CA1215196A - Process for fluorinated polymer - Google Patents
Process for fluorinated polymerInfo
- Publication number
- CA1215196A CA1215196A CA000391790A CA391790A CA1215196A CA 1215196 A CA1215196 A CA 1215196A CA 000391790 A CA000391790 A CA 000391790A CA 391790 A CA391790 A CA 391790A CA 1215196 A CA1215196 A CA 1215196A
- Authority
- CA
- Canada
- Prior art keywords
- polymer
- membrane
- liquid compound
- ion exchange
- anode
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 36
- 229920002313 fluoropolymer Polymers 0.000 title claims abstract description 12
- 239000012528 membrane Substances 0.000 claims abstract description 62
- 229920000642 polymer Polymers 0.000 claims abstract description 41
- 150000001875 compounds Chemical class 0.000 claims abstract description 29
- 239000007788 liquid Substances 0.000 claims abstract description 27
- 238000009835 boiling Methods 0.000 claims abstract description 16
- 229920001577 copolymer Polymers 0.000 claims description 30
- 125000000524 functional group Chemical group 0.000 claims description 16
- 238000000605 extraction Methods 0.000 claims description 13
- 238000005868 electrolysis reaction Methods 0.000 claims description 9
- 229920003303 ion-exchange polymer Polymers 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 230000007062 hydrolysis Effects 0.000 claims description 6
- 238000006460 hydrolysis reaction Methods 0.000 claims description 6
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 claims description 6
- 239000012267 brine Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 claims description 5
- AJDIZQLSFPQPEY-UHFFFAOYSA-N 1,1,2-Trichlorotrifluoroethane Chemical compound FC(F)(Cl)C(F)(Cl)Cl AJDIZQLSFPQPEY-UHFFFAOYSA-N 0.000 claims description 4
- 150000001924 cycloalkanes Chemical class 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 239000003014 ion exchange membrane Substances 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- 238000001035 drying Methods 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 238000009834 vaporization Methods 0.000 claims description 3
- 230000008016 vaporization Effects 0.000 claims description 3
- 239000007787 solid Substances 0.000 claims 7
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 2
- 238000005341 cation exchange Methods 0.000 claims 2
- 239000003518 caustics Substances 0.000 claims 2
- 150000001335 aliphatic alkanes Chemical class 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 238000005342 ion exchange Methods 0.000 abstract description 10
- 150000001733 carboxylic acid esters Chemical group 0.000 abstract description 2
- 238000010276 construction Methods 0.000 abstract 1
- 239000000178 monomer Substances 0.000 description 20
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 229920000180 alkyd Polymers 0.000 description 9
- 239000010410 layer Substances 0.000 description 8
- -1 fluorinated vinyl compound Chemical class 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- 125000001153 fluoro group Chemical group F* 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- MHNPWFZIRJMRKC-UHFFFAOYSA-N 1,1,2-trifluoroethene Chemical compound F[C]=C(F)F MHNPWFZIRJMRKC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000010924 continuous production Methods 0.000 description 3
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 235000019000 fluorine Nutrition 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 230000000717 retained effect Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 125000000391 vinyl group Chemical class [H]C([*])=C([H])[H] 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 239000004519 grease Substances 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 101150115538 nero gene Proteins 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 2
- 239000004810 polytetrafluoroethylene Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 230000003014 reinforcing effect Effects 0.000 description 2
- 230000003252 repetitive effect Effects 0.000 description 2
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical compound OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 description 2
- MIZLGWKEZAPEFJ-UHFFFAOYSA-N 1,1,2-trifluoroethene Chemical group FC=C(F)F MIZLGWKEZAPEFJ-UHFFFAOYSA-N 0.000 description 1
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical compound FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 description 1
- JYHIPQZCAWVGMM-UHFFFAOYSA-N 1-(2-ethoxypropoxy)ethanesulfonyl fluoride Chemical compound CCOC(C)COC(C)S(F)(=O)=O JYHIPQZCAWVGMM-UHFFFAOYSA-N 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- MGWGWNFMUOTEHG-UHFFFAOYSA-N 4-(3,5-dimethylphenyl)-1,3-thiazol-2-amine Chemical compound CC1=CC(C)=CC(C=2N=C(N)SC=2)=C1 MGWGWNFMUOTEHG-UHFFFAOYSA-N 0.000 description 1
- AWQOXJOAQMCOED-UHFFFAOYSA-N 8-nonylenic acid Chemical compound OC(=O)CCCCCCC=C AWQOXJOAQMCOED-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 241000490229 Eucephalus Species 0.000 description 1
- 229910006095 SO2F Inorganic materials 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- 235000018936 Vitellaria paradoxa Nutrition 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical group 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- KYKAJFCTULSVSH-UHFFFAOYSA-N chloro(fluoro)methane Chemical compound F[C]Cl KYKAJFCTULSVSH-UHFFFAOYSA-N 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- 238000006298 dechlorination reaction Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- XUCNUKMRBVNAPB-UHFFFAOYSA-N fluoroethene Chemical compound FC=C XUCNUKMRBVNAPB-UHFFFAOYSA-N 0.000 description 1
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical group FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000009545 invasion Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M nitrite group Chemical group N(=O)[O-] IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- MWUXSHHQAYIFBG-UHFFFAOYSA-N nitrogen oxide Inorganic materials O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 239000011555 saturated liquid Substances 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F6/00—Post-polymerisation treatments
- C08F6/26—Treatment of polymers prepared in bulk also solid polymers or polymer melts
- C08F6/28—Purification
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/214,997 US4360601A (en) | 1980-12-10 | 1980-12-10 | Process for extraction of fluorinated copolymers with fluorocarbons |
| US214,997 | 1980-12-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1215196A true CA1215196A (en) | 1986-12-09 |
Family
ID=22801225
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000391790A Expired CA1215196A (en) | 1980-12-10 | 1981-12-08 | Process for fluorinated polymer |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4360601A (enExample) |
| EP (1) | EP0056896B2 (enExample) |
| JP (1) | JPS57121005A (enExample) |
| CA (1) | CA1215196A (enExample) |
| DE (1) | DE3163767D1 (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4784900A (en) * | 1985-05-31 | 1988-11-15 | University Of Bath | Method for sizing polytretrafluoroethylene fabrics |
| US4650551A (en) * | 1985-05-31 | 1987-03-17 | The Dow Chemical Company | Supported ion exchange membrane films |
| KR920001992B1 (ko) * | 1985-05-31 | 1992-03-09 | 더 다우 케미칼 캄파니 | 신규한 플루오로 중합체 용액 |
| US4784882A (en) * | 1985-05-31 | 1988-11-15 | The Dow Chemical Company | Method for forming composite polymer films |
| US4650711A (en) * | 1985-05-31 | 1987-03-17 | The Dow Chemical Company | Method for sizing polytetrafluoroethylene fabrics |
| US5114515A (en) * | 1985-05-31 | 1992-05-19 | The Dow Chemical Company | Method for forming polymer composite films using removable substrates |
| US5110385A (en) * | 1985-05-31 | 1992-05-05 | The Dow Chemical Company | Method for forming polymer composite films using a removable substrate |
| US4698243A (en) * | 1986-06-20 | 1987-10-06 | The Dow Chemical Company | Method for sizing and hydrolyzing polytetrafluoroethylene fabrics, fibers, yarns, or threads |
| US4778723A (en) * | 1986-06-20 | 1988-10-18 | The Dow Chemical Company | Method for sizing polytetrafluoroethylene fibers, yarn, or threads |
| JPH02169603A (ja) * | 1988-12-23 | 1990-06-29 | Toyo Eng Corp | 重合体分散液の精製方法 |
| JP3006049B2 (ja) * | 1990-07-26 | 2000-02-07 | ダイキン工業株式会社 | 溶融加工可能なテトラフルオロエチレン共重合体の低分子量体除去方法 |
| US5152882A (en) * | 1990-09-28 | 1992-10-06 | Rosemount Inc. | Integral hydrolysis layer junction |
| EP0545068A3 (en) * | 1991-11-08 | 1993-12-22 | Du Pont | Wetting of diaphragms |
| US5237049A (en) * | 1992-08-28 | 1993-08-17 | E. I. Du Pont De Nemours And Company | Purification and adhesion of fluoropolymers |
| US5281680A (en) * | 1993-01-14 | 1994-01-25 | E. I. Du Pont De Nemours And Company | Polymerization of fluorinated copolymers |
| WO2003073921A1 (en) * | 2002-03-06 | 2003-09-12 | Atropos Limited | A steerable colonoscope probe with variable stiffness |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3221070A (en) * | 1963-09-12 | 1965-11-30 | Thiokol Chemical Corp | Isolation of tetrafluoroethylene and hexafluoropropene from the pyrolyzates of chlorodifluoromethane |
| FR2388014A1 (fr) * | 1977-04-20 | 1978-11-17 | Du Pont | Polymere fluore echangeur d'ions comportant des groupes carboxyliques et pellicules et membranes formees de ce polymere |
| US4131740A (en) * | 1977-04-20 | 1978-12-26 | E. I. Du Pont De Nemours And Company | Alkyl perfluoro-ω-fluoroformyl esters and their preparation |
| US4243508A (en) * | 1979-04-26 | 1981-01-06 | Dankese Joseph P | Electrochemical apparatus |
-
1980
- 1980-12-10 US US06/214,997 patent/US4360601A/en not_active Expired - Lifetime
-
1981
- 1981-10-28 DE DE8181305112T patent/DE3163767D1/de not_active Expired
- 1981-10-28 EP EP81305112A patent/EP0056896B2/en not_active Expired
- 1981-12-07 JP JP56195770A patent/JPS57121005A/ja active Granted
- 1981-12-08 CA CA000391790A patent/CA1215196A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| EP0056896B2 (en) | 1989-11-23 |
| EP0056896B1 (en) | 1984-05-23 |
| US4360601A (en) | 1982-11-23 |
| JPS57121005A (en) | 1982-07-28 |
| EP0056896A1 (en) | 1982-08-04 |
| DE3163767D1 (en) | 1984-06-28 |
| JPS6144882B2 (enExample) | 1986-10-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1215196A (en) | Process for fluorinated polymer | |
| CA1119350A (en) | Ion-exchange structures of copolymer blends | |
| SU1075986A3 (ru) | Электролизер дл получени хлора и раствора гидроокиси щелочного металла | |
| US5281680A (en) | Polymerization of fluorinated copolymers | |
| CA1185921A (en) | Electrolytic cell having an improved ion exchange membrane and process for operating | |
| US4683041A (en) | Process for electrolysis of sodium chloride | |
| US4267364A (en) | Fluorinated ion exchange polymer containing carboxylic groups, process for making same, and film and membrane thereof | |
| US4178218A (en) | Cation exchange membrane and use thereof in the electrolysis of sodium chloride | |
| US4340680A (en) | Cation exchange membrane of fluorinated polymer for an electrolysis | |
| NO159174B (no) | Fluorerte kopolymerer, samt fremgangsmaate ved fremstilling derav. | |
| US4209367A (en) | Electrolysis of aqueous alkali metal halide solution | |
| CA1209528A (en) | Fluorpolymer membrane with microporous stretched sheet reinforcement | |
| US4266036A (en) | Recovery of polymeric cation exchange materials for reuse by converting by reaction to the precursor form | |
| EP0079157B1 (en) | Process for esterifying fluorinated carboxylic acid polymer | |
| KR100393440B1 (ko) | 전기분해용양이온교환막및고순도수산화칼륨의제조방법 | |
| JPS59211583A (ja) | 電解方法及び電解槽 | |
| GB1604176A (en) | Perfluorovinyl compounds and copolymers thereof | |
| US4255240A (en) | Ion-exchange structures of copolymer blends | |
| US9604180B2 (en) | Fluorinated copolymer and ion exchange membrane | |
| AU615262B2 (en) | Organic polymeric material and ion-exchange membrane produced therefrom | |
| JPS62500243A (ja) | 新規なイオン性フッ素化ポリマーと、その製造方法 | |
| US4487668A (en) | Fluorinated ion exchange polymer containing carboxylic groups, and film and membrane thereof | |
| EP0057065B1 (en) | Production of cation permselective membrane and electrolytic cell containing said membrane | |
| US4217198A (en) | Coated perfluorosulfonic acid resin membranes and a method for their preparation | |
| Miyake | The design and development of Flemion membranes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |