
- 1985-02-21 US US06/703,631 patent/US4615819A/en not_active Expired - Fee Related
- 1985-02-22 CA CA000475004A patent/CA1232178A/en not_active Expired
- 1985-02-22 PH PH31904A patent/PH20387A/en unknown
- 1985-02-22 ZW ZW25/85A patent/ZW2585A1/xx unknown
- 1985-02-25 AU AU39120/85A patent/AU559957B2/en not_active Ceased
- 1985-02-25 IN IN53/BOM/85A patent/IN162412B/en unknown
- 1985-02-26 EP EP85301297A patent/EP0153857B2/en not_active Expired - Lifetime
- 1985-02-26 AT AT85301297T patent/ATE37392T1/de active
- 1985-02-26 DE DE8585301297T patent/DE3565120D1/de not_active Expired
- 1985-02-27 KR KR1019850001223A patent/KR900000898B1/ko not_active Expired
- 1985-02-27 BR BR8500872A patent/BR8500872A/pt not_active IP Right Cessation
- 1985-02-27 GR GR850510A patent/GR850510B/el not_active IP Right Cessation
- 1985-02-27 NO NO850794A patent/NO850794L/no unknown
- 1985-02-28 JP JP60040266A patent/JPS60210700A/ja active Granted
- 1985-02-28 PT PT80028A patent/PT80028B/pt not_active IP Right Cessation
- 1985-02-28 ZA ZA851533A patent/ZA851533B/xx unknown
- 1985-02-28 AR AR299635A patent/AR240958A1/es active
- 1985-02-28 ES ES540818A patent/ES8706802A1/es not_active Expired
-
1987
- 1987-11-10 KE KE3787A patent/KE3787A/xx unknown
- 1987-11-25 SG SG1028/87A patent/SG102887G/en unknown
-
1988
- 1988-01-21 IN IN12/BOM/88A patent/IN166996B/en unknown
- 1988-04-07 HK HK245/88A patent/HK24588A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ZW2585A1 (en) | 1985-09-11 |
| AR240958A2 (es) | 1991-03-27 |
| ES540818A0 (es) | 1987-06-16 |
| AR240958A1 (es) | 1991-03-27 |
| US4615819A (en) | 1986-10-07 |
| IN166996B (enFirst) | 1990-08-18 |
| PT80028B (pt) | 1988-02-17 |
| DE3565120D1 (en) | 1988-10-27 |
| ES8706802A1 (es) | 1987-06-16 |
| JPS60210700A (ja) | 1985-10-23 |
| KR850007081A (ko) | 1985-10-30 |
| AU559957B2 (en) | 1987-03-26 |
| HK24588A (en) | 1988-04-15 |
| BR8500872A (pt) | 1985-12-03 |
| EP0153857B1 (en) | 1988-09-21 |
| EP0153857A3 (en) | 1986-05-14 |
| TR22431A (tr) | 1987-06-02 |
| ZA851533B (en) | 1986-10-29 |
| NO850794L (no) | 1985-08-30 |
| IN162412B (enFirst) | 1988-05-21 |
| ATE37392T1 (de) | 1988-10-15 |
| PT80028A (en) | 1985-03-01 |
| AU3912085A (en) | 1985-09-05 |
| EP0153857A2 (en) | 1985-09-04 |
| SG102887G (en) | 1988-09-23 |
| EP0153857B2 (en) | 1996-05-08 |
| KR900000898B1 (ko) | 1990-02-17 |
| KE3787A (en) | 1988-01-08 |
| GR850510B (enFirst) | 1985-05-13 |
| PH20387A (en) | 1986-12-08 |
| JPH0360880B2 (enFirst) | 1991-09-18 |
| GB8405266D0 (en) | 1984-04-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1232178A (en) | Detergent compositions | |
| CA2109499C (en) | Detergent gels containing ethoxylated alkyl sulfate surfactants in hexagonal liquid crystal form | |
| US4396525A (en) | Phosphate free liquid scouring composition | |
| EP0723576B1 (en) | Liquid detergent compositions comprising salts of alpha sulfonated fatty acid methyl or ethyl esters, and anionic surfactants | |
| AU695205B2 (en) | Light duty cleaning composition | |
| EP0659205B1 (en) | Improvements to hard surface cleaners | |
| CA1220110A (en) | Detergent compositions | |
| JPH05132699A (ja) | 軽質液体洗剤組成物 | |
| GB1565735A (en) | Cleaning compositions | |
| KR940010121B1 (ko) | 세제조성물 | |
| RU2073700C1 (ru) | Жидкая моющая композиция для мытья посуды | |
| EP0112046B1 (en) | Detergent compositions | |
| JPH02212600A (ja) | ベタイン及びエーテル硫酸塩を包含する洗剤組成物 | |
| GB2179053A (en) | Heavy-duty detergent gel compositions | |
| JP2003505446A (ja) | アルコキシル化アミン | |
| EP1190027A1 (en) | Liquid laundry detergent composition containing ethoxylated quaternary surfactant | |
| WO2001088073A1 (en) | Light duty liquid cleaners | |
| JPH0463120B2 (enFirst) | ||
| US4014806A (en) | Novel organopolyphosphates in aqueous cleaning compositions | |
| GB2155031A (en) | Detergent gel compositions | |
| CA1220694A (en) | Detergent compositions | |
| US20030092593A1 (en) | Superior surfactant system for laundry detergent composition based on alkyl benzene sulfonate and ethylene oxide/propylene oxide copolymer | |
| GB2188058A (en) | Liquid hand cleaner containing solid phase | |
| GB2271998A (en) | Semi-solid non-soap detergent composition | |
| SU1578182A1 (ru) | Состав дл мыть посуды |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |