CA1169884A - Process for the isomerization of a halogenated toluene - Google Patents
Process for the isomerization of a halogenated tolueneInfo
- Publication number
- CA1169884A CA1169884A CA000384091A CA384091A CA1169884A CA 1169884 A CA1169884 A CA 1169884A CA 000384091 A CA000384091 A CA 000384091A CA 384091 A CA384091 A CA 384091A CA 1169884 A CA1169884 A CA 1169884A
- Authority
- CA
- Canada
- Prior art keywords
- reaction
- zeolite
- isomerization
- acid form
- catalyst
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 25
- 150000003613 toluenes Chemical class 0.000 title claims abstract description 17
- 238000006317 isomerization reaction Methods 0.000 title claims description 25
- 239000010457 zeolite Substances 0.000 claims abstract description 28
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims abstract description 26
- 229910021536 Zeolite Inorganic materials 0.000 claims abstract description 24
- 239000002253 acid Substances 0.000 claims abstract description 15
- 229910052782 aluminium Inorganic materials 0.000 claims description 6
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 5
- 150000001768 cations Chemical class 0.000 claims description 5
- 229910052680 mordenite Inorganic materials 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- -1 rare earth ion Chemical class 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 229910052761 rare earth metal Inorganic materials 0.000 claims description 2
- 229910052710 silicon Inorganic materials 0.000 claims description 2
- 239000010703 silicon Substances 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 abstract description 22
- 238000006243 chemical reaction Methods 0.000 description 22
- 239000000203 mixture Substances 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000005342 ion exchange Methods 0.000 description 6
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 5
- 238000007086 side reaction Methods 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 238000005054 agglomeration Methods 0.000 description 3
- 230000002776 aggregation Effects 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 2
- NPDACUSDTOMAMK-UHFFFAOYSA-N 4-Chlorotoluene Chemical compound CC1=CC=C(Cl)C=C1 NPDACUSDTOMAMK-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 238000001354 calcination Methods 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- NVLHGZIXTRYOKT-UHFFFAOYSA-N 1-chloro-2,3-dimethylbenzene Chemical group CC1=CC=CC(Cl)=C1C NVLHGZIXTRYOKT-UHFFFAOYSA-N 0.000 description 1
- IBSQPLPBRSHTTG-UHFFFAOYSA-N 1-chloro-2-methylbenzene Chemical compound CC1=CC=CC=C1Cl IBSQPLPBRSHTTG-UHFFFAOYSA-N 0.000 description 1
- OSOUNOBYRMOXQQ-UHFFFAOYSA-N 1-chloro-3-methylbenzene Chemical compound CC1=CC=CC(Cl)=C1 OSOUNOBYRMOXQQ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000000748 compression moulding Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011973 solid acid Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- JLQFVGYYVXALAG-CFEVTAHFSA-N yasmin 28 Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1.C([C@]12[C@H]3C[C@H]3[C@H]3[C@H]4[C@@H]([C@]5(CCC(=O)C=C5[C@@H]5C[C@@H]54)C)CC[C@@]31C)CC(=O)O2 JLQFVGYYVXALAG-CFEVTAHFSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/35—Preparation of halogenated hydrocarbons by reactions not affecting the number of carbon or of halogen atoms in the reaction
- C07C17/358—Preparation of halogenated hydrocarbons by reactions not affecting the number of carbon or of halogen atoms in the reaction by isomerisation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP115898/1980 | 1980-08-25 | ||
| JP55115898A JPS5740428A (en) | 1980-08-25 | 1980-08-25 | Isomerization of halogenated toluene |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1169884A true CA1169884A (en) | 1984-06-26 |
Family
ID=14673926
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000384091A Expired CA1169884A (en) | 1980-08-25 | 1981-08-18 | Process for the isomerization of a halogenated toluene |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4368339A (enExample) |
| EP (1) | EP0046665B1 (enExample) |
| JP (1) | JPS5740428A (enExample) |
| CA (1) | CA1169884A (enExample) |
| DE (1) | DE3163885D1 (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS57163327A (en) * | 1981-03-31 | 1982-10-07 | Toray Ind Inc | Isomerizing method of halogenated toluene |
| DE3131682A1 (de) * | 1981-08-11 | 1983-02-24 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von p-chlortoluol und/oder m-chlortoluol |
| JPS59199642A (ja) * | 1983-04-28 | 1984-11-12 | Toray Ind Inc | 2,6−ジクロルトルエンの分離方法 |
| JPS6052042U (ja) * | 1983-09-12 | 1985-04-12 | トヨタ自動車株式会社 | 精密鋳造用造型治具 |
| DE3334674A1 (de) * | 1983-09-24 | 1985-04-11 | Hoechst Ag, 6230 Frankfurt | Verfahren zur isomerisierung von dichlortoluolen |
| JPS60230044A (ja) * | 1984-04-27 | 1985-11-15 | Kurimoto Iron Works Ltd | 水分自動測定装置 |
| DE3569235D1 (en) * | 1984-06-02 | 1989-05-11 | Hoechst Ag | Process for the isomerisation of mono- or dichlorotoluene |
| US4806697A (en) * | 1987-03-25 | 1989-02-21 | Eastman Kodak Company | Selective liquid phase disproportionation catalysts for iodoaromatics |
| US4792641A (en) * | 1987-03-25 | 1988-12-20 | Eastman Kodak Company | Process for preparing iodinated aromatic compounds |
| US4806698A (en) * | 1987-03-25 | 1989-02-21 | Eastman Kodak Company | Liquid phase isomerization of iodoaromatic compounds |
| JPS63315316A (ja) * | 1987-06-19 | 1988-12-23 | Matsuo Kogyosho:Kk | 自動車用換気装置 |
| DE3922035A1 (de) * | 1989-07-05 | 1991-01-17 | Hoechst Ag | Verfahren zur herstellung von 2-chlor- bzw. 2-bromnaphthalin |
| DE4314299A1 (de) * | 1993-04-30 | 1994-11-03 | Bayer Ag | Verfahren zur Herstellung von m-Chloraromaten |
| DE4334437A1 (de) * | 1993-10-08 | 1995-04-13 | Hoechst Ag | Verfahren zur Herstellung von 1-Brom-3,5-difluorbenzol |
| KR101728410B1 (ko) | 2014-12-03 | 2017-04-20 | 한국세라믹기술원 | 마이크로 다공성 소재를 이용한 파라-카보레인의 제조방법 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3077503A (en) * | 1960-05-02 | 1963-02-12 | Dow Chemical Co | Preparation of o-bromotoluene |
| US3560579A (en) * | 1968-12-20 | 1971-02-02 | Gulf Research Development Co | Process for preparing meta-halotoluene |
| US3742073A (en) * | 1969-12-03 | 1973-06-26 | Gulf Research Development Co | Conversion of chloroaromatics to meta derivatives beyond equilibrium |
-
1980
- 1980-08-25 JP JP55115898A patent/JPS5740428A/ja active Granted
-
1981
- 1981-08-05 US US06/290,238 patent/US4368339A/en not_active Expired - Lifetime
- 1981-08-18 CA CA000384091A patent/CA1169884A/en not_active Expired
- 1981-08-20 EP EP81303809A patent/EP0046665B1/en not_active Expired
- 1981-08-20 DE DE8181303809T patent/DE3163885D1/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5740428A (en) | 1982-03-06 |
| EP0046665B1 (en) | 1984-05-30 |
| US4368339A (en) | 1983-01-11 |
| JPS6215049B2 (enExample) | 1987-04-06 |
| DE3163885D1 (en) | 1984-07-05 |
| EP0046665A1 (en) | 1982-03-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1169884A (en) | Process for the isomerization of a halogenated toluene | |
| EP0130407B1 (en) | Process for producing dimethylamine | |
| US3366578A (en) | Zeolite and method for making the improved zeolite | |
| US4716137A (en) | Process of preparing a catalyst containing activated isomerization sites | |
| EP2047906B1 (en) | Aromatic isomerization catalyst | |
| US4513166A (en) | Process for the low polymerization of isobutene | |
| EP0412623B1 (en) | Process for separating 2-chloro-m-xylene | |
| US3932554A (en) | Isomerization of saturated hydrocarbons with mordenite catalyst containing fluorine and chlorine | |
| JPS6024771B2 (ja) | 改良された異性化法 | |
| JPS6241574B2 (enExample) | ||
| US3873632A (en) | Alkylaromatic hydrocarbon isomerization process | |
| CA1209591A (en) | Process for isomerizing a halogenated toluene | |
| CA1332400C (en) | Zeolite l | |
| US3673267A (en) | Isomerization of cyclohexane in the presence of a mordenite catalyst | |
| US4489216A (en) | Hydrocarbon isomerization | |
| US4754083A (en) | Para selectivity in catalyzed disubstitutions of monosubstituted benzenes containing meta-directing substituents | |
| EP0534019A1 (en) | Isomerization of alkylphenols | |
| US4625061A (en) | Process for preparing cyanamide | |
| CA1274549A (en) | Catalytic treatment process | |
| US4873383A (en) | Method for selective isolation of Dichlorobenzene | |
| US4861928A (en) | Process for the isomerization of dichlorotoluene | |
| KR100537444B1 (ko) | 할로겐화 에틸벤젠의 이성화 방법 | |
| KR960002592B1 (ko) | 트리클로로벤젠의 이성질화 방법 | |
| JPS6248648B2 (enExample) | ||
| AT293355B (de) | Verfahren zur katalytischen Isomerisierung und/oder Disproportionierung von alkylaromatischen Kohlenwasserstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |