CA1207466A - Ptc circuit protection device - Google Patents
Ptc circuit protection deviceInfo
- Publication number
- CA1207466A CA1207466A CA000421678A CA421678A CA1207466A CA 1207466 A CA1207466 A CA 1207466A CA 000421678 A CA000421678 A CA 000421678A CA 421678 A CA421678 A CA 421678A CA 1207466 A CA1207466 A CA 1207466A
- Authority
- CA
- Canada
- Prior art keywords
- ptc element
- enclosure
- leads
- ptc
- electrodes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000428 dust Substances 0.000 claims abstract description 20
- 229920001940 conductive polymer Polymers 0.000 claims abstract description 18
- -1 polytetrafluoroethylene Polymers 0.000 claims abstract description 6
- 229920001343 polytetrafluoroethylene Polymers 0.000 claims abstract description 4
- 239000004810 polytetrafluoroethylene Substances 0.000 claims abstract description 4
- 239000000919 ceramic Substances 0.000 claims abstract description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 31
- 229910052799 carbon Inorganic materials 0.000 claims description 29
- 239000011810 insulating material Substances 0.000 claims description 11
- 239000006229 carbon black Substances 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 9
- 239000011231 conductive filler Substances 0.000 claims description 2
- 229920002313 fluoropolymer Polymers 0.000 claims description 2
- 239000004811 fluoropolymer Substances 0.000 claims description 2
- 239000000463 material Substances 0.000 abstract description 14
- 230000015572 biosynthetic process Effects 0.000 abstract description 4
- 230000000694 effects Effects 0.000 abstract description 2
- 230000002411 adverse Effects 0.000 abstract 1
- 239000003575 carbonaceous material Substances 0.000 abstract 1
- 230000003628 erosive effect Effects 0.000 description 8
- 230000001965 increasing effect Effects 0.000 description 5
- 230000001419 dependent effect Effects 0.000 description 3
- 239000003822 epoxy resin Substances 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 229920000647 polyepoxide Polymers 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000004926 polymethyl methacrylate Substances 0.000 description 2
- 150000004684 trihydrates Chemical class 0.000 description 2
- 102100024133 Coiled-coil domain-containing protein 50 Human genes 0.000 description 1
- 229920004943 Delrin® Polymers 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 101000910772 Homo sapiens Coiled-coil domain-containing protein 50 Proteins 0.000 description 1
- 229920004142 LEXAN™ Polymers 0.000 description 1
- 239000004418 Lexan Substances 0.000 description 1
- 229920005372 Plexiglas® Polymers 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 239000011354 acetal resin Substances 0.000 description 1
- 239000003522 acrylic cement Substances 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 239000005388 borosilicate glass Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000005007 epoxy-phenolic resin Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01C—RESISTORS
- H01C1/00—Details
- H01C1/02—Housing; Enclosing; Embedding; Filling the housing or enclosure
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01C—RESISTORS
- H01C7/00—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material
- H01C7/02—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material having positive temperature coefficient
- H01C7/027—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material having positive temperature coefficient consisting of conducting or semi-conducting material dispersed in a non-conductive organic material
Landscapes
- Engineering & Computer Science (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Chemical & Material Sciences (AREA)
- Dispersion Chemistry (AREA)
- Ceramic Engineering (AREA)
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Thermistors And Varistors (AREA)
- Emergency Protection Circuit Devices (AREA)
- Amplifiers (AREA)
- Air Bags (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US349,505 | 1982-02-17 | ||
| US06/349,505 US4481498A (en) | 1982-02-17 | 1982-02-17 | PTC Circuit protection device |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1207466A true CA1207466A (en) | 1986-07-08 |
Family
ID=23372680
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000421678A Expired CA1207466A (en) | 1982-02-17 | 1983-02-16 | Ptc circuit protection device |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4481498A (show.php) |
| EP (1) | EP0087884B1 (show.php) |
| JP (1) | JPS58190230A (show.php) |
| AT (1) | ATE20159T1 (show.php) |
| CA (1) | CA1207466A (show.php) |
| DE (1) | DE3363651D1 (show.php) |
| GB (1) | GB2115221B (show.php) |
| HK (1) | HK39288A (show.php) |
| IL (1) | IL67928A (show.php) |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4549161A (en) * | 1982-02-17 | 1985-10-22 | Raychem Corporation | PTC Circuit protection device |
| US4542365A (en) * | 1982-02-17 | 1985-09-17 | Raychem Corporation | PTC Circuit protection device |
| US4550301A (en) * | 1982-02-17 | 1985-10-29 | Raychem Corporation | PTC Circuit protection device |
| US4719335A (en) * | 1984-01-23 | 1988-01-12 | Raychem Corporation | Devices comprising conductive polymer compositions |
| CA1233911A (en) * | 1984-01-23 | 1988-03-08 | Michael C. Jones | Laminar conductive polymer devices |
| US4761541A (en) * | 1984-01-23 | 1988-08-02 | Raychem Corporation | Devices comprising conductive polymer compositions |
| US5089688A (en) * | 1984-07-10 | 1992-02-18 | Raychem Corporation | Composite circuit protection devices |
| US4780598A (en) * | 1984-07-10 | 1988-10-25 | Raychem Corporation | Composite circuit protection devices |
| US5064997A (en) * | 1984-07-10 | 1991-11-12 | Raychem Corporation | Composite circuit protection devices |
| US5148005A (en) * | 1984-07-10 | 1992-09-15 | Raychem Corporation | Composite circuit protection devices |
| US4777351A (en) * | 1984-09-14 | 1988-10-11 | Raychem Corporation | Devices comprising conductive polymer compositions |
| US4685025A (en) * | 1985-03-14 | 1987-08-04 | Raychem Corporation | Conductive polymer circuit protection devices having improved electrodes |
| US4884163A (en) * | 1985-03-14 | 1989-11-28 | Raychem Corporation | Conductive polymer devices |
| US4647896A (en) * | 1985-03-14 | 1987-03-03 | Raychem Corporation | Materials for packaging circuit protection devices |
| US4774024A (en) * | 1985-03-14 | 1988-09-27 | Raychem Corporation | Conductive polymer compositions |
| US4647894A (en) * | 1985-03-14 | 1987-03-03 | Raychem Corporation | Novel designs for packaging circuit protection devices |
| US4639818A (en) * | 1985-09-17 | 1987-01-27 | Raychem Corporation | Vent hole assembly |
| EP0388990A3 (en) | 1986-02-20 | 1993-03-31 | RAYCHEM CORPORATION (a Delaware corporation) | Method and articles employing ion exchange material |
| US4907340A (en) * | 1987-09-30 | 1990-03-13 | Raychem Corporation | Electrical device comprising conductive polymers |
| US4924074A (en) * | 1987-09-30 | 1990-05-08 | Raychem Corporation | Electrical device comprising conductive polymers |
| US5166658A (en) * | 1987-09-30 | 1992-11-24 | Raychem Corporation | Electrical device comprising conductive polymers |
| SE462250B (sv) * | 1988-10-13 | 1990-05-21 | Asea Brown Boveri | Anordning foer oeverstroemsskydd |
| SE465524B (sv) * | 1990-02-08 | 1991-09-23 | Asea Brown Boveri | Anordning foer oeverlast- och kortslutningsskydd i elektriska anlaeggningar |
| US5247277A (en) * | 1990-02-14 | 1993-09-21 | Raychem Corporation | Electrical devices |
| US5122775A (en) * | 1990-02-14 | 1992-06-16 | Raychem Corporation | Connection device for resistive elements |
| WO1991013483A1 (fr) * | 1990-02-27 | 1991-09-05 | Tdk Corporation | Circuit protecteur de courant de surcharge |
| US5231371A (en) * | 1990-02-27 | 1993-07-27 | Tdk Corporation | Overcurrent protection circuit |
| GB9113888D0 (en) * | 1991-06-27 | 1991-08-14 | Raychem Sa Nv | Circuit protection devices |
| US5557250A (en) * | 1991-10-11 | 1996-09-17 | Raychem Corporation | Telecommunications terminal block |
| DE4425330A1 (de) * | 1993-07-26 | 1996-01-25 | Siemens Ag | Schalter zur Strombegrenzung |
| DE4446045A1 (de) * | 1994-12-22 | 1996-06-27 | Siemens Ag | Schalter zur Strombegrenzung |
| US5663702A (en) * | 1995-06-07 | 1997-09-02 | Littelfuse, Inc. | PTC electrical device having fuse link in series and metallized ceramic electrodes |
| TW309619B (show.php) * | 1995-08-15 | 1997-07-01 | Mourns Multifuse Hong Kong Ltd | |
| DE69606310T2 (de) * | 1995-08-15 | 2001-04-05 | Bourns, Multifuse (Hong Kong) Ltd. | Oberflächenmontierte leitfähige bauelemente und verfahren zur herstellung derselben |
| US6059997A (en) * | 1995-09-29 | 2000-05-09 | Littlelfuse, Inc. | Polymeric PTC compositions |
| US6020808A (en) | 1997-09-03 | 2000-02-01 | Bourns Multifuse (Hong Kong) Ltd. | Multilayer conductive polymer positive temperature coefficent device |
| US6128168A (en) | 1998-01-14 | 2000-10-03 | General Electric Company | Circuit breaker with improved arc interruption function |
| US6236302B1 (en) | 1998-03-05 | 2001-05-22 | Bourns, Inc. | Multilayer conductive polymer device and method of manufacturing same |
| US6172591B1 (en) | 1998-03-05 | 2001-01-09 | Bourns, Inc. | Multilayer conductive polymer device and method of manufacturing same |
| US6242997B1 (en) | 1998-03-05 | 2001-06-05 | Bourns, Inc. | Conductive polymer device and method of manufacturing same |
| JPH11355961A (ja) * | 1998-06-05 | 1999-12-24 | Yazaki Corp | Ptc素子を有する回路保護装置及びptc素子を有する回路保護装置を備えた電気接続箱 |
| AU6047199A (en) | 1998-09-25 | 2000-04-17 | Bourns, Inc. | Two-step process for preparing positive temperature coefficient polymer materials |
| US6144540A (en) | 1999-03-09 | 2000-11-07 | General Electric Company | Current suppressing circuit breaker unit for inductive motor protection |
| US6157286A (en) | 1999-04-05 | 2000-12-05 | General Electric Company | High voltage current limiting device |
| US6429533B1 (en) | 1999-11-23 | 2002-08-06 | Bourns Inc. | Conductive polymer device and method of manufacturing same |
| US20020089408A1 (en) * | 2000-01-11 | 2002-07-11 | Walsh Cecilia A. | Electrical device |
| US6579931B1 (en) | 2000-02-25 | 2003-06-17 | Littelfuse, Inc. | Low resistivity polymeric PTC compositions |
| US7616420B2 (en) * | 2000-12-26 | 2009-11-10 | Landis+Gyr, Inc. | Excessive surge protection method and apparatus |
| US7425885B2 (en) * | 2001-02-15 | 2008-09-16 | Integral Technologies, Inc. | Low cost electrical fuses manufactured from conductive loaded resin-based materials |
| US20120217233A1 (en) * | 2011-02-28 | 2012-08-30 | Tom Richards, Inc. | Ptc controlled environment heater |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3037266A (en) * | 1957-01-30 | 1962-06-05 | Allen Bradley Co | Method for making sealed resistors |
| US3878357A (en) * | 1965-02-25 | 1975-04-15 | Texas Instruments Inc | Component oven |
| US3803528A (en) * | 1972-06-29 | 1974-04-09 | American Components Inc | Hermetically sealed electrical resistor component |
| US4101862A (en) * | 1976-11-19 | 1978-07-18 | K.K. Tokai Rika Denki Seisakusho | Current limiting element for preventing electrical overcurrent |
| JPS5379254A (en) * | 1976-12-22 | 1978-07-13 | Tokai Rika Co Ltd | Overcurrent breaker |
| SE7802801L (sv) * | 1978-03-10 | 1979-09-11 | Ssab Svenskt Stal Ab | Elektrisk isolator |
| US4315237A (en) * | 1978-12-01 | 1982-02-09 | Raychem Corporation | PTC Devices comprising oxygen barrier layers |
| US4329726A (en) * | 1978-12-01 | 1982-05-11 | Raychem Corporation | Circuit protection devices comprising PTC elements |
| US4238812A (en) * | 1978-12-01 | 1980-12-09 | Raychem Corporation | Circuit protection devices comprising PTC elements |
| US4237441A (en) * | 1978-12-01 | 1980-12-02 | Raychem Corporation | Low resistivity PTC compositions |
| US4282003A (en) * | 1978-12-06 | 1981-08-04 | Texas Instruments Incorporated | Method for constructing a self-regulating electric heater |
| US4255698A (en) * | 1979-01-26 | 1981-03-10 | Raychem Corporation | Protection of batteries |
| DE2939470C2 (de) * | 1979-09-28 | 1982-04-08 | Siemens AG, 1000 Berlin und 8000 München | Kaltleiter-Heizeinrichtung |
| US4413301A (en) * | 1980-04-21 | 1983-11-01 | Raychem Corporation | Circuit protection devices comprising PTC element |
| US4317027A (en) * | 1980-04-21 | 1982-02-23 | Raychem Corporation | Circuit protection devices |
| US4352083A (en) * | 1980-04-21 | 1982-09-28 | Raychem Corporation | Circuit protection devices |
| CA1168433A (en) * | 1980-05-19 | 1984-06-05 | Umesh K. Sopory | Ptc conductive polymers and devices comprising them |
-
1982
- 1982-02-17 US US06/349,505 patent/US4481498A/en not_active Expired - Lifetime
-
1983
- 1983-02-16 AT AT83300773T patent/ATE20159T1/de not_active IP Right Cessation
- 1983-02-16 EP EP83300773A patent/EP0087884B1/en not_active Expired
- 1983-02-16 DE DE8383300773T patent/DE3363651D1/de not_active Expired
- 1983-02-16 GB GB08304206A patent/GB2115221B/en not_active Expired
- 1983-02-16 CA CA000421678A patent/CA1207466A/en not_active Expired
- 1983-02-16 IL IL67928A patent/IL67928A/xx not_active IP Right Cessation
- 1983-02-16 JP JP58025457A patent/JPS58190230A/ja active Granted
-
1988
- 1988-05-26 HK HK392/88A patent/HK39288A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB8304206D0 (en) | 1983-03-23 |
| HK39288A (en) | 1988-06-03 |
| ATE20159T1 (de) | 1986-06-15 |
| DE3363651D1 (en) | 1986-07-03 |
| US4481498A (en) | 1984-11-06 |
| JPH0461577B2 (show.php) | 1992-10-01 |
| JPS58190230A (ja) | 1983-11-07 |
| GB2115221B (en) | 1986-04-30 |
| EP0087884A1 (en) | 1983-09-07 |
| IL67928A (en) | 1988-01-31 |
| EP0087884B1 (en) | 1986-05-28 |
| IL67928A0 (en) | 1983-06-15 |
| GB2115221A (en) | 1983-09-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1207466A (en) | Ptc circuit protection device | |
| US4542365A (en) | PTC Circuit protection device | |
| US4549161A (en) | PTC Circuit protection device | |
| CA1240407A (en) | Electrical devices comprising cross-linked conductive polymers | |
| Ruschau et al. | Resistivities of conductive composites | |
| US4475138A (en) | Circuit protection devices comprising PTC element | |
| US4780598A (en) | Composite circuit protection devices | |
| US4413301A (en) | Circuit protection devices comprising PTC element | |
| US4845838A (en) | Method of making a PTC conductive polymer electrical device | |
| US5140297A (en) | PTC conductive polymer compositions | |
| US5195013A (en) | PTC conductive polymer compositions | |
| JP2831594B2 (ja) | Ptc素子を有する保護回路 | |
| US4955267A (en) | Method of making a PTC conductive polymer electrical device | |
| JPH049361B2 (show.php) | ||
| YU61903A (sh) | Električni izolatori, materijali i oprema | |
| EP0063440A2 (en) | Radiation cross-linking of PTC conductive polymers | |
| US4951384A (en) | Method of making a PTC conductive polymer electrical device | |
| EP0201993B1 (en) | Packaging for ptc-based circuit protection devices | |
| WO2002091398A3 (en) | Circuit protection arrangement | |
| US4550301A (en) | PTC Circuit protection device | |
| DE3855679D1 (de) | Leitfähige polymere enthaltende elektrische anordnung | |
| US4642664A (en) | Electrical device made of partially pryolyzed polymer | |
| Brainard et al. | Flashover of resistor and varistor materials | |
| CA1180761A (en) | Humidity sensor | |
| CA1184319A (en) | Radiation cross-linking of ptc conductive polymers |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |