CA1164732A - Encapsulated apm and method of preparation - Google Patents
Encapsulated apm and method of preparationInfo
- Publication number
- CA1164732A CA1164732A CA000404097A CA404097A CA1164732A CA 1164732 A CA1164732 A CA 1164732A CA 000404097 A CA000404097 A CA 000404097A CA 404097 A CA404097 A CA 404097A CA 1164732 A CA1164732 A CA 1164732A
- Authority
- CA
- Canada
- Prior art keywords
- cellulose
- methyl ester
- coating material
- particles
- apm
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 42
- 238000002360 preparation method Methods 0.000 title description 6
- IAOZJIPTCAWIRG-QWRGUYRKSA-N aspartame Chemical compound OC(=O)C[C@H](N)C(=O)N[C@H](C(=O)OC)CC1=CC=CC=C1 IAOZJIPTCAWIRG-QWRGUYRKSA-N 0.000 claims abstract description 90
- 238000000576 coating method Methods 0.000 claims abstract description 78
- 239000000463 material Substances 0.000 claims abstract description 77
- 239000011248 coating agent Substances 0.000 claims abstract description 75
- 239000000203 mixture Substances 0.000 claims abstract description 43
- 235000015218 chewing gum Nutrition 0.000 claims abstract description 22
- 229920002678 cellulose Polymers 0.000 claims abstract description 20
- 229940112822 chewing gum Drugs 0.000 claims abstract description 18
- 108010010803 Gelatin Proteins 0.000 claims abstract description 11
- 229920002494 Zein Polymers 0.000 claims abstract description 11
- 238000005538 encapsulation Methods 0.000 claims abstract description 11
- 229920000159 gelatin Polymers 0.000 claims abstract description 11
- 239000008273 gelatin Substances 0.000 claims abstract description 11
- 235000019322 gelatine Nutrition 0.000 claims abstract description 11
- 235000011852 gelatine desserts Nutrition 0.000 claims abstract description 11
- 239000005019 zein Substances 0.000 claims abstract description 11
- 229940093612 zein Drugs 0.000 claims abstract description 11
- 229920002554 vinyl polymer Polymers 0.000 claims abstract description 7
- 239000002245 particle Substances 0.000 claims description 48
- 150000004702 methyl esters Chemical class 0.000 claims description 28
- 239000003765 sweetening agent Substances 0.000 claims description 28
- 239000001913 cellulose Substances 0.000 claims description 18
- 235000010980 cellulose Nutrition 0.000 claims description 18
- 235000003599 food sweetener Nutrition 0.000 claims description 18
- 244000215068 Acacia senegal Species 0.000 claims description 10
- 229920000084 Gum arabic Polymers 0.000 claims description 10
- 239000000205 acacia gum Substances 0.000 claims description 10
- 235000010489 acacia gum Nutrition 0.000 claims description 10
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 claims description 10
- 235000000346 sugar Nutrition 0.000 claims description 10
- 235000021092 sugar substitutes Nutrition 0.000 claims description 10
- 239000000796 flavoring agent Substances 0.000 claims description 9
- 235000019634 flavors Nutrition 0.000 claims description 9
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 claims description 9
- -1 polyethylene Polymers 0.000 claims description 9
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 claims description 8
- 235000021355 Stearic acid Nutrition 0.000 claims description 8
- 235000013305 food Nutrition 0.000 claims description 8
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 claims description 8
- 239000007787 solid Substances 0.000 claims description 8
- 239000000600 sorbitol Substances 0.000 claims description 8
- 239000008117 stearic acid Substances 0.000 claims description 8
- 239000001856 Ethyl cellulose Substances 0.000 claims description 7
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 claims description 7
- 239000004952 Polyamide Substances 0.000 claims description 7
- 229920001249 ethyl cellulose Polymers 0.000 claims description 7
- 235000019325 ethyl cellulose Nutrition 0.000 claims description 7
- 229920002647 polyamide Polymers 0.000 claims description 7
- 229920000098 polyolefin Polymers 0.000 claims description 6
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 6
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 6
- 239000001993 wax Substances 0.000 claims description 6
- SATHPVQTSSUFFW-UHFFFAOYSA-N 4-[6-[(3,5-dihydroxy-4-methoxyoxan-2-yl)oxymethyl]-3,5-dihydroxy-4-methoxyoxan-2-yl]oxy-2-(hydroxymethyl)-6-methyloxane-3,5-diol Chemical compound OC1C(OC)C(O)COC1OCC1C(O)C(OC)C(O)C(OC2C(C(CO)OC(C)C2O)O)O1 SATHPVQTSSUFFW-UHFFFAOYSA-N 0.000 claims description 5
- 229920000189 Arabinogalactan Polymers 0.000 claims description 5
- 239000001904 Arabinogalactan Substances 0.000 claims description 5
- 229920002134 Carboxymethyl cellulose Polymers 0.000 claims description 5
- 229920000623 Cellulose acetate phthalate Polymers 0.000 claims description 5
- 239000004354 Hydroxyethyl cellulose Substances 0.000 claims description 5
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 claims description 5
- 239000000020 Nitrocellulose Substances 0.000 claims description 5
- 239000004698 Polyethylene Substances 0.000 claims description 5
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 claims description 5
- 235000019312 arabinogalactan Nutrition 0.000 claims description 5
- 235000013871 bee wax Nutrition 0.000 claims description 5
- 239000012166 beeswax Substances 0.000 claims description 5
- 239000001768 carboxy methyl cellulose Substances 0.000 claims description 5
- 235000010948 carboxy methyl cellulose Nutrition 0.000 claims description 5
- 239000008112 carboxymethyl-cellulose Substances 0.000 claims description 5
- 239000004203 carnauba wax Substances 0.000 claims description 5
- 235000013869 carnauba wax Nutrition 0.000 claims description 5
- 229940081734 cellulose acetate phthalate Drugs 0.000 claims description 5
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 claims description 5
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 claims description 5
- 229920001220 nitrocellulos Polymers 0.000 claims description 5
- 239000012188 paraffin wax Substances 0.000 claims description 5
- 229920000193 polymethacrylate Polymers 0.000 claims description 5
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 5
- 239000012177 spermaceti Substances 0.000 claims description 5
- 229940084106 spermaceti Drugs 0.000 claims description 5
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 claims description 4
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 claims description 4
- 239000004067 bulking agent Substances 0.000 claims description 4
- 229940075529 glyceryl stearate Drugs 0.000 claims description 4
- 239000001863 hydroxypropyl cellulose Substances 0.000 claims description 4
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 claims description 4
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 claims description 4
- 150000008163 sugars Chemical class 0.000 claims description 2
- 230000008021 deposition Effects 0.000 claims 9
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 claims 4
- 229920000609 methyl cellulose Polymers 0.000 claims 4
- 239000001923 methylcellulose Substances 0.000 claims 4
- 235000010981 methylcellulose Nutrition 0.000 claims 4
- 229920000573 polyethylene Polymers 0.000 claims 4
- 229940014259 gelatin Drugs 0.000 claims 3
- 229960004274 stearic acid Drugs 0.000 claims 3
- 229940012831 stearyl alcohol Drugs 0.000 claims 3
- 235000019809 paraffin wax Nutrition 0.000 claims 2
- 235000019271 petrolatum Nutrition 0.000 claims 2
- 238000009472 formulation Methods 0.000 abstract description 7
- 239000008122 artificial sweetener Substances 0.000 abstract description 4
- 235000021311 artificial sweeteners Nutrition 0.000 abstract description 4
- 238000010348 incorporation Methods 0.000 abstract description 4
- 229920003086 cellulose ether Polymers 0.000 abstract 1
- 239000008393 encapsulating agent Substances 0.000 description 5
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 4
- 239000004014 plasticizer Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 229940077731 carbohydrate nutrients Drugs 0.000 description 3
- 150000001720 carbohydrates Chemical class 0.000 description 3
- 235000014633 carbohydrates Nutrition 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 230000001055 chewing effect Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 235000009508 confectionery Nutrition 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- BXRNXXXXHLBUKK-UHFFFAOYSA-N piperazine-2,5-dione Chemical compound O=C1CNC(=O)CN1 BXRNXXXXHLBUKK-UHFFFAOYSA-N 0.000 description 3
- 238000001694 spray drying Methods 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 244000223760 Cinnamomum zeylanicum Species 0.000 description 2
- 108010016626 Dipeptides Proteins 0.000 description 2
- 244000024873 Mentha crispa Species 0.000 description 2
- 235000014749 Mentha crispa Nutrition 0.000 description 2
- 244000246386 Mentha pulegium Species 0.000 description 2
- 235000016257 Mentha pulegium Nutrition 0.000 description 2
- 235000004357 Mentha x piperita Nutrition 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- 235000017803 cinnamon Nutrition 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 235000001050 hortel pimenta Nutrition 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 150000005846 sugar alcohols Chemical class 0.000 description 2
- URAYPUMNDPQOKB-UHFFFAOYSA-N triacetin Chemical compound CC(=O)OCC(OC(C)=O)COC(C)=O URAYPUMNDPQOKB-UHFFFAOYSA-N 0.000 description 2
- LDVVTQMJQSCDMK-UHFFFAOYSA-N 1,3-dihydroxypropan-2-yl formate Chemical compound OCC(CO)OC=O LDVVTQMJQSCDMK-UHFFFAOYSA-N 0.000 description 1
- YZQCXOFQZKCETR-UWVGGRQHSA-N Asp-Phe Chemical compound OC(=O)C[C@H](N)C(=O)N[C@H](C(O)=O)CC1=CC=CC=C1 YZQCXOFQZKCETR-UWVGGRQHSA-N 0.000 description 1
- 235000018185 Betula X alpestris Nutrition 0.000 description 1
- 235000018212 Betula X uliginosa Nutrition 0.000 description 1
- 229920001412 Chicle Polymers 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 240000000896 Dyera costulata Species 0.000 description 1
- 240000001238 Gaultheria procumbens Species 0.000 description 1
- 235000007297 Gaultheria procumbens Nutrition 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 239000004378 Glycyrrhizin Substances 0.000 description 1
- 229920001908 Hydrogenated starch hydrolysate Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- 240000001794 Manilkara zapota Species 0.000 description 1
- 235000011339 Manilkara zapota Nutrition 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 235000007265 Myrrhis odorata Nutrition 0.000 description 1
- 240000004760 Pimpinella anisum Species 0.000 description 1
- 235000012550 Pimpinella anisum Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 244000228451 Stevia rebaudiana Species 0.000 description 1
- 235000006092 Stevia rebaudiana Nutrition 0.000 description 1
- UEDUENGHJMELGK-HYDKPPNVSA-N Stevioside Chemical compound O([C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O[C@]12C(=C)C[C@@]3(C1)CC[C@@H]1[C@@](C)(CCC[C@]1([C@@H]3CC2)C)C(=O)O[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O UEDUENGHJMELGK-HYDKPPNVSA-N 0.000 description 1
- TVXBFESIOXBWNM-UHFFFAOYSA-N Xylitol Natural products OCCC(O)C(O)C(O)CCO TVXBFESIOXBWNM-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- YGCFIWIQZPHFLU-UHFFFAOYSA-N acesulfame Chemical compound CC1=CC(=O)NS(=O)(=O)O1 YGCFIWIQZPHFLU-UHFFFAOYSA-N 0.000 description 1
- 229910000086 alane Inorganic materials 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 108010069205 aspartyl-phenylalanine Proteins 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000015496 breakfast cereal Nutrition 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000011246 composite particle Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 229940109275 cyclamate Drugs 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 235000013365 dairy product Nutrition 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- QGGZBXOADPVUPN-UHFFFAOYSA-N dihydrochalcone Chemical compound C=1C=CC=CC=1C(=O)CCC1=CC=CC=C1 QGGZBXOADPVUPN-UHFFFAOYSA-N 0.000 description 1
- PXLWOFBAEVGBOA-UHFFFAOYSA-N dihydrochalcone Natural products OC1C(O)C(O)C(CO)OC1C1=C(O)C=CC(C(=O)CC(O)C=2C=CC(O)=CC=2)=C1O PXLWOFBAEVGBOA-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000012041 food component Nutrition 0.000 description 1
- 239000005417 food ingredient Substances 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 239000008369 fruit flavor Substances 0.000 description 1
- 125000005908 glyceryl ester group Chemical group 0.000 description 1
- 239000001087 glyceryl triacetate Substances 0.000 description 1
- 235000013773 glyceryl triacetate Nutrition 0.000 description 1
- LPLVUJXQOOQHMX-UHFFFAOYSA-N glycyrrhetinic acid glycoside Natural products C1CC(C2C(C3(CCC4(C)CCC(C)(CC4C3=CC2=O)C(O)=O)C)(C)CC2)(C)C2C(C)(C)C1OC1OC(C(O)=O)C(O)C(O)C1OC1OC(C(O)=O)C(O)C(O)C1O LPLVUJXQOOQHMX-UHFFFAOYSA-N 0.000 description 1
- 229960004949 glycyrrhizic acid Drugs 0.000 description 1
- UYRUBYNTXSDKQT-UHFFFAOYSA-N glycyrrhizic acid Natural products CC1(C)C(CCC2(C)C1CCC3(C)C2C(=O)C=C4C5CC(C)(CCC5(C)CCC34C)C(=O)O)OC6OC(C(O)C(O)C6OC7OC(O)C(O)C(O)C7C(=O)O)C(=O)O UYRUBYNTXSDKQT-UHFFFAOYSA-N 0.000 description 1
- 235000019410 glycyrrhizin Nutrition 0.000 description 1
- LPLVUJXQOOQHMX-QWBHMCJMSA-N glycyrrhizinic acid Chemical compound O([C@@H]1[C@@H](O)[C@H](O)[C@H](O[C@@H]1O[C@@H]1C([C@H]2[C@]([C@@H]3[C@@]([C@@]4(CC[C@@]5(C)CC[C@@](C)(C[C@H]5C4=CC3=O)C(O)=O)C)(C)CC2)(C)CC1)(C)C)C(O)=O)[C@@H]1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O LPLVUJXQOOQHMX-QWBHMCJMSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- HEBKCHPVOIAQTA-UHFFFAOYSA-N meso ribitol Natural products OCC(O)C(O)C(O)CO HEBKCHPVOIAQTA-UHFFFAOYSA-N 0.000 description 1
- 150000001455 metallic ions Chemical class 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000005022 packaging material Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 229940013618 stevioside Drugs 0.000 description 1
- OHHNJQXIOPOJSC-UHFFFAOYSA-N stevioside Natural products CC1(CCCC2(C)C3(C)CCC4(CC3(CCC12C)CC4=C)OC5OC(CO)C(O)C(O)C5OC6OC(CO)C(O)C(O)C6O)C(=O)OC7OC(CO)C(O)C(O)C7O OHHNJQXIOPOJSC-UHFFFAOYSA-N 0.000 description 1
- 235000019202 steviosides Nutrition 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229960002622 triacetin Drugs 0.000 description 1
- 239000000341 volatile oil Substances 0.000 description 1
- 239000000811 xylitol Substances 0.000 description 1
- 235000010447 xylitol Nutrition 0.000 description 1
- HEBKCHPVOIAQTA-SCDXWVJYSA-N xylitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)CO HEBKCHPVOIAQTA-SCDXWVJYSA-N 0.000 description 1
- 229960002675 xylitol Drugs 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23G—COCOA; COCOA PRODUCTS, e.g. CHOCOLATE; SUBSTITUTES FOR COCOA OR COCOA PRODUCTS; CONFECTIONERY; CHEWING GUM; ICE-CREAM; PREPARATION THEREOF
- A23G4/00—Chewing gum
- A23G4/06—Chewing gum characterised by the composition containing organic or inorganic compounds
- A23G4/14—Chewing gum characterised by the composition containing organic or inorganic compounds containing peptides or proteins
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23G—COCOA; COCOA PRODUCTS, e.g. CHOCOLATE; SUBSTITUTES FOR COCOA OR COCOA PRODUCTS; CONFECTIONERY; CHEWING GUM; ICE-CREAM; PREPARATION THEREOF
- A23G4/00—Chewing gum
- A23G4/06—Chewing gum characterised by the composition containing organic or inorganic compounds
- A23G4/10—Chewing gum characterised by the composition containing organic or inorganic compounds characterised by the carbohydrates used, e.g. polysaccharides
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23G—COCOA; COCOA PRODUCTS, e.g. CHOCOLATE; SUBSTITUTES FOR COCOA OR COCOA PRODUCTS; CONFECTIONERY; CHEWING GUM; ICE-CREAM; PREPARATION THEREOF
- A23G4/00—Chewing gum
- A23G4/18—Chewing gum characterised by shape, structure or physical form, e.g. aerated products
- A23G4/20—Composite products, e.g. centre-filled, multi-layer, laminated
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23L—FOODS, FOODSTUFFS OR NON-ALCOHOLIC BEVERAGES, NOT OTHERWISE PROVIDED FOR; PREPARATION OR TREATMENT THEREOF
- A23L27/00—Spices; Flavouring agents or condiments; Artificial sweetening agents; Table salts; Dietetic salt substitutes; Preparation or treatment thereof
- A23L27/30—Artificial sweetening agents
- A23L27/31—Artificial sweetening agents containing amino acids, nucleotides, peptides or derivatives
- A23L27/32—Artificial sweetening agents containing amino acids, nucleotides, peptides or derivatives containing dipeptides or derivatives
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23L—FOODS, FOODSTUFFS OR NON-ALCOHOLIC BEVERAGES, NOT OTHERWISE PROVIDED FOR; PREPARATION OR TREATMENT THEREOF
- A23L27/00—Spices; Flavouring agents or condiments; Artificial sweetening agents; Table salts; Dietetic salt substitutes; Preparation or treatment thereof
- A23L27/70—Fixation, conservation, or encapsulation of flavouring agents
- A23L27/72—Encapsulation
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23V—INDEXING SCHEME RELATING TO FOODS, FOODSTUFFS OR NON-ALCOHOLIC BEVERAGES AND LACTIC OR PROPIONIC ACID BACTERIA USED IN FOODSTUFFS OR FOOD PREPARATION
- A23V2002/00—Food compositions, function of food ingredients or processes for food or foodstuffs
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Polymers & Plastics (AREA)
- Engineering & Computer Science (AREA)
- Food Science & Technology (AREA)
- Health & Medical Sciences (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Nutrition Science (AREA)
- Inorganic Chemistry (AREA)
- Molecular Biology (AREA)
- Confectionery (AREA)
- Seasonings (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US269,081 | 1981-06-02 | ||
| US06/269,081 US4384004A (en) | 1981-06-02 | 1981-06-02 | Encapsulated APM and method of preparation |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1164732A true CA1164732A (en) | 1984-04-03 |
Family
ID=23025716
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000404097A Expired CA1164732A (en) | 1981-06-02 | 1982-05-31 | Encapsulated apm and method of preparation |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4384004A (esLanguage) |
| EP (1) | EP0067595B1 (esLanguage) |
| JP (1) | JPS57202268A (esLanguage) |
| AT (1) | ATE25566T1 (esLanguage) |
| CA (1) | CA1164732A (esLanguage) |
| DE (1) | DE3275496D1 (esLanguage) |
Families Citing this family (173)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3213284C2 (de) * | 1982-04-08 | 1987-01-08 | Winfried 8451 Kümmersbruck Kruppa | Antikaries-Kaugummi |
| EP0111560A4 (en) * | 1982-06-14 | 1987-02-03 | Key Pharma | Sustained release aspirin. |
| WO1984000295A1 (en) * | 1982-07-09 | 1984-02-02 | Key Pharma | Sustained release quinidine dosage form |
| US4634587A (en) * | 1982-07-09 | 1987-01-06 | Key Pharmaceuticals, Inc. | Sustained release quinidine dosage form |
| EP0101756A1 (de) * | 1982-08-31 | 1984-03-07 | Chimicasa Gmbh | Wasserlösliche Süssungstablette |
| EP0101755A1 (de) * | 1982-08-31 | 1984-03-07 | Chimicasa Gmbh | Wassarlösliche, durch Pressen verfestigte Süssungstablette |
| WO1984003201A1 (en) * | 1983-02-18 | 1984-08-30 | Wrigley W M Jun Co | Shellac encapsulant for active ingredients in chewing gum |
| US4673577A (en) * | 1983-02-18 | 1987-06-16 | Wm. Wrigley Jr. Company | Shellac encapsulant for high-potency sweeteners in chewing gum |
| CA1220966A (en) * | 1983-08-22 | 1987-04-28 | Susan J. Pettigrew | Non-saccaride sweetened product |
| WO1985001862A1 (en) * | 1983-11-04 | 1985-05-09 | General Foods Corporation | Sweetener composition, process for making the same, and comestibles comprising said sweetener composition |
| US4704288A (en) * | 1984-07-25 | 1987-11-03 | Tsau Josef H | Heat stabilized sweetener composition containing APM |
| US4590075A (en) * | 1984-08-27 | 1986-05-20 | Warner-Lambert Company | Elastomer encapsulation of flavors and sweeteners, long lasting flavored chewing gum compositions based thereon and process of preparation |
| US4894234A (en) * | 1984-10-05 | 1990-01-16 | Sharma Shri C | Novel drug delivery system for antiarrhythmics |
| US4797288A (en) * | 1984-10-05 | 1989-01-10 | Warner-Lambert Company | Novel drug delivery system |
| US4935242A (en) * | 1984-10-05 | 1990-06-19 | Warner-Lambert Company | Novel drug delivery system for expectorants |
| US4804548A (en) * | 1984-10-05 | 1989-02-14 | Warner-Lambert Company | Novel sweetener delivery systems |
| US4597970A (en) * | 1984-10-05 | 1986-07-01 | Warner-Lambert Company | Chewing gum compositions containing novel sweetener delivery systems and method of preparation |
| US4828857A (en) * | 1984-10-05 | 1989-05-09 | Warner-Lambert Company | Novel sweetener delivery systems |
| US4752485A (en) * | 1984-10-05 | 1988-06-21 | Warner-Lambert Company | Novel sweetener delivery systems |
| EP0185442A3 (en) * | 1984-10-05 | 1988-08-31 | Warner-Lambert Company | A novel sweetener delivery system and a chewing gum composition comprising the sweetener delivery system |
| US4894233A (en) * | 1984-10-05 | 1990-01-16 | Sharma Shri C | Novel drug delivery system for decongestants |
| US4933183A (en) * | 1984-10-05 | 1990-06-12 | Warner-Lambert Company | Novel drug delivery system for mineral supplements |
| US4738854A (en) * | 1984-12-04 | 1988-04-19 | Nabisco Brands, Inc. | Comestible containing moisture and shelf storage stabilized L-aspartic acid derivative |
| WO1986003944A1 (en) * | 1985-01-03 | 1986-07-17 | Joyce Patrick J | Heat stabilized peptide table salt substitutes |
| US4800095A (en) * | 1985-03-29 | 1989-01-24 | Nabisco Brands, Inc. | Stabilized APM in comestibles |
| AU586232B2 (en) * | 1985-03-29 | 1989-07-06 | Nabisco Brands Incorporated | Stabilized apm in comestibles |
| US4753806A (en) * | 1985-03-29 | 1988-06-28 | Nabisco Brands, Inc. | Flexible sugarless chewing gum |
| US4774094A (en) * | 1985-03-29 | 1988-09-27 | Nabisco Brands, Inc. | Stabilized APM in comestibles |
| EP0323442A1 (en) * | 1985-03-29 | 1989-07-05 | Nabisco Brands, Inc. | A cooked composition of glycerine and hydrogenated starch hydrolysate and the use thereof as a stabilizer for L-aspartic acid sweetening agent in comestibles |
| US4588612A (en) * | 1985-04-24 | 1986-05-13 | Scm Corporation | Pretreatment in encapsulation process |
| IT1189727B (it) * | 1985-08-30 | 1988-02-04 | Roberto Cappellari | Gomma da masticare ad effetto diversificabile nel gusto e nel tempo |
| US5179009A (en) * | 1985-10-11 | 1993-01-12 | Ajinomoto Co., Inc. | Process for producing L-aspartyl-L-phenylalanine and its diketopiperazine |
| US4740376A (en) * | 1986-01-07 | 1988-04-26 | Warner-Lambert Company | Encapsulation composition for use with chewing gum and edible products |
| US4711784A (en) * | 1986-01-07 | 1987-12-08 | Warner-Lambert Company | Encapsulation composition for use with chewing gum and edible products |
| PT84102B (pt) * | 1986-01-16 | 1989-07-31 | Dow Chemical Co | Processo para a preparacao de composicoes edulcorantes artificiais em particulas, termicamente estaveis, contendo um edulcorante oligopeptidico |
| AU7472687A (en) * | 1986-06-25 | 1988-01-07 | Nabisco Brands Incorporated | Encapsulated active comestible ingredients |
| US4855127A (en) * | 1986-07-07 | 1989-08-08 | Dow Corning Corporation | Lattice-entrapped composition |
| US5192563A (en) * | 1986-10-22 | 1993-03-09 | Wm. Wrigley, Jr. Company | Strongly mint-flavored chewing gums with reduced bitterness and harshness |
| US5112625A (en) * | 1989-02-15 | 1992-05-12 | Wm. Wrigley Jr. Company | Aqueous zein coated sweeteners and other ingredients for chewing gum |
| US4863745A (en) * | 1986-10-22 | 1989-09-05 | Wm. Wrigley Jr. Company | Chewing gum containing zein coated high-potency sweetener and method |
| US5221543A (en) * | 1986-10-22 | 1993-06-22 | Firma Wilhelm Fette Gmbh | Method of making a fast release stabilized aspartame ingredient for chewing gum |
| US5217735A (en) * | 1986-10-22 | 1993-06-08 | Wm. Wrigley Jr. Company | Method of making chewing gum with delayed release ingredients |
| US4824681A (en) * | 1986-12-19 | 1989-04-25 | Warner-Lambert Company | Encapsulated sweetener composition for use with chewing gum and edible products |
| US4911934A (en) * | 1986-12-19 | 1990-03-27 | Warner-Lambert Company | Chewing gum composition with encapsulated sweetener having extended flavor release |
| US4722845A (en) * | 1986-12-23 | 1988-02-02 | Warner-Lambert Company | Stable cinnamon-flavored chewing gum composition |
| US4933190A (en) * | 1986-12-23 | 1990-06-12 | Warner-Lambert Co. | Multiple encapsulated sweetener delivery system |
| US4981698A (en) * | 1986-12-23 | 1991-01-01 | Warner-Lambert Co. | Multiple encapsulated sweetener delivery system and method of preparation |
| US4931293A (en) * | 1986-12-23 | 1990-06-05 | Warner-Lambert Company | Food acid delivery systems containing polyvinyl acetate |
| US4816265A (en) * | 1986-12-23 | 1989-03-28 | Warner-Lambert Company | Sweetener delivery systems containing polyvinyl acetate |
| EP0278994A1 (en) * | 1987-02-16 | 1988-08-24 | Alfa Gum Investment Inc. | Chewing gum |
| US4975270A (en) * | 1987-04-21 | 1990-12-04 | Nabisco Brands, Inc. | Elastomer encased active ingredients |
| US4986991A (en) * | 1987-05-15 | 1991-01-22 | Wm Wrigley, Jr., Company | Chewing gum having an extended sweetness |
| US4927654A (en) * | 1987-07-23 | 1990-05-22 | The Nutrasweet Company | Water soluble bulking agents |
| US4822622A (en) * | 1987-07-30 | 1989-04-18 | Warner-Lambert Co. | Stabilized chewing gum product and method of making same |
| US4822621A (en) * | 1987-07-30 | 1989-04-18 | Warner-Lambert Company | Method and product for increased aspartame stability in chewing gum |
| EP0311093A3 (de) * | 1987-10-08 | 1990-08-08 | Firma E. Otto Schmidt | Verfahren zum Herstellen kalorienreduzierter Backwaren |
| DE3781413T2 (de) * | 1987-12-15 | 1993-02-11 | Wrigley W M Jun Co | Verfahren fuer agglomerierung von suessstoffen mit einer hohen suesskraft. |
| US4919941A (en) * | 1987-12-18 | 1990-04-24 | Wm. Wrigley Jr. Company | Chewing gum containing delayed release protein sweetener and method |
| US4885175A (en) * | 1987-12-23 | 1989-12-05 | Wm. Wrigley Jr. Company | Method of making chewing gum with wax-coated delayed release ingredients |
| US4931295A (en) * | 1988-12-02 | 1990-06-05 | Wm. Wrigley Jr. Company | Chewing gum containing high-potency sweetener particles with modified zein coating |
| WO1989003170A2 (en) * | 1988-12-09 | 1989-04-20 | Wm. Wrigley Jr. Company | Method of controlling release of acesulfame k in chewing gum and gum produced thereby |
| NZ232237A (en) * | 1989-02-06 | 1991-05-28 | Wrigley W M Jun Co | Food product containing porous polymeric beads impregnated with volatile flavourings |
| ATE106189T1 (de) * | 1989-03-28 | 1994-06-15 | Wrigley W M Jun Co | Verbesserte alitamstabilität in kaugummi durch einkapselung. |
| US5057327A (en) * | 1989-12-29 | 1991-10-15 | Wm. Wrigley Jr. Company | Chewing gum with longer lasting sweetness using alitame |
| US5034231A (en) * | 1989-03-28 | 1991-07-23 | Wm. Wrigly, Jr. Company | Alitame stability using hydrogenated starch hydrolysate syrups |
| US5039530A (en) * | 1990-03-01 | 1991-08-13 | Wm. Wrigley Jr. Company | Storage stable chewing gum containing alitame |
| WO1990006061A1 (en) * | 1989-03-28 | 1990-06-14 | Wm. Wrigley Jr. Company | Method of controlling release of alitame in chewing gum and gum produced thereby |
| US4997659A (en) * | 1989-03-28 | 1991-03-05 | The Wm. Wrigley Jr. Company | Alitame stability in chewing gum by encapsulation |
| CN1045911A (zh) * | 1989-03-28 | 1990-10-10 | 箭牌糖类有限公司 | 通过包胶法提高口香糖中埃利坦(Alitame)的稳定性 |
| US5169658A (en) * | 1989-04-19 | 1992-12-08 | Wm. Wrigley Jr. Company | Polyvinyl acetate encapsulation of crystalline sucralose for use in chewing gum |
| US5154939A (en) * | 1989-04-19 | 1992-10-13 | Wm. Wrigley Jr. Company | Use of salt to improve extrusion encapsulation of chewing gum ingredients |
| US5198251A (en) * | 1989-04-19 | 1993-03-30 | Wm. Wrigley Jr. Company | Gradual release structures for chewing gum |
| US5108762A (en) * | 1989-04-19 | 1992-04-28 | Wm. Wrigley Jr. Company | Gradual release structures for chewing gum |
| US5139794A (en) * | 1989-04-19 | 1992-08-18 | Wm. Wrigley Jr. Company | Use of encapsulated salts in chewing gum |
| US5229148A (en) * | 1989-04-19 | 1993-07-20 | Wm. Wrigley Jr. Company | Method of combining active ingredients with polyvinyl acetates |
| US4978537A (en) * | 1989-04-19 | 1990-12-18 | Wm. Wrigley Jr. Company | Gradual release structures for chewing gum |
| US5165944A (en) * | 1989-04-19 | 1992-11-24 | Wm. Wrigley Jr. Company | Gradual release structures for chewing gum |
| US5098725A (en) * | 1989-06-30 | 1992-03-24 | Bio-Dar, Ltd. | Heat stabilized flavoring agents coated with hydrogenated castor oil |
| NO903521L (no) * | 1989-08-14 | 1991-02-15 | Warner Lambert Co | Aromautleveringssystem for tyggegummi. |
| WO1989011212A2 (en) * | 1989-08-30 | 1989-11-30 | Wm. Wrigley Jr. Company | Method of controlling release of cyclamate in chewing gum and gum produced thereby |
| AU639645B2 (en) * | 1989-10-10 | 1993-07-29 | Wm. Wrigley Jr. Company | Gradual release structures made from fiber spinning techniques |
| WO1990007859A2 (en) * | 1989-11-22 | 1990-07-26 | Wm. Wrigley Jr. Company | Method of controlling release of sucralose in chewing gum and gum produced thereby |
| US5000965A (en) * | 1990-02-21 | 1991-03-19 | Warner-Lambert Company | Method for the preparation of sweetening agent delivery systems containing polyvinyl acetate |
| WO1990007864A2 (en) * | 1990-04-25 | 1990-07-26 | Wm. Wrigley Jr. Company | Method of controlling release of clycyrrhizin in chewing gum and gum produced thereby |
| JPH048251A (ja) * | 1990-04-26 | 1992-01-13 | Mitsui Sugar Co Ltd | 甘味持続性コーティング糖類を含有するチューインガムおよびその製造法 |
| US5139797A (en) * | 1990-04-27 | 1992-08-18 | Leaf, Inc. | Stabilized sweetener compositions, chewing gum compositions containing same and methods for their preparation |
| US5043169A (en) * | 1990-05-25 | 1991-08-27 | Warner-Lambert Company | Stabilized Sweetner Composition |
| FR2663221B1 (fr) * | 1990-06-19 | 1994-12-23 | Sanofi Sa | Composition d'aspartam. |
| WO1991003147A2 (en) * | 1990-10-22 | 1991-03-21 | Wm. Wrigley Jr. Company | Method of controlling release of stevioside in chewing gum and gum produced thereby |
| US5064658A (en) * | 1990-10-31 | 1991-11-12 | Warner-Lamber Company | Encapsulated synergistic sweetening agent compositions comprising aspartame and acesulfame-K and methods for preparing same |
| US5139798A (en) * | 1990-11-21 | 1992-08-18 | Wm. Wrigley Jr. Company | Polyvinyl acetate encapsulation of codried sucralose for use in chewing gum |
| AU1241192A (en) * | 1990-12-17 | 1992-07-22 | Brian Butcher | Microencapsulated sweeteners for use in baked goods |
| US5128155A (en) * | 1990-12-20 | 1992-07-07 | Wm. Wrigley Jr. Company | Flavor releasing structures for chewing gum |
| US5126151A (en) * | 1991-01-24 | 1992-06-30 | Warner-Lambert Company | Encapsulation matrix |
| WO1993000828A2 (en) * | 1991-07-08 | 1993-01-21 | Warner-Lambert Company | Stabilized sweetener composition |
| US5169657A (en) * | 1991-07-17 | 1992-12-08 | Wm. Wrigley Jr. Company | Polyvinyl acetate encapsulation of sucralose from solutions for use in chewing gum |
| NZ243667A (en) * | 1991-08-02 | 1995-02-24 | Kurihara Yoshie | Chewing gum containing coated curculin derivative or fruit containing curculin |
| US5192561A (en) * | 1991-09-19 | 1993-03-09 | Wm. Wrigley Jr. Company | Aspartame stability in chewing gum using an acid gelatin system |
| US5164210A (en) * | 1991-10-08 | 1992-11-17 | Wm. Wrigley Jr. Company | Zein/shellac encapsulation of high intensity sweeteners in chewing gum |
| US5599556A (en) * | 1991-12-31 | 1997-02-04 | Abbott Laboratories | Prolamine coatings for taste masking |
| US5160742A (en) * | 1991-12-31 | 1992-11-03 | Abbott Laboratories | System for delivering an active substance for sustained release |
| US5437877A (en) * | 1992-03-03 | 1995-08-01 | Wm. Wrigley Jr. Company | Wax-free chewing gum with initial soft bite |
| US5462754A (en) * | 1992-03-03 | 1995-10-31 | Wm. Wrigley Jr. Company | Abhesive chewing gum with improved sweetness profile |
| WO1993022939A1 (en) * | 1992-05-11 | 1993-11-25 | Wm. Wrigley, Jr. Company | Improved high intensity sweetener ingredient |
| US5437875A (en) * | 1993-03-02 | 1995-08-01 | Wm. Wrigley, Jr. Company | Wax-free low moisture chewing gum |
| US5441750A (en) * | 1993-03-02 | 1995-08-15 | Wm. Wrigley Jr. Company | Wax-free chewing gum with improved processing properties |
| US5436013A (en) * | 1993-03-02 | 1995-07-25 | Wm. Wrigley Jr. Company | Process for manufacturing wax-free chewing gums with fast set-up times |
| US5437876A (en) * | 1993-03-02 | 1995-08-01 | Wm. Wrigley Jr. Company | Wax-free chewing gums with controlled sweetener release |
| US5360614A (en) * | 1993-04-26 | 1994-11-01 | The Estee Corporation | Method of controlling the release of carbohydrates by encapsulation and composition therefor |
| FI953726A7 (fi) * | 1993-12-07 | 1995-09-06 | The Nutrasweet Company | Stabiilit hiukkasmaiset makeuttajakoostumukset |
| US5545414A (en) * | 1995-03-22 | 1996-08-13 | Abbott Laboratories | Cholesterol lowering food product |
| AU6122496A (en) * | 1995-06-20 | 1997-01-22 | Pharma-Vinci A/S | A method of preparing an oral preparation provided on the outer side with an enteric coating, as well as an oral preparation obtained by the method |
| EP0784933A3 (en) * | 1995-10-16 | 1997-11-26 | Leaf, Inc. | Extended release of additives in comestible products |
| NL1003600C2 (nl) * | 1996-07-16 | 1998-01-21 | Holland Sweetener Co | Stabiele dipeptide-zoetstof bevattende suspensies in water. |
| US6455080B1 (en) * | 1997-12-29 | 2002-09-24 | Wm. Wrigley Jr., Company | Chewing gum containing controlled release acyclic carboxamide and method of making |
| US6627233B1 (en) | 1997-09-18 | 2003-09-30 | Wm. Wrigley Jr. Company | Chewing gum containing physiological cooling agents |
| WO1999017618A1 (en) * | 1997-10-07 | 1999-04-15 | Wm. Wrigley Jr. Company | Chewing gum containing arabinogalactan |
| US6017566A (en) * | 1997-10-20 | 2000-01-25 | Wm. Wrigley Jr. Company | Gum base and chewing gum containing edible polyesters and method for manufacture |
| WO1999027798A1 (en) * | 1997-12-03 | 1999-06-10 | Wm. Wrigley Jr. Company | Improved chewing gum formulations including aspartame and sodium bicarbonate |
| US6692778B2 (en) * | 1998-06-05 | 2004-02-17 | Wm. Wrigley Jr. Company | Method of controlling release of N-substituted derivatives of aspartame in chewing gum |
| AU2006203624B2 (en) * | 1998-06-05 | 2008-07-10 | Wm. Wrigley Jr. Company | Method of controlling release of N-substituted derivatives of aspartame in chewing gum and gum produced thereby |
| EP1083799B1 (en) * | 1998-06-05 | 2010-09-29 | Wm. Wrigley Jr. Company | Method of controlling release of n-substituted derivatives of aspartame in chewing gum and gum produced thereby |
| RU2225139C2 (ru) * | 1998-06-05 | 2004-03-10 | Вм. Ригли Дж. Компани | Способ получения жевательной резинки, содержащей n-замещенное производное аспартама (варианты), и жевательная резинка, полученная по этому способу (варианты) |
| JP2002526565A (ja) * | 1998-09-18 | 2002-08-20 | ハーマン・ウント・ライマー・ゲゼルシヤフト・ミツト・ベシユレンクテル・ハフツング | 特定の放出挙動を有するカプセルに包まれた香料及び/又は芳香剤 |
| US7041277B2 (en) * | 2000-03-10 | 2006-05-09 | Cadbury Adams Usa Llc | Chewing gum and confectionery compositions with encapsulated stain removing agent compositions, and methods of making and using the same |
| US6685978B1 (en) | 2000-04-04 | 2004-02-03 | Cp Kelco Aps | Gelled and gellable compositions for food products |
| GB0016173D0 (en) * | 2000-06-30 | 2000-08-23 | Nestle Sa | Confectionery product containing active ingredients |
| EP1301091A2 (en) * | 2000-07-18 | 2003-04-16 | The NutraSweet Company | Drying of neotame with co-agents |
| US20020115729A1 (en) * | 2000-11-27 | 2002-08-22 | Yang Robert K. | Stabilization method and composition utilizing an amphoteric polymer |
| JP3583380B2 (ja) * | 2001-04-26 | 2004-11-04 | 高砂香料工業株式会社 | コーティング剤およびコーティング粉末 |
| JP3553521B2 (ja) * | 2001-04-26 | 2004-08-11 | 高砂香料工業株式会社 | コーティング剤及びコーティング粉末 |
| US7445769B2 (en) | 2002-10-31 | 2008-11-04 | Cadbury Adams Usa Llc | Compositions for removing stains from dental surfaces and methods of making and using the same |
| US20080317681A1 (en) * | 2003-07-11 | 2008-12-25 | Petros Gebreselassie | Compositions containing a stain removing complex, and methods of making and using the same |
| US7390518B2 (en) | 2003-07-11 | 2008-06-24 | Cadbury Adams Usa, Llc | Stain removing chewing gum composition |
| US20050112236A1 (en) * | 2003-11-21 | 2005-05-26 | Navroz Boghani | Delivery system for active components as part of an edible composition having preselected tensile strength |
| US8597703B2 (en) * | 2005-05-23 | 2013-12-03 | Kraft Foods Global Brands Llc | Delivery system for active components as part of an edible composition including a ratio of encapsulating material and active component |
| US8389031B2 (en) | 2005-05-23 | 2013-03-05 | Kraft Foods Global Brands Llc | Coated delivery system for active components as part of an edible composition |
| US9271904B2 (en) * | 2003-11-21 | 2016-03-01 | Intercontinental Great Brands Llc | Controlled release oral delivery systems |
| US8591972B2 (en) | 2005-05-23 | 2013-11-26 | Kraft Foods Global Brands Llc | Delivery system for coated active components as part of an edible composition |
| US8591974B2 (en) | 2003-11-21 | 2013-11-26 | Kraft Foods Global Brands Llc | Delivery system for two or more active components as part of an edible composition |
| US8389032B2 (en) * | 2005-05-23 | 2013-03-05 | Kraft Foods Global Brands Llc | Delivery system for active components as part of an edible composition having selected particle size |
| US8591968B2 (en) * | 2005-05-23 | 2013-11-26 | Kraft Foods Global Brands Llc | Edible composition including a delivery system for active components |
| US8591973B2 (en) | 2005-05-23 | 2013-11-26 | Kraft Foods Global Brands Llc | Delivery system for active components and a material having preselected hydrophobicity as part of an edible composition |
| AU2005216982B8 (en) * | 2004-02-26 | 2008-11-13 | Wm. Wrigley Jr. Company | Confections containing a blend of physiological cooling agents |
| US20060024245A1 (en) * | 2004-07-29 | 2006-02-02 | Cadbury Adams, Llc. | Tooth whitening compositions and delivery systems therefor |
| US7641892B2 (en) | 2004-07-29 | 2010-01-05 | Cadburry Adams USA, LLC | Tooth whitening compositions and delivery systems therefor |
| US7727565B2 (en) | 2004-08-25 | 2010-06-01 | Cadbury Adams Usa Llc | Liquid-filled chewing gum composition |
| US7955630B2 (en) | 2004-09-30 | 2011-06-07 | Kraft Foods Global Brands Llc | Thermally stable, high tensile strength encapsulated actives |
| US9198448B2 (en) | 2005-02-07 | 2015-12-01 | Intercontinental Great Brands Llc | Stable tooth whitening gum with reactive ingredients |
| BRPI0611272A2 (pt) * | 2005-05-03 | 2011-11-16 | Mutual Pharmaceutical Co | formulações de quinina |
| ES2688772T3 (es) | 2005-05-23 | 2018-11-06 | Intercontinental Great Brands Llc | Composición de goma de mascar con relleno central |
| US7851005B2 (en) | 2005-05-23 | 2010-12-14 | Cadbury Adams Usa Llc | Taste potentiator compositions and beverages containing same |
| US7851006B2 (en) | 2005-05-23 | 2010-12-14 | Cadbury Adams Usa Llc | Taste potentiator compositions and beverages containing same |
| WO2006127604A2 (en) | 2005-05-23 | 2006-11-30 | Cadbury Adams Usa Llc | Confectionery composition including an elastomeric component, a cooked saccharide component, and a food acid |
| WO2006127277A2 (en) | 2005-05-23 | 2006-11-30 | Cadbury Adams Usa Llc | Liquid-filled chewing gum composition |
| AU2006249857B2 (en) | 2005-05-23 | 2010-05-13 | Intercontinental Great Brands Llc | Taste potentiator compositions and edible confectionery and chewing gum products containing same |
| US8268371B2 (en) | 2005-08-22 | 2012-09-18 | Kraft Foods Global Brands Llc | Degradable chewing gum |
| US20070053972A1 (en) * | 2005-09-08 | 2007-03-08 | Cadbury Adams Usa Llc. | Gelatin capsules containing actives |
| US20070178188A1 (en) * | 2006-01-27 | 2007-08-02 | Cadbury Adams Usa Llc | Chewing gum compositions including free neotame sweetener compositions |
| BRPI0710692A2 (pt) * | 2006-04-21 | 2011-08-23 | Cadbury Adams Usa Llc | composições de revestimentos, composições de confeitaria e goma de mascar e métodos |
| US8178138B2 (en) * | 2006-06-23 | 2012-05-15 | Church & Dwight Co., Inc. | Ruminant feedstock dietary supplement |
| US7939117B2 (en) * | 2006-06-23 | 2011-05-10 | Church & Dwight Co., Inc. | Ruminant feedstock dietary supplement |
| US8182851B2 (en) * | 2006-06-23 | 2012-05-22 | Church & Dwight Co., Inc. | Ruminant feedstock dietary supplement |
| US20080166449A1 (en) | 2006-11-29 | 2008-07-10 | Cadbury Adams Usa Llc | Confectionery compositions including an elastomeric component and a saccharide component |
| EP2136648A1 (en) * | 2007-04-04 | 2009-12-30 | Gumlink A/S | Center-filled chewing gum product for dental care |
| IL183818A0 (en) * | 2007-06-10 | 2007-10-31 | Shimon Harpaz | Uniformly abrasive confectionery product and process therefor |
| US9504274B2 (en) * | 2009-01-27 | 2016-11-29 | Frito-Lay North America, Inc. | Methods of flavor encapsulation and matrix-assisted concentration of aqueous foods and products produced therefrom |
| BRPI1008543A2 (pt) | 2009-02-10 | 2015-09-15 | Cadbury Adams Mexico S De R L De C V | composicoes pra cobertura para confeitaria e goma de mascar e metodos para faze-las |
| IT1399630B1 (it) | 2010-04-20 | 2013-04-26 | Perfetti Van Melle Spa | Formulazioni alimentari a lento rilascio |
| WO2015195534A2 (en) | 2014-06-16 | 2015-12-23 | Intercontinental Great Brands Llc | Degradable chewing gum |
| PL3393276T3 (pl) * | 2015-12-22 | 2022-12-05 | Mccormick & Company, Incorporated | Produkt kapsułkowania o dużej integralności |
| DE102016203008A1 (de) | 2016-02-25 | 2017-08-31 | Wacker Chemie Ag | Verkapselte Süßstoffe und Verfahren zur ihrer Herstellung |
| CN118648652A (zh) * | 2024-07-19 | 2024-09-17 | 源生源(海南)投资有限责任公司 | 一种复配型过瘤胃蛋白饲料及其制备方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4031258A (en) * | 1972-03-30 | 1977-06-21 | General Foods Corporation | Inorganic salts of dipeptide sweeteners |
| US3928633A (en) * | 1973-12-03 | 1975-12-23 | Gen Foods Corp | Sweetening composition and process therefor |
| US3962468A (en) * | 1974-03-07 | 1976-06-08 | General Foods Corporation | Spray-dried L-aspartic acid derivatives |
| US4059706A (en) * | 1974-03-07 | 1977-11-22 | General Foods Corporation | Spray-dried L-aspartic acid derivatives |
| US3929988A (en) * | 1974-06-21 | 1975-12-30 | Colgate Palmolive Co | Flavored dentifrice |
| NL7607365A (nl) * | 1975-07-04 | 1977-01-06 | Tate & Lyle Ltd | Werkwijze voor de bereiding van zoetmakende samenstellingen onder toepassing van arabino- galactan. |
| US4122195A (en) * | 1977-01-24 | 1978-10-24 | General Foods Corporation | Fixation of APM in chewing gum |
| EP0014554A1 (en) * | 1979-02-06 | 1980-08-20 | TATE & LYLE PATENT HOLDINGS LIMITED | Sweetening compositions containing peptide sweeteners and a method for their manufacture |
-
1981
- 1981-06-02 US US06/269,081 patent/US4384004A/en not_active Expired - Lifetime
-
1982
- 1982-05-28 EP EP82302768A patent/EP0067595B1/en not_active Expired
- 1982-05-28 AT AT82302768T patent/ATE25566T1/de not_active IP Right Cessation
- 1982-05-28 DE DE8282302768T patent/DE3275496D1/de not_active Expired
- 1982-05-31 JP JP57091495A patent/JPS57202268A/ja active Pending
- 1982-05-31 CA CA000404097A patent/CA1164732A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US4384004A (en) | 1983-05-17 |
| US4384004B1 (esLanguage) | 1993-06-22 |
| ATE25566T1 (de) | 1987-03-15 |
| EP0067595A2 (en) | 1982-12-22 |
| DE3275496D1 (en) | 1987-04-09 |
| EP0067595B1 (en) | 1987-03-04 |
| JPS57202268A (en) | 1982-12-11 |
| EP0067595A3 (en) | 1983-10-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1164732A (en) | Encapsulated apm and method of preparation | |
| US4673577A (en) | Shellac encapsulant for high-potency sweeteners in chewing gum | |
| US4824681A (en) | Encapsulated sweetener composition for use with chewing gum and edible products | |
| US4911934A (en) | Chewing gum composition with encapsulated sweetener having extended flavor release | |
| EP0967883B1 (en) | Chewing gum composition containing sodium glycinate | |
| US5270061A (en) | Dual composition hard coated gum with improved shelf life | |
| AU2002219968B2 (en) | Encapsulated acid mixtures and products including same | |
| US5043169A (en) | Stabilized Sweetner Composition | |
| AU556557B2 (en) | Shellac encapsulant for active ingredients in chewing gum | |
| US6472000B1 (en) | Method of controlling release of bitterness inhibitors in chewing gum and gum produced thereby | |
| JPH09502615A (ja) | エリスリトールを含有する硬質被膜を有するチューイングガムペレット | |
| US5124160A (en) | Granulation of active ingredients using polyvinyl acetate and alcohol | |
| WO1993000828A2 (en) | Stabilized sweetener composition | |
| US6080432A (en) | Chewing gum composition containing sodium glycinate and method of making a chewing gum product therefrom | |
| AU773949B2 (en) | Method of controlling release of bitterness inhibitors in chewing gum and gum produced thereby | |
| HK2490A (en) | Shellac encapsulant for active ingredients in chewing gum |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |