CA1197647A - Thermosetting resin composition and prepolymer thereof - Google Patents
Thermosetting resin composition and prepolymer thereofInfo
- Publication number
- CA1197647A CA1197647A CA000414295A CA414295A CA1197647A CA 1197647 A CA1197647 A CA 1197647A CA 000414295 A CA000414295 A CA 000414295A CA 414295 A CA414295 A CA 414295A CA 1197647 A CA1197647 A CA 1197647A
- Authority
- CA
- Canada
- Prior art keywords
- bis
- dicyanobenzene
- ether
- epoxy
- benzene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000011342 resin composition Substances 0.000 title claims abstract description 26
- 229920001187 thermosetting polymer Polymers 0.000 title claims abstract description 18
- -1 nitrile compound Chemical class 0.000 claims abstract description 53
- 150000001875 compounds Chemical class 0.000 claims abstract description 44
- 239000004593 Epoxy Substances 0.000 claims abstract description 37
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 54
- 125000003504 2-oxazolinyl group Chemical group O1C(=NCC1)* 0.000 claims description 35
- 239000003054 catalyst Substances 0.000 claims description 20
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical group OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 claims description 19
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 14
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 12
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims description 12
- 125000002560 nitrile group Chemical group 0.000 claims description 9
- DBIWHDFLQHGOCS-UHFFFAOYSA-N piperidine;trifluoroborane Chemical compound FB(F)F.C1CCNCC1 DBIWHDFLQHGOCS-UHFFFAOYSA-N 0.000 claims description 9
- UZJZIZFCQFZDHP-UHFFFAOYSA-N 3-nitrobenzene-1,2-dicarbonitrile Chemical compound [O-][N+](=O)C1=CC=CC(C#N)=C1C#N UZJZIZFCQFZDHP-UHFFFAOYSA-N 0.000 claims description 8
- BHXFKXOIODIUJO-UHFFFAOYSA-N benzene-1,4-dicarbonitrile Chemical compound N#CC1=CC=C(C#N)C=C1 BHXFKXOIODIUJO-UHFFFAOYSA-N 0.000 claims description 8
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 claims description 8
- 229920003986 novolac Polymers 0.000 claims description 8
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 6
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 claims description 6
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 claims description 6
- ZWZGXLKXKAPXMZ-UHFFFAOYSA-N 2,2'-dihydroxy-3,3'-dimethoxy-5,5'-dipropyldiphenylmethane Chemical compound COC1=CC(CCC)=CC(CC=2C(=C(OC)C=C(CCC)C=2)O)=C1O ZWZGXLKXKAPXMZ-UHFFFAOYSA-N 0.000 claims description 5
- YKHADQVQERKEPN-UHFFFAOYSA-N 2-chloro-3-ethylbenzene-1,4-dicarbonitrile Chemical compound CCC1=C(Cl)C(C#N)=CC=C1C#N YKHADQVQERKEPN-UHFFFAOYSA-N 0.000 claims description 5
- 229910015900 BF3 Inorganic materials 0.000 claims description 5
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 claims description 5
- 229920001568 phenolic resin Polymers 0.000 claims description 5
- BXJWDOYMROEHEN-UHFFFAOYSA-N tributylstibane Chemical compound CCCC[Sb](CCCC)CCCC BXJWDOYMROEHEN-UHFFFAOYSA-N 0.000 claims description 5
- BPHYZRNTQNPLFI-UHFFFAOYSA-N 2,4,6-trihydroxytoluene Chemical compound CC1=C(O)C=C(O)C=C1O BPHYZRNTQNPLFI-UHFFFAOYSA-N 0.000 claims description 4
- LIINDGFYZPDUHC-UHFFFAOYSA-N 2,5-dicyanobenzoic acid Chemical compound OC(=O)C1=CC(C#N)=CC=C1C#N LIINDGFYZPDUHC-UHFFFAOYSA-N 0.000 claims description 4
- ZSJIRGBDYMYVDO-UHFFFAOYSA-N 2,5-dimethylbenzene-1,4-dicarbonitrile Chemical compound CC1=CC(C#N)=C(C)C=C1C#N ZSJIRGBDYMYVDO-UHFFFAOYSA-N 0.000 claims description 4
- NZHNJOJQMPJLFA-UHFFFAOYSA-N 2-[3,5-bis(oxiran-2-yl)phenyl]oxirane Chemical compound C1OC1C1=CC(C2OC2)=CC(C2OC2)=C1 NZHNJOJQMPJLFA-UHFFFAOYSA-N 0.000 claims description 4
- OWEBGWBRTKTKHR-UHFFFAOYSA-N 2-[4-[4-(oxiran-2-yl)phenyl]phenyl]oxirane Chemical group C1OC1C1=CC=C(C=2C=CC(=CC=2)C2OC2)C=C1 OWEBGWBRTKTKHR-UHFFFAOYSA-N 0.000 claims description 4
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 claims description 4
- BWQCUROJHJQRJU-UHFFFAOYSA-N 2-bromobenzene-1,4-dicarbonitrile Chemical compound BrC1=CC(C#N)=CC=C1C#N BWQCUROJHJQRJU-UHFFFAOYSA-N 0.000 claims description 4
- KELQMIQLTBTJNV-UHFFFAOYSA-N 2-chlorobenzene-1,3-dicarbonitrile Chemical compound ClC1=C(C#N)C=CC=C1C#N KELQMIQLTBTJNV-UHFFFAOYSA-N 0.000 claims description 4
- FMKUGBCTKZQVGP-UHFFFAOYSA-N 2-methylbenzene-1,3,5-tricarbonitrile Chemical compound CC1=C(C#N)C=C(C#N)C=C1C#N FMKUGBCTKZQVGP-UHFFFAOYSA-N 0.000 claims description 4
- UJXAVMZSVIODSH-UHFFFAOYSA-N 2-methylbenzene-1,4-dicarbonitrile Chemical compound CC1=CC(C#N)=CC=C1C#N UJXAVMZSVIODSH-UHFFFAOYSA-N 0.000 claims description 4
- SDBXDRHHEQKAIA-UHFFFAOYSA-N 3-chloro-5-(chloromethyl)-2-ethylbenzene-1,4-dicarbonitrile Chemical compound CCC1=C(Cl)C(C#N)=C(CCl)C=C1C#N SDBXDRHHEQKAIA-UHFFFAOYSA-N 0.000 claims description 4
- RUPDOKVCLMUDSG-UHFFFAOYSA-N 3-hydroxybenzene-1,2,4,5-tetracarbonitrile Chemical compound OC1=C(C#N)C(C#N)=CC(C#N)=C1C#N RUPDOKVCLMUDSG-UHFFFAOYSA-N 0.000 claims description 4
- HMCXXVRMUCKXIG-UHFFFAOYSA-N 3-nitrobenzene-1,2,4,5-tetracarbonitrile Chemical compound [O-][N+](=O)C1=C(C#N)C(C#N)=CC(C#N)=C1C#N HMCXXVRMUCKXIG-UHFFFAOYSA-N 0.000 claims description 4
- HJYRYLIYQJIQAY-UHFFFAOYSA-N 3-pentylbenzene-1,2,4,5-tetracarbonitrile Chemical compound CCCCCC1=C(C#N)C(C#N)=CC(C#N)=C1C#N HJYRYLIYQJIQAY-UHFFFAOYSA-N 0.000 claims description 4
- KAXYYLCSSXFXKR-UHFFFAOYSA-N 4-(4-cyanophenyl)benzonitrile Chemical group C1=CC(C#N)=CC=C1C1=CC=C(C#N)C=C1 KAXYYLCSSXFXKR-UHFFFAOYSA-N 0.000 claims description 4
- HVMHLMJYHBAOPL-UHFFFAOYSA-N 4-[2-(7-oxabicyclo[4.1.0]heptan-4-yl)propan-2-yl]-7-oxabicyclo[4.1.0]heptane Chemical compound C1CC2OC2CC1C(C)(C)C1CC2OC2CC1 HVMHLMJYHBAOPL-UHFFFAOYSA-N 0.000 claims description 4
- GSELOSLCLAWQDJ-UHFFFAOYSA-N 4-[4-(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile Chemical compound C1=C(C#N)C(C#N)=CC=C1OC(C=C1)=CC=C1OC1=CC=C(C#N)C(C#N)=C1 GSELOSLCLAWQDJ-UHFFFAOYSA-N 0.000 claims description 4
- KTXGZMYCYWBZPM-UHFFFAOYSA-N 4-bromobenzene-1,2,3,5-tetracarbonitrile Chemical compound BrC1=C(C#N)C=C(C#N)C(C#N)=C1C#N KTXGZMYCYWBZPM-UHFFFAOYSA-N 0.000 claims description 4
- LRJQWEBGONSIFY-UHFFFAOYSA-N 4-hydroxybenzene-1,2,3-tricarbonitrile Chemical compound OC1=CC=C(C#N)C(C#N)=C1C#N LRJQWEBGONSIFY-UHFFFAOYSA-N 0.000 claims description 4
- QESYLFCJDFCRIT-UHFFFAOYSA-N 4-hydroxybenzene-1,3-dicarbonitrile Chemical compound OC1=CC=C(C#N)C=C1C#N QESYLFCJDFCRIT-UHFFFAOYSA-N 0.000 claims description 4
- LGDBUNLCUXIRBO-UHFFFAOYSA-N 4-propan-2-ylbenzene-1,2,3,5-tetracarbonitrile Chemical compound CC(C)C1=C(C#N)C=C(C#N)C(C#N)=C1C#N LGDBUNLCUXIRBO-UHFFFAOYSA-N 0.000 claims description 4
- UBFORUHJOUPFHX-UHFFFAOYSA-N 5-aminobenzene-1,3-dicarbonitrile Chemical compound NC1=CC(C#N)=CC(C#N)=C1 UBFORUHJOUPFHX-UHFFFAOYSA-N 0.000 claims description 4
- SHKIKKGTMQPDDL-UHFFFAOYSA-N 5-propan-2-ylbenzene-1,3-dicarbonitrile Chemical compound CC(C)C1=CC(C#N)=CC(C#N)=C1 SHKIKKGTMQPDDL-UHFFFAOYSA-N 0.000 claims description 4
- FPQODPOKVHESKZ-UHFFFAOYSA-N 6-fluorobenzene-1,2,4-tricarbonitrile Chemical compound FC1=CC(C#N)=CC(C#N)=C1C#N FPQODPOKVHESKZ-UHFFFAOYSA-N 0.000 claims description 4
- ADAHGVUHKDNLEB-UHFFFAOYSA-N Bis(2,3-epoxycyclopentyl)ether Chemical compound C1CC2OC2C1OC1CCC2OC21 ADAHGVUHKDNLEB-UHFFFAOYSA-N 0.000 claims description 4
- ZFIVKAOQEXOYFY-UHFFFAOYSA-N Diepoxybutane Chemical compound C1OC1C1OC1 ZFIVKAOQEXOYFY-UHFFFAOYSA-N 0.000 claims description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 4
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 claims description 4
- FAAXSAZENACQBT-UHFFFAOYSA-N benzene-1,2,4,5-tetracarbonitrile Chemical compound N#CC1=CC(C#N)=C(C#N)C=C1C#N FAAXSAZENACQBT-UHFFFAOYSA-N 0.000 claims description 4
- GLROGUSVUGSGPO-UHFFFAOYSA-N bis(3-methyl-7-oxabicyclo[4.1.0]heptan-4-yl) hexanedioate Chemical compound C1C2OC2CC(C)C1OC(=O)CCCCC(=O)OC1CC2OC2CC1C GLROGUSVUGSGPO-UHFFFAOYSA-N 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- LAQPNDIUHRHNCV-UHFFFAOYSA-N isophthalonitrile Chemical compound N#CC1=CC=CC(C#N)=C1 LAQPNDIUHRHNCV-UHFFFAOYSA-N 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 claims description 4
- 229960001553 phloroglucinol Drugs 0.000 claims description 4
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 claims description 4
- 229960001755 resorcinol Drugs 0.000 claims description 4
- NXIHMZUXSZKKBX-UHFFFAOYSA-N 1h-imidazole;trifluoroborane Chemical compound FB(F)F.C1=CNC=N1 NXIHMZUXSZKKBX-UHFFFAOYSA-N 0.000 claims description 3
- KYVDSANOILYQMU-UHFFFAOYSA-N 2-chlorobenzene-1,3,5-tricarbonitrile Chemical compound ClC1=C(C#N)C=C(C#N)C=C1C#N KYVDSANOILYQMU-UHFFFAOYSA-N 0.000 claims description 3
- WPEVAJUMJVYVGF-UHFFFAOYSA-N 2-nitrobenzene-1,3,5-tricarbonitrile Chemical compound [O-][N+](=O)C1=C(C#N)C=C(C#N)C=C1C#N WPEVAJUMJVYVGF-UHFFFAOYSA-N 0.000 claims description 3
- KFWDJOCCHMICPQ-UHFFFAOYSA-N 2-octylbenzene-1,4-dicarbonitrile Chemical compound CCCCCCCCC1=CC(C#N)=CC=C1C#N KFWDJOCCHMICPQ-UHFFFAOYSA-N 0.000 claims description 3
- DRNPGEPMHMPIQU-UHFFFAOYSA-N O.[Ti].[Ti].CCCCO.CCCCO.CCCCO.CCCCO.CCCCO.CCCCO Chemical compound O.[Ti].[Ti].CCCCO.CCCCO.CCCCO.CCCCO.CCCCO.CCCCO DRNPGEPMHMPIQU-UHFFFAOYSA-N 0.000 claims description 3
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 claims description 3
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 claims description 3
- SGLGUTWNGVJXPP-UHFFFAOYSA-N benzene-1,3,5-tricarbonitrile Chemical compound N#CC1=CC(C#N)=CC(C#N)=C1 SGLGUTWNGVJXPP-UHFFFAOYSA-N 0.000 claims description 3
- PZGVVCOOWYSSGB-UHFFFAOYSA-L but-2-enedioate;dioctyltin(2+) Chemical compound CCCCCCCC[Sn]1(CCCCCCCC)OC(=O)C=CC(=O)O1 PZGVVCOOWYSSGB-UHFFFAOYSA-L 0.000 claims description 3
- BSDOQSMQCZQLDV-UHFFFAOYSA-N butan-1-olate;zirconium(4+) Chemical compound [Zr+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] BSDOQSMQCZQLDV-UHFFFAOYSA-N 0.000 claims description 3
- PIMYDFDXAUVLON-UHFFFAOYSA-M chloro(triethyl)stannane Chemical compound CC[Sn](Cl)(CC)CC PIMYDFDXAUVLON-UHFFFAOYSA-M 0.000 claims description 3
- 229960003280 cupric chloride Drugs 0.000 claims description 3
- QRUYYSPCOGSZGQ-UHFFFAOYSA-L cyclopentane;dichlorozirconium Chemical compound Cl[Zr]Cl.[CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1 QRUYYSPCOGSZGQ-UHFFFAOYSA-L 0.000 claims description 3
- JJPZOIJCDNHCJP-UHFFFAOYSA-N dibutyl(sulfanylidene)tin Chemical compound CCCC[Sn](=S)CCCC JJPZOIJCDNHCJP-UHFFFAOYSA-N 0.000 claims description 3
- FFKSUTHTFIDTNU-UHFFFAOYSA-N dibutyl-bis(ethenyl)stannane Chemical compound CCCC[Sn](C=C)(C=C)CCCC FFKSUTHTFIDTNU-UHFFFAOYSA-N 0.000 claims description 3
- JDVIRCVIXCMTPU-UHFFFAOYSA-N ethanamine;trifluoroborane Chemical compound CCN.FB(F)F JDVIRCVIXCMTPU-UHFFFAOYSA-N 0.000 claims description 3
- NJVOZLGKTAPUTQ-UHFFFAOYSA-M fentin chloride Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 NJVOZLGKTAPUTQ-UHFFFAOYSA-M 0.000 claims description 3
- BFWMWWXRWVJXSE-UHFFFAOYSA-M fentin hydroxide Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(O)C1=CC=CC=C1 BFWMWWXRWVJXSE-UHFFFAOYSA-M 0.000 claims description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 claims description 3
- BCWYYHBWCZYDNB-UHFFFAOYSA-N propan-2-ol;zirconium Chemical compound [Zr].CC(C)O.CC(C)O.CC(C)O.CC(C)O BCWYYHBWCZYDNB-UHFFFAOYSA-N 0.000 claims description 3
- RWWNQEOPUOCKGR-UHFFFAOYSA-N tetraethyltin Chemical compound CC[Sn](CC)(CC)CC RWWNQEOPUOCKGR-UHFFFAOYSA-N 0.000 claims description 3
- MZIYQMVHASXABC-UHFFFAOYSA-N tetrakis(ethenyl)stannane Chemical compound C=C[Sn](C=C)(C=C)C=C MZIYQMVHASXABC-UHFFFAOYSA-N 0.000 claims description 3
- WBJSMHDYLOJVKC-UHFFFAOYSA-N tetraphenyllead Chemical compound C1=CC=CC=C1[Pb](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 WBJSMHDYLOJVKC-UHFFFAOYSA-N 0.000 claims description 3
- CRHIAMBJMSSNNM-UHFFFAOYSA-N tetraphenylstannane Chemical compound C1=CC=CC=C1[Sn](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 CRHIAMBJMSSNNM-UHFFFAOYSA-N 0.000 claims description 3
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 claims description 3
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 claims description 3
- YSUXTNDMKYYZPR-UHFFFAOYSA-M tributylstannyl prop-2-enoate Chemical compound CCCC[Sn](CCCC)(CCCC)OC(=O)C=C YSUXTNDMKYYZPR-UHFFFAOYSA-M 0.000 claims description 3
- ZHXAZZQXWJJBHA-UHFFFAOYSA-N triphenylbismuthane Chemical compound C1=CC=CC=C1[Bi](C=1C=CC=CC=1)C1=CC=CC=C1 ZHXAZZQXWJJBHA-UHFFFAOYSA-N 0.000 claims description 3
- HVYVMSPIJIWUNA-UHFFFAOYSA-N triphenylstibine Chemical compound C1=CC=CC=C1[Sb](C=1C=CC=CC=1)C1=CC=CC=C1 HVYVMSPIJIWUNA-UHFFFAOYSA-N 0.000 claims description 3
- OECTYKWYRCHAKR-UHFFFAOYSA-N 4-vinylcyclohexene dioxide Chemical compound C1OC1C1CC2OC2CC1 OECTYKWYRCHAKR-UHFFFAOYSA-N 0.000 claims description 2
- JAGHDVYKBYUAFD-UHFFFAOYSA-L cyclopenta-1,3-diene;titanium(4+);dichloride Chemical compound [Cl-].[Cl-].[Ti+4].C1C=CC=[C-]1.C1C=CC=[C-]1 JAGHDVYKBYUAFD-UHFFFAOYSA-L 0.000 claims description 2
- REDSKZBUUUQMSK-UHFFFAOYSA-N tributyltin Chemical compound CCCC[Sn](CCCC)CCCC.CCCC[Sn](CCCC)CCCC REDSKZBUUUQMSK-UHFFFAOYSA-N 0.000 claims description 2
- SLSBELRIYLWIKA-UHFFFAOYSA-N 2,5-bis(4-phenoxybenzoyl)benzene-1,4-dicarbonitrile Chemical compound C=1C(C#N)=C(C(=O)C=2C=CC(OC=3C=CC=CC=3)=CC=2)C=C(C#N)C=1C(=O)C(C=C1)=CC=C1OC1=CC=CC=C1 SLSBELRIYLWIKA-UHFFFAOYSA-N 0.000 claims 6
- SSIIVKRGBWPLNS-UHFFFAOYSA-N 4-[3-(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile Chemical compound C1=C(C#N)C(C#N)=CC=C1OC1=CC=CC(OC=2C=C(C(C#N)=CC=2)C#N)=C1 SSIIVKRGBWPLNS-UHFFFAOYSA-N 0.000 claims 3
- KSABLEMOPGEISR-UHFFFAOYSA-N 4-[4-[3-[4-(4-cyanobenzoyl)-2-phenoxybenzoyl]benzoyl]-3-phenoxybenzoyl]benzonitrile Chemical compound C=1C=C(C(=O)C=2C=C(C=CC=2)C(=O)C=2C(=CC(=CC=2)C(=O)C=2C=CC(=CC=2)C#N)OC=2C=CC=CC=2)C(OC=2C=CC=CC=2)=CC=1C(=O)C1=CC=C(C#N)C=C1 KSABLEMOPGEISR-UHFFFAOYSA-N 0.000 claims 3
- VCKOISCQHNZPPQ-UHFFFAOYSA-N 4-[4-[3-[4-(4-cyanobenzoyl)-2-phenoxyphenyl]sulfonylphenyl]sulfonyl-3-phenoxybenzoyl]benzonitrile Chemical compound C=1C=C(S(=O)(=O)C=2C=C(C=CC=2)S(=O)(=O)C=2C(=CC(=CC=2)C(=O)C=2C=CC(=CC=2)C#N)OC=2C=CC=CC=2)C(OC=2C=CC=CC=2)=CC=1C(=O)C1=CC=C(C#N)C=C1 VCKOISCQHNZPPQ-UHFFFAOYSA-N 0.000 claims 3
- GCQXFKBSPSLVPY-UHFFFAOYSA-N 4-[4-[4-(3,4-dicyanophenoxy)phenyl]phenoxy]benzene-1,2-dicarbonitrile Chemical group C1=C(C#N)C(C#N)=CC=C1OC1=CC=C(C=2C=CC(OC=3C=C(C(C#N)=CC=3)C#N)=CC=2)C=C1 GCQXFKBSPSLVPY-UHFFFAOYSA-N 0.000 claims 3
- XVNISIDATMKYGL-UHFFFAOYSA-N 6-(4-cyanophenyl)-7-thiabicyclo[4.1.0]hepta-2,4-diene-3-carbonitrile Chemical compound C1=CC(C#N)=CC2SC21C1=CC=C(C#N)C=C1 XVNISIDATMKYGL-UHFFFAOYSA-N 0.000 claims 3
- YXALYBMHAYZKAP-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]heptan-4-ylmethyl 7-oxabicyclo[4.1.0]heptane-4-carboxylate Chemical compound C1CC2OC2CC1C(=O)OCC1CC2OC2CC1 YXALYBMHAYZKAP-UHFFFAOYSA-N 0.000 claims 3
- CFMUSUSAXOVNOD-PAMPIZDHSA-L (Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate manganese(2+) Chemical compound [Mn+2].FC(F)(F)C(/[O-])=C/C(=O)C(F)(F)F.FC(F)(F)C(/[O-])=C/C(=O)C(F)(F)F CFMUSUSAXOVNOD-PAMPIZDHSA-L 0.000 claims 2
- DJQNCYZAJIZLSV-UHFFFAOYSA-N 2-(dichloromethyl)benzene-1,3-dicarbonitrile Chemical compound ClC(Cl)C1=C(C#N)C=CC=C1C#N DJQNCYZAJIZLSV-UHFFFAOYSA-N 0.000 claims 2
- KTXWGMUMDPYXNN-UHFFFAOYSA-N 2-ethylhexan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCCC(CC)C[O-].CCCCC(CC)C[O-].CCCCC(CC)C[O-].CCCCC(CC)C[O-] KTXWGMUMDPYXNN-UHFFFAOYSA-N 0.000 claims 2
- NZXNRBQAEAFJQY-UHFFFAOYSA-N C(C1CO1)OC1=C(C(=O)C2=C(C=CC=C2)OCC2CO2)C=CC(C1)(OCC1CO1)OCC1CO1 Chemical compound C(C1CO1)OC1=C(C(=O)C2=C(C=CC=C2)OCC2CO2)C=CC(C1)(OCC1CO1)OCC1CO1 NZXNRBQAEAFJQY-UHFFFAOYSA-N 0.000 claims 2
- LDLDYFCCDKENPD-UHFFFAOYSA-N ethenylcyclohexane Chemical compound C=CC1CCCCC1 LDLDYFCCDKENPD-UHFFFAOYSA-N 0.000 claims 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims 2
- KQJBQMSCFSJABN-UHFFFAOYSA-N octadecan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCCCCCCCCCCCCCCCC[O-].CCCCCCCCCCCCCCCCCC[O-].CCCCCCCCCCCCCCCCCC[O-].CCCCCCCCCCCCCCCCCC[O-] KQJBQMSCFSJABN-UHFFFAOYSA-N 0.000 claims 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims 1
- DYOGQIOSFADTHU-UHFFFAOYSA-N 1-dibutylstiborylbutane Chemical compound CCCC[Sb](=O)(CCCC)CCCC DYOGQIOSFADTHU-UHFFFAOYSA-N 0.000 claims 1
- HNUKMDPEDCSDKO-UHFFFAOYSA-L [Cl-].[Cl-].C1C=CC=C1[Ti+2]C1=CC=CC1 Chemical compound [Cl-].[Cl-].C1C=CC=C1[Ti+2]C1=CC=CC1 HNUKMDPEDCSDKO-UHFFFAOYSA-L 0.000 claims 1
- 230000009102 absorption Effects 0.000 description 22
- 238000010521 absorption reaction Methods 0.000 description 22
- 229920005989 resin Polymers 0.000 description 18
- 239000011347 resin Substances 0.000 description 18
- 238000001723 curing Methods 0.000 description 15
- 230000003247 decreasing effect Effects 0.000 description 6
- 125000003700 epoxy group Chemical group 0.000 description 6
- 238000000862 absorption spectrum Methods 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 239000004644 polycyanurate Substances 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 230000001588 bifunctional effect Effects 0.000 description 3
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 description 3
- 239000007848 Bronsted acid Substances 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 235000014786 phosphorus Nutrition 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 230000004580 weight loss Effects 0.000 description 2
- JCIIKRHCWVHVFF-UHFFFAOYSA-N 1,2,4-thiadiazol-5-amine;hydrochloride Chemical compound Cl.NC1=NC=NS1 JCIIKRHCWVHVFF-UHFFFAOYSA-N 0.000 description 1
- QKUSYGZVIAWWPY-UHFFFAOYSA-N 1,3-dioxane;7-oxabicyclo[4.1.0]heptane Chemical compound C1COCOC1.C1CCCC2OC21 QKUSYGZVIAWWPY-UHFFFAOYSA-N 0.000 description 1
- DOFKMEPRLINJMZ-UHFFFAOYSA-N 1-hexylphosphonoylhexane Chemical compound CCCCCCP(=O)CCCCCC DOFKMEPRLINJMZ-UHFFFAOYSA-N 0.000 description 1
- VTGXVUQXDHXADV-UHFFFAOYSA-N 1-methyl-1-oxidopiperidin-1-ium Chemical compound C[N+]1([O-])CCCCC1 VTGXVUQXDHXADV-UHFFFAOYSA-N 0.000 description 1
- CHZLVSBMXZSPNN-UHFFFAOYSA-N 2,4-dimethylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C(C)=C1 CHZLVSBMXZSPNN-UHFFFAOYSA-N 0.000 description 1
- FFISWZPYNKWIRR-UHFFFAOYSA-N 5-oxidophenazin-5-ium Chemical compound C1=CC=C2[N+]([O-])=C(C=CC=C3)C3=NC2=C1 FFISWZPYNKWIRR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- DWGWCWDDNTVOGF-UHFFFAOYSA-N Cl.Cl.Cl.Cl.Cl.Cl Chemical compound Cl.Cl.Cl.Cl.Cl.Cl DWGWCWDDNTVOGF-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- LKQUDAOAMBKKQW-UHFFFAOYSA-N N,N-dimethylaniline N-oxide Chemical compound CN(C)(=O)C1=CC=CC=C1 LKQUDAOAMBKKQW-UHFFFAOYSA-N 0.000 description 1
- LFTLOKWAGJYHHR-UHFFFAOYSA-N N-methylmorpholine N-oxide Chemical compound CN1(=O)CCOCC1 LFTLOKWAGJYHHR-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000013006 addition curing Methods 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- BXILREUWHCQFES-UHFFFAOYSA-K aluminum;trichloride;hydrochloride Chemical compound [Al+3].Cl.[Cl-].[Cl-].[Cl-] BXILREUWHCQFES-UHFFFAOYSA-K 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- NUZIUQUIUFXLAH-UHFFFAOYSA-N barium(2+);iron(2+);hexacyanide Chemical compound [Fe+2].[Ba+2].[Ba+2].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] NUZIUQUIUFXLAH-UHFFFAOYSA-N 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- KVRAGBDTQYNMNO-UHFFFAOYSA-N bis[2,4-bis(oxiran-2-ylmethoxy)phenyl]methanone Chemical compound C=1C=C(OCC2OC2)C=C(OCC2OC2)C=1C(=O)C(C(=C1)OCC2OC2)=CC=C1OCC1CO1 KVRAGBDTQYNMNO-UHFFFAOYSA-N 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- NZNMSOFKMUBTKW-UHFFFAOYSA-M cyclohexanecarboxylate Chemical compound [O-]C(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-M 0.000 description 1
- SPKJCVZOZISLEI-UHFFFAOYSA-N cyclopenta-1,3-diene;1-cyclopenta-1,3-dien-1-ylethanone;iron(2+) Chemical compound [Fe+2].C=1C=C[CH-]C=1.CC(=O)C1=CC=C[CH-]1 SPKJCVZOZISLEI-UHFFFAOYSA-N 0.000 description 1
- CLVJBRYGLQNRDA-UHFFFAOYSA-N diphenylarsorylbenzene Chemical compound C=1C=CC=CC=1[As](C=1C=CC=CC=1)(=O)C1=CC=CC=C1 CLVJBRYGLQNRDA-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- YAGKRVSRTSUGEY-UHFFFAOYSA-N ferricyanide Chemical compound [Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] YAGKRVSRTSUGEY-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 150000002506 iron compounds Chemical class 0.000 description 1
- YWBREQLMDUVNIR-UHFFFAOYSA-N iron(2+);hexacyanide Chemical compound [Fe+2].[Fe+2].[Fe+2].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] YWBREQLMDUVNIR-UHFFFAOYSA-N 0.000 description 1
- DCYOBGZUOMKFPA-UHFFFAOYSA-N iron(2+);iron(3+);octadecacyanide Chemical compound [Fe+2].[Fe+2].[Fe+2].[Fe+3].[Fe+3].[Fe+3].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] DCYOBGZUOMKFPA-UHFFFAOYSA-N 0.000 description 1
- BQZFDPZOAJMUIU-UHFFFAOYSA-N iron(3+);hexacyanide Chemical compound [Fe+3].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] BQZFDPZOAJMUIU-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- MMAXOAIHEPNELR-UHFFFAOYSA-N n,n-dimethylcyclohexanamine oxide Chemical compound C[N+](C)([O-])C1CCCCC1 MMAXOAIHEPNELR-UHFFFAOYSA-N 0.000 description 1
- VWJGVSICRWKTBN-UHFFFAOYSA-N n-ethyl-n-methylbutan-1-amine oxide Chemical compound CCCC[N+](C)([O-])CC VWJGVSICRWKTBN-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000002901 organomagnesium compounds Chemical class 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 229940096826 phenylmercuric acetate Drugs 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000000276 potassium ferrocyanide Substances 0.000 description 1
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical compound [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 1
- GTSHREYGKSITGK-UHFFFAOYSA-N sodium ferrocyanide Chemical compound [Na+].[Na+].[Na+].[Na+].[Fe+2].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] GTSHREYGKSITGK-UHFFFAOYSA-N 0.000 description 1
- 239000000264 sodium ferrocyanide Substances 0.000 description 1
- 235000012247 sodium ferrocyanide Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- WRWQVSOJXAVREP-UHFFFAOYSA-J tetrachlorotitanium hydrochloride Chemical compound Cl.[Cl-].[Cl-].[Cl-].[Cl-].[Ti+4] WRWQVSOJXAVREP-UHFFFAOYSA-J 0.000 description 1
- LOJPEGWUHVRGBN-UHFFFAOYSA-J tetrachlorotitanium;triethylalumane Chemical compound [Cl-].[Cl-].[Cl-].[Cl-].[Ti+4].CC[Al](CC)CC LOJPEGWUHVRGBN-UHFFFAOYSA-J 0.000 description 1
- AETLIPLCBDMJOD-UHFFFAOYSA-J tetrachlorotitanium;tris(2-methylpropyl)alumane Chemical compound Cl[Ti](Cl)(Cl)Cl.CC(C)C[Al](CC(C)C)CC(C)C AETLIPLCBDMJOD-UHFFFAOYSA-J 0.000 description 1
- MWCFXRVLEYZWBD-UHFFFAOYSA-N tetralithium;iron(2+);hexacyanide Chemical compound [Li+].[Li+].[Li+].[Li+].[Fe+2].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] MWCFXRVLEYZWBD-UHFFFAOYSA-N 0.000 description 1
- XOGGUFAVLNCTRS-UHFFFAOYSA-N tetrapotassium;iron(2+);hexacyanide Chemical compound [K+].[K+].[K+].[K+].[Fe+2].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] XOGGUFAVLNCTRS-UHFFFAOYSA-N 0.000 description 1
- 238000005829 trimerization reaction Methods 0.000 description 1
- UYPYRKYUKCHHIB-UHFFFAOYSA-N trimethylamine N-oxide Chemical compound C[N+](C)(C)[O-] UYPYRKYUKCHHIB-UHFFFAOYSA-N 0.000 description 1
- 229940113165 trimethylolpropane Drugs 0.000 description 1
- ZMBHCYHQLYEYDV-UHFFFAOYSA-N trioctylphosphine oxide Chemical compound CCCCCCCCP(=O)(CCCCCCCC)CCCCCCCC ZMBHCYHQLYEYDV-UHFFFAOYSA-N 0.000 description 1
- BPLUKJNHPBNVQL-UHFFFAOYSA-N triphenylarsine Chemical compound C1=CC=CC=C1[As](C=1C=CC=CC=1)C1=CC=CC=C1 BPLUKJNHPBNVQL-UHFFFAOYSA-N 0.000 description 1
- VYNGFCUGSYEOOZ-UHFFFAOYSA-N triphenylphosphine sulfide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=S)C1=CC=CC=C1 VYNGFCUGSYEOOZ-UHFFFAOYSA-N 0.000 description 1
- BYGOPQKDHGXNCD-UHFFFAOYSA-N tripotassium;iron(3+);hexacyanide Chemical compound [K+].[K+].[K+].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] BYGOPQKDHGXNCD-UHFFFAOYSA-N 0.000 description 1
- DCXPBOFGQPCWJY-UHFFFAOYSA-N trisodium;iron(3+);hexacyanide Chemical compound [Na+].[Na+].[Na+].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] DCXPBOFGQPCWJY-UHFFFAOYSA-N 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- CRUISIDZTHMGJT-UHFFFAOYSA-L zinc;dichloride;hydrochloride Chemical compound Cl.[Cl-].[Cl-].[Zn+2] CRUISIDZTHMGJT-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/40—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the curing agents used
- C08G59/4007—Curing agents not provided for by the groups C08G59/42 - C08G59/66
- C08G59/4014—Nitrogen containing compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Epoxy Resins (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP172732/1981 | 1981-10-30 | ||
| JP56172732A JPS5874720A (ja) | 1981-10-30 | 1981-10-30 | 耐熱性樹脂の製法 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1197647A true CA1197647A (en) | 1985-12-03 |
Family
ID=15947287
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000414295A Expired CA1197647A (en) | 1981-10-30 | 1982-10-27 | Thermosetting resin composition and prepolymer thereof |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4448940A (enExample) |
| EP (1) | EP0078503B1 (enExample) |
| JP (1) | JPS5874720A (enExample) |
| CA (1) | CA1197647A (enExample) |
| DE (1) | DE3269450D1 (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4618712A (en) * | 1982-02-23 | 1986-10-21 | Ciba-Geigy Corporation | N-cyanocarboxylic acid amides, processes for their preparation and their use |
| US4487915A (en) * | 1984-02-02 | 1984-12-11 | The Dow Chemical Company | Hydroxy aromatic oligomers containing triazine and oxazoline groups and epoxy resins prepared therefrom |
| US4506063A (en) * | 1984-02-22 | 1985-03-19 | The Dow Chemical Company | Advanced epoxy resins containing triazine or both triazine and oxazoline groups |
| US4609686A (en) * | 1985-04-19 | 1986-09-02 | The Standard Oil Company | 100 percent solids epoxy, nitrile coating compositions and method of making same |
| US4619986A (en) * | 1985-06-28 | 1986-10-28 | The United States Of America As Represented By The Secretary Of The Navy | Epoxy phthalonitrile polymers |
| CA1312040C (en) * | 1985-12-19 | 1992-12-29 | Joseph Victor Koleske | Conformal coatings cured with actinic radiation |
| US5939508A (en) * | 1995-09-01 | 1999-08-17 | The United States Of America As Represented By The Secretary Of The Navy | High temperature epoxy-phthalonitrile blends |
| US7204574B2 (en) * | 2004-06-30 | 2007-04-17 | Lexmark International, Inc. | Polyimide thickfilm flow feature photoresist and method of applying same |
| JP5467720B2 (ja) * | 2007-12-28 | 2014-04-09 | リンテック株式会社 | 粘接着剤組成物、粘接着シートおよび半導体装置の製造方法 |
| US10329759B2 (en) | 2012-09-17 | 2019-06-25 | Steelcase Inc. | Floor-to-ceiling partition wall assembly |
| US9506247B2 (en) | 2014-03-28 | 2016-11-29 | Steelcase Inc. | Transparent panel system for partitions |
| JP6724144B2 (ja) * | 2016-01-07 | 2020-07-15 | エルジー・ケム・リミテッド | フタロニトリル樹脂 |
| KR102118628B1 (ko) * | 2017-09-22 | 2020-06-03 | 주식회사 엘지화학 | 프탈로니트릴 수지 |
| CA3154312A1 (en) * | 2019-10-31 | 2021-05-06 | Huntsman Advanced Materials Americas Llc | Phthalonitrile resins, methods of making same and compositions thereof |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE527446A (enExample) * | 1953-03-30 | |||
| US3091595A (en) * | 1956-03-22 | 1963-05-28 | Shell Oil Co | Cyano-substituted polyamides and their use as curing agents for polyepoxides |
| GB1320683A (en) * | 1969-09-29 | 1973-06-20 | Ici Ltd | Organic cyanamides |
| US3784508A (en) * | 1972-09-15 | 1974-01-08 | Dow Chemical Co | Rapid cure polyepoxide oxazine or oxazoline systems |
| US3960813A (en) * | 1974-02-13 | 1976-06-01 | Atlantic Richfield Company | Zinc chloride as catalyst for epoxy/adnc blends |
| CH630652A5 (de) * | 1977-10-25 | 1982-06-30 | Ciba Geigy Ag | Verfahren zur herstellung gehaerteter formkoerper auf basis von epoxidharzen und haertern fuer epoxidharze. |
| DE2907195A1 (de) * | 1979-02-23 | 1980-08-28 | Tschernichov | Waermebestaendiges material |
| CH637411A5 (de) * | 1979-04-20 | 1983-07-29 | Ciba Geigy Ag | Epoxidharz, haerter und haertungsbeschleuniger enthaltende, lagerfaehige homogene mischung und deren verwendung zur herstellung gehaerteter erzeugnisse. |
| GB2028338B (en) * | 1979-08-13 | 1982-10-13 | Ciba Geigy Ag | Cyanamides of organic primary amines useful as epoxy curing agents |
| JPS5690827A (en) * | 1979-12-26 | 1981-07-23 | Toshiba Corp | Heat-resistant resin composition |
| US4379728A (en) * | 1982-02-04 | 1983-04-12 | W. R. Grace & Co. | Cyanourea compounds or polymers thereof as epoxy resin curing agents |
-
1981
- 1981-10-30 JP JP56172732A patent/JPS5874720A/ja active Granted
-
1982
- 1982-10-26 US US06/436,720 patent/US4448940A/en not_active Expired - Lifetime
- 1982-10-27 CA CA000414295A patent/CA1197647A/en not_active Expired
- 1982-10-27 EP EP82109938A patent/EP0078503B1/en not_active Expired
- 1982-10-27 DE DE8282109938T patent/DE3269450D1/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE3269450D1 (en) | 1986-04-03 |
| EP0078503A1 (en) | 1983-05-11 |
| JPH0356254B2 (enExample) | 1991-08-27 |
| JPS5874720A (ja) | 1983-05-06 |
| EP0078503B1 (en) | 1986-02-26 |
| US4448940A (en) | 1984-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1197647A (en) | Thermosetting resin composition and prepolymer thereof | |
| US4153621A (en) | Glycidyl ethers derived from 3,3',5,5'-tetraalkyl-4,4'-dihydroxybiphenyl | |
| US3245950A (en) | Epoxy resin compositions and cured products obtained therefrom | |
| TW201816006A (zh) | 可固化環氧組成物 | |
| CN109563017A (zh) | 包合化合物及其制备方法以及其用途 | |
| JPH10509999A (ja) | 多官能性シアネートエステルとエポキシのブレンド物 | |
| US3383360A (en) | Diepoxide ethers of azophenolic compounds and resins therefrom | |
| US4619986A (en) | Epoxy phthalonitrile polymers | |
| US3793248A (en) | Adducts,containing epoxide groups,from polyepoxide compounds and binuclear n-heterocyclic compounds | |
| JPS6173719A (ja) | 新規なエポキシ樹脂組成物 | |
| US3395121A (en) | Curing epoxy resins with boron trichloride-tertiary amine complexes | |
| US5892111A (en) | Cure-accelerator for epoxy resin | |
| US3642938A (en) | Storage stable heat-currable soluble and fusible precondenates based on polyepoxide compounds acid polyesters and anhydride curing agents | |
| JPH0670028B2 (ja) | グリシジルオキシジケトン及びその製造方法 | |
| US3798242A (en) | N,n'-diglycidyl-dicarboxylic acid dianilides | |
| KR0139001B1 (ko) | 방향족 디아민 경화제를 포함하는 에폭시 수지 조성물 | |
| US4713428A (en) | Branched polyesters | |
| US3795658A (en) | Epoxy resins from dimethyladamantane bisphenols | |
| JPH0340052B2 (enExample) | ||
| CA1182948A (en) | Curable epoxy resins | |
| US3386924A (en) | Curing polyepoxy compounds with tetrahydrotricyclopentadienylene diamine | |
| US3799894A (en) | Adducts,containing epoxide groups,from polyepoxide compounds and binuclear n-heterocyclic compounds | |
| US4038338A (en) | New polyepoxide-polysiloxane compounds | |
| US4158090A (en) | Epoxy resin compositions (case B) containing cumene-maleic anhydride residue | |
| US3931058A (en) | Polyglycidyl compounds, processes for their manufacture and use |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |