CA1191139A - Aroyl amino acids - Google Patents
Aroyl amino acidsInfo
- Publication number
- CA1191139A CA1191139A CA000392790A CA392790A CA1191139A CA 1191139 A CA1191139 A CA 1191139A CA 000392790 A CA000392790 A CA 000392790A CA 392790 A CA392790 A CA 392790A CA 1191139 A CA1191139 A CA 1191139A
- Authority
- CA
- Canada
- Prior art keywords
- hydrogen
- alkyl
- carbon atoms
- hydroxy
- cycloalkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000005239 aroylamino group Chemical group 0.000 title 1
- -1 nitro, carboxy, cyano, sulfonamido Chemical group 0.000 claims abstract description 57
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 38
- 239000001257 hydrogen Substances 0.000 claims abstract description 38
- 150000001875 compounds Chemical class 0.000 claims abstract description 30
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 27
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 27
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 25
- 125000001589 carboacyl group Chemical group 0.000 claims abstract description 24
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 19
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 18
- 125000003282 alkyl amino group Chemical group 0.000 claims abstract description 18
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 18
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 18
- 150000002367 halogens Chemical class 0.000 claims abstract description 18
- 125000004663 dialkyl amino group Chemical group 0.000 claims abstract description 17
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 15
- 125000003118 aryl group Chemical group 0.000 claims abstract description 15
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 15
- 125000001424 substituent group Chemical group 0.000 claims abstract description 15
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 14
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 11
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 10
- 239000011593 sulfur Chemical group 0.000 claims abstract description 10
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract description 9
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims abstract description 8
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims abstract description 8
- 125000003435 aroyl group Chemical group 0.000 claims abstract description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 5
- 125000003396 thiol group Chemical group [H]S* 0.000 claims abstract description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 4
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 claims abstract description 4
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 4
- 239000001301 oxygen Substances 0.000 claims abstract description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 45
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 32
- 125000004432 carbon atom Chemical group C* 0.000 claims description 31
- 238000000034 method Methods 0.000 claims description 30
- 238000006243 chemical reaction Methods 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 21
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 9
- 125000005842 heteroatom Chemical group 0.000 claims description 8
- 239000003513 alkali Substances 0.000 claims description 7
- 231100000252 nontoxic Toxicity 0.000 claims description 7
- 230000003000 nontoxic effect Effects 0.000 claims description 7
- AJWUSVUOAIUDGZ-UHFFFAOYSA-N tert-butyl 2-(cyclopentylamino)acetate Chemical compound CC(C)(C)OC(=O)CNC1CCCC1 AJWUSVUOAIUDGZ-UHFFFAOYSA-N 0.000 claims description 7
- 150000001408 amides Chemical class 0.000 claims description 5
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 4
- 125000002541 furyl group Chemical group 0.000 claims description 4
- 230000007062 hydrolysis Effects 0.000 claims description 4
- 238000006460 hydrolysis reaction Methods 0.000 claims description 4
- 230000020477 pH reduction Effects 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 125000001544 thienyl group Chemical group 0.000 claims description 4
- ZJCWYBKMXXKHOK-UHFFFAOYSA-N 2-[(2-acetylbenzenecarbothioyl)-cyclopentylamino]acetic acid Chemical compound CC(=O)C1=CC=CC=C1C(=S)N(CC(O)=O)C1CCCC1 ZJCWYBKMXXKHOK-UHFFFAOYSA-N 0.000 claims description 3
- GJYQKLYQLSFBPR-UHFFFAOYSA-N 2-[cyclopentyl-(3-methoxy-2-sulfanylbenzoyl)amino]acetic acid Chemical compound COC1=CC=CC(C(=O)N(CC(O)=O)C2CCCC2)=C1S GJYQKLYQLSFBPR-UHFFFAOYSA-N 0.000 claims description 3
- 150000001413 amino acids Chemical class 0.000 claims description 3
- 238000000605 extraction Methods 0.000 claims description 3
- 238000006467 substitution reaction Methods 0.000 claims description 3
- VZMSMVNCEWNQRH-UHFFFAOYSA-N 2-acetylbenzenecarbothioic s-acid Chemical compound CC(=O)C1=CC=CC=C1C(O)=S VZMSMVNCEWNQRH-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 230000029936 alkylation Effects 0.000 claims description 2
- 238000005804 alkylation reaction Methods 0.000 claims description 2
- 238000010640 amide synthesis reaction Methods 0.000 claims description 2
- 239000002585 base Substances 0.000 claims description 2
- 238000006396 nitration reaction Methods 0.000 claims description 2
- 238000006277 sulfonation reaction Methods 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 9
- 238000002360 preparation method Methods 0.000 claims 4
- 125000005493 quinolyl group Chemical group 0.000 claims 3
- HWMUVZBRGKAJCZ-UHFFFAOYSA-N 2-[(3-chloro-2-sulfanylbenzoyl)-cyclopentylamino]acetic acid Chemical compound C=1C=CC(Cl)=C(S)C=1C(=O)N(CC(=O)O)C1CCCC1 HWMUVZBRGKAJCZ-UHFFFAOYSA-N 0.000 claims 2
- WXDNZGYVWOUYAC-UHFFFAOYSA-N 2-[cyclopentyl-[2-sulfanyl-3-(trifluoromethyl)benzoyl]amino]acetic acid Chemical compound C=1C=CC(C(F)(F)F)=C(S)C=1C(=O)N(CC(=O)O)C1CCCC1 WXDNZGYVWOUYAC-UHFFFAOYSA-N 0.000 claims 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims 2
- RGULWHHARZAWTP-UHFFFAOYSA-N 2-[(2-acetylsulfanyl-3-chlorobenzoyl)-cyclopentylamino]acetic acid Chemical compound CC(=O)SC1=C(Cl)C=CC=C1C(=O)N(CC(O)=O)C1CCCC1 RGULWHHARZAWTP-UHFFFAOYSA-N 0.000 claims 1
- DJLYZXNJMGPNEY-UHFFFAOYSA-N 2-[(2-acetylsulfanyl-3-methoxybenzoyl)-cyclopentylamino]acetic acid Chemical compound COC1=CC=CC(C(=O)N(CC(O)=O)C2CCCC2)=C1SC(C)=O DJLYZXNJMGPNEY-UHFFFAOYSA-N 0.000 claims 1
- JLELLEVRYCFOKF-UHFFFAOYSA-N 2-acetylsulfanyl-3-chlorobenzoic acid Chemical compound CC(=O)SC1=C(Cl)C=CC=C1C(O)=O JLELLEVRYCFOKF-UHFFFAOYSA-N 0.000 claims 1
- 230000010933 acylation Effects 0.000 claims 1
- 238000005917 acylation reaction Methods 0.000 claims 1
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 claims 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 abstract description 3
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 abstract description 3
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 abstract description 3
- 230000002401 inhibitory effect Effects 0.000 abstract description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 51
- 239000000243 solution Substances 0.000 description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 32
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 30
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 20
- 229940093499 ethyl acetate Drugs 0.000 description 17
- 235000019439 ethyl acetate Nutrition 0.000 description 17
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 15
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- 239000012267 brine Substances 0.000 description 14
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 14
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 13
- 239000000047 product Substances 0.000 description 13
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- 229960000583 acetic acid Drugs 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 12
- 239000003921 oil Substances 0.000 description 11
- 235000019198 oils Nutrition 0.000 description 11
- 239000000284 extract Substances 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 7
- 235000011167 hydrochloric acid Nutrition 0.000 description 7
- 229960000443 hydrochloric acid Drugs 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 229910052725 zinc Inorganic materials 0.000 description 7
- 239000011701 zinc Substances 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000012362 glacial acetic acid Substances 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000002002 slurry Substances 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 235000009518 sodium iodide Nutrition 0.000 description 5
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 5
- 235000019345 sodium thiosulphate Nutrition 0.000 description 5
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 229940048181 sodium sulfide nonahydrate Drugs 0.000 description 4
- WMDLZMCDBSJMTM-UHFFFAOYSA-M sodium;sulfanide;nonahydrate Chemical compound O.O.O.O.O.O.O.O.O.[Na+].[SH-] WMDLZMCDBSJMTM-UHFFFAOYSA-M 0.000 description 4
- 239000005711 Benzoic acid Substances 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 239000012670 alkaline solution Substances 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000006482 condensation reaction Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 229940001474 sodium thiosulfate Drugs 0.000 description 3
- 238000010792 warming Methods 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- LRHRHAWNXCGABU-UHFFFAOYSA-N 2-(cyclopentylazaniumyl)acetate Chemical compound OC(=O)CNC1CCCC1 LRHRHAWNXCGABU-UHFFFAOYSA-N 0.000 description 2
- LWUAMROXVQLJKA-UHFFFAOYSA-N 2-amino-3-chlorobenzoic acid Chemical compound NC1=C(Cl)C=CC=C1C(O)=O LWUAMROXVQLJKA-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 206010020772 Hypertension Diseases 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229940022663 acetate Drugs 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 2
- 229940005991 chloric acid Drugs 0.000 description 2
- 238000011097 chromatography purification Methods 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 239000013058 crude material Substances 0.000 description 2
- 230000029087 digestion Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 2
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 2
- XBPKRVHTESHFAA-LURJTMIESA-N (2s)-2-azaniumyl-2-cyclopentylacetate Chemical compound OC(=O)[C@@H](N)C1CCCC1 XBPKRVHTESHFAA-LURJTMIESA-N 0.000 description 1
- SCGAYIBESQGFOA-UHFFFAOYSA-N 2-[[3-(2-chloroacetyl)-2-hydroxybenzoyl]-cyclopentylamino]acetic acid Chemical compound C=1C=CC(C(=O)CCl)=C(O)C=1C(=O)N(CC(=O)O)C1CCCC1 SCGAYIBESQGFOA-UHFFFAOYSA-N 0.000 description 1
- GHKOLCAPLKXQCI-UHFFFAOYSA-N 2-acetylsulfanyl-3-(trifluoromethyl)benzoic acid Chemical compound CC(=O)SC1=C(C(O)=O)C=CC=C1C(F)(F)F GHKOLCAPLKXQCI-UHFFFAOYSA-N 0.000 description 1
- VNUQOLNYYXBRST-UHFFFAOYSA-N 2-acetylsulfanyl-3-methoxybenzoic acid Chemical compound COC1=CC=CC(C(O)=O)=C1SC(C)=O VNUQOLNYYXBRST-UHFFFAOYSA-N 0.000 description 1
- CGMMPMYKMDITEA-UHFFFAOYSA-N 2-ethylbenzoic acid Chemical compound CCC1=CC=CC=C1C(O)=O CGMMPMYKMDITEA-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- QJQRWEGBIBQJSV-UHFFFAOYSA-N 3-(2-chloroacetyl)-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=CC(C(=O)CCl)=C1O QJQRWEGBIBQJSV-UHFFFAOYSA-N 0.000 description 1
- MIGXOSUJYNRJJO-UHFFFAOYSA-N 3-chloro-2-sulfanylbenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1S MIGXOSUJYNRJJO-UHFFFAOYSA-N 0.000 description 1
- FTQMNOFVPBFDPF-UHFFFAOYSA-N 3-methoxy-2-sulfanylbenzoic acid Chemical compound COC1=CC=CC(C(O)=O)=C1S FTQMNOFVPBFDPF-UHFFFAOYSA-N 0.000 description 1
- SXOPCLUOUFQBJV-UHFFFAOYSA-N 3-methoxyanthranilic acid Chemical compound COC1=CC=CC(C(O)=O)=C1N SXOPCLUOUFQBJV-UHFFFAOYSA-N 0.000 description 1
- MXLDJTXXAYVWDF-UHFFFAOYSA-N 7-(trifluoromethyl)-1h-indole-2,3-dione Chemical compound FC(F)(F)C1=CC=CC2=C1NC(=O)C2=O MXLDJTXXAYVWDF-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 1
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- QSACCXVHEVWNMX-UHFFFAOYSA-N N-acetylanthranilic acid Chemical compound CC(=O)NC1=CC=CC=C1C(O)=O QSACCXVHEVWNMX-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 1
- 150000005826 halohydrocarbons Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- HVFSJXUIRWUHRG-UHFFFAOYSA-N oic acid Natural products C1CC2C3CC=C4CC(OC5C(C(O)C(O)C(CO)O5)O)CC(O)C4(C)C3CCC2(C)C1C(C)C(O)CC(C)=C(C)C(=O)OC1OC(COC(C)=O)C(O)C(O)C1OC(C(C1O)O)OC(COC(C)=O)C1OC1OC(CO)C(O)C(O)C1O HVFSJXUIRWUHRG-UHFFFAOYSA-N 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229940001593 sodium carbonate Drugs 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C231/00—Preparation of carboxylic acid amides
- C07C231/02—Preparation of carboxylic acid amides from carboxylic acids or from esters, anhydrides, or halides thereof by reaction with ammonia or amines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C327/00—Thiocarboxylic acids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/219,051 US4440941A (en) | 1980-12-22 | 1980-12-22 | Aroyl-aminoacids, amides and esters thereof |
| US219,051 | 1980-12-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1191139A true CA1191139A (en) | 1985-07-30 |
Family
ID=22817640
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000392790A Expired CA1191139A (en) | 1980-12-22 | 1981-12-21 | Aroyl amino acids |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4440941A (enExample) |
| EP (1) | EP0054936B1 (enExample) |
| JP (1) | JPS57131749A (enExample) |
| KR (1) | KR830007542A (enExample) |
| AT (1) | ATE20234T1 (enExample) |
| AU (1) | AU546887B2 (enExample) |
| CA (1) | CA1191139A (enExample) |
| DE (1) | DE3174787D1 (enExample) |
| ES (1) | ES508706A0 (enExample) |
| IE (1) | IE52164B1 (enExample) |
| IL (1) | IL64616A (enExample) |
| NZ (1) | NZ199358A (enExample) |
| ZA (1) | ZA818870B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3276110D1 (en) * | 1981-03-04 | 1987-05-27 | Ici Plc | Amide derivatives, processes for preparing them, their use as fungicides and pesticidal compositions containing them |
| US4717736A (en) * | 1984-01-23 | 1988-01-05 | Merck Frosst Canada, Inc. | Antagonists of slow reacting substances of anaphylaxis |
| US5240957A (en) * | 1984-01-31 | 1993-08-31 | Astra Lakemedel Akteibolag | Oxysalicylamido derivatives |
| US4560506A (en) * | 1984-05-25 | 1985-12-24 | E. R. Squibb & Sons, Inc. | Mercaptocycloalkylcarbonyl and mercaptoarylcarbonyl dipeptides |
| US4647555A (en) * | 1984-10-25 | 1987-03-03 | The United States Of America As Represented By The Secretary Of The Army | Esters of boron analogues of amino acids |
| GB8704671D0 (en) * | 1987-02-27 | 1987-04-01 | Shell Int Research | Glycine compounds |
| EP0284510A3 (en) * | 1987-03-24 | 1990-08-22 | Asahi Breweries, Ltd. | N-[N alpha-(1(S)-carboxy-3-cyclohexyl-propyl)-1-lysyl] N-cyclopentylglycine as antihypertensives |
| EP0384636A1 (en) * | 1989-02-21 | 1990-08-29 | FISONS plc | Pharmaceutically active compounds |
| US5801195A (en) * | 1994-12-30 | 1998-09-01 | Celgene Corporation | Immunotherapeutic aryl amides |
| EP1645288A1 (en) * | 2004-10-07 | 2006-04-12 | CTG Pharma S.r.l. | New nuclear transcription factors regulators |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2895992A (en) * | 1959-07-21 | Process for the production of benzoic | ||
| US2603617A (en) * | 1946-08-30 | 1952-07-15 | American Cyanamid Co | Plasticizing natural and synthetic elastomers by incorporation of n-isopropyl thiosalicylamide |
| NL281394A (enExample) * | 1961-07-25 | |||
| JPS5530506B2 (enExample) * | 1973-04-17 | 1980-08-11 | ||
| JPS5530505B2 (enExample) * | 1973-02-14 | 1980-08-11 | ||
| LU78805A1 (de) * | 1977-12-30 | 1979-07-20 | Byk Gulden Lomberg Chem Fab | Acylhydrocarbylaminoalkansaeuren,ihre herstellung und verwendung sowie sie enthaltende arzneimittel |
| DK244979A (da) * | 1978-06-14 | 1979-12-15 | Byk Gulden Lomberg Chem Fab | Fremgangsmaade til fremstilling af substituerede aminosyrer |
| EP0006217B1 (de) * | 1978-06-14 | 1982-03-31 | Byk Gulden Lomberg Chemische Fabrik GmbH | Substituierte Aminoalkansäuren, ihre Verwendung und Herstellung und sie enthaltende Arzneimittel |
| JPS5742662A (en) * | 1980-08-29 | 1982-03-10 | Chugai Pharmaceut Co Ltd | Benzoic acid amide derivative |
-
1980
- 1980-12-22 US US06/219,051 patent/US4440941A/en not_active Expired - Fee Related
-
1981
- 1981-12-18 EP EP81110594A patent/EP0054936B1/en not_active Expired
- 1981-12-18 AT AT81110594T patent/ATE20234T1/de not_active IP Right Cessation
- 1981-12-18 DE DE8181110594T patent/DE3174787D1/de not_active Expired
- 1981-12-21 CA CA000392790A patent/CA1191139A/en not_active Expired
- 1981-12-22 JP JP56206268A patent/JPS57131749A/ja active Granted
- 1981-12-22 ES ES508706A patent/ES508706A0/es active Granted
- 1981-12-22 AU AU78761/81A patent/AU546887B2/en not_active Ceased
- 1981-12-22 ZA ZA818870A patent/ZA818870B/xx unknown
- 1981-12-22 IE IE3039/81A patent/IE52164B1/en unknown
- 1981-12-22 KR KR1019810005062A patent/KR830007542A/ko not_active Withdrawn
- 1981-12-22 IL IL64616A patent/IL64616A/xx unknown
- 1981-12-22 NZ NZ199358A patent/NZ199358A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EP0054936B1 (en) | 1986-06-04 |
| IE813039L (en) | 1982-06-22 |
| IL64616A0 (en) | 1982-03-31 |
| KR830007542A (ko) | 1983-10-21 |
| IL64616A (en) | 1985-11-29 |
| JPH0231707B2 (enExample) | 1990-07-16 |
| ES8300318A1 (es) | 1982-11-01 |
| ZA818870B (en) | 1982-11-24 |
| JPS57131749A (en) | 1982-08-14 |
| EP0054936A1 (en) | 1982-06-30 |
| US4440941A (en) | 1984-04-03 |
| ES508706A0 (es) | 1982-11-01 |
| AU546887B2 (en) | 1985-09-26 |
| AU7876181A (en) | 1982-07-01 |
| ATE20234T1 (de) | 1986-06-15 |
| IE52164B1 (en) | 1987-07-22 |
| DE3174787D1 (de) | 1986-07-10 |
| NZ199358A (en) | 1985-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ244985A (en) | Peptide compounds, preparation and pharmaceutical compositions thereof | |
| CA1191139A (en) | Aroyl amino acids | |
| US4628084A (en) | Process for 3-acylamino benzodiazepines | |
| WO2019075976A1 (zh) | 一种制备盐酸罗沙替丁醋酸酯及中间体的方法 | |
| Hiskey et al. | Sulfur-Containing Polypeptides. II. Selective Removal of S-Protective Groups from Some L-Cysteinyl-L-cysteine Derivatives1, 2 | |
| KR20050061490A (ko) | 티에노피롤 유도체의 제조 방법과 중간체 | |
| JPH033658B2 (enExample) | ||
| EP0372470A2 (en) | Novel alpha-cyano-beta-oxopropionamides | |
| US5030738A (en) | Synthesis of antiulcer compounds | |
| CN110981813A (zh) | 一种2-氰基-5-芳基-1h-咪唑类化合物的合成方法 | |
| JPH0631218B2 (ja) | 新規な2‐アミノチオフエン誘導体 | |
| US5994593A (en) | Synthesis and purification of 3,3-dimethylbutyraldehyde via hydrolysis of 1,1-dichloro-3,3-dimethylbutane or 1-bromo-1-chloro-3,3-dimethylbutane | |
| US5789597A (en) | Process for the preparation of compounds having ACE inhibitory action and intermediates in said process | |
| JPH0753711B2 (ja) | 新規なピロリノン類及びその製法 | |
| Sudo et al. | Reactions of alicyclic aminonitrile | |
| US4213905A (en) | Preparation of 5-aroyl-1-loweralkylpyrrole-2-acetic acid salts | |
| CN111100071A (zh) | 一种合成2-氰基-5-芳基-1h-咪唑类化合物的方法 | |
| Wright et al. | A synthesis of 2-aryl-3-hydroxybenzothiophenes and analogs by the base promoted cyclization of N-phenyl-2-(benzylthio) benzamides | |
| CA1154027A (en) | Derivatives of benzo¬b| furan | |
| US4479950A (en) | Aroylaminoacid disulfides | |
| US4515958A (en) | Process for preparing 1-alkyl-5-mercaptotetrazoles | |
| US4347246A (en) | Antihypertensive lactams | |
| CA1156244A (en) | Process for the preparation of n-[2-(2- thenoyl)thiopropionyl]-glycine | |
| JPH01316352A (ja) | 3‐シアノ‐4‐アリールピロールの製造法 | |
| KR920005828B1 (ko) | 2-[(2-아미노에틸)-티오메틸]-5-디메틸아미노메틸 푸란의 산부가염의 제조방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry | ||
| MKEX | Expiry |
Effective date: 20020730 |